fastnetmon-ng/src/fastnetmon.cpp

/* Author: pavel.odintsov@gmail.com */
/* License: GPLv2 */

#include <stdio.h>
#include <stdlib.h>
#include <errno.h>
#include <string.h>
#include <unistd.h>
#include <signal.h>
#include <time.h>
#include <math.h>

#include <sys/socket.h>
#include <sys/resource.h>
#include <sys/stat.h>
#include <arpa/inet.h>
#include <netinet/ip.h>
#include <netinet/tcp.h>
#include <netinet/udp.h>
#include <netinet/ip_icmp.h>
#include <netinet/if_ether.h>
#include <netinet/in.h>

#include "libpatricia/patricia.h"
#include "fastnetmon_types.h"
#include "fast_library.h"

// Plugins
#include "sflow_plugin/sflow_collector.h"
#include "netflow_plugin/netflow_collector.h"
#include "pcap_plugin/pcap_collector.h"
#include "netmap_plugin/netmap_collector.h"

#ifdef PF_RING
#include "pfring_plugin/pfring_collector.h"
#endif

// Yes, maybe it's not an good idea but with this we can guarantee working code in example plugin
#include "example_plugin/example_collector.h"


#include <algorithm>
#include <iostream>
#include <map>
#include <fstream>

#include <vector>
#include <utility>
#include <sstream>

#include <boost/thread.hpp>
#include <boost/thread/mutex.hpp>
#include <boost/regex.hpp>

// log4cpp logging facility
#include "log4cpp/Category.hh"
#include "log4cpp/Appender.hh"
#include "log4cpp/FileAppender.hh"
#include "log4cpp/OstreamAppender.hh"
#include "log4cpp/Layout.hh"
#include "log4cpp/BasicLayout.hh"
#include "log4cpp/PatternLayout.hh"
#include "log4cpp/Priority.hh"

// Boost libs
#include <boost/algorithm/string.hpp>

#ifdef GEOIP
#include "GeoIP.h"
#endif

#ifdef REDIS
#include <hiredis/hiredis.h>
#endif

std::string pid_path = "/var/run/fastnetmon.pid";
std::string global_config_path = "/etc/fastnetmon.conf";

time_t last_call_of_traffic_recalculation;

// Variable with all data from main screen
std::string screen_data_stats = "";

// Global map with parsed config file
std::map<std::string, std::string> configuration_map;

/* Configuration block, we must move it to configuration file  */
#ifdef REDIS
unsigned int redis_port = 6379;
std::string redis_host = "127.0.0.1";
// because it's additional and very specific feature we should disable it by default
bool redis_enabled = false;
#endif

// This flag could enable print of ban actions and thresholds on the client's screen 
bool print_configuration_params_on_the_screen = false;

// Trigger for enable or disable traffic counting for whole subnets
bool enable_subnet_counters = false;

// We will announce whole subnet instead single IP with BGP if this flag enabled
bool exabgp_announce_whole_subnet = false;

bool enable_ban_for_pps = false;
bool enable_ban_for_bandwidth = false;
bool enable_ban_for_flows_per_second = false;

bool enable_conection_tracking = true;

bool enable_data_collection_from_mirror = true;
bool enable_netmap_collection = false;
bool enable_sflow_collection = false;
bool enable_netflow_collection = false;
bool enable_pcap_collection = false;

// Time consumed by reaclculation for all IPs
struct timeval speed_calculation_time;

// Time consumed by drawing stats for all IPs
struct timeval drawing_thread_execution_time;

// Global thread group for packet capture threads
boost::thread_group packet_capture_plugin_thread_group;

// Total number of hosts in our networks
// We need this as global variable because it's very important value for configuring data structures
unsigned int total_number_of_hosts_in_our_networks = 0;

#ifdef GEOIP
GeoIP* geo_ip = NULL;
#endif

patricia_tree_t* lookup_tree, *whitelist_tree;

bool DEBUG = 0;

// flag about dumping all packets to log
bool DEBUG_DUMP_ALL_PACKETS = false;

// Period for update screen for console version of tool
unsigned int check_period = 3;

// Standard ban time in seconds for all attacks but you can tune this value
int standard_ban_time = 1800;

// We calc average pps/bps for this time
double average_calculation_amount = 15;

// Show average or absolute value of speed
bool print_average_traffic_counts = true;

// Key used for sorting clients in output.  Allowed sort params: packets/bytes/flows
std::string sort_parameter = "packets";

// Path to notify script
std::string notify_script_path = "/usr/local/bin/notify_about_attack.sh";

// Path to file with networks for whitelising
std::string white_list_path = "/etc/networks_whitelist";

// Path to file with all networks listing
std::string networks_list_path = "/etc/networks_list";

// Number of lines in programm output
unsigned int max_ips_in_list = 7;

// We must ban IP if it exceeed this limit in PPS
unsigned int ban_threshold_pps = 20000;

// We must ban IP of it exceed this limit for number of flows in any direction
unsigned int ban_threshold_flows = 3500;

// We must ban client if it exceed 1GBps
unsigned int ban_threshold_mbps = 1000;

// Number of lines for sending ben attack details to email
unsigned int ban_details_records_count = 500;


// log file
log4cpp::Category& logger = log4cpp::Category::getRoot();
std::string log_file_path = "/var/log/fastnetmon.log";
std::string attack_details_folder = "/var/log/fastnetmon_attacks";

/* Configuration block ends */

// We count total number of incoming/outgoing/internal and other traffic type packets/bytes
// And initilize by 0 all fields
total_counter_element total_counters[4];
total_counter_element total_speed_counters[4];

// Total amount of non parsed packets
uint64_t total_unparsed_packets = 0;

uint64_t incoming_total_flows_speed = 0;
uint64_t outgoing_total_flows_speed = 0;

map_of_vector_counters SubnetVectorMap;

// Here we store taffic per subnet
map_for_subnet_counters PerSubnetCountersMap;

// Here we store traffic speed per subnet
map_for_subnet_counters PerSubnetSpeedMap;


// Flow tracking structures
map_of_vector_counters_for_flow SubnetVectorMapFlow;

/* End of our data structs */

boost::mutex data_counters_mutex;
boost::mutex speed_counters_mutex;
boost::mutex total_counters_mutex;

boost::mutex ban_list_details_mutex;

boost::mutex ban_list_mutex;
boost::mutex flow_counter;

// map for flows
std::map<uint64_t, int> FlowCounter;

// Struct for string speed per IP
map_for_counters SpeedCounter;

// Struct for storing average speed per IP for specified interval
map_for_counters SpeedCounterAverage;

#ifdef GEOIP
map_for_counters GeoIpCounter;
#endif

// In ddos info we store attack power and direction
std::map<uint32_t, banlist_item> ban_list;
std::map<uint32_t, std::vector<simple_packet> > ban_list_details;

std::vector<subnet_t> our_networks;
std::vector<subnet_t> whitelist_networks;

// Ban enable/disable flag
bool we_do_real_ban = true;

// ExaBGP support flag
bool exabgp_enabled = false;
std::string exabgp_community = "";
std::string exabgp_command_pipe = "/var/run/exabgp.cmd";
std::string exabgp_next_hop = "";

// Graphite monitoring
bool graphite_enabled = false;
std::string graphite_host = "127.0.0.1";
unsigned short int graphite_port = 2003;
std::string graphite_prefix = "fastnetmon.";

bool process_incoming_traffic = true;
bool process_outgoing_traffic = true;

