fastnetmon-ng/src/fastnetmon.cpp

4808 lines
184 KiB
C++
Raw Normal View History

2013-10-21 11:43:54 +02:00
/* Author: pavel.odintsov@gmail.com */
/* License: GPLv2 */
2013-10-18 12:16:55 +02:00
#include <errno.h>
#include <math.h>
#include <new>
#include <signal.h>
#include <stdio.h>
#include <stdlib.h>
2013-10-18 12:16:55 +02:00
#include <string.h>
2013-10-21 11:43:54 +02:00
#include <time.h>
#include <unistd.h>
2013-10-21 11:43:54 +02:00
#include <sys/socket.h>
2013-10-18 12:16:55 +02:00
#include <arpa/inet.h>
2018-07-11 16:41:24 +02:00
#include <net/if_arp.h> // struct arphdr
2013-10-21 11:43:54 +02:00
#include <netinet/if_ether.h>
#include <netinet/in.h>
#include <netinet/ip.h>
#include <netinet/ip_icmp.h>
#include <netinet/tcp.h>
#include <netinet/udp.h>
#include <sys/resource.h>
#include <sys/stat.h>
2013-10-18 12:16:55 +02:00
#include "bgp_flow_spec.h"
2015-03-21 12:24:31 +01:00
#include "fast_library.h"
#include "fastnetmon_packet_parser.h"
#include "fastnetmon_types.h"
#include "libpatricia/patricia.h"
#include "packet_storage.h"
// Here we store variables which differs for different paltforms
#include "fast_platform.h"
#ifdef ENABLE_DPI
#include "fast_dpi.h"
#endif
#ifdef FASTNETMON_API
#ifdef __GNUC__
#pragma GCC diagnostic push
#pragma GCC diagnostic ignored "-Wdeprecated-declarations"
#endif // __GNUC__
#include "fastnetmon.grpc.pb.h"
#include <grpc++/grpc++.h>
#ifdef __GNUC__
#pragma GCC diagnostic pop
#endif // __GNUC__
#endif
// Plugins
#include "netflow_plugin/netflow_collector.h"
#include "pcap_plugin/pcap_collector.h"
#include "sflow_plugin/sflow_collector.h"
#ifdef NETMAP_PLUGIN
2015-03-10 15:17:52 +01:00
#include "netmap_plugin/netmap_collector.h"
#endif
#ifdef PF_RING
#include "pfring_plugin/pfring_collector.h"
#endif
#ifdef SNABB_SWITCH
#include "snabbswitch_plugin/snabbswitch_collector.h"
#endif
#ifdef FASTNETMON_ENABLE_AFPACKET
#include "afpacket_plugin/afpacket_collector.h"
#endif
#ifdef PF_RING
#include "actions/pfring_hardware_filter_action.h"
#endif
#ifdef ENABLE_GOBGP
#include "actions/gobgp_action.h"
#endif
// Yes, maybe it's not an good idea but with this we can guarantee working code in example plugin
2015-01-26 10:10:35 +01:00
#include "example_plugin/example_collector.h"
2014-06-26 17:08:19 +02:00
2013-10-18 12:16:55 +02:00
#include <algorithm>
#include <fstream>
2013-10-18 12:16:55 +02:00
#include <iostream>
#include <map>
2013-11-15 15:35:44 +01:00
2013-10-18 12:16:55 +02:00
#include <sstream>
#include <utility>
#include <vector>
2013-10-18 12:16:55 +02:00
#include <boost/regex.hpp>
#include <boost/thread.hpp>
#include <boost/thread/mutex.hpp>
2013-10-21 16:47:31 +02:00
#include <boost/program_options.hpp>
#include "all_logcpp_libraries.h"
// Boost libs
2013-10-18 12:16:55 +02:00
#include <boost/algorithm/string.hpp>
#include <boost/algorithm/string/trim.hpp>
2013-12-28 20:11:20 +01:00
#ifdef GEOIP
#include "GeoIP.h"
#endif
2013-10-20 00:10:19 +02:00
#ifdef REDIS
#include <hiredis/hiredis.h>
#endif
2013-10-18 12:21:41 +02:00
#ifdef MONGO
#include <bson.h>
#include <mongoc.h>
#endif
2015-08-10 17:29:53 +02:00
// #define IPV6_HASH_COUNTERS
#ifdef IPV6_HASH_COUNTERS
#include "concurrentqueue.h"
#endif
#ifdef FASTNETMON_API
using fastmitigation::BanListReply;
using fastmitigation::BanListRequest;
using fastmitigation::Fastnetmon;
using grpc::Server;
using grpc::ServerBuilder;
using grpc::ServerContext;
using grpc::Status;
2015-10-16 11:34:48 +02:00
std::unique_ptr<Server> api_server;
bool enable_api = false;
#endif
time_t last_call_of_traffic_recalculation;
std::string cli_stats_file_path = "/tmp/fastnetmon.dat";
unsigned int stats_thread_sleep_time = 3600;
unsigned int stats_thread_initial_call_delay = 30;
bool process_internal_traffic_as_external = false;
unsigned int recalculate_speed_timeout = 1;
// Send or not any details about attack for ban script call over stdin
bool notify_script_pass_details = true;
bool pfring_hardware_filters_enabled = false;
bool notify_script_enabled = true;
2015-07-17 13:52:28 +02:00
// We could collect attack dumps in pcap format
bool collect_attack_pcap_dumps = false;
2015-07-29 16:06:50 +02:00
// We could process this dumps with DPI
bool process_pcap_attack_dumps_with_dpi = false;
bool unban_only_if_attack_finished = true;
logging_configuration_t logging_configuration;
// Variable with all data from main screen
2015-01-27 20:29:51 +01:00
std::string screen_data_stats = "";
// Global map with parsed config file
typedef std::map<std::string, std::string> configuration_map_t;
configuration_map_t configuration_map;
// Every X seconds we will run ban list cleaner thread
// If customer uses ban_time smaller than this value we will use ban_time/2 as unban_iteration_sleep_time
int unban_iteration_sleep_time = 60;
bool unban_enabled = true;
#ifdef ENABLE_DPI
struct ndpi_detection_module_struct* my_ndpi_struct = NULL;
u_int32_t ndpi_size_flow_struct = 0;
u_int32_t ndpi_size_id_struct = 0;
#endif
#ifdef ENABLE_GOBGP
bool gobgp_enabled = false;
#endif
#ifdef MONGO
std::string mongodb_host = "localhost";
unsigned int mongodb_port = 27017;
bool mongodb_enabled = false;
std::string mongodb_database_name = "fastnetmon";
#endif
2013-11-15 15:35:44 +01:00
/* Configuration block, we must move it to configuration file */
2013-10-21 12:27:43 +02:00
#ifdef REDIS
unsigned int redis_port = 6379;
2015-01-27 20:29:51 +01:00
std::string redis_host = "127.0.0.1";
2015-08-17 22:51:45 +02:00
// redis key prefix
2015-08-17 22:44:46 +02:00
std::string redis_prefix = "";
2015-06-04 12:15:42 +02:00
// because it's additional and very specific feature we should disable it by default
bool redis_enabled = false;
2013-10-21 12:27:43 +02:00
#endif
2013-10-18 12:16:55 +02:00
bool monitor_local_ip_addresses = true;
// Enable monitoring for OpenVZ VPS IP addresses by reading their list from kernel
bool monitor_openvz_vps_ip_addresses = false;
// This flag could enable print of ban actions and thresholds on the client's screen
bool print_configuration_params_on_the_screen = false;
// Trigger for enable or disable traffic counting for whole subnets
bool enable_subnet_counters = false;
// We will announce whole subnet instead single IP with BGP if this flag enabled
bool exabgp_announce_whole_subnet = false;
// We will announce only /32 host
bool exabgp_announce_host = false;
// With this flag we will announce more specfic then whole block Flow Spec announces
bool exabgp_flow_spec_announces = false;
2015-07-04 21:29:32 +02:00
ban_settings_t global_ban_settings;
void init_global_ban_settings() {
// ban Configuration params
global_ban_settings.enable_ban_for_pps = false;
global_ban_settings.enable_ban_for_bandwidth = false;
global_ban_settings.enable_ban_for_flows_per_second = false;
// We must ban IP if it exceeed this limit in PPS
global_ban_settings.ban_threshold_pps = 20000;
// We must ban IP of it exceed this limit for number of flows in any direction
global_ban_settings.ban_threshold_flows = 3500;
// We must ban client if it exceed 1GBps
global_ban_settings.ban_threshold_mbps = 1000;
// Disable per protocol thresholds too
global_ban_settings.enable_ban_for_tcp_pps = false;
global_ban_settings.enable_ban_for_tcp_bandwidth = false;
global_ban_settings.enable_ban_for_udp_pps = false;
global_ban_settings.enable_ban_for_udp_bandwidth = false;
global_ban_settings.enable_ban_for_icmp_pps = false;
global_ban_settings.enable_ban_for_icmp_bandwidth = false;
2015-07-04 21:29:32 +02:00
// Ban enable/disable flag
global_ban_settings.enable_ban = true;
}
bool enable_conection_tracking = true;
bool enable_snabbswitch_collection = false;
bool enable_afpacket_collection = false;
2014-12-02 13:43:34 +01:00
bool enable_data_collection_from_mirror = true;
2015-03-10 15:17:52 +01:00
bool enable_netmap_collection = false;
2014-12-02 13:43:34 +01:00
bool enable_sflow_collection = false;
bool enable_netflow_collection = false;
bool enable_pcap_collection = false;
// Time consumed by reaclculation for all IPs
struct timeval speed_calculation_time;
// Time consumed by drawing stats for all IPs
struct timeval drawing_thread_execution_time;
// Global thread group for packet capture threads
boost::thread_group packet_capture_plugin_thread_group;
// Global thread group for service processes (speed recalculation,
// screen updater and ban list cleaner)
boost::thread_group service_thread_group;
// Total number of hosts in our networks
// We need this as global variable because it's very important value for configuring data structures
unsigned int total_number_of_hosts_in_our_networks = 0;
2013-12-28 20:11:20 +01:00
#ifdef GEOIP
GeoIP* geo_ip = NULL;
2013-12-28 20:11:20 +01:00
#endif
// IPv4 lookup trees
patricia_tree_t *lookup_tree_ipv4, *whitelist_tree_ipv4;
// IPv6 lookup trees
patricia_tree_t *lookup_tree_ipv6, *whitelist_tree_ipv6;
bool DEBUG = 0;
2013-10-21 12:27:43 +02:00
2014-12-15 20:08:39 +01:00
// flag about dumping all packets to log
2014-06-20 17:18:27 +02:00
bool DEBUG_DUMP_ALL_PACKETS = false;
2015-09-29 17:00:02 +02:00
// dump "other" packets
bool DEBUG_DUMP_OTHER_PACKETS = false;
// Period for update screen for console version of tool
unsigned int check_period = 3;
2013-10-21 12:27:43 +02:00
// Standard ban time in seconds for all attacks but you can tune this value
int global_ban_time = 1800;
// We calc average pps/bps for this time
double average_calculation_amount = 15;
// We calc average pps/bps for subnets with this time, we use longer value for calculation average network traffic
double average_calculation_amount_for_subnets = 30;
// Show average or absolute value of speed
bool print_average_traffic_counts = true;
2015-04-27 14:49:03 +02:00
// Key used for sorting clients in output. Allowed sort params: packets/bytes/flows
2015-01-27 20:29:51 +01:00
std::string sort_parameter = "packets";
2013-10-21 15:43:00 +02:00
2017-05-08 16:21:52 +02:00
// Number of lines in program output
unsigned int max_ips_in_list = 7;
2013-10-21 12:27:43 +02:00
2013-11-15 15:35:44 +01:00
// Number of lines for sending ben attack details to email
unsigned int ban_details_records_count = 500;
2013-10-21 12:27:43 +02:00
// We haven't option for configure it with configuration file
unsigned int number_of_packets_for_pcap_attack_dump = 500;
2014-06-09 14:47:11 +02:00
// log file
2014-06-24 12:16:22 +02:00
log4cpp::Category& logger = log4cpp::Category::getRoot();
2014-06-09 14:47:11 +02:00
// We storae all active BGP Flow Spec announces here
typedef std::map<std::string, uint32_t> active_flow_spec_announces_t;
active_flow_spec_announces_t active_flow_spec_announces;
2013-11-15 15:35:44 +01:00
/* Configuration block ends */
2013-10-21 12:27:43 +02:00
// We count total number of incoming/outgoing/internal and other traffic type packets/bytes
// And initilize by 0 all fields
total_counter_element total_counters[4];
total_counter_element total_speed_counters[4];
total_counter_element total_speed_average_counters[4];
2013-11-15 15:35:44 +01:00
2014-12-10 16:08:12 +01:00
// Total amount of non parsed packets
uint64_t total_unparsed_packets = 0;
uint64_t total_unparsed_packets_speed = 0;
2014-12-01 22:08:38 +01:00
// Total amount of IPv6 packets
uint64_t total_ipv6_packets = 0;
// IPv6 traffic which belongs to our own networks
uint64_t our_ipv6_packets = 0;
uint64_t incoming_total_flows_speed = 0;
uint64_t outgoing_total_flows_speed = 0;
map_of_vector_counters SubnetVectorMap;
// Here we store taffic per subnet
map_for_subnet_counters PerSubnetCountersMap;
// Here we store traffic speed per subnet
map_for_subnet_counters PerSubnetSpeedMap;
// Here we store average speed per subnet
map_for_subnet_counters PerSubnetAverageSpeedMap;
// Flow tracking structures
map_of_vector_counters_for_flow SubnetVectorMapFlow;
2013-11-15 15:35:44 +01:00
/* End of our data structs */
boost::mutex ban_list_details_mutex;
boost::mutex ban_list_mutex;
2014-10-22 04:29:55 +02:00
boost::mutex flow_counter;
2013-10-21 21:45:33 +02:00
2014-10-22 04:29:55 +02:00
// map for flows
2015-01-27 20:29:51 +01:00
std::map<uint64_t, int> FlowCounter;
2014-10-22 04:29:55 +02:00
2014-11-15 01:10:04 +01:00
// Struct for string speed per IP
map_of_vector_counters SubnetVectorMapSpeed;
// Struct for storing average speed per IP for specified interval
map_of_vector_counters SubnetVectorMapSpeedAverage;
2013-12-28 20:11:20 +01:00
#ifdef GEOIP
map_for_counters GeoIpCounter;
#endif
2014-11-15 01:10:04 +01:00
// In ddos info we store attack power and direction
2015-01-27 20:29:51 +01:00
std::map<uint32_t, banlist_item> ban_list;
std::map<uint32_t, std::vector<simple_packet_t> > ban_list_details;
2013-10-18 12:16:55 +02:00
host_group_map_t host_groups;
// Here we store assignment from subnet to certain host group for fast lookup
subnet_to_host_group_map_t subnet_to_host_groups;
host_group_ban_settings_map_t host_group_ban_settings_map;
2015-05-21 18:34:17 +02:00
std::vector<subnet_t> our_networks;
std::vector<subnet_t> whitelist_networks;
2013-10-18 12:16:55 +02:00
2015-04-26 11:47:37 +02:00
// ExaBGP support flag
bool exabgp_enabled = false;
std::string exabgp_community = "";
// We could use separate communities for subnet and host announces
std::string exabgp_community_subnet = "";
std::string exabgp_community_host = "";
2015-05-11 21:56:18 +02:00
std::string exabgp_command_pipe = "/var/run/exabgp.cmd";
std::string exabgp_next_hop = "";
2015-04-26 11:47:37 +02:00
2015-05-10 20:42:49 +02:00
// Graphite monitoring
bool graphite_enabled = false;
std::string graphite_host = "127.0.0.1";
unsigned short int graphite_port = 2003;
// Default graphite namespace
std::string graphite_prefix = "fastnetmon";
2015-05-10 20:42:49 +02:00
bool process_incoming_traffic = true;
bool process_outgoing_traffic = true;
2014-11-15 01:10:04 +01:00
// Prototypes
#ifdef ENABLE_DPI
void init_current_instance_of_ndpi();
#endif
inline void build_average_speed_counters_from_speed_counters(map_element* current_average_speed_element,
map_element& new_speed_element,
double exp_value,
double exp_power);
inline void build_speed_counters_from_packet_counters(map_element& new_speed_element,
map_element* vector_itr,
double speed_calc_period);
void execute_ip_ban(uint32_t client_ip, map_element average_speed_element, std::string flow_attack_details, subnet_t customer_subnet);
std::string get_attack_description_in_json(uint32_t client_ip, attack_details& current_attack);
logging_configuration_t read_logging_settings(configuration_map_t configuration_map);
2015-07-30 18:00:42 +02:00
std::string get_amplification_attack_type(amplification_attack_type_t attack_type);
std::string generate_flow_spec_for_amplification_attack(amplification_attack_type_t amplification_attack_type,
std::string destination_ip);
bool exabgp_flow_spec_ban_manage(std::string action, std::string flow_spec_rule_as_text);
void call_attack_details_handlers(uint32_t client_ip, attack_details& current_attack, std::string attack_fingerprint);
2015-07-17 14:11:01 +02:00
void call_ban_handlers(uint32_t client_ip, attack_details& current_attack, std::string flow_attack_details);
2015-07-17 13:52:28 +02:00
void call_unban_handlers(uint32_t client_ip, attack_details& current_attack);
ban_settings_t read_ban_settings(configuration_map_t configuration_map, std::string host_group_name = "");
void exabgp_prefix_ban_manage(std::string action,
std::string prefix_as_string_with_mask,
std::string exabgp_next_hop,
std::string exabgp_community);
std::string print_subnet_load();
2015-07-07 17:54:38 +02:00
bool we_should_ban_this_ip(map_element* current_average_speed_element, ban_settings_t current_ban_settings);
unsigned int get_max_used_protocol(uint64_t tcp, uint64_t udp, uint64_t icmp);
void print_attack_details_to_file(std::string details, std::string client_ip_as_string, attack_details current_attack);
2015-07-07 17:48:47 +02:00
std::string print_ban_thresholds(ban_settings_t current_ban_settings);
bool load_configuration_file();
2015-01-27 20:29:51 +01:00
std::string print_flow_tracking_for_ip(conntrack_main_struct& conntrack_element, std::string client_ip);
void convert_integer_to_conntrack_hash_struct(packed_session* packed_connection_data,
packed_conntrack_hash* unpacked_data);
2014-11-13 16:01:15 +01:00
uint64_t convert_conntrack_hash_struct_to_integer(packed_conntrack_hash* struct_value);
void cleanup_ban_list();
2015-01-27 20:29:51 +01:00
std::string get_attack_description(uint32_t client_ip, attack_details& current_attack);
void send_attack_details(uint32_t client_ip, attack_details current_attack_details);
void free_up_all_resources();
2015-01-27 20:29:51 +01:00
std::string print_ddos_attack_details();
void recalculate_speed();
2015-01-27 20:29:51 +01:00
std::string print_channel_speed(std::string traffic_type, direction packet_direction);
void process_packet(simple_packet_t& current_packet);
2017-05-08 16:21:52 +02:00
void traffic_draw_program();
void interruption_signal_handler(int signal_number);
2013-10-18 12:16:55 +02:00
#ifdef FASTNETMON_API
void silent_logging_function(gpr_log_func_args* args) {
// We do not want any logging here
}
// Logic and data behind the server's behavior.
2015-10-16 11:34:48 +02:00
class FastnetmonApiServiceImpl final : public Fastnetmon::Service {
Status GetBanlist(::grpc::ServerContext* context,
const ::fastmitigation::BanListRequest* request,
::grpc::ServerWriter< ::fastmitigation::BanListReply>* writer) override {
2015-10-16 12:28:57 +02:00
logger << log4cpp::Priority::INFO << "API we asked for banlist";
2015-10-16 12:28:57 +02:00
for (std::map<uint32_t, banlist_item>::iterator itr = ban_list.begin(); itr != ban_list.end(); ++itr) {
std::string client_ip_as_string = convert_ip_as_uint_to_string(itr->first);
BanListReply reply;
reply.set_ip_address(client_ip_as_string + "/32");
2015-10-16 12:28:57 +02:00
writer->Write(reply);
}
return Status::OK;
}
Status ExecuteBan(ServerContext* context,
const fastmitigation::ExecuteBanRequest* request,
fastmitigation::ExecuteBanReply* reply) override {
2015-10-16 12:28:57 +02:00
logger << log4cpp::Priority::INFO << "API we asked for ban for IP: " << request->ip_address();
2015-10-16 12:56:31 +02:00
if (!is_v4_host(request->ip_address())) {
logger << log4cpp::Priority::ERROR << "IP bad format";
return Status::CANCELLED;
}
2015-10-16 12:56:31 +02:00
uint32_t client_ip = convert_ip_as_string_to_uint(request->ip_address());
struct attack_details current_attack;
ban_list_mutex.lock();
ban_list[client_ip] = current_attack;
ban_list_mutex.unlock();
ban_list_details_mutex.lock();
ban_list_details[client_ip] = std::vector<simple_packet_t>();
2015-10-16 12:56:31 +02:00
ban_list_details_mutex.unlock();
logger << log4cpp::Priority::INFO << "API call ban handlers manually";
std::string flow_attack_details = "manually triggered attack";
call_ban_handlers(client_ip, current_attack, flow_attack_details);
return Status::OK;
}
Status ExecuteUnBan(ServerContext* context,
const fastmitigation::ExecuteBanRequest* request,
fastmitigation::ExecuteBanReply* reply) override {
2015-10-16 12:16:46 +02:00
logger << log4cpp::Priority::INFO << "API: We asked for unban for IP: " << request->ip_address();
if (!is_v4_host(request->ip_address())) {
logger << log4cpp::Priority::ERROR << "IP bad format";
return Status::CANCELLED;
}
uint32_t banned_ip = convert_ip_as_string_to_uint(request->ip_address());
if (ban_list.count(banned_ip) == 0) {
logger << log4cpp::Priority::ERROR << "API: Could not find IP in ban list";
return Status::CANCELLED;
}
banlist_item ban_details = ban_list[banned_ip];
logger << log4cpp::Priority::INFO << "API: call unban handlers";
call_unban_handlers(banned_ip, ban_details);
logger << log4cpp::Priority::INFO << "API: remove IP from ban list";
ban_list_mutex.lock();
ban_list.erase(banned_ip);
ban_list_mutex.unlock();
return Status::OK;
}
};
2015-10-16 11:34:48 +02:00
// We could not define this variable in top of the file because we should define class before
FastnetmonApiServiceImpl api_service;
2015-10-16 11:34:48 +02:00
std::unique_ptr<Server> StartupApiServer() {
std::string server_address("127.0.0.1:50052");
ServerBuilder builder;
// Listen on the given address without any authentication mechanism.
builder.AddListeningPort(server_address, grpc::InsecureServerCredentials());
// Register "service" as the instance through which we'll communicate with
// clients. In this case it corresponds to an *synchronous* service.
2015-10-16 11:34:48 +02:00
builder.RegisterService(&api_service);
// Finally assemble the server.
2015-10-16 11:34:48 +02:00
std::unique_ptr<Server> current_api_server(builder.BuildAndStart());
logger << log4cpp::Priority::INFO << "API server listening on " << server_address;
2015-10-16 11:34:48 +02:00
return current_api_server;
}
void RunApiServer() {
logger << log4cpp::Priority::INFO << "Launch API server";
2015-10-16 11:34:48 +02:00
api_server = StartupApiServer();
// Wait for the server to shutdown. Note that some other thread must be
// responsible for shutting down the server for this call to ever return.