// Prototypes
#ifdef HWFILTER_LOCKING
void block_all_traffic_with_82599_hardware_filtering(std::string client_ip_as_string);
#endif

std::string print_subnet_load();
std::string get_printable_attack_name(attack_type_t attack);
attack_type_t detect_attack_type(attack_details& current_attack);
bool we_should_ban_this_ip(map_element* current_average_speed_element);
unsigned int get_max_used_protocol(uint64_t tcp, uint64_t udp, uint64_t icmp);
void print_attack_details_to_file(std::string details, std::string client_ip_as_string, attack_details current_attack);
std::string print_ban_thresholds();
bool load_configuration_file();
std::string print_flow_tracking_for_ip(conntrack_main_struct& conntrack_element, std::string client_ip);
void convert_integer_to_conntrack_hash_struct(packed_session* packed_connection_data,
                                              packed_conntrack_hash* unpacked_data);
uint64_t convert_conntrack_hash_struct_to_integer(packed_conntrack_hash* struct_value);
void cleanup_ban_list();
std::string get_attack_description(uint32_t client_ip, attack_details& current_attack);
void send_attack_details(uint32_t client_ip, attack_details current_attack_details);
void free_up_all_resources();
std::string print_ddos_attack_details();
void execute_ip_ban(uint32_t client_ip,
                    map_element new_speed_element,
                    map_element current_speed_element,
                    std::string flow_attack_details);
direction get_packet_direction(uint32_t src_ip, uint32_t dst_ip, unsigned long& subnet, unsigned int& subnet_cidr_mask);
void recalculate_speed();
std::string print_channel_speed(std::string traffic_type, direction packet_direction);
void process_packet(simple_packet& current_packet);
void traffic_draw_programm();
void interruption_signal_handler(int signal_number);

/* Class for custom comparison fields by different fields */
class TrafficComparatorClass {
    private:
    sort_type sort_field;
    direction sort_direction;

    public:
    TrafficComparatorClass(direction sort_direction, sort_type sort_field) {
        this->sort_field = sort_field;
        this->sort_direction = sort_direction;
    }

    bool operator()(pair_of_map_elements a, pair_of_map_elements b) {
        if (sort_field == FLOWS) {
            if (sort_direction == INCOMING) {
                return a.second.in_flows > b.second.in_flows;
            } else if (sort_direction == OUTGOING) {
                return a.second.out_flows > b.second.out_flows;
            } else {
                return false;
            }
        } else if (sort_field == PACKETS) {
            if (sort_direction == INCOMING) {
                return a.second.in_packets > b.second.in_packets;
            } else if (sort_direction == OUTGOING) {
                return a.second.out_packets > b.second.out_packets;
            } else {
                return false;
            }
        } else if (sort_field == BYTES) {
            if (sort_direction == INCOMING) {
                return a.second.in_bytes > b.second.in_bytes;
            } else if (sort_direction == OUTGOING) {
                return a.second.out_bytes > b.second.out_bytes;
            } else {
                return false;
            }
        } else {
            return false;
        }
    }
};

std::string get_direction_name(direction direction_value) {
    std::string direction_name;

    switch (direction_value) {
    case INCOMING:
        direction_name = "incoming";
        break;
    case OUTGOING:
        direction_name = "outgoing";
        break;
    case INTERNAL:
        direction_name = "internal";
        break;
    case OTHER:
        direction_name = "other";
        break;
    default:
        direction_name = "unknown";
        break;
    }

    return direction_name;
}

void sigpipe_handler_for_popen(int signo) {
    logger << log4cpp::Priority::ERROR << "Sorry but we experienced error with popen. "
           << "Please check your scripts. It should receive data on stdin!";

    exit(1);
}

// exec command and pass data to it stdin
bool exec_with_stdin_params(std::string cmd, std::string params) {
    FILE* pipe = popen(cmd.c_str(), "w");
    if (!pipe) {
        logger << log4cpp::Priority::ERROR << "Can't execute programm " << cmd
               << " error code: " << errno << " error text: " << strerror(errno);
        return false;
    }

    int fputs_ret = fputs(params.c_str(), pipe);

    if (fputs_ret) {
        pclose(pipe);
        return true;
    } else {
        logger << log4cpp::Priority::ERROR << "Can't pass data to stdin of programm " << cmd;
        pclose(pipe);
        return false;
    }
}

#ifdef GEOIP
bool geoip_init() {
    // load GeoIP ASN database to memory
    geo_ip = GeoIP_open("/root/fastnetmon/GeoIPASNum.dat", GEOIP_MEMORY_CACHE);

    if (geo_ip == NULL) {
        return false;
    } else {
        return true;
    }
}
#endif

#ifdef REDIS
redisContext* redis_init_connection() {
    struct timeval timeout = { 1, 500000 }; // 1.5 seconds
    redisContext* redis_context = redisConnectWithTimeout(redis_host.c_str(), redis_port, timeout);
    if (redis_context->err) {
        logger << log4cpp::Priority::INFO << "Connection error:" << redis_context->errstr;
        return NULL;
    }

    // We should check connection with ping because redis do not check connection
    redisReply* reply = (redisReply*)redisCommand(redis_context, "PING");
    if (reply) {
        freeReplyObject(reply);
    } else {
        return NULL;
    }

    return redis_context;
}
#endif

#ifdef REDIS
void store_data_in_redis(std::string key_name, std::string attack_details) {
    redisReply* reply = NULL;
    redisContext* redis_context = redis_init_connection();

    if (!redis_context) {
        logger << log4cpp::Priority::INFO << "Could not initiate connection to Redis";
        return;
    }

    reply = (redisReply*)redisCommand(redis_context, "SET %s %s", key_name.c_str(), attack_details.c_str());

    // If we store data correctly ...
    if (!reply) {
        logger.error("Can't increment traffic in redis error_code: %d error_string: %s",
                     redis_context->err, redis_context->errstr);

        // Handle redis server restart corectly
        if (redis_context->err == 1 or redis_context->err == 3) {
            // Connection refused
            logger.error(
            "Unfortunately we can't store data in Redis because server reject connection");
        }
    } else {
        freeReplyObject(reply);
    }

    redisFree(redis_context);
}
#endif

std::string draw_table(map_for_counters& my_map_packets, direction data_direction, bool do_redis_update, sort_type sort_item) {
    std::vector<pair_of_map_elements> vector_for_sort;

    std::stringstream output_buffer;

    // Preallocate memory for sort vector
    vector_for_sort.reserve(my_map_packets.size());

    for (map_for_counters::iterator ii = my_map_packets.begin(); ii != my_map_packets.end(); ++ii) {
        // store all elements into vector for sorting
        vector_for_sort.push_back(std::make_pair((*ii).first, (*ii).second));
    }

    if (data_direction == INCOMING or data_direction == OUTGOING) {
        std::sort(vector_for_sort.begin(), vector_for_sort.end(),
                  TrafficComparatorClass(data_direction, sort_item));
    } else {
        logger << log4cpp::Priority::ERROR << "Unexpected bahaviour on sort function";
        return "Internal error";
    }

    graphite_data_t graphite_data;

    unsigned int element_number = 0;
    // TODO: fix this code because iteraton over over millions of IPs is very CPU intensive
    for (std::vector<pair_of_map_elements>::iterator ii = vector_for_sort.begin();
         ii != vector_for_sort.end(); ++ii) {
        uint32_t client_ip = (*ii).first;
        std::string client_ip_as_string = convert_ip_as_uint_to_string((*ii).first);

        uint64_t pps = 0;
        uint64_t bps = 0;
        uint64_t flows = 0;

        uint64_t pps_average = 0;
        uint64_t bps_average = 0;
        uint64_t flows_average = 0;

        // TODO: replace map by vector iteration
        map_element* current_average_speed_element = &SpeedCounterAverage[client_ip];
        map_element* current_speed_element = &SpeedCounter[client_ip];

        // Create polymorphic pps, byte and flow counters
        if (data_direction == INCOMING) {
            pps = current_speed_element->in_packets;
            bps = current_speed_element->in_bytes;
            flows = current_speed_element->in_flows;

            pps_average = current_average_speed_element->in_packets;
            bps_average = current_average_speed_element->in_bytes;
            flows_average = current_average_speed_element->in_flows;
        } else if (data_direction == OUTGOING) {
            pps = current_speed_element->out_packets;
            bps = current_speed_element->out_bytes;
            flows = current_speed_element->out_flows;

            pps_average = current_average_speed_element->out_packets;
            bps_average = current_average_speed_element->out_bytes;
            flows_average = current_average_speed_element->out_flows;
        }

        uint64_t mbps = convert_speed_to_mbps(bps);
        uint64_t mbps_average = convert_speed_to_mbps(bps_average);

        // Print first max_ips_in_list elements in list, we will show top 20 "huge" channel loaders
        if (element_number < max_ips_in_list) {
            std::string is_banned = ban_list.count(client_ip) > 0 ? " *banned* " : "";
            // We use setw for alignment
            output_buffer << client_ip_as_string << "\t\t";

            if (graphite_enabled) {
                std::string direction_as_string;

                if (data_direction == INCOMING) {
                    direction_as_string = "incoming";
                } else if (data_direction == OUTGOING) {
                    direction_as_string = "outgoing";
                }

                std::string ip_as_string_with_dash_delimiters = client_ip_as_string;
                // Replace dots by dashes
                std::replace(ip_as_string_with_dash_delimiters.begin(),
                             ip_as_string_with_dash_delimiters.end(), '.', '_');

                graphite_data[graphite_prefix + ip_as_string_with_dash_delimiters + "." + direction_as_string + ".pps"] =
                pps;
                graphite_data[graphite_prefix + ip_as_string_with_dash_delimiters + "." + direction_as_string + ".mbps"] =
                mbps;
                graphite_data[graphite_prefix + ip_as_string_with_dash_delimiters + "." + direction_as_string + ".flows"] =
                flows;
            }

            if (print_average_traffic_counts) {
                output_buffer << std::setw(6) << pps_average << " pps ";
                output_buffer << std::setw(6) << mbps_average << " mbps ";
                output_buffer << std::setw(6) << flows_average << " flows ";
            } else {
                output_buffer << std::setw(6) << pps << " pps ";
                output_buffer << std::setw(6) << mbps << " mbps ";
                output_buffer << std::setw(6) << flows << " flows ";
            }

            output_buffer << is_banned << std::endl;
        }

        element_number++;
    }

    if (graphite_enabled) {
        bool graphite_put_result = store_data_to_graphite(graphite_port, graphite_host, graphite_data);

        if (!graphite_put_result) {
            logger << log4cpp::Priority::ERROR << "Can't store data to Graphite";
        }
    }

    return output_buffer.str();
}

// TODO: move to lirbary
// read whole file to vector
std::vector<std::string> read_file_to_vector(std::string file_name) {
    std::vector<std::string> data;
    std::string line;

    std::ifstream reading_file;

    reading_file.open(file_name.c_str(), std::ifstream::in);
    if (reading_file.is_open()) {
        while (getline(reading_file, line)) {
            data.push_back(line);
        }
    } else {
        logger << log4cpp::Priority::ERROR << "Can't open file: " << file_name;
    }

    return data;
}

// Load configuration
bool load_configuration_file() {
    std::ifstream config_file(global_config_path.c_str());
    std::string line;

    if (!config_file.is_open()) {
        logger << log4cpp::Priority::ERROR << "Can't open config file";
        return false;
    }

    while (getline(config_file, line)) {
        std::vector<std::string> parsed_config;

        if (line.find("#") == 0 or line.empty()) {
            // Ignore comments line
            continue;
        }

        boost::split(parsed_config, line, boost::is_any_of(" ="), boost::token_compress_on);

        if (parsed_config.size() == 2) {
            configuration_map[parsed_config[0]] = parsed_config[1];
        } else {
            logger << log4cpp::Priority::ERROR << "Can't parse config line: '" << line << "'";
        }
    }

    if (configuration_map.count("enable_connection_tracking")) {
        if (configuration_map["enable_connection_tracking"] == "on") {
            enable_conection_tracking = true;
        } else {
            enable_conection_tracking = false;
        }
    }

    if (configuration_map.count("ban_time") != 0) {
        standard_ban_time = convert_string_to_integer(configuration_map["ban_time"]);
    }

    if (configuration_map.count("average_calculation_time") != 0) {
        average_calculation_amount =
        convert_string_to_integer(configuration_map["average_calculation_time"]);
    }

    if (configuration_map.count("threshold_pps") != 0) {
        ban_threshold_pps = convert_string_to_integer(configuration_map["threshold_pps"]);
    }

    if (configuration_map.count("threshold_mbps") != 0) {
        ban_threshold_mbps = convert_string_to_integer(configuration_map["threshold_mbps"]);
    }

    if (configuration_map.count("threshold_flows") != 0) {
        ban_threshold_flows = convert_string_to_integer(configuration_map["threshold_flows"]);
    }

    if (configuration_map.count("enable_ban") != 0) {
        if (configuration_map["enable_ban"] == "on") {
            we_do_real_ban = true;
        } else {
            we_do_real_ban = false;
        }
    }

    if (configuration_map.count("exabgp") != 0) {
        if (configuration_map["exabgp"] == "on") {
            exabgp_enabled = true;
        } else {
            exabgp_enabled = false;
        }
    }

    if (exabgp_enabled) {
        // TODO: add community format validation
        exabgp_community = configuration_map["exabgp_community"];
        if (exabgp_community.empty()) {
            logger << log4cpp::Priority::ERROR
                   << "You enabled exabgp but not specified community, we disable exabgp support";
            exabgp_enabled = false;
        }
    }

    if (exabgp_enabled) {
        exabgp_command_pipe = configuration_map["exabgp_command_pipe"];

        if (exabgp_command_pipe.empty()) {
            logger << log4cpp::Priority::ERROR << "You enabled exabgp but not specified "
                                                  "exabgp_command_pipe, so we disable exabgp "
                                                  "support";

            exabgp_enabled = false;
        }
    }

    if (exabgp_enabled) {
        exabgp_next_hop = configuration_map["exabgp_next_hop"];

        if (exabgp_next_hop.empty()) {
            logger
            << log4cpp::Priority::ERROR
            << "You enabled exabgp but not specified exabgp_next_hop, so we disable exabgp support";

            exabgp_enabled = false;
        }

        if (exabgp_enabled) {
            logger << log4cpp::Priority::INFO << "ExaBGP support initialized correctly";
        }
    }

    if (configuration_map.count("sflow") != 0) {
        if (configuration_map["sflow"] == "on") {
            enable_sflow_collection = true;
        } else {
            enable_sflow_collection = false;
        }
    }

    if (configuration_map.count("netflow") != 0) {
        if (configuration_map["netflow"] == "on") {
            enable_netflow_collection = true;
        } else {
            enable_netflow_collection = false;
        }
    }

    if (configuration_map.count("exabgp_announce_whole_subnet") != 0) {
        exabgp_announce_whole_subnet = configuration_map["exabgp_announce_whole_subnet"] == "on" ? true : false;
    }

    if (configuration_map.count("enable_subnet_counters") != 0) {
        enable_subnet_counters = configuration_map["enable_subnet_counters"] == "on" ? true : false;
    }