2015-10-16 11:34:48 +02:00
api_server->Wait();
logger << log4cpp::Priority::INFO << "API server got shutdown signal";
}
#endif
2014-12-04 15:45:42 +01:00
/* Class for custom comparison fields by different fields */
template <typename T> class TrafficComparatorClass {
2014-12-04 15:45:42 +01:00
private:
sort_type sort_field;
direction sort_direction;
public:
TrafficComparatorClass(direction sort_direction, sort_type sort_field) {
this->sort_field = sort_field;
this->sort_direction = sort_direction;
}
bool operator()(T a, T b) {
if (sort_field == FLOWS) {
if (sort_direction == INCOMING) {
return a.second.in_flows > b.second.in_flows;
} else if (sort_direction == OUTGOING) {
return a.second.out_flows > b.second.out_flows;
2014-12-04 15:45:42 +01:00
} else {
return false;
}
} else if (sort_field == PACKETS) {
if (sort_direction == INCOMING) {
return a.second.in_packets > b.second.in_packets;
} else if (sort_direction == OUTGOING) {
return a.second.out_packets > b.second.out_packets;
} else {
return false;
}
} else if (sort_field == BYTES) {
if (sort_direction == INCOMING) {
return a.second.in_bytes > b.second.in_bytes;
} else if (sort_direction == OUTGOING) {
return a.second.out_bytes > b.second.out_bytes;
} else {
return false;
}
} else {
return false;
2014-12-04 15:45:42 +01:00
}
}
2014-12-04 15:45:42 +01:00
};
void sigpipe_handler_for_popen(int signo) {
logger
<< log4cpp::Priority::ERROR << "Sorry but we experienced error with popen. "
<< "Please check your scripts. They should receive data on stdin! Optionally you could disable "
"passing any details with configuration param: notify_script_pass_details = no";
2015-06-03 13:06:13 +02:00
// Well, we do not need exit here because we have another options to notifying about atatck
// exit(1);
}
2014-06-09 13:53:31 +02:00
// exec command and pass data to it stdin
2015-01-27 20:29:51 +01:00
bool exec_with_stdin_params(std::string cmd, std::string params) {
2013-10-19 16:40:54 +02:00
FILE* pipe = popen(cmd.c_str(), "w");
2014-12-26 09:57:30 +01:00
if (!pipe) {
2017-05-08 16:21:52 +02:00
logger << log4cpp::Priority::ERROR << "Can't execute program " << cmd
<< " error code: " << errno << " error text: " << strerror(errno);
2014-12-26 09:57:30 +01:00
return false;
}
2013-10-19 16:40:54 +02:00
int fputs_ret = fputs(params.c_str(), pipe);
if (fputs_ret) {
pclose(pipe);
2013-10-19 16:40:54 +02:00
return true;
} else {
2017-05-08 16:21:52 +02:00
logger << log4cpp::Priority::ERROR << "Can't pass data to stdin of program " << cmd;
pclose(pipe);
2013-10-19 16:40:54 +02:00
return false;
}
}
2013-12-28 20:11:20 +01:00
#ifdef GEOIP
bool geoip_init() {
// load GeoIP ASN database to memory
geo_ip = GeoIP_open("/root/fastnetmon/GeoIPASNum.dat", GEOIP_MEMORY_CACHE);
if (geo_ip == NULL) {
return false;
} else {
return true;
}
}
#endif
2013-10-20 00:10:19 +02:00
#ifdef REDIS
redisContext* redis_init_connection() {
2013-10-21 11:43:54 +02:00
struct timeval timeout = { 1, 500000 }; // 1.5 seconds
redisContext* redis_context = redisConnectWithTimeout(redis_host.c_str(), redis_port, timeout);
2013-10-21 11:43:54 +02:00
if (redis_context->err) {
2015-09-29 21:01:56 +02:00
logger << log4cpp::Priority::ERROR << "Redis connection error:" << redis_context->errstr;
return NULL;
2013-10-21 11:43:54 +02:00
}
2014-11-15 01:10:04 +01:00
// We should check connection with ping because redis do not check connection
2013-10-21 11:43:54 +02:00
redisReply* reply = (redisReply*)redisCommand(redis_context, "PING");
if (reply) {
freeReplyObject(reply);
} else {
return NULL;
2013-10-21 11:43:54 +02:00
}
return redis_context;
2013-10-21 11:43:54 +02:00
}
#endif
2013-10-21 11:43:54 +02:00
#ifdef MONGO
void store_data_in_mongo(std::string key_name, std::string attack_details_json) {
mongoc_client_t* client;
mongoc_collection_t* collection;
mongoc_cursor_t* cursor;
bson_error_t error;
bson_oid_t oid;
bson_t* doc;
mongoc_init();
std::string collection_name = "attacks";
std::string connection_string =
"mongodb://" + mongodb_host + ":" + convert_int_to_string(mongodb_port) + "/";
client = mongoc_client_new(connection_string.c_str());
if (!client) {
logger << log4cpp::Priority::ERROR << "Can't connect to MongoDB database";
return;
}
bson_error_t bson_from_json_error;
bson_t* bson_data = bson_new_from_json((const uint8_t*)attack_details_json.c_str(),
attack_details_json.size(), &bson_from_json_error);
if (!bson_data) {
logger << log4cpp::Priority::ERROR << "Could not convert JSON to BSON";
return;
}
// logger << log4cpp::Priority::INFO << bson_as_json(bson_data, NULL);
collection =
mongoc_client_get_collection(client, mongodb_database_name.c_str(), collection_name.c_str());
doc = bson_new();
bson_oid_init(&oid, NULL);
BSON_APPEND_OID(doc, "_id", &oid);
bson_append_document(doc, key_name.c_str(), key_name.size(), bson_data);
// logger << log4cpp::Priority::INFO << bson_as_json(doc, NULL);
if (!mongoc_collection_insert(collection, MONGOC_INSERT_NONE, doc, NULL, &error)) {
logger << log4cpp::Priority::ERROR << "Could not store data to MongoDB: " << error.message;
}
// TODO: destroy bson_data too!
bson_destroy(doc);
mongoc_collection_destroy(collection);
mongoc_client_destroy(client);
}
#endif
#ifdef REDIS
void store_data_in_redis(std::string key_name, std::string attack_details) {
redisReply* reply = NULL;
redisContext* redis_context = redis_init_connection();
2013-10-20 00:10:19 +02:00
2013-10-21 11:43:54 +02:00
if (!redis_context) {
2015-09-29 21:01:56 +02:00
logger << log4cpp::Priority::ERROR << "Could not initiate connection to Redis";
2013-10-21 11:43:54 +02:00
return;
2013-10-20 00:10:19 +02:00
}
2013-10-21 11:43:54 +02:00
reply = (redisReply*)redisCommand(redis_context, "SET %s %s", key_name.c_str(), attack_details.c_str());
2013-10-21 11:43:54 +02:00
2014-11-15 01:10:04 +01:00
// If we store data correctly ...
2013-10-21 11:43:54 +02:00
if (!reply) {
logger << log4cpp::Priority::ERROR
<< "Can't increment traffic in redis error_code: " << redis_context->err
<< " error_string: " << redis_context->errstr;
2014-11-15 01:10:04 +01:00
// Handle redis server restart corectly
2013-10-21 11:43:54 +02:00
if (redis_context->err == 1 or redis_context->err == 3) {
// Connection refused
logger << log4cpp::Priority::ERROR
<< "Unfortunately we can't store data in Redis because server reject connection";
2013-10-21 11:43:54 +02:00
}
} else {
freeReplyObject(reply);
2013-10-21 11:43:54 +02:00
}
redisFree(redis_context);
2013-10-20 00:10:19 +02:00
}
#endif
std::string draw_table(direction data_direction, bool do_redis_update, sort_type sort_item) {
std::vector<pair_of_map_elements> vector_for_sort;
2013-10-18 12:16:55 +02:00
2015-01-27 20:29:51 +01:00
std::stringstream output_buffer;
// Preallocate memory for sort vector
// We use total networks size for this vector
vector_for_sort.reserve(total_number_of_hosts_in_our_networks);
// Switch to Average speed there!!!
map_of_vector_counters* current_speed_map = NULL;
if (print_average_traffic_counts) {
current_speed_map = &SubnetVectorMapSpeedAverage;
} else {
current_speed_map = &SubnetVectorMapSpeed;
}
map_element zero_map_element;
memset(&zero_map_element, 0, sizeof(zero_map_element));
unsigned int count_of_zero_speed_packets = 0;
for (map_of_vector_counters::iterator itr = current_speed_map->begin();
itr != current_speed_map->end(); ++itr) {
for (vector_of_counters::iterator vector_itr = itr->second.begin();
vector_itr != itr->second.end(); ++vector_itr) {
int current_index = vector_itr - itr->second.begin();
// convert to host order for math operations
uint32_t subnet_ip = ntohl(itr->first.first);
uint32_t client_ip_in_host_bytes_order = subnet_ip + current_index;
// covnert to our standard network byte order
uint32_t client_ip = htonl(client_ip_in_host_bytes_order);
// Do not add zero speed packets to sort list
if (memcmp((void*)&zero_map_element, &*vector_itr, sizeof(map_element)) != 0) {
vector_for_sort.push_back(std::make_pair(client_ip, *vector_itr));
} else {
count_of_zero_speed_packets++;
}
}
}
// Sort only first X elements in this vector
unsigned int shift_for_sort = max_ips_in_list;
2014-12-04 15:45:42 +01:00
if (data_direction == INCOMING or data_direction == OUTGOING) {
// Because in another case we will got segmentation fault
unsigned int vector_size = vector_for_sort.size();
if (vector_size < shift_for_sort) {
shift_for_sort = vector_size;
}
std::partial_sort(vector_for_sort.begin(), vector_for_sort.begin() + shift_for_sort,
vector_for_sort.end(),
TrafficComparatorClass<pair_of_map_elements>(data_direction, sort_item));
} else {
logger << log4cpp::Priority::ERROR << "Unexpected bahaviour on sort function";
return "Internal error";
}
unsigned int element_number = 0;
// In this loop we print only top X talkers in our subnet to screen buffer
for (std::vector<pair_of_map_elements>::iterator ii = vector_for_sort.begin();
ii != vector_for_sort.end(); ++ii) {
// Print first max_ips_in_list elements in list, we will show top X "huge" channel loaders
2015-08-26 17:24:10 +02:00
if (element_number >= max_ips_in_list) {
break;
}
uint32_t client_ip = (*ii).first;
2015-01-27 20:29:51 +01:00
std::string client_ip_as_string = convert_ip_as_uint_to_string((*ii).first);
uint64_t pps = 0;
uint64_t bps = 0;
uint64_t flows = 0;
uint64_t pps_average = 0;
uint64_t bps_average = 0;
uint64_t flows_average = 0;
// Here we could have average or instantaneous speed
map_element* current_speed_element = &ii->second;
2014-11-15 01:10:04 +01:00
// Create polymorphic pps, byte and flow counters
if (data_direction == INCOMING) {
pps = current_speed_element->in_packets;
bps = current_speed_element->in_bytes;
flows = current_speed_element->in_flows;
} else if (data_direction == OUTGOING) {
pps = current_speed_element->out_packets;
bps = current_speed_element->out_bytes;
flows = current_speed_element->out_flows;
}
uint64_t mbps = convert_speed_to_mbps(bps);
uint64_t mbps_average = convert_speed_to_mbps(bps_average);
std::string is_banned = ban_list.count(client_ip) > 0 ? " *banned* " : "";
// We use setw for alignment
output_buffer << client_ip_as_string << "\t\t";
output_buffer << std::setw(6) << pps << " pps ";
output_buffer << std::setw(6) << mbps << " mbps ";
output_buffer << std::setw(6) << flows << " flows ";
output_buffer << is_banned << std::endl;
2015-05-10 20:42:49 +02:00
element_number++;
}
graphite_data_t graphite_data;
// TODO: add graphite operations time to the config file
if (graphite_enabled) {
for (std::vector<pair_of_map_elements>::iterator ii = vector_for_sort.begin();
ii != vector_for_sort.end(); ++ii) {
uint32_t client_ip = (*ii).first;
std::string client_ip_as_string = convert_ip_as_uint_to_string((*ii).first);
uint64_t pps = 0;
uint64_t bps = 0;
uint64_t flows = 0;
// Here we could have average or instantaneous speed
map_element* current_speed_element = &ii->second;
// Create polymorphic pps, byte and flow counters
if (data_direction == INCOMING) {
pps = current_speed_element->in_packets;
bps = current_speed_element->in_bytes;
flows = current_speed_element->in_flows;
} else if (data_direction == OUTGOING) {
pps = current_speed_element->out_packets;
bps = current_speed_element->out_bytes;
flows = current_speed_element->out_flows;
}
2015-05-10 20:42:49 +02:00
std::string direction_as_string;
if (data_direction == INCOMING) {
direction_as_string = "incoming";
} else if (data_direction == OUTGOING) {
direction_as_string = "outgoing";
2015-05-10 20:42:49 +02:00
}
std::string ip_as_string_with_dash_delimiters = client_ip_as_string;
// Replace dots by dashes
std::replace(ip_as_string_with_dash_delimiters.begin(),
ip_as_string_with_dash_delimiters.end(), '.', '_');
std::string graphite_current_prefix =
graphite_prefix + ".hosts." + ip_as_string_with_dash_delimiters + "." + direction_as_string;
if (print_average_traffic_counts) {
graphite_current_prefix = graphite_current_prefix + ".average";
}
// We do not store zero data to Graphite
if (pps != 0) {
graphite_data[graphite_current_prefix + ".pps"] = pps;
}
if (bps != 0) {
graphite_data[graphite_current_prefix + ".bps"] = bps * 8;
}
if (flows != 0) {
graphite_data[graphite_current_prefix + ".flows"] = flows;
}
}
}
// TODO: we should switch to piclke format instead text
// TODO: we should check packet size for Graphite
// logger << log4cpp::Priority::INFO << "We will write " << graphite_data.size() << " records to Graphite";
2015-05-11 14:28:14 +02:00
if (graphite_enabled) {
bool graphite_put_result = store_data_to_graphite(graphite_port, graphite_host, graphite_data);
2015-05-10 20:42:49 +02:00
2015-05-11 14:28:14 +02:00
if (!graphite_put_result) {
logger << log4cpp::Priority::ERROR << "Can't store data to Graphite";
2015-05-11 14:28:14 +02:00
}
2015-05-10 20:42:49 +02:00
}
return output_buffer.str();
2013-10-18 12:16:55 +02:00
}
2015-03-21 12:24:31 +01:00
// TODO: move to lirbary
2014-06-09 11:57:28 +02:00
// read whole file to vector
2015-01-27 20:29:51 +01:00
std::vector<std::string> read_file_to_vector(std::string file_name) {
std::vector<std::string> data;
std::string line;
2014-06-09 11:57:28 +02:00
2015-01-27 20:29:51 +01:00
std::ifstream reading_file;
reading_file.open(file_name.c_str(), std::ifstream::in);
2014-06-09 11:57:28 +02:00
if (reading_file.is_open()) {
while (getline(reading_file, line)) {
boost::algorithm::trim(line);
data.push_back(line);
2014-06-09 11:57:28 +02:00
}
} else {
logger << log4cpp::Priority::ERROR << "Can't open file: " << file_name;
2014-06-09 11:57:28 +02:00
}
return data;
}
void parse_hostgroups(std::string name, std::string value) {
// We are creating new host group of subnets
if (name != "hostgroup") {
return;
}
std::vector<std::string> splitted_new_host_group;
// We have new host groups in form:
// hostgroup = new_host_group_name:11.22.33.44/32,....
split(splitted_new_host_group, value, boost::is_any_of(":"), boost::token_compress_on);
if (splitted_new_host_group.size() != 2) {
logger << log4cpp::Priority::ERROR << "We can't parse new host group";
return;
}
boost::algorithm::trim(splitted_new_host_group[0]);
boost::algorithm::trim(splitted_new_host_group[1]);
std::string host_group_name = splitted_new_host_group[0];
if (host_groups.count(host_group_name) > 0) {
logger << log4cpp::Priority::WARN << "We already have this host group (" << host_group_name
<< "). Please check!";
return;
}
// Split networks
std::vector<std::string> hostgroup_subnets =
split_strings_to_vector_by_comma(splitted_new_host_group[1]);
for (std::vector<std::string>::iterator itr = hostgroup_subnets.begin();
itr != hostgroup_subnets.end(); ++itr) {
subnet_t subnet = convert_subnet_from_string_to_binary_with_cidr_format(*itr);
host_groups[host_group_name].push_back(subnet);
logger << log4cpp::Priority::WARN << "We add subnet " << convert_subnet_to_string(subnet)
<< " to host group " << host_group_name;
// And add to subnet to host group lookup hash
if (subnet_to_host_groups.count(subnet) > 0) {
// Huston, we have problem! Subnet to host group mapping should map single subnet to single group!
logger << log4cpp::Priority::WARN << "Seems you have specified single subnet " << *itr
<< " to multiple host groups, please fix it, it's prohibited";
} else {
subnet_to_host_groups[subnet] = host_group_name;
}
}
logger << log4cpp::Priority::INFO << "We have created host group " << host_group_name
<< " with " << host_groups[host_group_name].size() << " subnets";
}
2014-06-09 11:08:19 +02:00
// Load configuration
bool load_configuration_file() {
std::ifstream config_file(global_config_path.c_str());
2015-01-27 20:29:51 +01:00
std::string line;
2014-06-09 11:08:19 +02:00
if (!config_file.is_open()) {
logger << log4cpp::Priority::ERROR << "Can't open config file";
return false;
}
2014-06-09 11:08:19 +02:00
while (getline(config_file, line)) {
2015-04-27 14:48:11 +02:00
std::vector<std::string> parsed_config;
boost::algorithm::trim(line);
2015-04-27 14:48:11 +02:00
if (line.find("#") == 0 or line.empty()) {
// Ignore comments line
continue;
}
boost::split(parsed_config, line, boost::is_any_of("="), boost::token_compress_on);
if (parsed_config.size() == 2) {
boost::algorithm::trim(parsed_config[0]);
boost::algorithm::trim(parsed_config[1]);
configuration_map[parsed_config[0]] = parsed_config[1];
// Well, we parse host groups here
parse_hostgroups(parsed_config[0], parsed_config[1]);
} else {
logger << log4cpp::Priority::ERROR << "Can't parse config line: '" << line << "'";
}
}
if (configuration_map.count("enable_connection_tracking")) {
if (configuration_map["enable_connection_tracking"] == "on") {
enable_conection_tracking = true;
} else {
enable_conection_tracking = false;
}
}
if (configuration_map.count("process_internal_traffic_as_external")) {
if (configuration_map["process_internal_traffic_as_external"] == "on") {
process_internal_traffic_as_external = true;
} else {
process_internal_traffic_as_external = false;
}
}
2014-12-03 16:03:47 +01:00
if (configuration_map.count("ban_time") != 0) {
global_ban_time = convert_string_to_integer(configuration_map["ban_time"]);
// Completely disable unban option
if (global_ban_time == 0) {
unban_enabled = false;
}
2014-12-03 16:03:47 +01:00
}
if (configuration_map.count("pid_path") != 0) {
pid_path = configuration_map["pid_path"];
}
if (configuration_map.count("cli_stats_file_path") != 0) {
cli_stats_file_path = configuration_map["cli_stats_file_path"];
}
if (configuration_map.count("unban_only_if_attack_finished") != 0) {
if (configuration_map["unban_only_if_attack_finished"] == "on") {
unban_only_if_attack_finished = true;
} else {
unban_only_if_attack_finished = false;
}
}
if (configuration_map.count("graphite_prefix") != 0) {
graphite_prefix = configuration_map["graphite_prefix"];
}
2014-12-02 15:11:27 +01:00
if (configuration_map.count("average_calculation_time") != 0) {
average_calculation_amount =
convert_string_to_integer(configuration_map["average_calculation_time"]);
2014-12-02 15:11:27 +01:00
}
if (configuration_map.count("average_calculation_time_for_subnets") != 0) {
average_calculation_amount_for_subnets =
convert_string_to_integer(configuration_map["average_calculation_time_for_subnets"]);
}
if (configuration_map.count("speed_calculation_delay") != 0) {
recalculate_speed_timeout = convert_string_to_integer(configuration_map["speed_calculation_delay"]);
}
if (configuration_map.count("monitor_local_ip_addresses") != 0) {
monitor_local_ip_addresses = configuration_map["monitor_local_ip_addresses"] == "on" ? true : false;
}
if (configuration_map.count("monitor_openvz_vps_ip_addresses") != 0) {
monitor_openvz_vps_ip_addresses = configuration_map["monitor_openvz_vps_ip_addresses"] == "on" ? true : false;
}
#ifdef FASTNETMON_API
if (configuration_map.count("enable_api") != 0) {
enable_api = configuration_map["enable_api"] == "on";
}
#endif
#ifdef ENABLE_GOBGP
// GoBGP configuration
if (configuration_map.count("gobgp") != 0) {
gobgp_enabled = configuration_map["gobgp"] == "on";
}
#endif
// ExaBGP configuration
2015-04-26 11:47:37 +02:00
if (configuration_map.count("exabgp") != 0) {
if (configuration_map["exabgp"] == "on") {
exabgp_enabled = true;
} else {
exabgp_enabled = false;
}
}
if (exabgp_enabled) {
// TODO: add community format validation
if (configuration_map.count("exabgp_community")) {
exabgp_community = configuration_map["exabgp_community"];
}
if (configuration_map.count("exabgp_community_subnet")) {
exabgp_community_subnet = configuration_map["exabgp_community_subnet"];
} else {
exabgp_community_subnet = exabgp_community;
}
if (configuration_map.count("exabgp_community_host")) {
exabgp_community_host = configuration_map["exabgp_community_host"];
} else {
exabgp_community_host = exabgp_community;
}
if (exabgp_enabled && exabgp_announce_whole_subnet && exabgp_community_subnet.empty()) {
logger << log4cpp::Priority::ERROR << "You enabled exabgp for subnet but not specified community, we disable exabgp support";
exabgp_enabled = false;
}
if (exabgp_enabled && exabgp_announce_host && exabgp_community_host.empty()) {
logger
<< log4cpp::Priority::ERROR
<< "You enabled exabgp for host but not specified community, we disable exabgp support";
exabgp_enabled = false;
}
2015-04-26 11:47:37 +02:00
}
if (exabgp_enabled) {
exabgp_command_pipe = configuration_map["exabgp_command_pipe"];
if (exabgp_command_pipe.empty()) {
logger << log4cpp::Priority::ERROR
<< "You enabled exabgp but not specified "
"exabgp_command_pipe, so we disable exabgp "
"support";
2015-04-26 11:47:37 +02:00
exabgp_enabled = false;
}
2015-04-26 11:47:37 +02:00
}
if (exabgp_enabled) {
exabgp_next_hop = configuration_map["exabgp_next_hop"];
if (exabgp_next_hop.empty()) {