    // Graphite
    if (configuration_map.count("graphite") != 0) {
        graphite_enabled = configuration_map["graphite"] == "on" ? true : false;
    }

    if (configuration_map.count("graphite_host") != 0) {
        graphite_host = configuration_map["graphite_host"];
    }

    if (configuration_map.count("graphite_port") != 0) {
        graphite_port = convert_string_to_integer(configuration_map["graphite_port"]);
    }

    if (configuration_map.count("process_incoming_traffic") != 0) {
        process_incoming_traffic = configuration_map["process_incoming_traffic"] == "on" ? true : false;
    }

    if (configuration_map.count("process_outgoing_traffic") != 0) {
        process_outgoing_traffic = configuration_map["process_outgoing_traffic"] == "on" ? true : false;
    }

    if (configuration_map.count("mirror") != 0) {
        if (configuration_map["mirror"] == "on") {
            enable_data_collection_from_mirror = true;
        } else {
            enable_data_collection_from_mirror = false;
        }
    }

    if (configuration_map.count("mirror_netmap") != 0) {
        if (configuration_map["mirror_netmap"] == "on") {
            enable_netmap_collection = true;
        } else {
            enable_netmap_collection = false;
        }
    }

    if (enable_netmap_collection && enable_data_collection_from_mirror) {
        logger << log4cpp::Priority::ERROR << "You have enabled pfring and netmap data collection "
                                              "from mirror which strictly prohibited, please "
                                              "select one";
        exit(1);
    }

    if (configuration_map.count("pcap") != 0) {
        if (configuration_map["pcap"] == "on") {
            enable_pcap_collection = true;
        } else {
            enable_pcap_collection = false;
        }
    }

    if (configuration_map.count("ban_for_pps") != 0) {
        if (configuration_map["ban_for_pps"] == "on") {
            enable_ban_for_pps = true;
        } else {
            enable_ban_for_pps = false;
        }
    }

    if (configuration_map.count("ban_for_bandwidth") != 0) {
        if (configuration_map["ban_for_bandwidth"] == "on") {
            enable_ban_for_bandwidth = true;
        } else {
            enable_ban_for_bandwidth = false;
        }
    }

    if (configuration_map.count("ban_for_flows") != 0) {
        if (configuration_map["ban_for_flows"] == "on") {
            enable_ban_for_flows_per_second = true;
        } else {
            enable_ban_for_flows_per_second = false;
        }
    }

    if (configuration_map.count("white_list_path") != 0) {
        white_list_path = configuration_map["white_list_path"];
    }

    if (configuration_map.count("networks_list_path") != 0) {
        networks_list_path = configuration_map["networks_list_path"];
    }

#ifdef REDIS
    if (configuration_map.count("redis_port") != 0) {
        redis_port = convert_string_to_integer(configuration_map["redis_port"]);
    }

    if (configuration_map.count("redis_host") != 0) {
        redis_host = configuration_map["redis_host"];
    }

    if (configuration_map.count("redis_enabled") != 0) {
        if (configuration_map["redis_enabled"] == "yes") {
            redis_enabled = true;
        } else {
            redis_enabled = false;
        }
    }
#endif

    if (configuration_map.count("ban_details_records_count") != 0) {
        ban_details_records_count =
        convert_string_to_integer(configuration_map["ban_details_records_count"]);
    }

    if (configuration_map.count("check_period") != 0) {
        check_period = convert_string_to_integer(configuration_map["check_period"]);
    }

    if (configuration_map.count("sort_parameter") != 0) {
        sort_parameter = configuration_map["sort_parameter"];
    }

    if (configuration_map.count("max_ips_in_list") != 0) {
        max_ips_in_list = convert_string_to_integer(configuration_map["max_ips_in_list"]);
    }

    if (configuration_map.count("notify_script_path") != 0) {
        notify_script_path = configuration_map["notify_script_path"];
    }

    return true;
}

/* Enable core dumps for simplify debug tasks */
void enable_core_dumps() {
    struct rlimit rlim;

    int result = getrlimit(RLIMIT_CORE, &rlim);

    if (result) {
        logger << log4cpp::Priority::ERROR << "Can't get current rlimit for RLIMIT_CORE";
        return;
    } else {
        rlim.rlim_cur = rlim.rlim_max;
        setrlimit(RLIMIT_CORE, &rlim);
    }
}

void subnet_vectors_allocator(prefix_t* prefix, void* data) {
    // Network byte order
    uint32_t subnet_as_integer = prefix->add.sin.s_addr;

    u_short bitlen = prefix->bitlen;
    double base = 2;
    int network_size_in_ips = pow(base, 32 - bitlen);
    // logger<< log4cpp::Priority::INFO<<"Subnet: "<<prefix->add.sin.s_addr<<" network size:
    // "<<network_size_in_ips;
    logger << log4cpp::Priority::INFO << "I will allocate " << network_size_in_ips
           << " records for subnet " << subnet_as_integer << " cidr mask: " << bitlen;

    // Initialize map element
    SubnetVectorMap[subnet_as_integer] = vector_of_counters(network_size_in_ips);

    // Zeroify all vector elements
    map_element zero_map_element;
    memset(&zero_map_element, 0, sizeof(zero_map_element));
    std::fill(SubnetVectorMap[subnet_as_integer].begin(), SubnetVectorMap[subnet_as_integer].end(), zero_map_element);

    // Initilize map element
    SubnetVectorMapFlow[subnet_as_integer] = vector_of_flow_counters(network_size_in_ips);

    // On creating it initilizes by zeros
    conntrack_main_struct zero_conntrack_main_struct;
    std::fill(SubnetVectorMapFlow[subnet_as_integer].begin(),
              SubnetVectorMapFlow[subnet_as_integer].end(), zero_conntrack_main_struct);

    // Initilize per subnet speed and packet counters
    subnet_t current_subnet = std::make_pair(subnet_as_integer, bitlen);

    PerSubnetCountersMap[current_subnet] = zero_map_element;
    PerSubnetSpeedMap[current_subnet] = zero_map_element;
}

void zeroify_all_counters() {
    map_element zero_map_element;
    memset(&zero_map_element, 0, sizeof(zero_map_element));

    for (map_of_vector_counters::iterator itr = SubnetVectorMap.begin(); itr != SubnetVectorMap.end(); ++itr) {
        // logger<< log4cpp::Priority::INFO<<"Zeroify "<<itr->first;
        std::fill(itr->second.begin(), itr->second.end(), zero_map_element);
    }
}

void zeroify_all_flow_counters() {
    // On creating it initilizes by zeros
    conntrack_main_struct zero_conntrack_main_struct;

    // Iterate over map
    for (map_of_vector_counters_for_flow::iterator itr = SubnetVectorMapFlow.begin();
         itr != SubnetVectorMapFlow.end(); ++itr) {
        // Iterate over vector
        for (vector_of_flow_counters::iterator vector_iterator = itr->second.begin();
             vector_iterator != itr->second.end(); ++vector_iterator) {
            // TODO: rewrite this monkey code
            vector_iterator->in_tcp.clear();
            vector_iterator->in_udp.clear();
            vector_iterator->in_icmp.clear();
            vector_iterator->in_other.clear();

            vector_iterator->out_tcp.clear();
            vector_iterator->out_udp.clear();
            vector_iterator->out_icmp.clear();
            vector_iterator->out_other.clear();
        }
    }
}

bool load_our_networks_list() {
    if (file_exists(white_list_path)) {
        std::vector<std::string> network_list_from_config = read_file_to_vector(white_list_path);

        for (std::vector<std::string>::iterator ii = network_list_from_config.begin();
             ii != network_list_from_config.end(); ++ii) {
            if (ii->length() > 0 && is_cidr_subnet(ii->c_str())) {
                make_and_lookup(whitelist_tree, const_cast<char*>(ii->c_str()));
            } else {
                logger << log4cpp::Priority::ERROR << "Can't parse line from whitelist: " << *ii;
            }
        }

        logger << log4cpp::Priority::INFO << "We loaded " << network_list_from_config.size()
               << " networks from whitelist file";
    }

    std::vector<std::string> networks_list_as_string;
    // We can bould "our subnets" automatically here
    if (file_exists("/proc/vz/version")) {
        logger << log4cpp::Priority::INFO << "We found OpenVZ";
        // Add /32 CIDR mask for every IP here
        std::vector<std::string> openvz_ips = read_file_to_vector("/proc/vz/veip");
        for (std::vector<std::string>::iterator ii = openvz_ips.begin(); ii != openvz_ips.end(); ++ii) {
            // skip IPv6 addresses
            if (strstr(ii->c_str(), ":") != NULL) {
                continue;
            }