logger
<< log4cpp::Priority::ERROR
<< "You enabled exabgp but not specified exabgp_next_hop, so we disable exabgp support";
exabgp_enabled = false;
}
if (configuration_map.count("exabgp_flow_spec_announces") != 0) {
exabgp_flow_spec_announces = configuration_map["exabgp_flow_spec_announces"] == "on";
}
2015-05-02 18:00:33 +02:00
if (exabgp_enabled) {
logger << log4cpp::Priority::INFO << "ExaBGP support initialized correctly";
}
2015-05-02 18:00:33 +02:00
}
2015-04-26 11:47:37 +02:00
2014-12-02 13:43:34 +01:00
if (configuration_map.count("sflow") != 0) {
if (configuration_map["sflow"] == "on") {
2014-12-02 13:43:34 +01:00
enable_sflow_collection = true;
} else {
enable_sflow_collection = false;
}
}
if (configuration_map.count("pfring_hardware_filters_enabled") != 0) {
pfring_hardware_filters_enabled = configuration_map["pfring_hardware_filters_enabled"] == "on";
}
if (configuration_map.count("netflow") != 0) {
if (configuration_map["netflow"] == "on") {
enable_netflow_collection = true;
} else {
enable_netflow_collection = false;
}
}
if (configuration_map.count("exabgp_announce_whole_subnet") != 0) {
exabgp_announce_whole_subnet = configuration_map["exabgp_announce_whole_subnet"] == "on" ? true : false;
}
if (configuration_map.count("exabgp_announce_host") != 0) {
exabgp_announce_host = configuration_map["exabgp_announce_host"] == "on" ? true : false;
}
if (configuration_map.count("enable_subnet_counters") != 0) {
enable_subnet_counters = configuration_map["enable_subnet_counters"] == "on" ? true : false;
}
2015-05-10 20:42:49 +02:00
// Graphite
if (configuration_map.count("graphite") != 0) {
graphite_enabled = configuration_map["graphite"] == "on" ? true : false;
}
if (configuration_map.count("graphite_host") != 0) {
graphite_host = configuration_map["graphite_host"];
}
if (configuration_map.count("graphite_port") != 0) {
graphite_port = convert_string_to_integer(configuration_map["graphite_port"]);
}
if (configuration_map.count("graphite_number_of_ips") != 0) {
logger << log4cpp::Priority::ERROR << "Sorry, you have used deprecated function graphite_number_of_ips";
}
if (configuration_map.count("process_incoming_traffic") != 0) {
process_incoming_traffic = configuration_map["process_incoming_traffic"] == "on" ? true : false;
}
if (configuration_map.count("process_outgoing_traffic") != 0) {
process_outgoing_traffic = configuration_map["process_outgoing_traffic"] == "on" ? true : false;
}
if (configuration_map.count("mirror") != 0) {
2014-12-02 13:43:34 +01:00
if (configuration_map["mirror"] == "on") {
enable_data_collection_from_mirror = true;
} else {
enable_data_collection_from_mirror = false;
}
}
if (configuration_map.count("mirror_netmap") != 0) {
2015-03-10 15:17:52 +01:00
if (configuration_map["mirror_netmap"] == "on") {
enable_netmap_collection = true;
} else {
enable_netmap_collection = false;
}
}
if (configuration_map.count("mirror_snabbswitch") != 0) {
enable_snabbswitch_collection = configuration_map["mirror_snabbswitch"] == "on";
}
if (configuration_map.count("mirror_afpacket") != 0) {
enable_afpacket_collection = configuration_map["mirror_afpacket"] == "on";
}
2015-03-10 15:17:52 +01:00
if (enable_netmap_collection && enable_data_collection_from_mirror) {
logger << log4cpp::Priority::ERROR
<< "You have enabled pfring and netmap data collection "
"from mirror which strictly prohibited, please "
"select one";
2015-03-10 15:17:52 +01:00
exit(1);
}
if (configuration_map.count("pcap") != 0) {
if (configuration_map["pcap"] == "on") {
enable_pcap_collection = true;
} else {
enable_pcap_collection = false;
}
}
// Read global ban configuration
global_ban_settings = read_ban_settings(configuration_map, "");
logging_configuration = read_logging_settings(configuration_map);
// logger << log4cpp::Priority::INFO << "We read global ban settings: " << print_ban_thresholds(global_ban_settings);
// Read host group ban settings
for (host_group_map_t::iterator hostgroup_itr = host_groups.begin();
hostgroup_itr != host_groups.end(); ++hostgroup_itr) {
std::string host_group_name = hostgroup_itr->first;
logger << log4cpp::Priority::INFO << "We will read ban settings for " << host_group_name;
host_group_ban_settings_map[host_group_name] = read_ban_settings(configuration_map, host_group_name);
// logger << log4cpp::Priority::INFO << "We read " << host_group_name << " ban settings "
// << print_ban_thresholds(host_group_ban_settings_map[ host_group_name ]);
}
if (configuration_map.count("white_list_path") != 0) {
white_list_path = configuration_map["white_list_path"];
}
if (configuration_map.count("networks_list_path") != 0) {
networks_list_path = configuration_map["networks_list_path"];
}
2014-06-09 11:57:28 +02:00
#ifdef REDIS
if (configuration_map.count("redis_port") != 0) {
redis_port = convert_string_to_integer(configuration_map["redis_port"]);
}
2014-06-09 11:08:19 +02:00
if (configuration_map.count("redis_host") != 0) {
redis_host = configuration_map["redis_host"];
}
2015-08-17 23:14:32 +02:00
if (configuration_map.count("redis_prefix") != 0) {
2015-08-17 22:44:46 +02:00
redis_prefix = configuration_map["redis_prefix"];
2015-08-17 19:50:06 +02:00
}
if (configuration_map.count("redis_enabled") != 0) {
// We use yes and on because it's stupid typo :(
if (configuration_map["redis_enabled"] == "on" or
configuration_map["redis_enabled"] == "yes") {
redis_enabled = true;
} else {
redis_enabled = false;
}
}
2014-06-09 11:57:28 +02:00
#endif
2014-06-09 11:08:19 +02:00
#ifdef MONGO
if (configuration_map.count("mongodb_enabled") != 0) {
if (configuration_map["mongodb_enabled"] == "on") {
mongodb_enabled = true;
}
}
if (configuration_map.count("mongodb_host") != 0) {
mongodb_host = configuration_map["mongodb_host"];
}
if (configuration_map.count("mongodb_port") != 0) {
mongodb_port = convert_string_to_integer(configuration_map["mongodb_port"]);
}
if (configuration_map.count("mongodb_database_name") != 0) {
mongodb_database_name = configuration_map["mongodb_database_name"];
}
#endif
if (configuration_map.count("ban_details_records_count") != 0) {
ban_details_records_count =
convert_string_to_integer(configuration_map["ban_details_records_count"]);
}
2014-06-09 11:08:19 +02:00
if (configuration_map.count("check_period") != 0) {
check_period = convert_string_to_integer(configuration_map["check_period"]);
}
2014-06-09 11:08:19 +02:00
if (configuration_map.count("sort_parameter") != 0) {
sort_parameter = configuration_map["sort_parameter"];
}
2014-06-09 11:08:19 +02:00
if (configuration_map.count("max_ips_in_list") != 0) {
max_ips_in_list = convert_string_to_integer(configuration_map["max_ips_in_list"]);
}
2014-06-09 11:08:19 +02:00
if (configuration_map.count("notify_script_path") != 0) {
notify_script_path = configuration_map["notify_script_path"];
2014-06-09 11:08:19 +02:00
}
if (configuration_map.count("notify_script_pass_details") != 0) {
notify_script_pass_details = configuration_map["notify_script_pass_details"] == "on" ? true : false;
}
2015-07-17 13:52:28 +02:00
if (file_exists(notify_script_path)) {
notify_script_enabled = true;
} else {
logger << log4cpp::Priority::ERROR << "We can't find notify script " << notify_script_path;
notify_script_enabled = false;
}
if (configuration_map.count("collect_attack_pcap_dumps") != 0) {
collect_attack_pcap_dumps = configuration_map["collect_attack_pcap_dumps"] == "on" ? true : false;
}
2015-07-29 16:06:50 +02:00
if (configuration_map.count("process_pcap_attack_dumps_with_dpi") != 0) {
if (collect_attack_pcap_dumps) {
process_pcap_attack_dumps_with_dpi =
configuration_map["process_pcap_attack_dumps_with_dpi"] == "on" ? true : false;
2015-07-29 16:06:50 +02:00
}
}
2015-07-29 16:06:50 +02:00
return true;
2014-06-09 11:08:19 +02:00
}
2014-06-22 21:04:43 +02:00
/* Enable core dumps for simplify debug tasks */
void enable_core_dumps() {
struct rlimit rlim;
2014-06-22 21:04:43 +02:00
int result = getrlimit(RLIMIT_CORE, &rlim);
if (result) {
logger << log4cpp::Priority::ERROR << "Can't get current rlimit for RLIMIT_CORE";
2014-06-22 21:04:43 +02:00
return;
} else {
rlim.rlim_cur = rlim.rlim_max;
setrlimit(RLIMIT_CORE, &rlim);
}
}
2013-11-15 15:35:44 +01:00
void subnet_vectors_allocator(prefix_t* prefix, void* data) {
// Network byte order
uint32_t subnet_as_integer = prefix->add.sin.s_addr;
u_short bitlen = prefix->bitlen;
double base = 2;
int network_size_in_ips = pow(base, 32 - bitlen);
// logger<< log4cpp::Priority::INFO<<"Subnet: "<<prefix->add.sin.s_addr<<" network size:
// "<<network_size_in_ips;
logger << log4cpp::Priority::INFO << "I will allocate " << network_size_in_ips
<< " records for subnet " << subnet_as_integer << " cidr mask: " << bitlen;
subnet_t current_subnet = std::make_pair(subnet_as_integer, bitlen);
map_element zero_map_element;
memset(&zero_map_element, 0, sizeof(zero_map_element));
// Initilize our counters with fill constructor
try {
SubnetVectorMap[current_subnet] = vector_of_counters(network_size_in_ips, zero_map_element);
SubnetVectorMapSpeed[current_subnet] = vector_of_counters(network_size_in_ips, zero_map_element);
SubnetVectorMapSpeedAverage[current_subnet] = vector_of_counters(network_size_in_ips, zero_map_element);
} catch (std::bad_alloc& ba) {
logger << log4cpp::Priority::ERROR << "Can't allocate memory for counters";
exit(1);
}
2014-11-13 16:01:15 +01:00
// Initilize map element
SubnetVectorMapFlow[current_subnet] = vector_of_flow_counters(network_size_in_ips);
2014-11-13 16:01:15 +01:00
2014-11-16 18:09:16 +01:00
// On creating it initilizes by zeros
conntrack_main_struct zero_conntrack_main_struct;
std::fill(SubnetVectorMapFlow[current_subnet].begin(),
SubnetVectorMapFlow[current_subnet].end(), zero_conntrack_main_struct);
PerSubnetCountersMap[current_subnet] = zero_map_element;
PerSubnetSpeedMap[current_subnet] = zero_map_element;
}
void zeroify_all_counters() {
map_element zero_map_element;
memset(&zero_map_element, 0, sizeof(zero_map_element));
for (map_of_vector_counters::iterator itr = SubnetVectorMap.begin(); itr != SubnetVectorMap.end(); ++itr) {
// logger<< log4cpp::Priority::INFO<<"Zeroify "<<itr->first;
std::fill(itr->second.begin(), itr->second.end(), zero_map_element);
}
}
void zeroify_all_flow_counters() {
2014-11-16 18:09:16 +01:00
// On creating it initilizes by zeros
conntrack_main_struct zero_conntrack_main_struct;
2014-11-13 16:01:15 +01:00
// Iterate over map
for (map_of_vector_counters_for_flow::iterator itr = SubnetVectorMapFlow.begin();
itr != SubnetVectorMapFlow.end(); ++itr) {
2014-11-13 16:01:15 +01:00
// Iterate over vector
for (vector_of_flow_counters::iterator vector_iterator = itr->second.begin();
vector_iterator != itr->second.end(); ++vector_iterator) {
2014-11-13 16:01:15 +01:00
// TODO: rewrite this monkey code
vector_iterator->in_tcp.clear();
vector_iterator->in_udp.clear();
vector_iterator->in_icmp.clear();
vector_iterator->in_other.clear();
vector_iterator->out_tcp.clear();
vector_iterator->out_udp.clear();
vector_iterator->out_icmp.clear();
vector_iterator->out_other.clear();
}
}
}
bool load_our_networks_list() {
if (file_exists(white_list_path)) {
unsigned int network_entries = 0;
std::vector<std::string> network_list_from_config = read_file_to_vector(white_list_path);
2014-06-09 14:47:11 +02:00
for (std::vector<std::string>::iterator ii = network_list_from_config.begin();
ii != network_list_from_config.end(); ++ii) {
std::string text_subnet = *ii;
if (text_subnet.empty()) {
continue;
}
if (is_v4_host(text_subnet)) {
logger << log4cpp::Priority::INFO << "Assuming /32 netmask for " << text_subnet;
text_subnet += "/32";
} else if (!is_cidr_subnet(text_subnet)) {
logger << log4cpp::Priority::ERROR << "Can't parse line from whitelist: " << text_subnet;
continue;
2014-10-21 12:21:48 +02:00
}
network_entries++;
make_and_lookup(whitelist_tree_ipv4, const_cast<char*>(text_subnet.c_str()));
}
logger << log4cpp::Priority::INFO << "We loaded " << network_entries << " networks from whitelist file";
2014-06-09 14:47:11 +02:00
}
std::vector<std::string> networks_list_ipv4_as_string;
std::vector<std::string> networks_list_ipv6_as_string;
// We can build list of our subnets automatically here
if (monitor_openvz_vps_ip_addresses && file_exists("/proc/vz/version")) {
logger << log4cpp::Priority::INFO << "We found OpenVZ";
2014-11-15 01:10:04 +01:00
// Add /32 CIDR mask for every IP here
2015-01-27 20:29:51 +01:00
std::vector<std::string> openvz_ips = read_file_to_vector("/proc/vz/veip");
for (std::vector<std::string>::iterator ii = openvz_ips.begin(); ii != openvz_ips.end(); ++ii) {
2014-06-09 13:53:31 +02:00
// skip header
if (strstr(ii->c_str(), "Version") != NULL) {
continue;
}
/*
Example data for this lines:
2a03:f480:1:17:0:0:0:19 0
185.4.72.40 0
*/
if (strstr(ii->c_str(), ":") == NULL) {
// IPv4
std::vector<std::string> subnet_as_string;
split(subnet_as_string, *ii, boost::is_any_of(" "), boost::token_compress_on);
std::string openvz_subnet = subnet_as_string[1] + "/32";
networks_list_ipv4_as_string.push_back(openvz_subnet);
} else {
// IPv6
std::vector<std::string> subnet_as_string;
split(subnet_as_string, *ii, boost::is_any_of(" "), boost::token_compress_on);
std::string openvz_subnet = subnet_as_string[1] + "/128";
networks_list_ipv6_as_string.push_back(openvz_subnet);
}
}
2014-06-30 10:49:55 +02:00
logger << log4cpp::Priority::INFO << "We loaded " << networks_list_ipv4_as_string.size()
<< " IPv4 networks from /proc/vz/veip";
logger << log4cpp::Priority::INFO << "We loaded " << networks_list_ipv6_as_string.size()
<< " IPv6 networks from /proc/vz/veip";
}
if (monitor_local_ip_addresses && file_exists("/sbin/ip")) {
logger << log4cpp::Priority::INFO << "We are working on Linux and could use ip tool for detecting local IP's";
ip_addresses_list_t ip_list = get_local_ip_v4_addresses_list();
logger << log4cpp::Priority::INFO << "We found " << ip_list.size()
<< " local IP addresses and will monitor they";
for (ip_addresses_list_t::iterator iter = ip_list.begin(); iter != ip_list.end(); ++iter) {
// TODO: add IPv6 here
networks_list_ipv4_as_string.push_back(*iter + "/32");
}
}
2013-10-18 12:59:58 +02:00
if (file_exists(networks_list_path)) {
std::vector<std::string> network_list_from_config = read_file_to_vector(networks_list_path);
for (std::vector<std::string>::iterator line_itr = network_list_from_config.begin();
line_itr != network_list_from_config.end(); ++line_itr) {
if (line_itr->length() == 0) {
// Skip blank lines in subnet list file silently
continue;
}
if (strstr(line_itr->c_str(), ":") == NULL) {
networks_list_ipv4_as_string.push_back(*line_itr);
} else {
networks_list_ipv6_as_string.push_back(*line_itr);
}
}
2014-06-09 16:28:56 +02:00
logger << log4cpp::Priority::INFO << "We loaded " << network_list_from_config.size()
<< " networks from networks file";
2013-10-18 12:59:58 +02:00
}
2013-10-18 12:16:55 +02:00
2014-11-15 01:10:04 +01:00
// Some consistency checks
assert(convert_ip_as_string_to_uint("255.255.255.0") == convert_cidr_to_binary_netmask(24));
assert(convert_ip_as_string_to_uint("255.255.255.255") == convert_cidr_to_binary_netmask(32));
2013-10-18 12:16:55 +02:00
logger << log4cpp::Priority::INFO << "Totally we have " << networks_list_ipv4_as_string.size() << " IPv4 subnets";
logger << log4cpp::Priority::INFO << "Totally we have " << networks_list_ipv6_as_string.size() << " IPv6 subnets";
for (std::vector<std::string>::iterator ii = networks_list_ipv4_as_string.begin();
ii != networks_list_ipv4_as_string.end(); ++ii) {
if (!is_cidr_subnet(*ii)) {
logger << log4cpp::Priority::ERROR << "Can't parse line from subnet list: '" << *ii << "'";
2015-02-18 20:31:55 +01:00
continue;
}
2015-02-18 20:31:55 +01:00
std::string network_address_in_cidr_form = *ii;
2015-02-18 20:31:55 +01:00
unsigned int cidr_mask = get_cidr_mask_from_network_as_string(network_address_in_cidr_form);
std::string network_address = get_net_address_from_network_as_string(network_address_in_cidr_form);
2014-12-16 11:56:08 +01:00
2015-02-18 20:31:55 +01:00
double base = 2;
total_number_of_hosts_in_our_networks += pow(base, 32 - cidr_mask);
2015-02-18 20:31:55 +01:00
// Make sure it's "subnet address" and not an host address
uint32_t subnet_address_as_uint = convert_ip_as_string_to_uint(network_address);
uint32_t subnet_address_netmask_binary = convert_cidr_to_binary_netmask(cidr_mask);
2015-02-18 20:31:55 +01:00
uint32_t generated_subnet_address = subnet_address_as_uint & subnet_address_netmask_binary;
if (subnet_address_as_uint != generated_subnet_address) {
std::string new_network_address_as_string =
convert_ip_as_uint_to_string(generated_subnet_address) + "/" + convert_int_to_string(cidr_mask);
logger << log4cpp::Priority::WARN << "We will use " << new_network_address_as_string
<< " instead of " << network_address_in_cidr_form << " because it's host address";
2015-02-18 20:31:55 +01:00
network_address_in_cidr_form = new_network_address_as_string;
2014-10-21 12:21:48 +02:00
}
2015-02-18 20:31:55 +01:00
make_and_lookup(lookup_tree_ipv4, const_cast<char*>(network_address_in_cidr_form.c_str()));
}
for (std::vector<std::string>::iterator ii = networks_list_ipv6_as_string.begin();
ii != networks_list_ipv6_as_string.end(); ++ii) {
// TODO: add IPv6 subnet format validation
make_and_lookup_ipv6(lookup_tree_ipv6, (char*)ii->c_str());
}
logger << log4cpp::Priority::INFO << "Total number of monitored hosts (total size of all networks): "
<< total_number_of_hosts_in_our_networks;
2014-06-30 10:49:55 +02:00
// 3 - speed counter, average speed counter and data counter
uint64_t memory_requirements = 3 * sizeof(map_element) * total_number_of_hosts_in_our_networks / 1024 / 1024;
logger << log4cpp::Priority::INFO << "We need " << memory_requirements
<< " MB of memory for storing counters for your networks";
/* Preallocate data structures */
patricia_process(lookup_tree_ipv4, (void_fn_t)subnet_vectors_allocator);
logger << log4cpp::Priority::INFO << "We start total zerofication of counters";
zeroify_all_counters();
logger << log4cpp::Priority::INFO << "We finished zerofication";
logger << log4cpp::Priority::INFO << "We loaded " << networks_list_ipv4_as_string.size()
<< " IPv4 subnets to our in-memory list of networks";
2014-06-09 16:28:56 +02:00
return true;
}
2015-08-10 17:29:53 +02:00
#ifdef IPV6_HASH_COUNTERS
moodycamel::ConcurrentQueue<simple_packet_t> multi_process_queue_for_ipv6_counters;
2015-08-10 17:29:53 +02:00
void ipv6_traffic_processor() {
simple_packet_t packets_from_queue[32];
2015-08-10 17:29:53 +02:00
while (true) {
std::size_t count = 0;
while ((count = multi_process_queue_for_ipv6_counters.try_dequeue_bulk(packets_from_queue, 32)) != 0) {
for (std::size_t i = 0; i != count; ++i) {
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&total_ipv6_packets, 1, __ATOMIC_RELAXED);
#else
2015-08-10 17:29:53 +02:00
__sync_fetch_and_add(&total_ipv6_packets, 1);
#endif
2015-08-10 17:29:53 +02:00
direction packet_direction = packets_from_queue[i].packet_direction;
uint64_t sampled_number_of_packets =
packets_from_queue[i].number_of_packets * packets_from_queue[i].sample_ratio;
uint64_t sampled_number_of_bytes =
packets_from_queue[i].length * packets_from_queue[i].sample_ratio;
2015-08-10 17:29:53 +02:00
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&total_counters[packet_direction].packets,
sampled_number_of_packets, __ATOMIC_RELAXED);
__atomic_add_fetch(&total_counters[packet_direction].bytes, sampled_number_of_bytes, __ATOMIC_RELAXED);
#else
2015-08-10 17:29:53 +02:00
__sync_fetch_and_add(&total_counters[packet_direction].packets, sampled_number_of_packets);
__sync_fetch_and_add(&total_counters[packet_direction].bytes, sampled_number_of_bytes);
#endif
2015-08-10 17:29:53 +02:00
if (packet_direction != OTHER) {
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&our_ipv6_packets, 1, __ATOMIC_RELAXED);
#else
2015-08-10 17:29:53 +02:00
__sync_fetch_and_add(&our_ipv6_packets, 1);
#endif
}
2015-08-10 17:29:53 +02:00
}
}
}
}
#endif
2014-11-15 01:10:04 +01:00
/* Process simple unified packet */
void process_packet(simple_packet_t& current_packet) {
2014-06-20 17:18:27 +02:00
// Packets dump is very useful for bug hunting
if (DEBUG_DUMP_ALL_PACKETS) {
logger << log4cpp::Priority::INFO << "Dump: " << print_simple_packet(current_packet);
2014-06-20 17:18:27 +02:00
}
2013-10-18 15:28:00 +02:00
if (current_packet.ip_protocol_version == 6) {
2015-08-10 17:29:53 +02:00
#ifdef IPV6_HASH_COUNTERS
current_packet.packet_direction =
get_packet_direction_ipv6(lookup_tree_ipv6, current_packet.src_ipv6, current_packet.dst_ipv6);
2015-08-10 17:29:53 +02:00
// TODO: move to bulk operations here!