            // skip header
            if (strstr(ii->c_str(), "Version") != NULL) {
                continue;
            }

            std::vector<std::string> subnet_as_string;
            split(subnet_as_string, *ii, boost::is_any_of(" "), boost::token_compress_on);

            std::string openvz_subnet = subnet_as_string[1] + "/32";
            networks_list_as_string.push_back(openvz_subnet);
        }

        logger << log4cpp::Priority::INFO << "We loaded " << networks_list_as_string.size()
               << " networks from /proc/vz/veip";
    }

    if (file_exists("/sbin/ip")) {
        logger << log4cpp::Priority::INFO
               << "We are working on Linux and could use ip tool for detecting local IP's";

        ip_addresses_list_t ip_list = get_local_ip_addresses_list();

        logger << log4cpp::Priority::INFO << "We found " << ip_list.size()
               << " local IP addresses and will monitor they";

        for (ip_addresses_list_t::iterator iter = ip_list.begin(); iter != ip_list.end(); ++iter) {
            networks_list_as_string.push_back(*iter + "/32");
        }
    }

    if (file_exists(networks_list_path)) {
        std::vector<std::string> network_list_from_config =
        read_file_to_vector("/etc/networks_list");
        networks_list_as_string.insert(networks_list_as_string.end(), network_list_from_config.begin(),
                                       network_list_from_config.end());

        logger << log4cpp::Priority::INFO << "We loaded " << network_list_from_config.size()
               << " networks from networks file";
    }

    // Some consistency checks
    assert(convert_ip_as_string_to_uint("255.255.255.0") == convert_cidr_to_binary_netmask(24));
    assert(convert_ip_as_string_to_uint("255.255.255.255") == convert_cidr_to_binary_netmask(32));

    for (std::vector<std::string>::iterator ii = networks_list_as_string.begin();
         ii != networks_list_as_string.end(); ++ii) {
        if (ii->length() == 0) {
            // Skip blank lines in subnet list file silently
            continue;
        }

        if (!is_cidr_subnet(ii->c_str())) {
            logger << log4cpp::Priority::ERROR << "Can't parse line from subnet list: '" << *ii << "'";
            continue;
        }

        std::string network_address_in_cidr_form = *ii;

        unsigned int cidr_mask = get_cidr_mask_from_network_as_string(network_address_in_cidr_form);
        std::string network_address = get_net_address_from_network_as_string(network_address_in_cidr_form);

        double base = 2;
        total_number_of_hosts_in_our_networks += pow(base, 32 - cidr_mask);

        // Make sure it's "subnet address" and not an host address
        uint32_t subnet_address_as_uint = convert_ip_as_string_to_uint(network_address);
        uint32_t subnet_address_netmask_binary = convert_cidr_to_binary_netmask(cidr_mask);
        uint32_t generated_subnet_address = subnet_address_as_uint & subnet_address_netmask_binary;

        if (subnet_address_as_uint != generated_subnet_address) {
            std::string new_network_address_as_string =
            convert_ip_as_uint_to_string(generated_subnet_address) + "/" + convert_int_to_string(cidr_mask);

            logger << log4cpp::Priority::WARN << "We will use " << new_network_address_as_string << " instead of "
                   << network_address_in_cidr_form << " because it's host address";

            network_address_in_cidr_form = new_network_address_as_string;
        }

        make_and_lookup(lookup_tree, const_cast<char*>(network_address_in_cidr_form.c_str()));
    }

    /* Preallocate data structures */

    patricia_process(lookup_tree, (void_fn_t)subnet_vectors_allocator);

    logger << log4cpp::Priority::INFO << "We start total zerofication of counters";
    zeroify_all_counters();
    logger << log4cpp::Priority::INFO << "We finished zerofication";

    logger << log4cpp::Priority::INFO << "We loaded " << networks_list_as_string.size()
           << " subnets to our in-memory list of networks";
    logger << log4cpp::Priority::INFO
           << "Total number of monitored hosts (total size of all networks): " << total_number_of_hosts_in_our_networks;

    return true;
}

/* Process simple unified packet */
void process_packet(simple_packet& current_packet) {
    // Packets dump is very useful for bug hunting
    if (DEBUG_DUMP_ALL_PACKETS) {
        logger << log4cpp::Priority::INFO << "Dump: " << print_simple_packet(current_packet);
    }

    // Subnet for found IPs
    unsigned long subnet = 0;
    unsigned int subnet_cidr_mask = 0;
    direction packet_direction = get_packet_direction(current_packet.src_ip, current_packet.dst_ip, subnet, subnet_cidr_mask);

    // Skip processing of specific traffic direction
    if ((packet_direction == INCOMING && !process_incoming_traffic) or
        (packet_direction == OUTGOING && !process_outgoing_traffic)) {
        return;
    }

    uint32_t subnet_in_host_byte_order = 0;
    // We operate in host bytes order and need to convert subnet
    if (subnet != 0) {
        subnet_in_host_byte_order = ntohl(subnet);
    }

    // Try to find map key for this subnet
    map_of_vector_counters::iterator itr;

    // Iterator for subnet counter
    subnet_counter_t* subnet_counter = NULL;

    if (packet_direction == OUTGOING or packet_direction == INCOMING) {
        // Find element in map of vectors
        itr = SubnetVectorMap.find(subnet);

        if (itr == SubnetVectorMap.end()) {
            logger << log4cpp::Priority::ERROR << "Can't find vector address in subnet map";
            return;
        }

        if (enable_subnet_counters) {
            map_for_subnet_counters::iterator subnet_iterator;

            // Find element in map of subnet counters
            subnet_iterator = PerSubnetCountersMap.find(std::make_pair(subnet, subnet_cidr_mask));

            if (subnet_iterator == PerSubnetCountersMap.end()) {
                logger << log4cpp::Priority::ERROR << "Can't find counter structure for subnet";
                return;
            }

            subnet_counter = &subnet_iterator->second;
        }
    }

    map_of_vector_counters_for_flow::iterator itr_flow;

    if (enable_conection_tracking) {
        if (packet_direction == OUTGOING or packet_direction == INCOMING) {
            itr_flow = SubnetVectorMapFlow.find(subnet);

            if (itr_flow == SubnetVectorMapFlow.end()) {
                logger << log4cpp::Priority::ERROR
                       << "Can't find vector address in subnet flow map";
                return;
            }
        }
    }

    /* Because we support mirroring, sflow and netflow we should support different cases:
        - One packet passed for processing (mirror)
        - Multiple packets ("flows") passed for processing (netflow)
        - One sampled packed passed for processing (netflow)
        - Another combinations of this three options
    */

    uint64_t sampled_number_of_packets = current_packet.number_of_packets * current_packet.sample_ratio;
    uint64_t sampled_number_of_bytes = current_packet.length * current_packet.sample_ratio;

    __sync_fetch_and_add(&total_counters[packet_direction].packets, sampled_number_of_packets);
    __sync_fetch_and_add(&total_counters[packet_direction].bytes, sampled_number_of_bytes);