multi_process_queue_for_ipv6_counters.enqueue(current_packet);
#else
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&total_ipv6_packets, 1, __ATOMIC_RELAXED);
#else
2015-08-10 17:29:53 +02:00
__sync_fetch_and_add(&total_ipv6_packets, 1);
#endif
2015-08-10 17:29:53 +02:00
#endif
2015-08-10 17:29:53 +02:00
return;
}
// We do not process IPv6 at all on this mement
if (current_packet.ip_protocol_version != 4) {
return;
}
// Subnet for found IPs
unsigned long subnet = 0;
unsigned int subnet_cidr_mask = 0;
direction packet_direction = get_packet_direction(lookup_tree_ipv4, current_packet.src_ip,
current_packet.dst_ip, subnet, subnet_cidr_mask);
2015-09-29 17:00:02 +02:00
// It's useful in case when we can't find what packets do not processed correctly
if (DEBUG_DUMP_OTHER_PACKETS && packet_direction == OTHER) {
logger << log4cpp::Priority::INFO << "Dump other: " << print_simple_packet(current_packet);
}
2015-09-29 17:00:02 +02:00
// Skip processing of specific traffic direction
if ((packet_direction == INCOMING && !process_incoming_traffic) or
(packet_direction == OUTGOING && !process_outgoing_traffic)) {
return;
}
subnet_t current_subnet = std::make_pair(subnet, subnet_cidr_mask);
uint32_t subnet_in_host_byte_order = 0;
// We operate in host bytes order and need to convert subnet
if (subnet != 0) {
subnet_in_host_byte_order = ntohl(current_subnet.first);
}
// Try to find map key for this subnet
map_of_vector_counters::iterator itr;
// Iterator for subnet counter
subnet_counter_t* subnet_counter = NULL;
if (packet_direction == OUTGOING or packet_direction == INCOMING) {
// Find element in map of vectors
itr = SubnetVectorMap.find(current_subnet);
if (itr == SubnetVectorMap.end()) {
logger << log4cpp::Priority::ERROR << "Can't find vector address in subnet map";
return;
}
if (enable_subnet_counters) {
map_for_subnet_counters::iterator subnet_iterator;
// Find element in map of subnet counters
subnet_iterator = PerSubnetCountersMap.find(current_subnet);
if (subnet_iterator == PerSubnetCountersMap.end()) {
logger << log4cpp::Priority::ERROR << "Can't find counter structure for subnet";
return;
}
subnet_counter = &subnet_iterator->second;
}
}
2013-10-21 21:45:33 +02:00
map_of_vector_counters_for_flow::iterator itr_flow;
if (enable_conection_tracking) {
if (packet_direction == OUTGOING or packet_direction == INCOMING) {
itr_flow = SubnetVectorMapFlow.find(current_subnet);
if (itr_flow == SubnetVectorMapFlow.end()) {
logger << log4cpp::Priority::ERROR << "Can't find vector address in subnet flow map";
return;
}
}
}
/* Because we support mirroring, sflow and netflow we should support different cases:
- One packet passed for processing (mirror)
- Multiple packets ("flows") passed for processing (netflow)
- One sampled packed passed for processing (netflow)
- Another combinations of this three options
*/
uint64_t sampled_number_of_packets = current_packet.number_of_packets * current_packet.sample_ratio;
uint64_t sampled_number_of_bytes = current_packet.length * current_packet.sample_ratio;
2014-12-02 10:30:20 +01:00
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&total_counters[packet_direction].packets, sampled_number_of_packets, __ATOMIC_RELAXED);
__atomic_add_fetch(&total_counters[packet_direction].bytes, sampled_number_of_bytes, __ATOMIC_RELAXED);
#else
__sync_fetch_and_add(&total_counters[packet_direction].packets, sampled_number_of_packets);
__sync_fetch_and_add(&total_counters[packet_direction].bytes, sampled_number_of_bytes);
#endif
// Incerement main and per protocol packet counters
if (packet_direction == OUTGOING or (process_internal_traffic_as_external && packet_direction == INTERNAL)) {
int64_t shift_in_vector = (int64_t)ntohl(current_packet.src_ip) - (int64_t)subnet_in_host_byte_order;
if (shift_in_vector < 0 or shift_in_vector >= itr->second.size()) {
logger << log4cpp::Priority::ERROR << "We tried to access to element with index " << shift_in_vector
<< " which located outside allocated vector with size " << itr->second.size();
logger << log4cpp::Priority::ERROR << "We expect issues with this packet in OUTGOING direction: "
<< print_simple_packet(current_packet);
return;
}
map_element* current_element = &itr->second[shift_in_vector];
2014-12-19 16:55:43 +01:00
// Main packet/bytes counter
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&current_element->out_packets, sampled_number_of_packets, __ATOMIC_RELAXED);
__atomic_add_fetch(&current_element->out_bytes, sampled_number_of_bytes, __ATOMIC_RELAXED);
#else
__sync_fetch_and_add(&current_element->out_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->out_bytes, sampled_number_of_bytes);
#endif
// Fragmented IP packets
2015-05-08 09:54:39 +02:00
if (current_packet.ip_fragmented) {
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&current_element->fragmented_out_packets, sampled_number_of_packets, __ATOMIC_RELAXED);
__atomic_add_fetch(&current_element->fragmented_out_bytes, sampled_number_of_bytes, __ATOMIC_RELAXED);
#else
2015-05-08 09:54:39 +02:00
__sync_fetch_and_add(&current_element->fragmented_out_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->fragmented_out_bytes, sampled_number_of_bytes);
#endif
2015-05-08 09:54:39 +02:00
}
// TODO: add another counters
if (enable_subnet_counters) {
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&subnet_counter->out_packets, sampled_number_of_packets, __ATOMIC_RELAXED);
__atomic_add_fetch(&subnet_counter->out_bytes, sampled_number_of_bytes, __ATOMIC_RELAXED);
#else
__sync_fetch_and_add(&subnet_counter->out_packets, sampled_number_of_packets);
__sync_fetch_and_add(&subnet_counter->out_bytes, sampled_number_of_bytes);
#endif
}
conntrack_main_struct* current_element_flow = NULL;
if (enable_conection_tracking) {
current_element_flow = &itr_flow->second[shift_in_vector];
}
2014-06-28 12:12:56 +02:00
// Collect data when ban client
if (!ban_list_details.empty() && ban_list_details.count(current_packet.src_ip) > 0 &&
ban_list_details[current_packet.src_ip].size() < ban_details_records_count) {
ban_list_details_mutex.lock();
if (collect_attack_pcap_dumps) {
// this code SHOULD NOT be called without mutex!
if (current_packet.packet_payload_length > 0 && current_packet.packet_payload_pointer != NULL) {
ban_list[current_packet.src_ip].pcap_attack_dump.write_packet(current_packet.packet_payload_pointer,
current_packet.packet_payload_length);
}
}
ban_list_details[current_packet.src_ip].push_back(current_packet);
ban_list_details_mutex.unlock();
}
uint64_t connection_tracking_hash = 0;
2013-10-18 15:28:00 +02:00
if (enable_conection_tracking) {
packed_conntrack_hash flow_tracking_structure;
flow_tracking_structure.opposite_ip = current_packet.dst_ip;
flow_tracking_structure.src_port = current_packet.source_port;
flow_tracking_structure.dst_port = current_packet.destination_port;
2014-11-13 16:01:15 +01:00
// convert this struct to 64 bit integer
connection_tracking_hash = convert_conntrack_hash_struct_to_integer(&flow_tracking_structure);
}
2014-11-13 16:01:15 +01:00
if (current_packet.protocol == IPPROTO_TCP) {
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&current_element->tcp_out_packets, sampled_number_of_packets, __ATOMIC_RELAXED);
__atomic_add_fetch(&current_element->tcp_out_bytes, sampled_number_of_bytes, __ATOMIC_RELAXED);
#else
__sync_fetch_and_add(&current_element->tcp_out_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->tcp_out_bytes, sampled_number_of_bytes);
#endif
if (extract_bit_value(current_packet.flags, TCP_SYN_FLAG_SHIFT)) {
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&current_element->tcp_syn_out_packets, sampled_number_of_packets, __ATOMIC_RELAXED);
__atomic_add_fetch(&current_element->tcp_syn_out_bytes, sampled_number_of_bytes, __ATOMIC_RELAXED);
#else
__sync_fetch_and_add(&current_element->tcp_syn_out_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->tcp_syn_out_bytes, sampled_number_of_bytes);
#endif
}
if (enable_conection_tracking) {
flow_counter.lock();
conntrack_key_struct* conntrack_key_struct_ptr =
&current_element_flow->out_tcp[connection_tracking_hash];
conntrack_key_struct_ptr->packets += sampled_number_of_packets;
conntrack_key_struct_ptr->bytes += sampled_number_of_bytes;
flow_counter.unlock();
}
} else if (current_packet.protocol == IPPROTO_UDP) {
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&current_element->udp_out_packets, sampled_number_of_packets, __ATOMIC_RELAXED);
__atomic_add_fetch(&current_element->udp_out_bytes, sampled_number_of_bytes, __ATOMIC_RELAXED);
#else
__sync_fetch_and_add(&current_element->udp_out_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->udp_out_bytes, sampled_number_of_bytes);
#endif
2014-11-13 16:01:15 +01:00
if (enable_conection_tracking) {
flow_counter.lock();
conntrack_key_struct* conntrack_key_struct_ptr =
&current_element_flow->out_udp[connection_tracking_hash];
conntrack_key_struct_ptr->packets += sampled_number_of_packets;
conntrack_key_struct_ptr->bytes += sampled_number_of_bytes;
flow_counter.unlock();
}
} else if (current_packet.protocol == IPPROTO_ICMP) {
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&current_element->icmp_out_packets, sampled_number_of_packets, __ATOMIC_RELAXED);
__atomic_add_fetch(&current_element->icmp_out_bytes, sampled_number_of_bytes, __ATOMIC_RELAXED);
#else
__sync_fetch_and_add(&current_element->icmp_out_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->icmp_out_bytes, sampled_number_of_bytes);
#endif
2014-12-19 16:55:43 +01:00
// no flow tracking for icmp
} else {
}
} else if (packet_direction == INCOMING or (process_internal_traffic_as_external && packet_direction == INTERNAL)) {
int64_t shift_in_vector = (int64_t)ntohl(current_packet.dst_ip) - (int64_t)subnet_in_host_byte_order;
if (shift_in_vector < 0 or shift_in_vector >= itr->second.size()) {
logger << log4cpp::Priority::ERROR << "We tried to access to element with index " << shift_in_vector
<< " which located outside allocated vector with size " << itr->second.size();
logger << log4cpp::Priority::ERROR << "We expect issues with this packet in INCOMING direction: "
<< print_simple_packet(current_packet);
return;
}
map_element* current_element = &itr->second[shift_in_vector];
// Main packet/bytes counter
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&current_element->in_packets, sampled_number_of_packets, __ATOMIC_RELAXED);
__atomic_add_fetch(&current_element->in_bytes, sampled_number_of_bytes, __ATOMIC_RELAXED);
#else
__sync_fetch_and_add(&current_element->in_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->in_bytes, sampled_number_of_bytes);
#endif
if (enable_subnet_counters) {
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&subnet_counter->in_packets, sampled_number_of_packets, __ATOMIC_RELAXED);
__atomic_add_fetch(&subnet_counter->in_bytes, sampled_number_of_bytes, __ATOMIC_RELAXED);
#else
__sync_fetch_and_add(&subnet_counter->in_packets, sampled_number_of_packets);
__sync_fetch_and_add(&subnet_counter->in_bytes, sampled_number_of_bytes);
#endif
}
// Count fragmented IP packets
2015-05-08 09:54:39 +02:00
if (current_packet.ip_fragmented) {
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&current_element->fragmented_in_packets, sampled_number_of_packets, __ATOMIC_RELAXED);
__atomic_add_fetch(&current_element->fragmented_in_bytes, sampled_number_of_bytes, __ATOMIC_RELAXED);
#else
2015-05-08 09:54:39 +02:00
__sync_fetch_and_add(&current_element->fragmented_in_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->fragmented_in_bytes, sampled_number_of_bytes);
#endif
2015-05-08 09:54:39 +02:00
}
conntrack_main_struct* current_element_flow = NULL;
if (enable_conection_tracking) {
current_element_flow = &itr_flow->second[shift_in_vector];
}
uint64_t connection_tracking_hash = 0;
if (enable_conection_tracking) {
packed_conntrack_hash flow_tracking_structure;
flow_tracking_structure.opposite_ip = current_packet.src_ip;
flow_tracking_structure.src_port = current_packet.source_port;
flow_tracking_structure.dst_port = current_packet.destination_port;
// convert this struct to 64 bit integer
connection_tracking_hash = convert_conntrack_hash_struct_to_integer(&flow_tracking_structure);
}
2013-10-18 15:28:00 +02:00
// Collect attack details
if (!ban_list_details.empty() && ban_list_details.count(current_packet.dst_ip) > 0 &&
ban_list_details[current_packet.dst_ip].size() < ban_details_records_count) {
ban_list_details_mutex.lock();
if (collect_attack_pcap_dumps) {
// this code SHOULD NOT be called without mutex!
if (current_packet.packet_payload_length > 0 && current_packet.packet_payload_pointer != NULL) {
ban_list[current_packet.dst_ip].pcap_attack_dump.write_packet(current_packet.packet_payload_pointer,
current_packet.packet_payload_length);
}
}
ban_list_details[current_packet.dst_ip].push_back(current_packet);
ban_list_details_mutex.unlock();
}
if (current_packet.protocol == IPPROTO_TCP) {
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&current_element->tcp_in_packets, sampled_number_of_packets, __ATOMIC_RELAXED);
__atomic_add_fetch(&current_element->tcp_in_bytes, sampled_number_of_bytes, __ATOMIC_RELAXED);
#else
__sync_fetch_and_add(&current_element->tcp_in_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->tcp_in_bytes, sampled_number_of_bytes);
#endif
if (extract_bit_value(current_packet.flags, TCP_SYN_FLAG_SHIFT)) {
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&current_element->tcp_syn_in_packets, sampled_number_of_packets, __ATOMIC_RELAXED);
__atomic_add_fetch(&current_element->tcp_syn_in_bytes, sampled_number_of_bytes, __ATOMIC_RELAXED);
#else
__sync_fetch_and_add(&current_element->tcp_syn_in_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->tcp_syn_in_bytes, sampled_number_of_bytes);
#endif
}
if (enable_conection_tracking) {
flow_counter.lock();
conntrack_key_struct* conntrack_key_struct_ptr =
&current_element_flow->in_tcp[connection_tracking_hash];
conntrack_key_struct_ptr->packets += sampled_number_of_packets;
conntrack_key_struct_ptr->bytes += sampled_number_of_bytes;
flow_counter.unlock();
}
} else if (current_packet.protocol == IPPROTO_UDP) {
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&current_element->udp_in_packets, sampled_number_of_packets, __ATOMIC_RELAXED);
__atomic_add_fetch(&current_element->udp_in_bytes, sampled_number_of_bytes, __ATOMIC_RELAXED);
#else
__sync_fetch_and_add(&current_element->udp_in_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->udp_in_bytes, sampled_number_of_bytes);
#endif
if (enable_conection_tracking) {
flow_counter.lock();
conntrack_key_struct* conntrack_key_struct_ptr =
&current_element_flow->in_udp[connection_tracking_hash];
2014-12-05 14:09:25 +01:00
conntrack_key_struct_ptr->packets += sampled_number_of_packets;
conntrack_key_struct_ptr->bytes += sampled_number_of_bytes;
flow_counter.unlock();
}
} else if (current_packet.protocol == IPPROTO_ICMP) {
#ifdef USE_NEW_ATOMIC_BUILTINS
__atomic_add_fetch(&current_element->icmp_in_packets, sampled_number_of_packets, __ATOMIC_RELAXED);
__atomic_add_fetch(&current_element->icmp_in_bytes, sampled_number_of_bytes, __ATOMIC_RELAXED);
#else
__sync_fetch_and_add(&current_element->icmp_in_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->icmp_in_bytes, sampled_number_of_bytes);
#endif
// no flow tracking for icmp
} else {
// TBD
}
} else if (packet_direction == INTERNAL) {
2013-10-18 12:16:55 +02:00
}
}
2013-10-18 12:16:55 +02:00
2013-12-28 20:11:20 +01:00
#ifdef GEOIP
unsigned int get_asn_for_ip(uint32_t ip) {
char* asn_raw = GeoIP_org_by_name(geo_ip, convert_ip_as_uint_to_string(remote_ip).c_str());
uint32_t asn_number = 0;
if (asn_raw == NULL) {
asn_number = 0;
} else {
// split string: AS1299 TeliaSonera International Carrier
2015-01-27 20:29:51 +01:00
std::vector<std::string> asn_as_string;
split(asn_as_string, asn_raw, boost::is_any_of(" "), boost::token_compress_on);
2013-12-28 20:11:20 +01:00
// free up original string
free(asn_raw);
2013-12-28 20:11:20 +01:00
// extract raw number
asn_number = convert_string_to_integer(asn_as_string[0].substr(2));
2013-12-28 20:11:20 +01:00
}
return asn_number;
2013-10-21 16:47:31 +02:00
}
#endif
2013-10-21 16:47:31 +02:00
2015-06-15 14:50:30 +02:00
// It's vizualization thread :)
void screen_draw_thread() {
// we need wait one second for calculating speed by recalculate_speed
//#include <sys/prctl.h>
// prctl(PR_SET_NAME , "fastnetmon calc thread", 0, 0, 0);
// Sleep for a half second for shift against calculatiuon thread
boost::this_thread::sleep(boost::posix_time::milliseconds(500));
while (true) {
// Available only from boost 1.54: boost::this_thread::sleep_for(
// boost::chrono::seconds(check_period) );
boost::this_thread::sleep(boost::posix_time::seconds(check_period));
2017-05-08 16:21:52 +02:00
traffic_draw_program();
2013-10-21 21:45:33 +02:00
}
}
void recalculate_speed_thread_handler() {
while (true) {
// recalculate data every one second
// Available only from boost 1.54: boost::this_thread::sleep_for( boost::chrono::seconds(1)
// );
boost::this_thread::sleep(boost::posix_time::seconds(recalculate_speed_timeout));
recalculate_speed();
}
}
// Get ban settings for this subnet or return global ban settings
ban_settings_t get_ban_settings_for_this_subnet(subnet_t subnet, std::string& host_group_name) {
// Try to find host group for this subnet
subnet_to_host_group_map_t::iterator host_group_itr = subnet_to_host_groups.find(subnet);
if (host_group_itr == subnet_to_host_groups.end()) {
// We haven't host groups for all subnets, it's OK
// logger << log4cpp::Priority::INFO << "We haven't custom host groups for this network. We will use global ban settings";
host_group_name = "global";
return global_ban_settings;
}
host_group_name = host_group_itr->second;
// We found host group for this subnet
host_group_ban_settings_map_t::iterator hostgroup_settings_itr =
host_group_ban_settings_map.find(host_group_itr->second);
if (hostgroup_settings_itr == host_group_ban_settings_map.end()) {
logger << log4cpp::Priority::ERROR << "We can't find ban settings for host group "
<< host_group_itr->second;
return global_ban_settings;
}
// We found ban settings for this host group and use they instead global
return hostgroup_settings_itr->second;
}
2014-11-15 01:10:04 +01:00
/* Calculate speed for all connnections */
void recalculate_speed() {
// logger<< log4cpp::Priority::INFO<<"We run recalculate_speed";
struct timeval start_calc_time;
gettimeofday(&start_calc_time, NULL);
double speed_calc_period = recalculate_speed_timeout;
time_t start_time;
time(&start_time);
2014-12-05 14:31:55 +01:00
// If we got 1+ seconds lag we should use new "delta" or skip this step
double time_difference = difftime(start_time, last_call_of_traffic_recalculation);
if (time_difference < 0) {
// It may happen when you adjust time
logger << log4cpp::Priority::ERROR << "Negative delay for traffic calculation " << time_difference << " Skipped iteration";
return;
} else if (time_difference < recalculate_speed_timeout) {
// It could occur on toolkit start or in some weird cases of Linux scheduler
// I really saw cases when sleep executed in zero zeconds:
// [WARN] Sleep time expected: 1. Sleep time experienced: 0
// But we have handlers for such case and should not bother client about with it
// And we are using DEBUG level here
logger << log4cpp::Priority::DEBUG
<< "We skip one iteration of speed_calc because it runs so early! That's "
"really impossible! Please ask support.";
logger << log4cpp::Priority::DEBUG << "Sleep time expected: " << recalculate_speed_timeout
<< ". Sleep time experienced: " << time_difference;
return;
} else if (int(time_difference) == int(speed_calc_period)) {
2014-11-15 01:10:04 +01:00
// All fine, we run on time
} else {
// logger << log4cpp::Priority::INFO << "Time from last run of speed_recalc is soooo big, we got ugly lags: " <<
// time_difference << " seconds";
speed_calc_period = time_difference;
}
map_element zero_map_element;
memset(&zero_map_element, 0, sizeof(zero_map_element));
uint64_t incoming_total_flows = 0;
uint64_t outgoing_total_flows = 0;
if (enable_subnet_counters) {
for (map_for_subnet_counters::iterator itr = PerSubnetSpeedMap.begin();
itr != PerSubnetSpeedMap.end(); ++itr) {
2015-05-21 18:34:17 +02:00
subnet_t current_subnet = itr->first;
map_for_subnet_counters::iterator iter_subnet = PerSubnetCountersMap.find(current_subnet);
if (iter_subnet == PerSubnetCountersMap.end()) {
logger << log4cpp::Priority::INFO << "Can't find traffic counters for subnet";
break;
}
subnet_counter_t* subnet_traffic = &iter_subnet->second;
subnet_counter_t new_speed_element;
new_speed_element.in_packets = uint64_t((double)subnet_traffic->in_packets / speed_calc_period);
new_speed_element.in_bytes = uint64_t((double)subnet_traffic->in_bytes / speed_calc_period);
new_speed_element.out_packets = uint64_t((double)subnet_traffic->out_packets / speed_calc_period);
new_speed_element.out_bytes = uint64_t((double)subnet_traffic->out_bytes / speed_calc_period);
/* Moving average recalculation for subnets */
/* http://en.wikipedia.org/wiki/Moving_average#Application_to_measuring_computer_performance */
double exp_power_subnet = -speed_calc_period / average_calculation_amount_for_subnets;
double exp_value_subnet = exp(exp_power_subnet);
map_element* current_average_speed_element = &PerSubnetAverageSpeedMap[current_subnet];
current_average_speed_element->in_bytes = uint64_t(
new_speed_element.in_bytes + exp_value_subnet * ((double)current_average_speed_element->in_bytes -
(double)new_speed_element.in_bytes));
current_average_speed_element->out_bytes = uint64_t(
new_speed_element.out_bytes + exp_value_subnet * ((double)current_average_speed_element->out_bytes -
(double)new_speed_element.out_bytes));
current_average_speed_element->in_packets = uint64_t(
new_speed_element.in_packets + exp_value_subnet * ((double)current_average_speed_element->in_packets -
(double)new_speed_element.in_packets));
current_average_speed_element->out_packets =
uint64_t(new_speed_element.out_packets +
exp_value_subnet * ((double)current_average_speed_element->out_packets -
(double)new_speed_element.out_packets));
// Update speed calculation structure
PerSubnetSpeedMap[current_subnet] = new_speed_element;
*subnet_traffic = zero_map_element;
// logger << log4cpp::Priority::INFO<<convert_subnet_to_string(current_subnet)
// << "in pps: " << new_speed_element.in_packets << " out pps: " << new_speed_element.out_packets;
}
}
for (map_of_vector_counters::iterator itr = SubnetVectorMap.begin(); itr != SubnetVectorMap.end(); ++itr) {
for (vector_of_counters::iterator vector_itr = itr->second.begin();
vector_itr != itr->second.end(); ++vector_itr) {
int current_index = vector_itr - itr->second.begin();
2014-12-05 14:47:57 +01:00
// New element
map_element new_speed_element;
// convert to host order for math operations
uint32_t subnet_ip = ntohl(itr->first.first);
uint32_t client_ip_in_host_bytes_order = subnet_ip + current_index;
// covnert to our standard network byte order
uint32_t client_ip = htonl(client_ip_in_host_bytes_order);
// Calculate speed for IP or whole subnet
build_speed_counters_from_packet_counters(new_speed_element, &*vector_itr, speed_calc_period);
2014-12-05 15:34:59 +01:00
conntrack_main_struct* flow_counter_ptr = &SubnetVectorMapFlow[itr->first][current_index];
if (enable_conection_tracking) {
// todo: optimize this operations!
// it's really bad and SLOW CODE
uint64_t total_out_flows = (uint64_t)flow_counter_ptr->out_tcp.size() +
(uint64_t)flow_counter_ptr->out_udp.size() +
(uint64_t)flow_counter_ptr->out_icmp.size() +
(uint64_t)flow_counter_ptr->out_other.size();
uint64_t total_in_flows =
(uint64_t)flow_counter_ptr->in_tcp.size() + (uint64_t)flow_counter_ptr->in_udp.size() +
(uint64_t)flow_counter_ptr->in_icmp.size() + (uint64_t)flow_counter_ptr->in_other.size();
new_speed_element.out_flows = uint64_t((double)total_out_flows / speed_calc_period);
new_speed_element.in_flows = uint64_t((double)total_in_flows / speed_calc_period);
// Increment global counter
outgoing_total_flows += new_speed_element.out_flows;
incoming_total_flows += new_speed_element.in_flows;
} else {
new_speed_element.out_flows = 0;
new_speed_element.in_flows = 0;
}
/* Moving average recalculation */
// http://en.wikipedia.org/wiki/Moving_average#Application_to_measuring_computer_performance
// double speed_calc_period = 1;
double exp_power = -speed_calc_period / average_calculation_amount;
double exp_value = exp(exp_power);
map_element* current_average_speed_element = &SubnetVectorMapSpeedAverage[itr->first][current_index];
// Calculate average speed from per-second speed
build_average_speed_counters_from_speed_counters(current_average_speed_element,
new_speed_element, exp_value, exp_power);
if (enable_conection_tracking) {
current_average_speed_element->out_flows = uint64_t(
new_speed_element.out_flows + exp_value * ((double)current_average_speed_element->out_flows -
(double)new_speed_element.out_flows));
current_average_speed_element->in_flows = uint64_t(
new_speed_element.in_flows + exp_value * ((double)current_average_speed_element->in_flows -
(double)new_speed_element.in_flows));
}
2014-12-02 16:15:26 +01:00
2014-12-02 16:34:49 +01:00
/* Moving average recalculation end */
std::string host_group_name;
ban_settings_t current_ban_settings = get_ban_settings_for_this_subnet(itr->first, host_group_name);
if (we_should_ban_this_ip(current_average_speed_element, current_ban_settings)) {
logger << log4cpp::Priority::DEBUG
<< "We have found host group for this host as: " << host_group_name;
2016-03-23 19:58:22 +01:00
2015-01-27 20:29:51 +01:00
std::string flow_attack_details = "";
if (enable_conection_tracking) {
flow_attack_details =
print_flow_tracking_for_ip(*flow_counter_ptr, convert_ip_as_uint_to_string(client_ip));
}
// TODO: we should pass type of ddos ban source (pps, flowd, bandwidth)!
execute_ip_ban(client_ip, *current_average_speed_element, flow_attack_details, itr->first);
2014-11-13 09:01:52 +01:00
}
SubnetVectorMapSpeed[itr->first][current_index] = new_speed_element;
*vector_itr = zero_map_element;
}
}
// Calculate global flow speed
incoming_total_flows_speed = uint64_t((double)incoming_total_flows / (double)speed_calc_period);
outgoing_total_flows_speed = uint64_t((double)outgoing_total_flows / (double)speed_calc_period);
if (enable_conection_tracking) {
// Clean Flow Counter
flow_counter.lock();
zeroify_all_flow_counters();
flow_counter.unlock();
}
2014-10-22 04:29:55 +02:00
total_unparsed_packets_speed = uint64_t((double)total_unparsed_packets / (double)speed_calc_period);
total_unparsed_packets = 0;
for (unsigned int index = 0; index < 4; index++) {
total_speed_counters[index].bytes =
uint64_t((double)total_counters[index].bytes / (double)speed_calc_period);
total_speed_counters[index].packets =
uint64_t((double)total_counters[index].packets / (double)speed_calc_period);
double exp_power = -speed_calc_period / average_calculation_amount;
double exp_value = exp(exp_power);
total_speed_average_counters[index].bytes = uint64_t(
total_speed_counters[index].bytes + exp_value * ((double)total_speed_average_counters[index].bytes -
(double)total_speed_counters[index].bytes));
total_speed_average_counters[index].packets =
uint64_t(total_speed_counters[index].packets +
exp_value * ((double)total_speed_average_counters[index].packets -
(double)total_speed_counters[index].packets));
// nullify data counters after speed calculation
total_counters[index].bytes = 0;
total_counters[index].packets = 0;
}
// Set time of previous startup
time(&last_call_of_traffic_recalculation);
struct timeval finish_calc_time;
gettimeofday(&finish_calc_time, NULL);
timeval_subtract(&speed_calculation_time, &finish_calc_time, &start_calc_time);
}
2014-06-09 14:47:11 +02:00
2015-01-27 20:29:51 +01:00
void print_screen_contents_into_file(std::string screen_data_stats_param) {
std::ofstream screen_data_file;
screen_data_file.open(cli_stats_file_path.c_str(), std::ios::trunc);
if (screen_data_file.is_open()) {
// Set 660 permissions to file for security reasons
chmod(cli_stats_file_path.c_str(), S_IRUSR | S_IWUSR | S_IRGRP | S_IWGRP | S_IROTH);
screen_data_file << screen_data_stats_param;
screen_data_file.close();
} else {
2017-05-08 16:21:52 +02:00
logger << log4cpp::Priority::ERROR << "Can't print program screen into file";
}
}
2017-05-08 16:21:52 +02:00
void traffic_draw_program() {
2015-01-27 20:29:51 +01:00
std::stringstream output_buffer;
// logger<<log4cpp::Priority::INFO<<"Draw table call";
struct timeval start_calc_time;
gettimeofday(&start_calc_time, NULL);
2013-10-21 21:45:33 +02:00
sort_type sorter;
if (sort_parameter == "packets") {
sorter = PACKETS;
} else if (sort_parameter == "bytes") {
sorter = BYTES;
} else if (sort_parameter == "flows") {
sorter = FLOWS;
} else {
logger << log4cpp::Priority::INFO << "Unexpected sorter type: " << sort_parameter;
sorter = PACKETS;
}
2013-10-21 15:43:00 +02:00
2020-08-02 17:15:30 +02:00
output_buffer << "FastNetMon " << fastnetmon_version << " Try Advanced edition: https://fastnetmon.com"
<< "\n"
<< "IPs ordered by: " << sort_parameter << "\n";
output_buffer << print_channel_speed("Incoming traffic", INCOMING) << std::endl;
if (process_incoming_traffic) {
output_buffer << draw_table(INCOMING, true, sorter);
output_buffer << std::endl;
}
2013-10-18 12:16:55 +02:00
output_buffer << print_channel_speed("Outgoing traffic", OUTGOING) << std::endl;
2013-10-18 12:16:55 +02:00
if (process_outgoing_traffic) {
output_buffer << draw_table(OUTGOING, false, sorter);
output_buffer << std::endl;
}
2013-10-18 12:16:55 +02:00
output_buffer << print_channel_speed("Internal traffic", INTERNAL) << std::endl;
2013-10-18 12:16:55 +02:00
output_buffer << std::endl;
2013-10-18 12:16:55 +02:00
output_buffer << print_channel_speed("Other traffic", OTHER) << std::endl;
2013-10-18 12:16:55 +02:00
output_buffer << std::endl;
2013-12-28 20:36:22 +01:00
// Application statistics
output_buffer << "Screen updated in:\t\t" << drawing_thread_execution_time.tv_sec << " sec "
<< drawing_thread_execution_time.tv_usec << " microseconds\n";
output_buffer << "Traffic calculated in:\t\t" << speed_calculation_time.tv_sec << " sec "
<< speed_calculation_time.tv_usec << " microseconds\n";
if (speed_calculation_time.tv_sec > 0) {
output_buffer
<< "ALERT! Toolkit working incorrectly! We should calculate speed in ~1 second\n";
}
2015-08-10 17:29:53 +02:00
#ifdef IPV6_HASH_COUNTERS
output_buffer << "Total amount of IPv6 packets: " << total_ipv6_packets << "\n";
2015-08-10 17:29:53 +02:00
#endif
output_buffer << "Total amount of IPv6 packets related to our own network: " << our_ipv6_packets << "\n";
output_buffer << "Not processed packets: " << total_unparsed_packets_speed << " pps\n";
2015-06-15 14:54:45 +02:00
// Print backend stats
if (enable_pcap_collection) {
output_buffer << get_pcap_stats() << "\n";
}
2015-06-15 14:54:45 +02:00
#ifdef PF_RING
if (enable_data_collection_from_mirror) {
output_buffer << get_pf_ring_stats();
}
#endif
2014-12-05 09:46:26 +01:00
2014-12-04 17:07:44 +01:00
// Print thresholds
if (print_configuration_params_on_the_screen) {
2015-07-07 17:48:47 +02:00
output_buffer << "\n" << print_ban_thresholds(global_ban_settings);
}
2014-12-04 17:07:44 +01:00
2014-11-15 01:10:04 +01:00
if (!ban_list.empty()) {
output_buffer << std::endl << "Ban list:" << std::endl;
output_buffer << print_ddos_attack_details();
2014-11-15 01:10:04 +01:00
}
if (enable_subnet_counters) {
output_buffer << std::endl << "Subnet load:" << std::endl;
output_buffer << print_subnet_load() << "\n";
}
screen_data_stats = output_buffer.str();
// Print screen contents into file
print_screen_contents_into_file(screen_data_stats);
struct timeval end_calc_time;
gettimeofday(&end_calc_time, NULL);
timeval_subtract(&drawing_thread_execution_time, &end_calc_time, &start_calc_time);
2013-10-18 12:16:55 +02:00
}
// pretty print channel speed in pps and MBit
2015-01-27 20:29:51 +01:00
std::string print_channel_speed(std::string traffic_type, direction packet_direction) {
uint64_t speed_in_pps = total_speed_average_counters[packet_direction].packets;
uint64_t speed_in_bps = total_speed_average_counters[packet_direction].bytes;
unsigned int number_of_tabs = 1;
// We need this for correct alignment of blocks
if (traffic_type == "Other traffic") {
number_of_tabs = 2;
}
std::stringstream stream;
stream << traffic_type;
for (unsigned int i = 0; i < number_of_tabs; i++) {
stream << "\t";
}
uint64_t speed_in_mbps = convert_speed_to_mbps(speed_in_bps);
stream << std::setw(6) << speed_in_pps << " pps " << std::setw(6) << speed_in_mbps << " mbps";
if (traffic_type == "Incoming traffic" or traffic_type == "Outgoing traffic") {
if (packet_direction == INCOMING) {
stream << " " << std::setw(6) << incoming_total_flows_speed << " flows";
} else if (packet_direction == OUTGOING) {
stream << " " << std::setw(6) << outgoing_total_flows_speed << " flows";
}
2015-05-10 20:42:49 +02:00
if (graphite_enabled) {
graphite_data_t graphite_data;
std::string direction_as_string;
if (packet_direction == INCOMING) {
direction_as_string = "incoming";
graphite_data[graphite_prefix + ".total." + direction_as_string + ".flows"] =
incoming_total_flows_speed;
2015-05-10 20:42:49 +02:00
} else if (packet_direction == OUTGOING) {
direction_as_string = "outgoing";
graphite_data[graphite_prefix + ".total." + direction_as_string + ".flows"] =
outgoing_total_flows_speed;
}
graphite_data[graphite_prefix + ".total." + direction_as_string + ".pps"] = speed_in_pps;
graphite_data[graphite_prefix + ".total." + direction_as_string + ".bps"] = speed_in_bps * 8;
2015-05-10 20:42:49 +02:00
bool graphite_put_result = store_data_to_graphite(graphite_port, graphite_host, graphite_data);
if (!graphite_put_result) {
logger << log4cpp::Priority::ERROR << "Can't store data to Graphite";
2015-05-10 20:42:49 +02:00
}
}
}
2015-05-10 20:42:49 +02:00
return stream.str();
}
2013-10-18 12:16:55 +02:00
bool file_is_appendable(std::string path) {
std::ofstream check_appendable_file;
check_appendable_file.open(path.c_str(), std::ios::app);
if (check_appendable_file.is_open()) {
// all fine, just close file
check_appendable_file.close();
return true;
} else {
return false;
}
}
2014-06-24 12:16:22 +02:00
void init_logging() {
// So log4cpp will never notify you if it could not write to log file due to permissions issues
// We will check it manually
if (!file_is_appendable(log_file_path)) {
std::cerr << "Can't open log file " << log_file_path
<< " for writing! Please check file and folder permissions" << std::endl;
exit(EXIT_FAILURE);
}
log4cpp::PatternLayout* layout = new log4cpp::PatternLayout();
layout->setConversionPattern("%d [%p] %m%n");
2014-06-24 12:16:22 +02:00
log4cpp::Appender* appender = new log4cpp::FileAppender("default", log_file_path);
2014-06-24 12:16:22 +02:00
appender->setLayout(layout);
logger.setPriority(log4cpp::Priority::INFO);
logger.addAppender(appender);
logger << log4cpp::Priority::INFO << "Logger initialized!";
2014-06-24 12:16:22 +02:00
}
void reconfigure_logging() {
log4cpp::PatternLayout* layout = new log4cpp::PatternLayout();
layout->setConversionPattern("[%p] %m%n");
if (logging_configuration.local_syslog_logging) {
log4cpp::Appender* local_syslog_appender =
new log4cpp::SyslogAppender("fastnetmon", "fastnetmon", LOG_USER);
local_syslog_appender->setLayout(layout);
logger.addAppender(local_syslog_appender);
logger << log4cpp::Priority::INFO << "We start local syslog logging corectly";
}
if (logging_configuration.remote_syslog_logging) {
log4cpp::Appender* remote_syslog_appender =
new log4cpp::RemoteSyslogAppender("fastnetmon", "fastnetmon", logging_configuration.remote_syslog_server,
LOG_USER, logging_configuration.remote_syslog_port);
remote_syslog_appender->setLayout(layout);
logger.addAppender(remote_syslog_appender);
logger << log4cpp::Priority::INFO << "We start remote syslog logging corectly";
}
}
2015-05-02 21:18:56 +02:00
// Call fork function
int do_fork() {
int status = 0;
switch (fork()) {
case 0:
// It's child
break;
case -1:
/* fork failed */
status = -1;
break;
default:
// We should close master process with _exit(0)
2017-05-08 16:21:52 +02:00
// We should not call exit() because it will destroy all global variables for program
_exit(0);
}
2015-05-02 21:18:56 +02:00
return status;
}
void redirect_fds() {
// Close stdin, stdout and stderr
2015-05-02 21:18:56 +02:00
close(0);
close(1);
close(2);
if (open("/dev/null", O_RDWR) != 0) {
// We can't notify anybody now
exit(1);
}
// Create copy of zero decriptor for 1 and 2 fd's
2015-06-06 17:19:10 +02:00
// We do not need return codes here but we need do it for suppressing complaints from compiler
int first_dup_result = dup(0);
int second_dup_result = dup(0);
2015-05-02 21:18:56 +02:00
}
int main(int argc, char** argv) {
2015-05-02 21:18:56 +02:00
bool daemonize = false;
bool only_configuration_check = false;
2015-05-02 21:18:56 +02:00
namespace po = boost::program_options;
try {
// clang-format off
po::options_description desc("Allowed options");
desc.add_options()
("help", "produce help message")
("version", "show version")
("daemonize", "detach from the terminal")
("configuration_check", "check configuration and exit")
("configuration_file", po::value<std::string>(),"set path to custom configuration file")
("log_file", po::value<std::string>(), "set path to custom log file");
// clang-format on
po::variables_map vm;
po::store(po::parse_command_line(argc, argv, desc), vm);
po::notify(vm);
if (vm.count("help")) {
std::cout << desc << std::endl;
exit(EXIT_SUCCESS);
}
if (vm.count("version")) {
std::cout << "Version: " << fastnetmon_version << std::endl;
exit(EXIT_SUCCESS);
}
if (vm.count("daemonize")) {
2015-05-02 21:18:56 +02:00
daemonize = true;
}
if (vm.count("configuration_check")) {
only_configuration_check = true;
}
if (vm.count("configuration_file")) {
global_config_path = vm["configuration_file"].as<std::string>();
std::cout << "We will use custom path to configuration file: " << global_config_path << std::endl;
}
2016-11-09 16:45:56 +01:00
if (vm.count("log_file")) {
log_file_path = vm["log_file"].as<std::string>();
std::cout << "We will use custom path to log file: " << log_file_path << std::endl;
}
} catch (po::error& e) {
std::cerr << "ERROR: " << e.what() << std::endl << std::endl;
exit(EXIT_FAILURE);
2015-05-02 21:18:56 +02:00
}
// We use ideas from here https://github.com/bmc/daemonize/blob/master/daemon.c
if (daemonize) {
int status = 0;
printf("We will run in daemonized mode\n");
if ((status = do_fork()) < 0) {
2015-05-02 21:18:56 +02:00
// fork failed
status = -1;
} else if (setsid() < 0) {
// Create new session
status = -1;
} else if ((status = do_fork()) < 0) {
status = -1;
} else {
2015-05-02 21:18:56 +02:00
// Clear inherited umask
umask(0);
// Chdir to root
int chdir_result = chdir("/");
2015-05-02 21:18:56 +02:00
// close all descriptors because we are daemon!
redirect_fds();
}
}
2015-05-02 22:53:45 +02:00
// enable core dumps
enable_core_dumps();
init_logging();
#ifdef FASTNETMON_API
gpr_set_log_function(silent_logging_function);
#endif
// Set default ban configuration
2015-07-04 21:29:32 +02:00
init_global_ban_settings();
// We should read configurartion file _after_ logging initialization
bool load_config_result = load_configuration_file();
if (!load_config_result) {
std::cerr << "Can't open config file " << global_config_path << " please create it!" << std::endl;
exit(1);
}
if (only_configuration_check) {
logger << log4cpp::Priority::INFO << "Configuration file is correct. Shutdown toolkit";
exit(0);
}
2015-05-02 22:53:45 +02:00
if (file_exists(pid_path)) {
pid_t pid_from_file = 0;
if (read_pid_from_file(pid_from_file, pid_path)) {
// We could read pid
if (pid_from_file > 0) {
// We use signal zero for check process existence
int kill_result = kill(pid_from_file, 0);
if (kill_result == 0) {
logger << log4cpp::Priority::ERROR
<< "FastNetMon is already running with pid: " << pid_from_file;
2015-05-02 22:53:45 +02:00
exit(1);
} else {
// Yes, we have pid with pid but it's zero
}
2015-05-02 22:53:45 +02:00
} else {
// pid from file is broken, we assume tool is not running
}
} else {
// We can't open file, let's assume it's broken and tool is not running
2015-05-02 22:53:45 +02:00
}
} else {
// no pid file
}
// If we not failed in check steps we could run toolkit
bool print_pid_to_file_result = print_pid_to_file(getpid(), pid_path);
if (!print_pid_to_file_result) {
logger << log4cpp::Priority::ERROR << "Could not create pid file, please check permissions: " << pid_path;
exit(EXIT_FAILURE);
}
2015-05-02 22:53:45 +02:00
#ifdef ENABLE_DPI
init_current_instance_of_ndpi();
#endif
lookup_tree_ipv4 = New_Patricia(32);
whitelist_tree_ipv4 = New_Patricia(32);
lookup_tree_ipv6 = New_Patricia(128);
whitelist_tree_ipv6 = New_Patricia(128);
// nullify total counters
for (int index = 0; index < 4; index++) {
total_counters[index].bytes = 0;
total_counters[index].packets = 0;
total_speed_counters[index].bytes = 0;
total_speed_counters[index].packets = 0;
total_speed_average_counters[index].bytes = 0;
total_speed_average_counters[index].packets = 0;
}
/* Create folder for attack details */
if (!folder_exists(attack_details_folder)) {
int mkdir_result = mkdir(attack_details_folder.c_str(), S_IRWXU);
if (mkdir_result != 0) {
logger << log4cpp::Priority::ERROR << "Can't create folder for attack details: " << attack_details_folder;
exit(1);
}
}
2014-06-20 17:18:27 +02:00
if (getenv("DUMP_ALL_PACKETS") != NULL) {
DEBUG_DUMP_ALL_PACKETS = true;
}
2015-09-29 17:00:02 +02:00
if (getenv("DUMP_OTHER_PACKETS") != NULL) {
DEBUG_DUMP_OTHER_PACKETS = true;
}
2014-11-13 16:01:15 +01:00
if (sizeof(packed_conntrack_hash) != sizeof(uint64_t) or sizeof(packed_conntrack_hash) != 8) {
logger << log4cpp::Priority::INFO << "Assertion about size of packed_conntrack_hash, it's "
<< sizeof(packed_conntrack_hash) << " instead 8";
2014-11-13 16:01:15 +01:00
exit(1);
}
logger << log4cpp::Priority::INFO << "Read configuration file";
2014-06-09 14:47:11 +02:00
// Reconfigure logging. We will enable specific logging methods here
reconfigure_logging();
2014-06-28 12:12:56 +02:00
load_our_networks_list();
2014-11-15 01:10:04 +01:00
// Setup CTRL+C handler
if (signal(SIGINT, interruption_signal_handler) == SIG_ERR) {
logger << log4cpp::Priority::ERROR << "Can't setup SIGINT handler";
exit(1);
}
/* Without this SIGPIPE error could shutdown toolkit on call of exec_with_stdin_params */
if (signal(SIGPIPE, sigpipe_handler_for_popen) == SIG_ERR) {
logger << log4cpp::Priority::ERROR << "Can't setup SIGPIPE handler";
exit(1);
}
2014-06-28 12:12:56 +02:00
2013-12-28 20:11:20 +01:00
#ifdef GEOIP
2014-11-15 01:10:04 +01:00
// Init GeoIP
if (!geoip_init()) {
logger << log4cpp::Priority::ERROR << "Can't load geoip tables";
2013-12-28 20:11:20 +01:00
exit(1);
}
2013-12-28 20:11:20 +01:00
#endif
2014-11-15 01:10:04 +01:00
// Init previous run date
time(&last_call_of_traffic_recalculation);
// We call init for each action
#ifdef ENABLE_GOBGP
if (gobgp_enabled) {
gobgp_action_init();
}
#endif
2015-08-10 17:29:53 +02:00
#ifdef IPV6_HASH_COUNTERS
service_thread_group.add_thread(new boost::thread(ipv6_traffic_processor));
#endif
#ifdef FASTNETMON_API
if (enable_api) {
service_thread_group.add_thread(new boost::thread(RunApiServer));
}
#endif
// Run screen draw thread
service_thread_group.add_thread(new boost::thread(screen_draw_thread));
2014-06-26 11:30:38 +02:00
// start thread for recalculating speed in realtime
service_thread_group.add_thread(new boost::thread(recalculate_speed_thread_handler));
// Run banlist cleaner thread
if (unban_enabled) {
service_thread_group.add_thread(new boost::thread(cleanup_ban_list));
}
2013-10-21 16:47:31 +02:00
#ifdef PF_RING
2014-12-02 13:43:34 +01:00
if (enable_data_collection_from_mirror) {
packet_capture_plugin_thread_group.add_thread(new boost::thread(start_pfring_collection, process_packet));
2014-12-02 13:43:34 +01:00
}
#endif
2015-01-22 16:51:04 +01:00
#ifdef NETMAP_PLUGIN
2015-03-10 15:17:52 +01:00
// netmap processing
if (enable_netmap_collection) {
packet_capture_plugin_thread_group.add_thread(new boost::thread(start_netmap_collection, process_packet));
2015-03-10 15:17:52 +01:00
}
#endif
2015-03-10 15:17:52 +01:00
#ifdef SNABB_SWITCH
if (enable_snabbswitch_collection) {
packet_capture_plugin_thread_group.add_thread(new boost::thread(start_snabbswitch_collection, process_packet));
}
#endif
#ifdef FASTNETMON_ENABLE_AFPACKET
if (enable_afpacket_collection) {
packet_capture_plugin_thread_group.add_thread(new boost::thread(start_afpacket_collection, process_packet));
}
#endif
2014-12-02 13:43:34 +01:00
if (enable_sflow_collection) {
packet_capture_plugin_thread_group.add_thread(new boost::thread(start_sflow_collection, process_packet));
2014-12-02 13:43:34 +01:00
}
if (enable_netflow_collection) {
packet_capture_plugin_thread_group.add_thread(new boost::thread(start_netflow_collection, process_packet));
}
if (enable_pcap_collection) {
packet_capture_plugin_thread_group.add_thread(new boost::thread(start_pcap_collection, process_packet));
2014-12-02 13:43:34 +01:00
}
2014-12-01 22:08:38 +01:00
// Wait for all threads in capture thread group
packet_capture_plugin_thread_group.join_all();
2015-03-10 15:17:52 +01:00
// Wait for all service threads
service_thread_group.join_all();
free_up_all_resources();
return 0;
}
void free_up_all_resources() {
2013-12-28 20:11:20 +01:00
#ifdef GEOIP
// Free up geoip handle
2013-12-28 20:11:20 +01:00
GeoIP_delete(geo_ip);
#endif
Destroy_Patricia(lookup_tree_ipv4, (void_fn_t)0);
Destroy_Patricia(whitelist_tree_ipv4, (void_fn_t)0);
Destroy_Patricia(lookup_tree_ipv6, (void_fn_t)0);
Destroy_Patricia(whitelist_tree_ipv6, (void_fn_t)0);
}
2017-05-08 16:21:52 +02:00
// For correct program shutdown by CTRL+C
void interruption_signal_handler(int signal_number) {
logger << log4cpp::Priority::INFO << "SIGNAL captured, prepare toolkit shutdown";
2013-10-18 12:16:55 +02:00
2015-10-16 11:47:57 +02:00
#ifdef FASTNETMON_API
2015-10-16 11:34:48 +02:00
logger << log4cpp::Priority::INFO << "Send shutdown command to API server";
api_server->Shutdown();
2015-10-16 11:47:57 +02:00
#endif
2015-10-16 11:34:48 +02:00
logger << log4cpp::Priority::INFO << "Interrupt service threads";
service_thread_group.interrupt_all();
2013-10-18 12:16:55 +02:00
logger << log4cpp::Priority::INFO << "Wait while they finished";
service_thread_group.join_all();
2014-03-11 20:48:15 +01:00
logger << log4cpp::Priority::INFO << "Interrupt packet capture treads";
packet_capture_plugin_thread_group.interrupt_all();
logger << log4cpp::Priority::INFO << "Wait while they finished";
packet_capture_plugin_thread_group.join_all();
logger << log4cpp::Priority::INFO << "Shutdown main process";
// TODO: we should REMOVE this exit command and wait for correct toolkit shutdown
exit(1);
2013-10-18 12:16:55 +02:00
}
unsigned int detect_attack_protocol(map_element& speed_element, direction attack_direction) {
if (attack_direction == INCOMING) {
return get_max_used_protocol(speed_element.tcp_in_packets, speed_element.udp_in_packets,
speed_element.icmp_in_packets);
} else {
// OUTGOING
return get_max_used_protocol(speed_element.tcp_out_packets, speed_element.udp_out_packets,
speed_element.icmp_out_packets);
}
}
#define my_max_on_defines(a, b) (a > b ? a : b)
unsigned int get_max_used_protocol(uint64_t tcp, uint64_t udp, uint64_t icmp) {
unsigned int max = my_max_on_defines(my_max_on_defines(udp, tcp), icmp);
if (max == tcp) {
return IPPROTO_TCP;
} else if (max == udp) {
return IPPROTO_UDP;
} else if (max == icmp) {
return IPPROTO_ICMP;
}
return 0;
}
void exabgp_ban_manage(std::string action, std::string ip_as_string, attack_details current_attack) {
// We will announce whole subent here
if (exabgp_announce_whole_subnet) {
std::string subnet_as_string_with_mask = convert_subnet_to_string(current_attack.customer_network);
exabgp_prefix_ban_manage(action, subnet_as_string_with_mask, exabgp_next_hop, exabgp_community_subnet);
}
// And we could announce single host here (/32)
if (exabgp_announce_host) {
std::string ip_as_string_with_mask = ip_as_string + "/32";
exabgp_prefix_ban_manage(action, ip_as_string_with_mask, exabgp_next_hop, exabgp_community_host);
}
}
// Low level ExaBGP ban management
void exabgp_prefix_ban_manage(std::string action,
std::string prefix_as_string_with_mask,
std::string exabgp_next_hop,
std::string exabgp_community) {
/* Buffer for BGP message */
char bgp_message[256];
if (action == "ban") {
sprintf(bgp_message, "announce route %s next-hop %s community %s\n",
prefix_as_string_with_mask.c_str(), exabgp_next_hop.c_str(), exabgp_community.c_str());
} else {
sprintf(bgp_message, "withdraw route %s next-hop %s\n", prefix_as_string_with_mask.c_str(),
exabgp_next_hop.c_str());
}
logger << log4cpp::Priority::INFO << "ExaBGP announce message: " << bgp_message;
int exabgp_pipe = open(exabgp_command_pipe.c_str(), O_WRONLY);
if (exabgp_pipe <= 0) {
logger << log4cpp::Priority::ERROR << "Can't open ExaBGP pipe " << exabgp_command_pipe
<< " Ban is not executed";
return;
}
int wrote_bytes = write(exabgp_pipe, bgp_message, strlen(bgp_message));
if (wrote_bytes != strlen(bgp_message)) {
logger << log4cpp::Priority::ERROR << "Can't write message to ExaBGP pipe";
}
close(exabgp_pipe);
}
bool exabgp_flow_spec_ban_manage(std::string action, std::string flow_spec_rule_as_text) {
std::string announce_action;
if (action == "ban") {
announce_action = "announce";
} else {
announce_action = "withdraw";
}
// Trailing \n is very important!