    // Incerementi main and per protocol packet counters
    if (packet_direction == OUTGOING) {
        int64_t shift_in_vector = (int64_t)ntohl(current_packet.src_ip) - (int64_t)subnet_in_host_byte_order;

        if (shift_in_vector < 0 or shift_in_vector >= itr->second.size()) {
            logger << log4cpp::Priority::ERROR << "We tried to access to element with index " << shift_in_vector
                   << " which located outside allocated vector with size " << itr->second.size();

            logger << log4cpp::Priority::ERROR
                   << "We expect issues with this packet in OUTGOING direction: "
                   << print_simple_packet(current_packet);

            return;
        }

        map_element* current_element = &itr->second[shift_in_vector];

        // Main packet/bytes counter
        __sync_fetch_and_add(&current_element->out_packets, sampled_number_of_packets);
        __sync_fetch_and_add(&current_element->out_bytes, sampled_number_of_bytes);

        // Fragmented IP packets
        if (current_packet.ip_fragmented) {
            __sync_fetch_and_add(&current_element->fragmented_out_packets, sampled_number_of_packets);
            __sync_fetch_and_add(&current_element->fragmented_out_bytes, sampled_number_of_bytes);
        }

        // TODO: add another counters
        if (enable_subnet_counters) {
            __sync_fetch_and_add(&subnet_counter->out_packets, sampled_number_of_packets);
            __sync_fetch_and_add(&subnet_counter->out_bytes,   sampled_number_of_bytes);
        }

        conntrack_main_struct* current_element_flow = NULL;
        if (enable_conection_tracking) {
            current_element_flow = &itr_flow->second[shift_in_vector];
        }

        // Collect data when ban client
        if (!ban_list_details.empty() && ban_list_details.count(current_packet.src_ip) > 0 &&
            ban_list_details[current_packet.src_ip].size() < ban_details_records_count) {

            ban_list_details_mutex.lock();
            ban_list_details[current_packet.src_ip].push_back(current_packet);
            ban_list_details_mutex.unlock();
        }

        uint64_t connection_tracking_hash = 0;

        if (enable_conection_tracking) {
            packed_conntrack_hash flow_tracking_structure;
            flow_tracking_structure.opposite_ip = current_packet.dst_ip;
            flow_tracking_structure.src_port = current_packet.source_port;
            flow_tracking_structure.dst_port = current_packet.destination_port;

            // convert this struct to 64 bit integer
            connection_tracking_hash = convert_conntrack_hash_struct_to_integer(&flow_tracking_structure);
        }

        if (current_packet.protocol == IPPROTO_TCP) {
            __sync_fetch_and_add(&current_element->tcp_out_packets, sampled_number_of_packets);
            __sync_fetch_and_add(&current_element->tcp_out_bytes, sampled_number_of_bytes);

            if (extract_bit_value(current_packet.flags, TCP_SYN_FLAG_SHIFT)) {
                __sync_fetch_and_add(&current_element->tcp_syn_out_packets, sampled_number_of_packets);
                __sync_fetch_and_add(&current_element->tcp_syn_out_bytes, sampled_number_of_bytes);
            }

            if (enable_conection_tracking) {
                flow_counter.lock();
                conntrack_key_struct* conntrack_key_struct_ptr =
                &current_element_flow->out_tcp[connection_tracking_hash];

                conntrack_key_struct_ptr->packets += sampled_number_of_packets;
                conntrack_key_struct_ptr->bytes += sampled_number_of_bytes;

                flow_counter.unlock();
            }
        } else if (current_packet.protocol == IPPROTO_UDP) {
            __sync_fetch_and_add(&current_element->udp_out_packets, sampled_number_of_packets);
            __sync_fetch_and_add(&current_element->udp_out_bytes, sampled_number_of_bytes);

            if (enable_conection_tracking) {
                flow_counter.lock();
                conntrack_key_struct* conntrack_key_struct_ptr =
                &current_element_flow->out_udp[connection_tracking_hash];

                conntrack_key_struct_ptr->packets += sampled_number_of_packets;
                conntrack_key_struct_ptr->bytes += sampled_number_of_bytes;

                flow_counter.unlock();
            }
        } else if (current_packet.protocol == IPPROTO_ICMP) {
            __sync_fetch_and_add(&current_element->icmp_out_packets, sampled_number_of_packets);
            __sync_fetch_and_add(&current_element->icmp_out_bytes, sampled_number_of_bytes);
            // no flow tracking for icmp
        } else {
        }

    } else if (packet_direction == INCOMING) {
        int64_t shift_in_vector = (int64_t)ntohl(current_packet.dst_ip) - (int64_t)subnet_in_host_byte_order;

        if (shift_in_vector < 0 or shift_in_vector >= itr->second.size()) {
            logger << log4cpp::Priority::ERROR << "We tried to access to element with index " << shift_in_vector
                   << " which located outside allocated vector with size " << itr->second.size();

            logger << log4cpp::Priority::INFO
                   << "We expect issues with this packet in INCOMING direction: "
                   << print_simple_packet(current_packet);

            return;
        }

        map_element* current_element = &itr->second[shift_in_vector];

        // Main packet/bytes counter
        __sync_fetch_and_add(&current_element->in_packets, sampled_number_of_packets);
        __sync_fetch_and_add(&current_element->in_bytes, sampled_number_of_bytes);

        if (enable_subnet_counters) {
            __sync_fetch_and_add(&subnet_counter->in_packets, sampled_number_of_packets);
            __sync_fetch_and_add(&subnet_counter->in_bytes,   sampled_number_of_bytes);
        }

        // Count fragmented IP packets
        if (current_packet.ip_fragmented) {
            __sync_fetch_and_add(&current_element->fragmented_in_packets, sampled_number_of_packets);
            __sync_fetch_and_add(&current_element->fragmented_in_bytes, sampled_number_of_bytes);
        }

        conntrack_main_struct* current_element_flow = NULL;

        if (enable_conection_tracking) {
            current_element_flow = &itr_flow->second[shift_in_vector];
        }

        uint64_t connection_tracking_hash = 0;
        if (enable_conection_tracking) {
            packed_conntrack_hash flow_tracking_structure;
            flow_tracking_structure.opposite_ip = current_packet.src_ip;
            flow_tracking_structure.src_port = current_packet.source_port;
            flow_tracking_structure.dst_port = current_packet.destination_port;

            // convert this struct to 64 bit integer
            connection_tracking_hash = convert_conntrack_hash_struct_to_integer(&flow_tracking_structure);
        }

        // Collect attack details
        if (!ban_list_details.empty() && ban_list_details.count(current_packet.dst_ip) > 0 &&
            ban_list_details[current_packet.dst_ip].size() < ban_details_records_count) {

            ban_list_details_mutex.lock();
            ban_list_details[current_packet.dst_ip].push_back(current_packet);
            ban_list_details_mutex.unlock();
        }

        if (current_packet.protocol == IPPROTO_TCP) {
            __sync_fetch_and_add(&current_element->tcp_in_packets, sampled_number_of_packets);
            __sync_fetch_and_add(&current_element->tcp_in_bytes, sampled_number_of_bytes);

            if (extract_bit_value(current_packet.flags, TCP_SYN_FLAG_SHIFT)) {
                __sync_fetch_and_add(&current_element->tcp_syn_in_packets, sampled_number_of_packets);
                __sync_fetch_and_add(&current_element->tcp_syn_in_bytes, sampled_number_of_bytes);
            }

            if (enable_conection_tracking) {
                flow_counter.lock();
                conntrack_key_struct* conntrack_key_struct_ptr =
                &current_element_flow->in_tcp[connection_tracking_hash];

                conntrack_key_struct_ptr->packets += sampled_number_of_packets;
                conntrack_key_struct_ptr->bytes += sampled_number_of_bytes;

                flow_counter.unlock();
            }
        } else if (current_packet.protocol == IPPROTO_UDP) {
            __sync_fetch_and_add(&current_element->udp_in_packets, sampled_number_of_packets);
            __sync_fetch_and_add(&current_element->udp_in_bytes, sampled_number_of_bytes);

            if (enable_conection_tracking) {
                flow_counter.lock();
                conntrack_key_struct* conntrack_key_struct_ptr =
                &current_element_flow->in_udp[connection_tracking_hash];

                conntrack_key_struct_ptr->packets += sampled_number_of_packets;
                conntrack_key_struct_ptr->bytes += sampled_number_of_bytes;
                flow_counter.unlock();
            }
        } else if (current_packet.protocol == IPPROTO_ICMP) {
            __sync_fetch_and_add(&current_element->icmp_in_packets, sampled_number_of_packets);
            __sync_fetch_and_add(&current_element->icmp_in_bytes, sampled_number_of_bytes);