std::string bgp_message = announce_action + " " + flow_spec_rule_as_text + "\n";
int exabgp_pipe = open(exabgp_command_pipe.c_str(), O_WRONLY);
if (exabgp_pipe <= 0) {
logger << log4cpp::Priority::ERROR << "Can't open ExaBGP pipe for flow spec announce " << exabgp_command_pipe;
return false;
}
int wrote_bytes = write(exabgp_pipe, bgp_message.c_str(), bgp_message.size());
if (wrote_bytes != bgp_message.size()) {
logger << log4cpp::Priority::ERROR << "Can't write message to ExaBGP pipe";
return false;
}
close(exabgp_pipe);
return true;
}
void execute_ip_ban(uint32_t client_ip, map_element average_speed_element, std::string flow_attack_details, subnet_t customer_subnet) {
2014-12-05 16:01:17 +01:00
struct attack_details current_attack;
uint64_t pps = 0;
uint64_t in_pps = average_speed_element.in_packets;
uint64_t out_pps = average_speed_element.out_packets;
uint64_t in_bps = average_speed_element.in_bytes;
uint64_t out_bps = average_speed_element.out_bytes;
uint64_t in_flows = average_speed_element.in_flows;
uint64_t out_flows = average_speed_element.out_flows;
2014-12-05 16:01:17 +01:00
direction data_direction;
2015-07-04 21:29:32 +02:00
if (!global_ban_settings.enable_ban) {
logger << log4cpp::Priority::INFO << "We do not ban: " << convert_ip_as_uint_to_string(client_ip)
<< " because ban disabled completely";
return;
}
// Detect attack direction with simple heuristic
2014-12-05 20:44:24 +01:00
if (abs(int((int)in_pps - (int)out_pps)) < 1000) {
// If difference between pps speed is so small we should do additional investigation using
// bandwidth speed
if (in_bps > out_bps) {
data_direction = INCOMING;
pps = in_pps;
} else {
data_direction = OUTGOING;
pps = out_pps;
}
} else {
if (in_pps > out_pps) {
data_direction = INCOMING;
pps = in_pps;
} else {
data_direction = OUTGOING;
pps = out_pps;
}
}
current_attack.attack_protocol = detect_attack_protocol(average_speed_element, data_direction);
if (ban_list.count(client_ip) > 0) {
if (ban_list[client_ip].attack_direction != data_direction) {
logger << log4cpp::Priority::INFO << "We expected very strange situation: attack direction for "
<< convert_ip_as_uint_to_string(client_ip) << " was changed";
return;
}
// update attack power
if (pps > ban_list[client_ip].max_attack_power) {
ban_list[client_ip].max_attack_power = pps;
}
2014-06-30 16:37:27 +02:00
return;
}
prefix_t prefix_for_check_adreess;
prefix_for_check_adreess.add.sin.s_addr = client_ip;
prefix_for_check_adreess.family = AF_INET;
prefix_for_check_adreess.bitlen = 32;
bool in_white_list = (patricia_search_best2(whitelist_tree_ipv4, &prefix_for_check_adreess, 1) != NULL);
2014-06-30 16:37:27 +02:00
if (in_white_list) {
return;
}
2014-06-30 16:37:27 +02:00
2015-01-27 20:29:51 +01:00
std::string data_direction_as_string = get_direction_name(data_direction);
logger << log4cpp::Priority::INFO << "We run execute_ip_ban code with following params "
<< " in_pps: " << in_pps << " out_pps: " << out_pps << " in_bps: " << in_bps
<< " out_bps: " << out_bps << " and we decide it's " << data_direction_as_string << " attack";
2014-06-26 11:30:38 +02:00
2015-01-27 20:29:51 +01:00
std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);
std::string pps_as_string = convert_int_to_string(pps);
2014-06-26 11:30:38 +02:00
// Store information about subnet
current_attack.customer_network = customer_subnet;
2014-11-15 01:10:04 +01:00
// Store ban time
time(&current_attack.ban_timestamp);
// set ban time in seconds
current_attack.ban_time = global_ban_time;
2015-07-17 13:52:28 +02:00
current_attack.unban_enabled = unban_enabled;
2014-10-20 17:42:14 +02:00
2014-11-15 01:10:04 +01:00
// Pass main information about attack
current_attack.attack_direction = data_direction;
current_attack.attack_power = pps;
current_attack.max_attack_power = pps;
current_attack.in_packets = in_pps;
current_attack.out_packets = out_pps;
current_attack.in_bytes = in_bps;
current_attack.out_bytes = out_bps;
2014-12-05 15:34:59 +01:00
// pass flow information
current_attack.in_flows = in_flows;
current_attack.out_flows = out_flows;
current_attack.fragmented_in_packets = average_speed_element.fragmented_in_packets;
current_attack.tcp_in_packets = average_speed_element.tcp_in_packets;
current_attack.tcp_syn_in_packets = average_speed_element.tcp_syn_in_packets;
current_attack.udp_in_packets = average_speed_element.udp_in_packets;
current_attack.icmp_in_packets = average_speed_element.icmp_in_packets;
current_attack.fragmented_out_packets = average_speed_element.fragmented_out_packets;
current_attack.tcp_out_packets = average_speed_element.tcp_out_packets;
current_attack.tcp_syn_out_packets = average_speed_element.tcp_syn_out_packets;
current_attack.udp_out_packets = average_speed_element.udp_out_packets;
current_attack.icmp_out_packets = average_speed_element.icmp_out_packets;
current_attack.fragmented_out_bytes = average_speed_element.fragmented_out_bytes;
current_attack.tcp_out_bytes = average_speed_element.tcp_out_bytes;
current_attack.tcp_syn_out_bytes = average_speed_element.tcp_syn_out_bytes;
current_attack.udp_out_bytes = average_speed_element.udp_out_bytes;
current_attack.icmp_out_bytes = average_speed_element.icmp_out_bytes;
current_attack.fragmented_in_bytes = average_speed_element.fragmented_in_bytes;
current_attack.tcp_in_bytes = average_speed_element.tcp_in_bytes;
current_attack.tcp_syn_in_bytes = average_speed_element.tcp_syn_in_bytes;
current_attack.udp_in_bytes = average_speed_element.udp_in_bytes;
current_attack.icmp_in_bytes = average_speed_element.icmp_in_bytes;
2014-12-05 15:34:59 +01:00
current_attack.average_in_packets = average_speed_element.in_packets;
current_attack.average_in_bytes = average_speed_element.in_bytes;
current_attack.average_in_flows = average_speed_element.in_flows;
2014-12-04 16:48:11 +01:00
current_attack.average_out_packets = average_speed_element.out_packets;
current_attack.average_out_bytes = average_speed_element.out_bytes;
current_attack.average_out_flows = average_speed_element.out_flows;
if (collect_attack_pcap_dumps) {
bool buffer_allocation_result =
current_attack.pcap_attack_dump.allocate_buffer(number_of_packets_for_pcap_attack_dump);
if (!buffer_allocation_result) {
logger << log4cpp::Priority::ERROR
<< "Can't allocate buffer for attack, switch off this option completely ";
collect_attack_pcap_dumps = false;
}
}
ban_list_mutex.lock();
ban_list[client_ip] = current_attack;
ban_list_mutex.unlock();
ban_list_details_mutex.lock();
ban_list_details[client_ip] = std::vector<simple_packet_t>();
ban_list_details_mutex.unlock();
logger << log4cpp::Priority::INFO << "Attack with direction: " << data_direction_as_string
<< " IP: " << client_ip_as_string << " Power: " << pps_as_string;
2015-07-17 14:11:01 +02:00
call_ban_handlers(client_ip, ban_list[client_ip], flow_attack_details);
}
void call_ban_handlers(uint32_t client_ip, attack_details& current_attack, std::string flow_attack_details) {
2015-07-17 14:11:01 +02:00
std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);
std::string pps_as_string = convert_int_to_string(current_attack.attack_power);
std::string data_direction_as_string = get_direction_name(current_attack.attack_direction);
bool store_attack_details_to_file = true;
std::string basic_attack_information = get_attack_description(client_ip, current_attack);
std::string basic_attack_information_in_json = get_attack_description_in_json(client_ip, current_attack);
std::string full_attack_description = basic_attack_information + flow_attack_details;
2015-07-17 14:11:01 +02:00
if (store_attack_details_to_file) {
print_attack_details_to_file(full_attack_description, client_ip_as_string, current_attack);
}
if (pfring_hardware_filters_enabled) {
#ifdef PF_RING
logger << log4cpp::Priority::INFO << "We will block traffic to/from this IP with hardware filters";
pfring_hardware_filter_action_block(client_ip_as_string);
#else
logger << log4cpp::Priority::ERROR << "You haven't compiled PF_RING hardware filters support";
#endif
}
2015-07-17 13:52:28 +02:00
if (notify_script_enabled) {
std::string script_call_params = notify_script_path + " " + client_ip_as_string + " " +
data_direction_as_string + " " + pps_as_string + " " + "ban";
logger << log4cpp::Priority::INFO << "Call script for ban client: " << client_ip_as_string;
// We should execute external script in separate thread because any lag in this code will be
// very distructive
if (notify_script_pass_details) {
// We will pass attack details over stdin
boost::thread exec_thread(exec_with_stdin_params, script_call_params, full_attack_description);
exec_thread.detach();
} else {
// Do not pass anything to script
boost::thread exec_thread(exec, script_call_params);
exec_thread.detach();
}
logger << log4cpp::Priority::INFO << "Script for ban client is finished: " << client_ip_as_string;
}
2015-05-11 21:56:18 +02:00
if (exabgp_enabled) {
logger << log4cpp::Priority::INFO << "Call ExaBGP for ban client started: " << client_ip_as_string;
2015-05-11 21:56:18 +02:00
boost::thread exabgp_thread(exabgp_ban_manage, "ban", client_ip_as_string, current_attack);
2015-05-11 21:56:18 +02:00
exabgp_thread.detach();
logger << log4cpp::Priority::INFO << "Call to ExaBGP for ban client is finished: " << client_ip_as_string;
}
#ifdef ENABLE_GOBGP
if (gobgp_enabled) {
logger << log4cpp::Priority::INFO << "Call GoBGP for ban client started: " << client_ip_as_string;
boost::thread gobgp_thread(gobgp_ban_manage, "ban", client_ip_as_string, current_attack);
gobgp_thread.detach();
logger << log4cpp::Priority::INFO << "Call to GoBGP for ban client is finished: " << client_ip_as_string;
}
#endif
#ifdef REDIS
if (redis_enabled) {
std::string redis_key_name = client_ip_as_string + "_information";
2015-08-17 21:50:56 +02:00
if (!redis_prefix.empty()) {
2015-08-17 23:14:32 +02:00
redis_key_name = redis_prefix + "_" + client_ip_as_string + "_information";
2015-08-17 19:50:06 +02:00
}
logger << log4cpp::Priority::INFO << "Start data save in Redis in key: " << redis_key_name;
boost::thread redis_store_thread(store_data_in_redis, redis_key_name, basic_attack_information_in_json);
redis_store_thread.detach();
logger << log4cpp::Priority::INFO << "Finish data save in Redis in key: " << redis_key_name;
2016-09-24 20:21:45 +02:00
// If we have flow dump put in redis too
if (!flow_attack_details.empty()) {
std::string redis_key_name = client_ip_as_string + "_flow_dump";
if (!redis_prefix.empty()) {
redis_key_name = redis_prefix + "_" + client_ip_as_string + "_flow_dump";
}
logger << log4cpp::Priority::INFO << "Start data save in redis in key: " << redis_key_name;
boost::thread redis_store_thread(store_data_in_redis, redis_key_name, flow_attack_details);
redis_store_thread.detach();
logger << log4cpp::Priority::INFO << "Finish data save in redis in key: " << redis_key_name;
}
}
2016-09-24 20:21:45 +02:00
#endif
#ifdef MONGO
if (mongodb_enabled) {
std::string mongo_key_name = client_ip_as_string + "_information_" +
print_time_t_in_fastnetmon_format(current_attack.ban_timestamp);
// We could not use dot in key names: http://docs.mongodb.org/manual/core/document/#dot-notation
std::replace(mongo_key_name.begin(), mongo_key_name.end(), '.', '_');
logger << log4cpp::Priority::INFO << "Start data save in Mongo in key: " << mongo_key_name;
boost::thread mongo_store_thread(store_data_in_mongo, mongo_key_name, basic_attack_information_in_json);
mongo_store_thread.detach();
logger << log4cpp::Priority::INFO << "Finish data save in Mongo in key: " << mongo_key_name;
}
#endif
}
2014-10-20 17:42:14 +02:00
/* Thread for cleaning up ban list */
void cleanup_ban_list() {
// If we use very small ban time we should call ban_cleanup thread more often
if (unban_iteration_sleep_time > global_ban_time) {
unban_iteration_sleep_time = int(global_ban_time / 2);
logger << log4cpp::Priority::INFO << "You are using enough small ban time "
<< global_ban_time << " we need reduce unban_iteration_sleep_time twices to "
<< unban_iteration_sleep_time << " seconds";
}
logger << log4cpp::Priority::INFO << "Run banlist cleanup thread, we will awake every "
<< unban_iteration_sleep_time << " seconds";
2014-10-21 15:25:13 +02:00
2014-10-20 17:42:14 +02:00
while (true) {
boost::this_thread::sleep(boost::posix_time::seconds(unban_iteration_sleep_time));
2014-10-20 17:42:14 +02:00
time_t current_time;
time(&current_time);
2015-07-17 13:52:28 +02:00
std::vector<uint32_t> ban_list_items_for_erase;
for (std::map<uint32_t, banlist_item>::iterator itr = ban_list.begin(); itr != ban_list.end(); ++itr) {
uint32_t client_ip = itr->first;
// This IP should be banned permanentely and we skip any processing
if (!itr->second.unban_enabled) {
continue;
}
2014-10-20 17:42:14 +02:00
2015-07-17 13:52:28 +02:00
double time_difference = difftime(current_time, itr->second.ban_timestamp);
int ban_time = itr->second.ban_time;
2014-10-20 17:42:14 +02:00
2015-07-17 13:52:28 +02:00
// Yes, we reached end of ban time for this customer
bool we_could_unban_this_ip = time_difference > ban_time;
2015-07-17 13:52:28 +02:00
// We haven't reached time for unban yet
if (!we_could_unban_this_ip) {
continue;
}
// Check about ongoing attack
if (unban_only_if_attack_finished) {
std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);
uint32_t subnet_in_host_byte_order = ntohl(itr->second.customer_network.first);
int64_t shift_in_vector = (int64_t)ntohl(client_ip) - (int64_t)subnet_in_host_byte_order;
// Try to find average speed element
map_of_vector_counters::iterator itr_average_speed =
SubnetVectorMapSpeedAverage.find(itr->second.customer_network);
if (itr_average_speed == SubnetVectorMapSpeedAverage.end()) {
logger << log4cpp::Priority::ERROR << "Can't find vector address in subnet map for unban function";
continue;
2015-07-17 13:52:28 +02:00
}
if (shift_in_vector < 0 or shift_in_vector >= itr_average_speed->second.size()) {
logger << log4cpp::Priority::ERROR << "We tried to access to element with index "
<< shift_in_vector << " which located outside allocated vector with size "
<< itr_average_speed->second.size();
2015-07-17 13:52:28 +02:00
continue;
}
map_element* average_speed_element = &itr_average_speed->second[shift_in_vector];
// We get ban settings from host subnet
std::string host_group_name;
ban_settings_t current_ban_settings =
get_ban_settings_for_this_subnet(itr->second.customer_network, host_group_name);
if (we_should_ban_this_ip(average_speed_element, current_ban_settings)) {
logger << log4cpp::Priority::ERROR << "Attack to IP " << client_ip_as_string
<< " still going! We should not unblock this host";
2015-07-17 13:52:28 +02:00
// Well, we still saw attack, skip to next iteration
continue;
}
}
2015-07-17 13:52:28 +02:00
// Add this IP to remove list
// We will remove keyas really after this loop
ban_list_items_for_erase.push_back(itr->first);
2015-07-17 13:52:28 +02:00
// Call all hooks for unban
call_unban_handlers(itr->first, itr->second);
}
2015-07-17 13:52:28 +02:00
// Remove all unbanned hosts from the ban list
for (std::vector<uint32_t>::iterator itr = ban_list_items_for_erase.begin();
itr != ban_list_items_for_erase.end(); ++itr) {
2015-07-17 13:52:28 +02:00
ban_list_mutex.lock();
ban_list.erase(*itr);
ban_list_mutex.unlock();
2015-07-17 13:52:28 +02:00
}
}
}
2015-07-17 13:52:28 +02:00
void call_unban_handlers(uint32_t client_ip, attack_details& current_attack) {
std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);
2014-10-22 01:49:10 +02:00
2015-07-17 13:52:28 +02:00
logger << log4cpp::Priority::INFO << "We will unban banned IP: " << client_ip_as_string
<< " because it ban time " << current_attack.ban_time << " seconds is ended";
2015-07-17 13:52:28 +02:00
if (notify_script_enabled) {
std::string data_direction_as_string = get_direction_name(current_attack.attack_direction);
2015-07-17 13:52:28 +02:00
std::string pps_as_string = convert_int_to_string(current_attack.attack_power);
std::string script_call_params = notify_script_path + " " + client_ip_as_string + " " +
data_direction_as_string + " " + pps_as_string + " unban";
2015-07-17 13:52:28 +02:00
logger << log4cpp::Priority::INFO << "Call script for unban client: " << client_ip_as_string;
2015-07-17 13:52:28 +02:00
// We should execute external script in separate thread because any lag in this
// code will be very distructive
boost::thread exec_thread(exec, script_call_params);
exec_thread.detach();
2015-07-17 13:52:28 +02:00
logger << log4cpp::Priority::INFO << "Script for unban client is finished: " << client_ip_as_string;
}
2015-07-17 13:52:28 +02:00
if (exabgp_enabled) {
logger << log4cpp::Priority::INFO << "Call ExaBGP for unban client started: " << client_ip_as_string;
2015-07-17 13:52:28 +02:00
boost::thread exabgp_thread(exabgp_ban_manage, "unban", client_ip_as_string, current_attack);
exabgp_thread.detach();
logger << log4cpp::Priority::INFO << "Call to ExaBGP for unban client is finished: " << client_ip_as_string;
}
#ifdef ENABLE_GOBGP
if (gobgp_enabled) {
logger << log4cpp::Priority::INFO << "Call GoBGP for unban client started: " << client_ip_as_string;
boost::thread gobgp_thread(gobgp_ban_manage, "unban", client_ip_as_string, current_attack);
gobgp_thread.detach();
logger << log4cpp::Priority::INFO << "Call to GoBGP for unban client is finished: " << client_ip_as_string;
}
#endif
2014-10-20 17:42:14 +02:00
}
2015-01-27 20:29:51 +01:00
std::string print_ddos_attack_details() {
std::stringstream output_buffer;
for (std::map<uint32_t, banlist_item>::iterator ii = ban_list.begin(); ii != ban_list.end(); ++ii) {
uint32_t client_ip = (*ii).first;
2015-01-27 20:29:51 +01:00
std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);
std::string max_pps_as_string = convert_int_to_string(((*ii).second).max_attack_power);
std::string attack_direction = get_direction_name(((*ii).second).attack_direction);
output_buffer << client_ip_as_string << "/" << max_pps_as_string << " pps " << attack_direction
<< " at " << print_time_t_in_fastnetmon_format(ii->second.ban_timestamp) << std::endl;
send_attack_details(client_ip, (*ii).second);
}
return output_buffer.str();
}
2015-07-15 11:14:02 +02:00
std::string get_attack_description(uint32_t client_ip, attack_details& current_attack) {
std::stringstream attack_description;
attack_description << "IP: " << convert_ip_as_uint_to_string(client_ip) << "\n";
attack_description << serialize_attack_description(current_attack) << "\n";
if (enable_subnet_counters) {
// Got subnet tracking structure
// TODO: we suppose case "no key exists" is not possible
map_element network_speed_meter = PerSubnetSpeedMap[current_attack.customer_network];
map_element average_network_speed_meter = PerSubnetAverageSpeedMap[current_attack.customer_network];
2015-07-15 11:14:02 +02:00
attack_description << "Network: " << convert_subnet_to_string(current_attack.customer_network) << "\n";
2015-07-15 11:14:02 +02:00
attack_description << serialize_network_load_to_text(network_speed_meter, false);
attack_description << serialize_network_load_to_text(average_network_speed_meter, true);
}
attack_description << serialize_statistic_counters_about_attack(current_attack);
return attack_description.str();
}
2015-07-15 11:14:02 +02:00
std::string get_attack_description_in_json(uint32_t client_ip, attack_details& current_attack) {
json_object* jobj = json_object_new_object();
json_object_object_add(jobj, "ip",
json_object_new_string(convert_ip_as_uint_to_string(client_ip).c_str()));
json_object_object_add(jobj, "attack_details", serialize_attack_description_to_json(current_attack));
2015-07-15 11:14:02 +02:00
if (enable_subnet_counters) {
map_element network_speed_meter = PerSubnetSpeedMap[current_attack.customer_network];
map_element average_network_speed_meter = PerSubnetAverageSpeedMap[current_attack.customer_network];
2015-08-13 18:32:36 +02:00
json_object_object_add(jobj, "network_load", serialize_network_load_to_json(network_speed_meter));
json_object_object_add(jobj, "network_average_load",
serialize_network_load_to_json(average_network_speed_meter));
2015-07-15 11:14:02 +02:00
}
// So we haven't statistic_counters here but from my point of view they are useless
std::string json_as_text = json_object_to_json_string(jobj);
// Free memory
json_object_put(jobj);
return json_as_text;
}
std::string generate_simple_packets_dump(std::vector<simple_packet_t>& ban_list_details) {
std::stringstream attack_details;
std::map<unsigned int, unsigned int> protocol_counter;
for (std::vector<simple_packet_t>::iterator iii = ban_list_details.begin();
iii != ban_list_details.end(); ++iii) {
attack_details << print_simple_packet(*iii);
protocol_counter[iii->protocol]++;
}
std::map<unsigned int, unsigned int>::iterator max_proto =
std::max_element(protocol_counter.begin(), protocol_counter.end(), protocol_counter.value_comp());
/*
attack_details
<< "\n"
<< "We got more packets (" << max_proto->second << " from " << ban_details_records_count
<< ") for protocol: " << get_protocol_name_by_number(max_proto->first) << "\n";
*/
return attack_details.str();
}
void send_attack_details(uint32_t client_ip, attack_details current_attack_details) {
2015-01-27 20:29:51 +01:00
std::string pps_as_string = convert_int_to_string(current_attack_details.attack_power);