            // no flow tracking for icmp
        } else {
            // TBD
        }

    } else if (packet_direction == INTERNAL) {
    }
}

#ifdef GEOIP
unsigned int get_asn_for_ip(uint32_t ip) {
    char* asn_raw = GeoIP_org_by_name(geo_ip, convert_ip_as_uint_to_string(remote_ip).c_str());
    uint32_t asn_number = 0;

    if (asn_raw == NULL) {
        asn_number = 0;
    } else {
        // split string: AS1299 TeliaSonera International Carrier
        std::vector<std::string> asn_as_string;
        split(asn_as_string, asn_raw, boost::is_any_of(" "), boost::token_compress_on);

        // free up original string
        free(asn_raw);

        // extract raw number
        asn_number = convert_string_to_integer(asn_as_string[0].substr(2));
    }

    return asn_number;
}
#endif

// void* void* data
// It's not an calculation thread, it's vizualization thread :)
void calculation_thread() {
    // we need wait one second for calculating speed by recalculate_speed

    //#include <sys/prctl.h>
    // prctl(PR_SET_NAME , "fastnetmon calc thread", 0, 0, 0);

    // Sleep for a half second for shift against calculatiuon thread
    boost::this_thread::sleep(boost::posix_time::milliseconds(500));

    while (1) {
        // Available only from boost 1.54: boost::this_thread::sleep_for(
        // boost::chrono::seconds(check_period) );
        boost::this_thread::sleep(boost::posix_time::seconds(check_period));
        traffic_draw_programm();
    }
}

void recalculate_speed_thread_handler() {
    while (1) {
        // recalculate data every one second
        // Available only from boost 1.54: boost::this_thread::sleep_for( boost::chrono::seconds(1)
        // );
        boost::this_thread::sleep(boost::posix_time::seconds(1));
        recalculate_speed();
    }
}

/* Calculate speed for all connnections */
void recalculate_speed() {
    // logger<< log4cpp::Priority::INFO<<"We run recalculate_speed";

    struct timeval start_calc_time;
    gettimeofday(&start_calc_time, NULL);

    double speed_calc_period = 1;
    time_t start_time;
    time(&start_time);

    // If we got 1+ seconds lag we should use new "delta" or skip this step
    double time_difference = difftime(start_time, last_call_of_traffic_recalculation);

    if (time_difference < 1) {
        // It could occur on programm start
        logger << log4cpp::Priority::INFO
               << "We skip one iteration of speed_calc because it runs so early!";
        return;
    } else if (int(time_difference) == 1) {
        // All fine, we run on time
    } else {
        logger << log4cpp::Priority::INFO
               << "Time from last run of speed_recalc is soooo big, we got ugly lags: " << time_difference;
        speed_calc_period = time_difference;
    }

    map_element zero_map_element;
    memset(&zero_map_element, 0, sizeof(zero_map_element));

    uint64_t incoming_total_flows = 0;
    uint64_t outgoing_total_flows = 0;

    if (enable_subnet_counters) {
        for (map_for_subnet_counters::iterator itr = PerSubnetSpeedMap.begin(); itr != PerSubnetSpeedMap.end(); ++itr) {
            subnet_t current_subnet = itr->first;

            map_for_subnet_counters::iterator iter_subnet = PerSubnetCountersMap.find(current_subnet);

            if (iter_subnet == PerSubnetCountersMap.end()) {
                logger << log4cpp::Priority::INFO<<"Can't find traffic counters for subnet";
                break;
            }

            subnet_counter_t* subnet_traffic = &iter_subnet->second; 

            subnet_counter_t new_speed_element;

            new_speed_element.in_packets = uint64_t((double)subnet_traffic->in_packets / speed_calc_period);
            new_speed_element.in_bytes   = uint64_t((double)subnet_traffic->in_bytes   / speed_calc_period); 

            new_speed_element.out_packets = uint64_t((double)subnet_traffic->out_packets / speed_calc_period);
            new_speed_element.out_bytes   = uint64_t((double)subnet_traffic->out_bytes   / speed_calc_period);   

            // Update speed calculation structure
            PerSubnetSpeedMap[current_subnet] = new_speed_element;
            *subnet_traffic = zero_map_element;

            //logger << log4cpp::Priority::INFO<<convert_subnet_to_string(current_subnet)
            //    << "in pps: " << new_speed_element.in_packets << " out pps: " << new_speed_element.out_packets;
        }
    }

    for (map_of_vector_counters::iterator itr = SubnetVectorMap.begin(); itr != SubnetVectorMap.end(); ++itr) {
        for (vector_of_counters::iterator vector_itr = itr->second.begin();
             vector_itr != itr->second.end(); ++vector_itr) {
            int current_index = vector_itr - itr->second.begin();

            // New element
            map_element new_speed_element;

            // convert to host order for math operations
            uint32_t subnet_ip = ntohl(itr->first);
            uint32_t client_ip_in_host_bytes_order = subnet_ip + current_index;

            // covnert to our standard network byte order
            uint32_t client_ip = htonl(client_ip_in_host_bytes_order);

            // Calculate speed for IP or whole subnet
            // calculate_speed_for_certain_entity(map_element* new_speed_element, map_element* traffic_counter_element);

            // calculate_speed(new_speed_element speed_element, vector_itr* );
            new_speed_element.in_packets = uint64_t((double)vector_itr->in_packets / speed_calc_period);
            new_speed_element.out_packets = uint64_t((double)vector_itr->out_packets / speed_calc_period);

            new_speed_element.in_bytes = uint64_t((double)vector_itr->in_bytes / speed_calc_period);
            new_speed_element.out_bytes = uint64_t((double)vector_itr->out_bytes / speed_calc_period);

            // Fragmented
            new_speed_element.fragmented_in_packets =
            uint64_t((double)vector_itr->fragmented_in_packets / speed_calc_period);
            new_speed_element.fragmented_out_packets =
            uint64_t((double)vector_itr->fragmented_out_packets / speed_calc_period);

            new_speed_element.fragmented_in_bytes =
            uint64_t((double)vector_itr->fragmented_in_bytes / speed_calc_period);
            new_speed_element.fragmented_out_bytes =
            uint64_t((double)vector_itr->fragmented_out_bytes / speed_calc_period);

            // By protocol counters

            // TCP
            new_speed_element.tcp_in_packets = uint64_t((double)vector_itr->tcp_in_packets / speed_calc_period);
            new_speed_element.tcp_out_packets =
            uint64_t((double)vector_itr->tcp_out_packets / speed_calc_period);

            new_speed_element.tcp_in_bytes = uint64_t((double)vector_itr->tcp_in_bytes / speed_calc_period);
            new_speed_element.tcp_out_bytes = uint64_t((double)vector_itr->tcp_out_bytes / speed_calc_period);

            // TCP syn
            new_speed_element.tcp_syn_in_packets =
            uint64_t((double)vector_itr->tcp_syn_in_packets / speed_calc_period);
            new_speed_element.tcp_syn_out_packets =
            uint64_t((double)vector_itr->tcp_syn_out_packets / speed_calc_period);

            new_speed_element.tcp_syn_in_bytes =
            uint64_t((double)vector_itr->tcp_syn_in_bytes / speed_calc_period);
            new_speed_element.tcp_syn_out_bytes =
            uint64_t((double)vector_itr->tcp_syn_out_bytes / speed_calc_period);