std::string attack_direction = get_direction_name(current_attack_details.attack_direction);
std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);
// Very strange code but it work in 95% cases
if (ban_list_details.count(client_ip) > 0 && ban_list_details[client_ip].size() >= ban_details_records_count) {
2015-01-27 20:29:51 +01:00
std::stringstream attack_details;
attack_details << get_attack_description(client_ip, current_attack_details) << "\n\n";
attack_details << generate_simple_packets_dump(ban_list_details[client_ip]);
logger << log4cpp::Priority::INFO << "Attack with direction: " << attack_direction
<< " IP: " << client_ip_as_string << " Power: " << pps_as_string
<< " traffic samples collected";
call_attack_details_handlers(client_ip, current_attack_details, attack_details.str());
// TODO: here we have definitely RACE CONDITION!!! FIX IT
2014-07-04 13:10:23 +02:00
// Remove key and prevent collection new data about this attack
ban_list_details_mutex.lock();
ban_list_details.erase(client_ip);
ban_list_details_mutex.unlock();
}
}
#ifdef ENABLE_DPI
// Parse raw binary stand-alone packet with nDPI
ndpi_protocol dpi_parse_packet(char* buffer,
uint32_t len,
uint32_t snap_len,
struct ndpi_id_struct* src,
struct ndpi_id_struct* dst,
struct ndpi_flow_struct* flow,
std::string& parsed_packet_as_string) {
struct pfring_pkthdr packet_header;
memset(&packet_header, 0, sizeof(packet_header));
packet_header.len = len;
2015-07-30 20:44:50 +02:00
packet_header.caplen = snap_len;
2015-07-29 22:32:32 +02:00
fastnetmon_parse_pkt((u_char*)buffer, &packet_header, 4, 1, 0);
uint32_t current_tickt = 0;
uint8_t* iph = (uint8_t*)(&buffer[packet_header.extended_hdr.parsed_pkt.offset.l3_offset]);
unsigned int ipsize = packet_header.len;
ndpi_protocol detected_protocol =
ndpi_detection_process_packet(my_ndpi_struct, flow, iph, ipsize, current_tickt, src, dst);
// So bad approach :(
char print_buffer[512];
fastnetmon_print_parsed_pkt(print_buffer, 512, (u_char*)buffer, &packet_header);
parsed_packet_as_string = std::string(print_buffer);
return detected_protocol;
}
#endif
#ifdef ENABLE_DPI
void init_current_instance_of_ndpi() {
my_ndpi_struct = init_ndpi();
if (my_ndpi_struct == NULL) {
logger << log4cpp::Priority::ERROR << "Can't load nDPI, disable it!";
process_pcap_attack_dumps_with_dpi = false;
return;
}
// Load sizes of main parsing structures
ndpi_size_id_struct = ndpi_detection_get_sizeof_ndpi_id_struct();
ndpi_size_flow_struct = ndpi_detection_get_sizeof_ndpi_flow_struct();
}
2016-08-19 21:18:56 +02:00
// Zeroify nDPI structure without memory leaks
void zeroify_ndpi_flow(struct ndpi_flow_struct* flow) {
if (flow->http.url) {
ndpi_free(flow->http.url);
}
if (flow->http.content_type) {
ndpi_free(flow->http.content_type);
}
memset(flow, 0, ndpi_size_flow_struct);
}
// Run flow spec mitigation rule
void launch_bgp_flow_spec_rule(amplification_attack_type_t attack_type, std::string client_ip_as_string) {
logger << log4cpp::Priority::INFO
<< "We detected this attack as: " << get_amplification_attack_type(attack_type);
std::string flow_spec_rule_text =
generate_flow_spec_for_amplification_attack(attack_type, client_ip_as_string);
logger << log4cpp::Priority::INFO
<< "We have generated BGP Flow Spec rule for this attack: " << flow_spec_rule_text;
if (exabgp_flow_spec_announces) {
active_flow_spec_announces_t::iterator itr = active_flow_spec_announces.find(flow_spec_rule_text);
if (itr == active_flow_spec_announces.end()) {
// We havent this flow spec rule active yet
logger << log4cpp::Priority::INFO << "We will publish flow spec announce about this attack";
bool exabgp_publish_result = exabgp_flow_spec_ban_manage("ban", flow_spec_rule_text);
if (exabgp_publish_result) {
active_flow_spec_announces[flow_spec_rule_text] = 1;
}
} else {
// We have already blocked this attack
logger << log4cpp::Priority::INFO << "The same rule was already sent to ExaBGP formerly";
}
} else {
logger << log4cpp::Priority::INFO << "exabgp_flow_spec_announces disabled. We will not talk to ExaBGP";
}
}
// Not so pretty copy and paste from pcap_reader()
// TODO: rewrite to memory parser
void produce_dpi_dump_for_pcap_dump(std::string pcap_file_path, std::stringstream& ss, std::string client_ip_as_string) {
int filedesc = open(pcap_file_path.c_str(), O_RDONLY);
if (filedesc <= 0) {
logger << log4cpp::Priority::ERROR << "Can't open file for DPI";
return;
}
struct fastnetmon_pcap_file_header pcap_header;
ssize_t file_header_readed_bytes =
read(filedesc, &pcap_header, sizeof(struct fastnetmon_pcap_file_header));
if (file_header_readed_bytes != sizeof(struct fastnetmon_pcap_file_header)) {
logger << log4cpp::Priority::ERROR << "Can't read pcap file header";
return;
}
// http://www.tcpdump.org/manpages/pcap-savefile.5.html
if (pcap_header.magic == 0xa1b2c3d4 or pcap_header.magic == 0xd4c3b2a1) {
// printf("Magic readed correctly\n");
} else {
logger << log4cpp::Priority::ERROR << "Magic in file header broken";
return;
}
// Buffer for packets
char packet_buffer[pcap_header.snaplen];
unsigned int total_packets_number = 0;
uint64_t dns_amplification_packets = 0;
uint64_t ntp_amplification_packets = 0;
uint64_t ssdp_amplification_packets = 0;
uint64_t snmp_amplification_packets = 0;
struct ndpi_id_struct* src = (struct ndpi_id_struct*)malloc(ndpi_size_id_struct);
2016-08-19 21:18:56 +02:00
memset(src, 0, ndpi_size_id_struct);
2016-08-19 21:26:41 +02:00
struct ndpi_id_struct* dst = (struct ndpi_id_struct*)malloc(ndpi_size_id_struct);
2016-08-19 21:18:56 +02:00
memset(dst, 0, ndpi_size_id_struct);
struct ndpi_flow_struct* flow = (struct ndpi_flow_struct*)malloc(ndpi_size_flow_struct);
memset(flow, 0, ndpi_size_flow_struct);
while (1) {
struct fastnetmon_pcap_pkthdr pcap_packet_header;
ssize_t packet_header_readed_bytes =
read(filedesc, &pcap_packet_header, sizeof(struct fastnetmon_pcap_pkthdr));
if (packet_header_readed_bytes != sizeof(struct fastnetmon_pcap_pkthdr)) {
if (packet_header_readed_bytes != 0) {
logger << log4cpp::Priority::INFO << "All packet read ? ("
<< packet_header_readed_bytes << ", " << errno << ")";
}
// We haven't any packets
break;
}
if (pcap_packet_header.incl_len > pcap_header.snaplen) {
logger << log4cpp::Priority::ERROR << "Please enlarge packet buffer for DPI";
return;
}
ssize_t packet_payload_readed_bytes = read(filedesc, packet_buffer, pcap_packet_header.incl_len);
if (pcap_packet_header.incl_len != packet_payload_readed_bytes) {
logger << log4cpp::Priority::ERROR << "I read packet header but can't read packet payload";
return;
}
2016-08-19 21:18:56 +02:00
// The flow must be reset to zero state - in other case the DPI will not detect all packets properly.
// To use flow properly there must be much more complicated code (with flow buffer for each flow probably)
// following code is copied from ndpi_free_flow() just to be sure there will be no memory leaks due to memset()
2016-08-19 21:18:56 +02:00
zeroify_ndpi_flow(flow);
std::string parsed_packet_as_string;
ndpi_protocol detected_protocol =
dpi_parse_packet(packet_buffer, pcap_packet_header.orig_len, pcap_packet_header.incl_len,
src, dst, flow, parsed_packet_as_string);
#if NDPI_MAJOR >= 2
u_int16_t app_protocol = detected_protocol.app_protocol;
#else
u_int16_t app_protocol = detected_protocol.protocol;
#endif
char* protocol_name = ndpi_get_proto_name(my_ndpi_struct, app_protocol);
char* master_protocol_name = ndpi_get_proto_name(my_ndpi_struct, detected_protocol.master_protocol);
if (app_protocol == NDPI_PROTOCOL_DNS) {
// It's answer for ANY request with so much
if (flow->protos.dns.query_type == 255 &&
flow->protos.dns.num_queries < flow->protos.dns.num_answers) {
dns_amplification_packets++;
}
} else if (app_protocol == NDPI_PROTOCOL_NTP) {
// Detect packets with type MON_GETLIST_1
if (flow->protos.ntp.version == 2 && flow->protos.ntp.request_code == 42) {
ntp_amplification_packets++;
}
} else if (app_protocol == NDPI_PROTOCOL_SSDP) {
// So, this protocol completely unexpected in WAN networks
ssdp_amplification_packets++;
} else if (app_protocol == NDPI_PROTOCOL_SNMP) {
// TODO: we need detailed tests for SNMP!
snmp_amplification_packets++;
}
ss << parsed_packet_as_string << " protocol: " << protocol_name
<< " master_protocol: " << master_protocol_name << "\n";
total_packets_number++;
}
// Free up all memory
ndpi_free_flow(flow);
free(dst);
free(src);
close(filedesc);
logger << log4cpp::Priority::INFO << "DPI pkt stats: total:" << total_packets_number
<< " DNS:" << dns_amplification_packets << " NTP:" << ntp_amplification_packets
<< " SSDP:" << ssdp_amplification_packets << " SNMP:" << snmp_amplification_packets;
amplification_attack_type_t attack_type;
2015-07-30 18:00:42 +02:00
// Attack type in unknown by default
attack_type = AMPLIFICATION_ATTACK_UNKNOWN;
// Detect amplification attack type
if ((double)dns_amplification_packets / (double)total_packets_number > 0.2) {
launch_bgp_flow_spec_rule(AMPLIFICATION_ATTACK_DNS, client_ip_as_string);
} else if ((double)ntp_amplification_packets / (double)total_packets_number > 0.2) {
launch_bgp_flow_spec_rule(AMPLIFICATION_ATTACK_NTP, client_ip_as_string);
} else if ((double)ssdp_amplification_packets / (double)total_packets_number > 0.2) {
launch_bgp_flow_spec_rule(AMPLIFICATION_ATTACK_SSDP, client_ip_as_string);
} else if ((double)snmp_amplification_packets / (double)total_packets_number > 0.2) {
launch_bgp_flow_spec_rule(AMPLIFICATION_ATTACK_SNMP, client_ip_as_string);
} else {
/*TODO
- full IP ban should be announced here !
- and maybe some protocol/port based statistics could be used to filter new/unknown attacks...
*/
logger
<< log4cpp::Priority::ERROR
<< "We can't detect attack type with DPI. It's not so critical, only for your information";
}
}
#endif
void call_attack_details_handlers(uint32_t client_ip, attack_details& current_attack, std::string attack_fingerprint) {
std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);
std::string attack_direction = get_direction_name(current_attack.attack_direction);
std::string pps_as_string = convert_int_to_string(current_attack.attack_power);
// We place this variables here because we need this paths from DPI parser code
std::string ban_timestamp_as_string = print_time_t_in_fastnetmon_format(current_attack.ban_timestamp);
std::string attack_pcap_dump_path =
attack_details_folder + "/" + client_ip_as_string + "_" + ban_timestamp_as_string + ".pcap";
if (collect_attack_pcap_dumps) {
int pcap_fump_filedesc = open(attack_pcap_dump_path.c_str(), O_WRONLY | O_CREAT, S_IRUSR | S_IWUSR);
if (pcap_fump_filedesc <= 0) {
logger << log4cpp::Priority::ERROR << "Can't open file for storing pcap dump: " << attack_pcap_dump_path;
} else {
ssize_t wrote_bytes =
write(pcap_fump_filedesc, (void*)current_attack.pcap_attack_dump.get_buffer_pointer(),
current_attack.pcap_attack_dump.get_used_memory());
if (wrote_bytes != current_attack.pcap_attack_dump.get_used_memory()) {
logger << log4cpp::Priority::ERROR << "Can't wrote all attack details to the disk correctly";
}
close(pcap_fump_filedesc);
// Freeup memory
current_attack.pcap_attack_dump.deallocate_buffer();
}
}
#ifdef ENABLE_DPI
// Yes, will be fine to read packets from the memory but we haven't this code yet
// Thus we could read from file with not good performance because it's simpler
if (collect_attack_pcap_dumps && process_pcap_attack_dumps_with_dpi) {
std::stringstream string_buffer_for_dpi_data;
string_buffer_for_dpi_data << "\n\nDPI\n\n";
produce_dpi_dump_for_pcap_dump(attack_pcap_dump_path, string_buffer_for_dpi_data, client_ip_as_string);
attack_fingerprint = attack_fingerprint + string_buffer_for_dpi_data.str();
}
#endif
print_attack_details_to_file(attack_fingerprint, client_ip_as_string, current_attack);
// Pass attack details to script
if (notify_script_enabled) {
logger << log4cpp::Priority::INFO
<< "Call script for notify about attack details for: " << client_ip_as_string;
std::string script_params = notify_script_path + " " + client_ip_as_string + " " +
attack_direction + " " + pps_as_string + " attack_details";
// We should execute external script in separate thread because any lag in this code
// will be very distructive
boost::thread exec_with_params_thread(exec_with_stdin_params, script_params, attack_fingerprint);
exec_with_params_thread.detach();
logger << log4cpp::Priority::INFO
<< "Script for notify about attack details is finished: " << client_ip_as_string;
}
#ifdef REDIS
if (redis_enabled) {
std::string redis_key_name = client_ip_as_string + "_packets_dump";
2015-08-17 19:50:06 +02:00
if (!redis_prefix.empty()) {
redis_key_name = redis_prefix + "_" + client_ip_as_string + "_packets_dump";
}
logger << log4cpp::Priority::INFO << "Start data save in redis for key: " << redis_key_name;
boost::thread redis_store_thread(store_data_in_redis, redis_key_name, attack_fingerprint);
redis_store_thread.detach();
logger << log4cpp::Priority::INFO << "Finish data save in redis for key: " << redis_key_name;
}
#endif
2014-06-26 12:10:57 +02:00
}
2014-11-13 16:01:15 +01:00
uint64_t convert_conntrack_hash_struct_to_integer(packed_conntrack_hash* struct_value) {
uint64_t unpacked_data = 0;
memcpy(&unpacked_data, struct_value, sizeof(uint64_t));
return unpacked_data;
}
2014-11-14 22:36:54 +01:00
void convert_integer_to_conntrack_hash_struct(packed_session* packed_connection_data,
packed_conntrack_hash* unpacked_data) {
memcpy(unpacked_data, packed_connection_data, sizeof(uint64_t));
2014-11-15 00:41:54 +01:00
}
std::string print_flow_tracking_for_specified_protocol(contrack_map_type& protocol_map,
std::string client_ip,
direction flow_direction) {
2015-01-27 20:29:51 +01:00
std::stringstream buffer;
2014-11-15 00:41:54 +01:00
// We shoud iterate over all fields
2014-11-29 22:50:31 +01:00
int printed_records = 0;
2014-11-15 00:41:54 +01:00
for (contrack_map_type::iterator itr = protocol_map.begin(); itr != protocol_map.end(); ++itr) {
// We should limit number of records in flow dump because syn flood attacks produce
// thounsands of lines
2014-11-29 22:50:31 +01:00
if (printed_records > ban_details_records_count) {
buffer << "Flows have cropped due to very long list.\n";
2014-11-29 22:50:31 +01:00
break;
}
2014-11-15 00:41:54 +01:00
uint64_t packed_connection_data = itr->first;
packed_conntrack_hash unpacked_key_struct;
convert_integer_to_conntrack_hash_struct(&packed_connection_data, &unpacked_key_struct);
std::string opposite_ip_as_string = convert_ip_as_uint_to_string(unpacked_key_struct.opposite_ip);
2014-11-15 00:41:54 +01:00
if (flow_direction == INCOMING) {
buffer << client_ip << ":" << unpacked_key_struct.dst_port << " < "
<< opposite_ip_as_string << ":" << unpacked_key_struct.src_port << " ";
2014-11-15 00:41:54 +01:00
} else if (flow_direction == OUTGOING) {
buffer << client_ip << ":" << unpacked_key_struct.src_port << " > "
<< opposite_ip_as_string << ":" << unpacked_key_struct.dst_port << " ";
}
buffer << itr->second.bytes << " bytes " << itr->second.packets << " packets";
buffer << "\n";
2014-11-29 22:50:31 +01:00
printed_records++;
}
2014-11-15 00:41:54 +01:00
return buffer.str();
}
2014-12-05 14:09:25 +01:00
/*
Attack types:
- syn flood: one local port, multiple remote hosts (and maybe multiple remote ports) and
small packet size
2014-12-05 14:09:25 +01:00
*/
/* Iterate over all flow tracking table */
2015-01-27 20:29:51 +01:00
bool process_flow_tracking_table(conntrack_main_struct& conntrack_element, std::string client_ip) {
std::map<uint32_t, unsigned int> uniq_remote_hosts_which_generate_requests_to_us;
std::map<unsigned int, unsigned int> uniq_local_ports_which_target_of_connectiuons_from_inside;
2014-12-05 14:09:25 +01:00
/* Process incoming TCP connections */
for (contrack_map_type::iterator itr = conntrack_element.in_tcp.begin();
itr != conntrack_element.in_tcp.end(); ++itr) {
2014-12-05 14:09:25 +01:00
uint64_t packed_connection_data = itr->first;
packed_conntrack_hash unpacked_key_struct;
convert_integer_to_conntrack_hash_struct(&packed_connection_data, &unpacked_key_struct);
2014-12-05 14:09:25 +01:00
uniq_remote_hosts_which_generate_requests_to_us[unpacked_key_struct.opposite_ip]++;
uniq_local_ports_which_target_of_connectiuons_from_inside[unpacked_key_struct.dst_port]++;
// we can calc average packet size
// string opposite_ip_as_string =
// convert_ip_as_uint_to_string(unpacked_key_struct.opposite_ip);
2014-12-05 14:09:25 +01:00
// unpacked_key_struct.src_port
// unpacked_key_struct.dst_port
// itr->second.packets
// itr->second.bytes
}
2014-12-16 11:56:08 +01:00
return true;
2014-12-05 14:09:25 +01:00
}
2015-01-27 20:29:51 +01:00
std::string print_flow_tracking_for_ip(conntrack_main_struct& conntrack_element, std::string client_ip) {
std::stringstream buffer;
2014-11-15 00:41:54 +01:00
std::string in_tcp =
print_flow_tracking_for_specified_protocol(conntrack_element.in_tcp, client_ip, INCOMING);
std::string in_udp =
print_flow_tracking_for_specified_protocol(conntrack_element.in_udp, client_ip, INCOMING);
2014-11-15 00:41:54 +01:00
2015-05-08 10:42:20 +02:00
unsigned long long total_number_of_incoming_tcp_flows = conntrack_element.in_tcp.size();
unsigned long long total_number_of_incoming_udp_flows = conntrack_element.in_udp.size();
unsigned long long total_number_of_outgoing_tcp_flows = conntrack_element.out_tcp.size();
unsigned long long total_number_of_outgoing_udp_flows = conntrack_element.out_udp.size();
2015-05-08 10:42:20 +02:00
2014-11-15 00:41:54 +01:00
bool we_have_incoming_flows = in_tcp.length() > 0 or in_udp.length() > 0;
if (we_have_incoming_flows) {
buffer << "Incoming\n\n";
2014-11-15 00:41:54 +01:00
if (in_tcp.length() > 0) {
buffer << "TCP flows: " << total_number_of_incoming_tcp_flows << "\n";
buffer << in_tcp << "\n";
2014-11-15 00:41:54 +01:00
}
if (in_udp.length() > 0) {
buffer << "UDP flows: " << total_number_of_incoming_udp_flows << "\n";
buffer << in_udp << "\n";
2014-11-15 00:41:54 +01:00
}
}
std::string out_tcp =
print_flow_tracking_for_specified_protocol(conntrack_element.out_tcp, client_ip, OUTGOING);
std::string out_udp =
print_flow_tracking_for_specified_protocol(conntrack_element.out_udp, client_ip, OUTGOING);
2014-11-15 00:41:54 +01:00
bool we_have_outgoing_flows = out_tcp.length() > 0 or out_udp.length() > 0;
// print delimiter if we have flows in both directions
if (we_have_incoming_flows && we_have_outgoing_flows) {
buffer << "\n";
2014-11-15 00:41:54 +01:00
}
if (we_have_outgoing_flows) {
buffer << "Outgoing\n\n";
2014-11-15 00:41:54 +01:00
if (out_tcp.length() > 0) {
buffer << "TCP flows: " << total_number_of_outgoing_tcp_flows << "\n";
buffer << out_tcp << "\n";
2014-11-15 00:41:54 +01:00
}
if (out_udp.length() > 0) {
buffer << "UDP flows: " << total_number_of_outgoing_udp_flows << "\n";
buffer << out_udp << "\n";
2014-11-15 00:41:54 +01:00
}
}
return buffer.str();
}
2014-11-14 22:36:54 +01:00
std::string print_subnet_load() {
std::stringstream buffer;
sort_type sorter;
if (sort_parameter == "packets") {
sorter = PACKETS;
} else if (sort_parameter == "bytes") {
sorter = BYTES;
} else if (sort_parameter == "flows") {
sorter = FLOWS;
} else {
logger << log4cpp::Priority::INFO << "Unexpected sorter type: " << sort_parameter;
sorter = PACKETS;
}
std::vector<pair_of_map_for_subnet_counters_elements_t> vector_for_sort;
vector_for_sort.reserve(PerSubnetSpeedMap.size());
for (map_for_subnet_counters::iterator itr = PerSubnetSpeedMap.begin();
itr != PerSubnetSpeedMap.end(); ++itr) {
vector_for_sort.push_back(std::make_pair(itr->first, itr->second));
}
std::sort(vector_for_sort.begin(), vector_for_sort.end(),
TrafficComparatorClass<pair_of_map_for_subnet_counters_elements_t>(INCOMING, sorter));
graphite_data_t graphite_data;
for (std::vector<pair_of_map_for_subnet_counters_elements_t>::iterator itr = vector_for_sort.begin();
itr != vector_for_sort.end(); ++itr) {
map_element* speed = &itr->second;
std::string subnet_as_string = convert_subnet_to_string(itr->first);
buffer << std::setw(18) << std::left << subnet_as_string;
if (graphite_enabled) {
std::string subnet_as_string_as_dash_delimiters = subnet_as_string;
// Replace dots by dashes
std::replace(subnet_as_string_as_dash_delimiters.begin(),
subnet_as_string_as_dash_delimiters.end(), '.', '_');
// Replace / by dashes too
std::replace(subnet_as_string_as_dash_delimiters.begin(),
subnet_as_string_as_dash_delimiters.end(), '/', '_');
graphite_data[graphite_prefix + ".networks." + subnet_as_string_as_dash_delimiters + ".incoming.pps"] =
speed->in_packets;
graphite_data[graphite_prefix + ".networks." + subnet_as_string_as_dash_delimiters + ".outgoing.pps"] =
speed->out_packets;
graphite_data[graphite_prefix + ".networks." + subnet_as_string_as_dash_delimiters + ".incoming.bps"] =
speed->in_bytes * 8;
graphite_data[graphite_prefix + ".networks." + subnet_as_string_as_dash_delimiters + ".outgoing.bps"] =
speed->out_bytes * 8;
}
buffer << " "
<< "pps in: " << std::setw(8) << speed->in_packets << " out: " << std::setw(8)
<< speed->out_packets << " mbps in: " << std::setw(5) << convert_speed_to_mbps(speed->in_bytes)
<< " out: " << std::setw(5) << convert_speed_to_mbps(speed->out_bytes) << "\n";
}
if (graphite_enabled) {
bool graphite_put_result = store_data_to_graphite(graphite_port, graphite_host, graphite_data);
if (!graphite_put_result) {
logger << log4cpp::Priority::ERROR << "Can't store network load data to Graphite";
}
}
return buffer.str();
}
2015-07-07 17:48:47 +02:00
std::string print_ban_thresholds(ban_settings_t current_ban_settings) {
2015-01-27 20:29:51 +01:00
std::stringstream output_buffer;
2014-12-04 17:07:44 +01:00
output_buffer << "Configuration params:\n";
2015-07-07 17:48:47 +02:00
if (current_ban_settings.enable_ban) {
output_buffer << "We call ban script: yes\n";
} else {
output_buffer << "We call ban script: no\n";
}
output_buffer << "Packets per second: ";
2015-07-07 17:48:47 +02:00
if (current_ban_settings.enable_ban_for_pps) {
output_buffer << current_ban_settings.ban_threshold_pps;
2014-12-04 17:07:44 +01:00
} else {
output_buffer << "disabled";
2014-12-04 17:07:44 +01:00
}
output_buffer << "\n";
2014-12-04 17:07:44 +01:00
output_buffer << "Mbps per second: ";
2015-07-07 17:48:47 +02:00
if (current_ban_settings.enable_ban_for_bandwidth) {
output_buffer << current_ban_settings.ban_threshold_mbps;
2014-12-04 17:07:44 +01:00
} else {
output_buffer << "disabled";
2014-12-04 17:07:44 +01:00
}
output_buffer << "\n";
2014-12-04 17:07:44 +01:00
output_buffer << "Flows per second: ";
2015-07-07 17:48:47 +02:00
if (current_ban_settings.enable_ban_for_flows_per_second) {
output_buffer << current_ban_settings.ban_threshold_flows;
2014-12-04 17:07:44 +01:00
} else {
output_buffer << "disabled";
2014-12-04 17:07:44 +01:00
}
output_buffer << "\n";
2014-12-04 17:07:44 +01:00
return output_buffer.str();
}
void print_attack_details_to_file(std::string details, std::string client_ip_as_string, attack_details current_attack) {
2015-01-27 20:29:51 +01:00
std::ofstream my_attack_details_file;
std::string ban_timestamp_as_string = print_time_t_in_fastnetmon_format(current_attack.ban_timestamp);
std::string attack_dump_path =
attack_details_folder + "/" + client_ip_as_string + "_" + ban_timestamp_as_string + ".txt";
2015-01-27 20:29:51 +01:00
my_attack_details_file.open(attack_dump_path.c_str(), std::ios::app);
if (my_attack_details_file.is_open()) {
my_attack_details_file << details << "\n\n";
my_attack_details_file.close();
} else {
logger << log4cpp::Priority::ERROR << "Can't print attack details to file";
}
}
logging_configuration_t read_logging_settings(configuration_map_t configuration_map) {
logging_configuration_t logging_configuration_temp;
if (configuration_map.count("logging:local_syslog_logging") != 0) {
logging_configuration_temp.local_syslog_logging =
configuration_map["logging:local_syslog_logging"] == "on";
}
if (configuration_map.count("logging:remote_syslog_logging") != 0) {
logging_configuration_temp.remote_syslog_logging =
configuration_map["logging:remote_syslog_logging"] == "on";
}
if (configuration_map.count("logging:remote_syslog_server") != 0) {
logging_configuration_temp.remote_syslog_server =
configuration_map["logging:remote_syslog_server"];
}
if (configuration_map.count("logging:remote_syslog_port") != 0) {
logging_configuration_temp.remote_syslog_port =
convert_string_to_integer(configuration_map["logging:remote_syslog_port"]);
}
if (logging_configuration_temp.remote_syslog_logging) {
if (logging_configuration_temp.remote_syslog_port > 0 &&
!logging_configuration_temp.remote_syslog_server.empty()) {
logger << log4cpp::Priority::INFO << "We have configured remote syslog logging corectly";
} else {
logger << log4cpp::Priority::ERROR << "You have enabled remote logging but haven't specified port or host";
logging_configuration_temp.remote_syslog_logging = false;
}
}
if (logging_configuration_temp.local_syslog_logging) {
logger << log4cpp::Priority::INFO << "We have configured local syslog logging corectly";
}
return logging_configuration_temp;
}
ban_settings_t read_ban_settings(configuration_map_t configuration_map, std::string host_group_name) {
ban_settings_t ban_settings;
std::string prefix = "";
if (host_group_name != "") {
prefix = host_group_name + "_";
}
if (configuration_map.count(prefix + "enable_ban") != 0) {
ban_settings.enable_ban = configuration_map[prefix + "enable_ban"] == "on";
}
if (configuration_map.count(prefix + "ban_for_pps") != 0) {
ban_settings.enable_ban_for_pps = configuration_map[prefix + "ban_for_pps"] == "on";
}
if (configuration_map.count(prefix + "ban_for_bandwidth") != 0) {
ban_settings.enable_ban_for_bandwidth = configuration_map[prefix + "ban_for_bandwidth"] == "on";
}
if (configuration_map.count(prefix + "ban_for_flows") != 0) {
ban_settings.enable_ban_for_flows_per_second =
configuration_map[prefix + "ban_for_flows"] == "on";
}
// Per protocol bandwidth triggers
if (configuration_map.count(prefix + "ban_for_tcp_bandwidth") != 0) {
ban_settings.enable_ban_for_tcp_bandwidth =
configuration_map[prefix + "ban_for_tcp_bandwidth"] == "on";
}
if (configuration_map.count(prefix + "ban_for_udp_bandwidth") != 0) {
ban_settings.enable_ban_for_udp_bandwidth =
configuration_map[prefix + "ban_for_udp_bandwidth"] == "on";
}
if (configuration_map.count(prefix + "ban_for_icmp_bandwidth") != 0) {
ban_settings.enable_ban_for_icmp_bandwidth =
configuration_map[prefix + "ban_for_icmp_bandwidth"] == "on";
}
// Per protocol pps ban triggers
if (configuration_map.count(prefix + "ban_for_tcp_pps") != 0) {
ban_settings.enable_ban_for_tcp_pps = configuration_map[prefix + "ban_for_tcp_pps"] == "on";
}
if (configuration_map.count(prefix + "ban_for_udp_pps") != 0) {
ban_settings.enable_ban_for_udp_pps = configuration_map[prefix + "ban_for_udp_pps"] == "on";
}
if (configuration_map.count(prefix + "ban_for_icmp_pps") != 0) {
ban_settings.enable_ban_for_icmp_pps =
configuration_map[prefix + "ban_for_icmp_pps"] == "on";
}
// Pps per protocol thresholds
if (configuration_map.count(prefix + "threshold_tcp_pps") != 0) {
ban_settings.ban_threshold_tcp_pps =
convert_string_to_integer(configuration_map[prefix + "threshold_tcp_pps"]);
}
if (configuration_map.count(prefix + "threshold_udp_pps") != 0) {
ban_settings.ban_threshold_udp_pps =
convert_string_to_integer(configuration_map[prefix + "threshold_udp_pps"]);
}
if (configuration_map.count(prefix + "threshold_icmp_pps") != 0) {
ban_settings.ban_threshold_icmp_pps =
convert_string_to_integer(configuration_map[prefix + "threshold_icmp_pps"]);
}
// Bandwidth per protocol thresholds
if (configuration_map.count(prefix + "threshold_tcp_mbps") != 0) {
ban_settings.ban_threshold_tcp_mbps =
convert_string_to_integer(configuration_map[prefix + "threshold_tcp_mbps"]);
}
if (configuration_map.count(prefix + "threshold_udp_mbps") != 0) {
ban_settings.ban_threshold_udp_mbps =
convert_string_to_integer(configuration_map[prefix + "threshold_udp_mbps"]);
}
if (configuration_map.count(prefix + "threshold_icmp_mbps") != 0) {
ban_settings.ban_threshold_icmp_mbps =
convert_string_to_integer(configuration_map[prefix + "threshold_icmp_mbps"]);
}
if (configuration_map.count(prefix + "threshold_pps") != 0) {
ban_settings.ban_threshold_pps =
convert_string_to_integer(configuration_map[prefix + "threshold_pps"]);
}
if (configuration_map.count(prefix + "threshold_mbps") != 0) {
ban_settings.ban_threshold_mbps =
convert_string_to_integer(configuration_map[prefix + "threshold_mbps"]);
}
if (configuration_map.count(prefix + "threshold_flows") != 0) {
ban_settings.ban_threshold_flows =
convert_string_to_integer(configuration_map[prefix + "threshold_flows"]);
}
return ban_settings;
}
2015-09-11 17:41:07 +02:00
bool exceed_pps_speed(uint64_t in_counter, uint64_t out_counter, unsigned int threshold) {
if (in_counter > threshold or out_counter > threshold) {
return true;
} else {
return false;
}
}
bool exceed_flow_speed(uint64_t in_counter, uint64_t out_counter, unsigned int threshold) {
if (in_counter > threshold or out_counter > threshold) {
return true;
} else {
return false;
}
2015-09-11 17:41:07 +02:00
}
bool exceed_mbps_speed(uint64_t in_counter, uint64_t out_counter, unsigned int threshold_mbps) {
if (convert_speed_to_mbps(in_counter) > threshold_mbps or convert_speed_to_mbps(out_counter) > threshold_mbps) {
return true;
} else {
return false;
}
}
// Return true when we should ban this IP
2015-07-07 17:54:38 +02:00
bool we_should_ban_this_ip(map_element* average_speed_element, ban_settings_t current_ban_settings) {
// we detect overspeed by packets
2015-09-11 17:20:45 +02:00
if (current_ban_settings.enable_ban_for_pps &&
exceed_pps_speed(average_speed_element->in_packets, average_speed_element->out_packets,
current_ban_settings.ban_threshold_pps)) {
logger << log4cpp::Priority::DEBUG << "We detected this attack by pps limit";
2015-09-11 17:41:07 +02:00
return true;
}
2015-09-11 17:20:45 +02:00
if (current_ban_settings.enable_ban_for_bandwidth &&
exceed_mbps_speed(average_speed_element->in_bytes, average_speed_element->out_bytes,
current_ban_settings.ban_threshold_mbps)) {
logger << log4cpp::Priority::DEBUG << "We detected this attack by mbps limit";
2015-09-11 17:41:07 +02:00
return true;
}
2015-07-07 17:54:38 +02:00
if (current_ban_settings.enable_ban_for_flows_per_second &&
exceed_flow_speed(average_speed_element->in_flows, average_speed_element->out_flows,
current_ban_settings.ban_threshold_flows)) {
logger << log4cpp::Priority::DEBUG << "We detected this attack by flow limit";
2015-09-11 17:41:07 +02:00
return true;
}
// We could try per protocol thresholds here
// Per protocol pps thresholds
if (current_ban_settings.enable_ban_for_tcp_pps &&
exceed_pps_speed(average_speed_element->tcp_in_packets, average_speed_element->tcp_out_packets,
current_ban_settings.ban_threshold_tcp_pps)) {
logger << log4cpp::Priority::DEBUG << "We detected this attack by tcp pps limit";
return true;
}
if (current_ban_settings.enable_ban_for_udp_pps &&
exceed_pps_speed(average_speed_element->udp_in_packets, average_speed_element->udp_out_packets,
current_ban_settings.ban_threshold_udp_pps)) {
logger << log4cpp::Priority::DEBUG << "We detected this attack by udp pps limit";
return true;
}
if (current_ban_settings.enable_ban_for_icmp_pps &&
exceed_pps_speed(average_speed_element->icmp_in_packets, average_speed_element->icmp_out_packets,
current_ban_settings.ban_threshold_icmp_pps)) {
logger << log4cpp::Priority::DEBUG << "We detected this attack by icmp pps limit";
return true;
}
// Per protocol bandwidth thresholds
if (current_ban_settings.enable_ban_for_tcp_bandwidth &&
exceed_mbps_speed(average_speed_element->tcp_in_bytes, average_speed_element->tcp_out_bytes,
current_ban_settings.ban_threshold_tcp_mbps)) {
logger << log4cpp::Priority::DEBUG << "We detected this attack by tcp mbps limit";
return true;
}
if (current_ban_settings.enable_ban_for_udp_bandwidth &&
exceed_mbps_speed(average_speed_element->udp_in_bytes, average_speed_element->udp_out_bytes,
current_ban_settings.ban_threshold_udp_mbps)) {
logger << log4cpp::Priority::DEBUG << "We detected this attack by udp mbps limit";
return true;
}
if (current_ban_settings.enable_ban_for_icmp_bandwidth &&
exceed_mbps_speed(average_speed_element->icmp_in_bytes, average_speed_element->icmp_out_bytes,
current_ban_settings.ban_threshold_icmp_mbps)) {
logger << log4cpp::Priority::DEBUG << "We detected this attack by icmp mbps limit";
return true;
}
2015-09-11 17:41:07 +02:00
return false;
}
std::string generate_flow_spec_for_amplification_attack(amplification_attack_type_t amplification_attack_type,
std::string destination_ip) {
exabgp_flow_spec_rule_t exabgp_rule;
bgp_flow_spec_action_t my_action;
// We drop all traffic by default
my_action.set_type(FLOW_SPEC_ACTION_DISCARD);
// Assign action to the rule
exabgp_rule.set_action(my_action);
// TODO: rewrite!
exabgp_rule.set_destination_subnet(
convert_subnet_from_string_to_binary_with_cidr_format(destination_ip + "/32"));
// We use only UDP here
exabgp_rule.add_protocol(FLOW_SPEC_PROTOCOL_UDP);
if (amplification_attack_type == AMPLIFICATION_ATTACK_DNS) {
exabgp_rule.add_source_port(53);
} else if (amplification_attack_type == AMPLIFICATION_ATTACK_NTP) {
exabgp_rule.add_source_port(123);
} else if (amplification_attack_type == AMPLIFICATION_ATTACK_SSDP) {
exabgp_rule.add_source_port(1900);
} else if (amplification_attack_type == AMPLIFICATION_ATTACK_SNMP) {
exabgp_rule.add_source_port(161);
} else if (amplification_attack_type == AMPLIFICATION_ATTACK_CHARGEN) {
exabgp_rule.add_source_port(19);
}
return exabgp_rule.serialize_single_line_exabgp_v4_configuration();
}
2015-07-30 18:00:42 +02:00
std::string get_amplification_attack_type(amplification_attack_type_t attack_type) {
if (attack_type == AMPLIFICATION_ATTACK_UNKNOWN) {
return "unknown";
} else if (attack_type == AMPLIFICATION_ATTACK_DNS) {
return "dns_amplification";
} else if (attack_type == AMPLIFICATION_ATTACK_NTP) {
return "ntp_amplification";
} else if (attack_type == AMPLIFICATION_ATTACK_SSDP) {
return "ssdp_amplification";
} else if (attack_type == AMPLIFICATION_ATTACK_SNMP) {
return "snmp_amplification";
} else if (attack_type == AMPLIFICATION_ATTACK_CHARGEN) {
return "chargen_amplification";
} else {
return "unexpected";
}
}
// We calculate speed from packet counters here
inline void build_speed_counters_from_packet_counters(map_element& new_speed_element,
map_element* vector_itr,
double speed_calc_period) {
// calculate_speed(new_speed_element speed_element, vector_itr* );
new_speed_element.in_packets = uint64_t((double)vector_itr->in_packets / speed_calc_period);
new_speed_element.out_packets = uint64_t((double)vector_itr->out_packets / speed_calc_period);
new_speed_element.in_bytes = uint64_t((double)vector_itr->in_bytes / speed_calc_period);
new_speed_element.out_bytes = uint64_t((double)vector_itr->out_bytes / speed_calc_period);
// Fragmented
new_speed_element.fragmented_in_packets =
uint64_t((double)vector_itr->fragmented_in_packets / speed_calc_period);
new_speed_element.fragmented_out_packets =
uint64_t((double)vector_itr->fragmented_out_packets / speed_calc_period);
new_speed_element.fragmented_in_bytes =
uint64_t((double)vector_itr->fragmented_in_bytes / speed_calc_period);
new_speed_element.fragmented_out_bytes =
uint64_t((double)vector_itr->fragmented_out_bytes / speed_calc_period);
// By protocol counters
// TCP
new_speed_element.tcp_in_packets = uint64_t((double)vector_itr->tcp_in_packets / speed_calc_period);
new_speed_element.tcp_out_packets = uint64_t((double)vector_itr->tcp_out_packets / speed_calc_period);
new_speed_element.tcp_in_bytes = uint64_t((double)vector_itr->tcp_in_bytes / speed_calc_period);
new_speed_element.tcp_out_bytes = uint64_t((double)vector_itr->tcp_out_bytes / speed_calc_period);
// TCP syn
new_speed_element.tcp_syn_in_packets = uint64_t((double)vector_itr->tcp_syn_in_packets / speed_calc_period);
new_speed_element.tcp_syn_out_packets =
uint64_t((double)vector_itr->tcp_syn_out_packets / speed_calc_period);
new_speed_element.tcp_syn_in_bytes = uint64_t((double)vector_itr->tcp_syn_in_bytes / speed_calc_period);
new_speed_element.tcp_syn_out_bytes = uint64_t((double)vector_itr->tcp_syn_out_bytes / speed_calc_period);
// UDP
new_speed_element.udp_in_packets = uint64_t((double)vector_itr->udp_in_packets / speed_calc_period);
new_speed_element.udp_out_packets = uint64_t((double)vector_itr->udp_out_packets / speed_calc_period);
new_speed_element.udp_in_bytes = uint64_t((double)vector_itr->udp_in_bytes / speed_calc_period);
new_speed_element.udp_out_bytes = uint64_t((double)vector_itr->udp_out_bytes / speed_calc_period);
// ICMP
new_speed_element.icmp_in_packets = uint64_t((double)vector_itr->icmp_in_packets / speed_calc_period);
new_speed_element.icmp_out_packets = uint64_t((double)vector_itr->icmp_out_packets / speed_calc_period);
new_speed_element.icmp_in_bytes = uint64_t((double)vector_itr->icmp_in_bytes / speed_calc_period);
new_speed_element.icmp_out_bytes = uint64_t((double)vector_itr->icmp_out_bytes / speed_calc_period);
}
inline void build_average_speed_counters_from_speed_counters(map_element* current_average_speed_element,
map_element& new_speed_element,
double exp_value,
double exp_power) {
// Global bytes counters
current_average_speed_element->in_bytes =
uint64_t(new_speed_element.in_bytes + exp_value * ((double)current_average_speed_element->in_bytes -
(double)new_speed_element.in_bytes));
current_average_speed_element->out_bytes =
uint64_t(new_speed_element.out_bytes + exp_value * ((double)current_average_speed_element->out_bytes -
(double)new_speed_element.out_bytes));
// Global packet counters
current_average_speed_element->in_packets =
uint64_t(new_speed_element.in_packets + exp_value * ((double)current_average_speed_element->in_packets -
(double)new_speed_element.in_packets));
current_average_speed_element->out_packets =
uint64_t(new_speed_element.out_packets + exp_value * ((double)current_average_speed_element->out_packets -
(double)new_speed_element.out_packets));
// Per packet type packet counters for in traffic
current_average_speed_element->fragmented_in_packets =
uint64_t(new_speed_element.fragmented_in_packets +
exp_value * ((double)current_average_speed_element->fragmented_in_packets -
(double)new_speed_element.fragmented_in_packets));
current_average_speed_element->tcp_in_packets =
uint64_t(new_speed_element.tcp_in_packets + exp_value * ((double)current_average_speed_element->tcp_in_packets -
(double)new_speed_element.tcp_in_packets));
current_average_speed_element->tcp_syn_in_packets =
uint64_t(new_speed_element.tcp_syn_in_packets +
exp_value * ((double)current_average_speed_element->tcp_syn_in_packets -
(double)new_speed_element.tcp_syn_in_packets));
current_average_speed_element->udp_in_packets =
uint64_t(new_speed_element.udp_in_packets + exp_value * ((double)current_average_speed_element->udp_in_packets -
(double)new_speed_element.udp_in_packets));
current_average_speed_element->icmp_in_packets =
uint64_t(new_speed_element.icmp_in_packets + exp_value * ((double)current_average_speed_element->icmp_in_packets -
(double)new_speed_element.icmp_in_packets));
// Per packet type packets counters for out
current_average_speed_element->fragmented_out_packets =
uint64_t(new_speed_element.fragmented_out_packets +
exp_value * ((double)current_average_speed_element->fragmented_out_packets -
(double)new_speed_element.fragmented_out_packets));
current_average_speed_element->tcp_out_packets =
uint64_t(new_speed_element.tcp_out_packets + exp_value * ((double)current_average_speed_element->tcp_out_packets -
(double)new_speed_element.tcp_out_packets));
current_average_speed_element->tcp_syn_out_packets =
uint64_t(new_speed_element.tcp_syn_out_packets +
exp_value * ((double)current_average_speed_element->tcp_syn_out_packets -
(double)new_speed_element.tcp_syn_out_packets));
current_average_speed_element->udp_out_packets =
uint64_t(new_speed_element.udp_out_packets + exp_value * ((double)current_average_speed_element->udp_out_packets -
(double)new_speed_element.udp_out_packets));
current_average_speed_element->icmp_out_packets = uint64_t(
new_speed_element.icmp_out_packets + exp_value * ((double)current_average_speed_element->icmp_out_packets -
(double)new_speed_element.icmp_out_packets));
// Per packet type bytes counter for out
current_average_speed_element->fragmented_out_bytes =
uint64_t(new_speed_element.fragmented_out_bytes +
exp_value * ((double)current_average_speed_element->fragmented_out_bytes -
(double)new_speed_element.fragmented_out_bytes));
current_average_speed_element->tcp_out_bytes =
uint64_t(new_speed_element.tcp_out_bytes + exp_value * ((double)current_average_speed_element->tcp_out_bytes -
(double)new_speed_element.tcp_out_bytes));
current_average_speed_element->tcp_syn_out_bytes = uint64_t(
new_speed_element.tcp_syn_out_bytes + exp_value * ((double)current_average_speed_element->tcp_syn_out_bytes -
(double)new_speed_element.tcp_syn_out_bytes));
current_average_speed_element->udp_out_bytes =
uint64_t(new_speed_element.udp_out_bytes + exp_value * ((double)current_average_speed_element->udp_out_bytes -
(double)new_speed_element.udp_out_bytes));
current_average_speed_element->icmp_out_bytes =
uint64_t(new_speed_element.icmp_out_bytes + exp_value * ((double)current_average_speed_element->icmp_out_bytes -
(double)new_speed_element.icmp_out_bytes));
// Per packet type bytes counter for in
current_average_speed_element->fragmented_in_bytes =
uint64_t(new_speed_element.fragmented_in_bytes +
exp_value * ((double)current_average_speed_element->fragmented_in_bytes -
(double)new_speed_element.fragmented_in_bytes));
current_average_speed_element->tcp_in_bytes =
uint64_t(new_speed_element.tcp_in_bytes + exp_value * ((double)current_average_speed_element->tcp_in_bytes -
(double)new_speed_element.tcp_in_bytes));
current_average_speed_element->tcp_syn_in_bytes = uint64_t(
new_speed_element.tcp_syn_in_bytes + exp_value * ((double)current_average_speed_element->tcp_syn_in_bytes -
(double)new_speed_element.tcp_syn_in_bytes));
current_average_speed_element->udp_in_bytes =
uint64_t(new_speed_element.udp_in_bytes + exp_value * ((double)current_average_speed_element->udp_in_bytes -
(double)new_speed_element.udp_in_bytes));
current_average_speed_element->icmp_in_bytes =
uint64_t(new_speed_element.icmp_in_bytes + exp_value * ((double)current_average_speed_element->icmp_in_bytes -
(double)new_speed_element.icmp_in_bytes));
}