            // UDP
            new_speed_element.udp_in_packets = uint64_t((double)vector_itr->udp_in_packets / speed_calc_period);
            new_speed_element.udp_out_packets =
            uint64_t((double)vector_itr->udp_out_packets / speed_calc_period);

            new_speed_element.udp_in_bytes = uint64_t((double)vector_itr->udp_in_bytes / speed_calc_period);
            new_speed_element.udp_out_bytes = uint64_t((double)vector_itr->udp_out_bytes / speed_calc_period);

            // ICMP
            new_speed_element.icmp_in_packets =
            uint64_t((double)vector_itr->icmp_in_packets / speed_calc_period);
            new_speed_element.icmp_out_packets =
            uint64_t((double)vector_itr->icmp_out_packets / speed_calc_period);

            new_speed_element.icmp_in_bytes = uint64_t((double)vector_itr->icmp_in_bytes / speed_calc_period);
            new_speed_element.icmp_out_bytes = uint64_t((double)vector_itr->icmp_out_bytes / speed_calc_period);

            conntrack_main_struct* flow_counter_ptr = &SubnetVectorMapFlow[itr->first][current_index];

            // todo: optimize this operations!
            uint64_t total_out_flows =
            (uint64_t)flow_counter_ptr->out_tcp.size() + (uint64_t)flow_counter_ptr->out_udp.size() +
            (uint64_t)flow_counter_ptr->out_icmp.size() + (uint64_t)flow_counter_ptr->out_other.size();

            uint64_t total_in_flows =
            (uint64_t)flow_counter_ptr->in_tcp.size() + (uint64_t)flow_counter_ptr->in_udp.size() +
            (uint64_t)flow_counter_ptr->in_icmp.size() + (uint64_t)flow_counter_ptr->in_other.size();

            new_speed_element.out_flows = uint64_t((double)total_out_flows / speed_calc_period);
            new_speed_element.in_flows = uint64_t((double)total_in_flows / speed_calc_period);

            // Increment global counter
            incoming_total_flows += new_speed_element.in_flows;
            outgoing_total_flows += new_speed_element.out_flows;

            /* Moving average recalculation */
            // http://en.wikipedia.org/wiki/Moving_average#Application_to_measuring_computer_performance
            // double speed_calc_period = 1;
            double exp_power = -speed_calc_period / average_calculation_amount;
            double exp_value = exp(exp_power);

            map_element* current_average_speed_element = &SpeedCounterAverage[client_ip];

            current_average_speed_element->in_bytes = uint64_t(
            new_speed_element.in_bytes +
            exp_value * ((double)current_average_speed_element->in_bytes - (double)new_speed_element.in_bytes));
            current_average_speed_element->out_bytes =
            uint64_t(new_speed_element.out_bytes +
                     exp_value * ((double)current_average_speed_element->out_bytes -
                                  (double)new_speed_element.out_bytes));

            current_average_speed_element->in_packets =
            uint64_t(new_speed_element.in_packets +
                     exp_value * ((double)current_average_speed_element->in_packets -
                                  (double)new_speed_element.in_packets));
            current_average_speed_element->out_packets =
            uint64_t(new_speed_element.out_packets +
                     exp_value * ((double)current_average_speed_element->out_packets -
                                  (double)new_speed_element.out_packets));

            current_average_speed_element->out_flows =
            uint64_t(new_speed_element.out_flows +
                     exp_value * ((double)current_average_speed_element->out_flows -
                                  (double)new_speed_element.out_flows));
            current_average_speed_element->in_flows = uint64_t(
            new_speed_element.in_flows +
            exp_value * ((double)current_average_speed_element->in_flows - (double)new_speed_element.in_flows));

            /* Moving average recalculation end */

            if (we_should_ban_this_ip(current_average_speed_element)) {
                std::string flow_attack_details = "";

                if (enable_conection_tracking) {
                    flow_attack_details =
                    print_flow_tracking_for_ip(*flow_counter_ptr, convert_ip_as_uint_to_string(client_ip));
                }

                // TODO: we should pass type of ddos ban source (pps, flowd, bandwidth)!
                execute_ip_ban(client_ip, new_speed_element, *current_average_speed_element, flow_attack_details);
            }

            speed_counters_mutex.lock();
            // map_element* current_speed_element = &SpeedCounter[client_ip];
            //*current_speed_element = new_speed_element;
            SpeedCounter[client_ip] = new_speed_element;
            speed_counters_mutex.unlock();

            data_counters_mutex.lock();
            *vector_itr = zero_map_element;
            data_counters_mutex.unlock();
        }
    }

    // Calculate global flow speed
    incoming_total_flows_speed = uint64_t((double)incoming_total_flows / (double)speed_calc_period);
    outgoing_total_flows_speed = uint64_t((double)outgoing_total_flows / (double)speed_calc_period);

    if (enable_conection_tracking) {
        // Clean Flow Counter
        flow_counter.lock();
        zeroify_all_flow_counters();
        flow_counter.unlock();
    }

    for (unsigned int index = 0; index < 4; index++) {
        total_speed_counters[index].bytes =
        uint64_t((double)total_counters[index].bytes / (double)speed_calc_period);
        total_speed_counters[index].packets =
        uint64_t((double)total_counters[index].packets / (double)speed_calc_period);

        // nullify data counters after speed calculation
        // total_counters_mutex.lock();
        total_counters[index].bytes = 0;
        total_counters[index].packets = 0;
        // total_counters_mutex.unlock();
    }

    // Set time of previous startup
    time(&last_call_of_traffic_recalculation);

    struct timeval finish_calc_time;
    gettimeofday(&finish_calc_time, NULL);

    timeval_subtract(&speed_calculation_time, &finish_calc_time, &start_calc_time);
}

void print_screen_contents_into_file(std::string screen_data_stats_param) {
    std::ofstream screen_data_file;
    screen_data_file.open("/tmp/fastnetmon.dat", std::ios::trunc);

    if (screen_data_file.is_open()) {
        screen_data_file << screen_data_stats_param;
        screen_data_file.close();
    } else {
        logger << log4cpp::Priority::ERROR << "Can't print programm screen into file";
    }
}

void traffic_draw_programm() {
    std::stringstream output_buffer;

    // logger<<log4cpp::Priority::INFO<<"Draw table call";

    struct timeval start_calc_time;
    gettimeofday(&start_calc_time, NULL);

    sort_type sorter;
    if (sort_parameter == "packets") {
        sorter = PACKETS;
    } else if (sort_parameter == "bytes") {
        sorter = BYTES;
    } else if (sort_parameter == "flows") {
        sorter = FLOWS;
    } else {
        logger << log4cpp::Priority::INFO << "Unexpected sorter type: " << sort_parameter;
        sorter = PACKETS;
    }

    output_buffer << "FastNetMon v1.0 FastVPS Eesti OU (c) VPS and dedicated: http://FastVPS.host"
                  << "\n"
                  << "IPs ordered by: " << sort_parameter << "\n";

    output_buffer << print_channel_speed("Incoming traffic", INCOMING) << std::endl;
    output_buffer << draw_table(SpeedCounter, INCOMING, true, sorter);

    output_buffer << std::endl;

    output_buffer << print_channel_speed("Outgoing traffic", OUTGOING) << std::endl;
    output_buffer << draw_table(SpeedCounter, OUTGOING, false, sorter);

    output_buffer << std::endl;

    output_buffer << print_channel_speed("Internal traffic", INTERNAL) << std::endl;

    output_buffer << std::endl;

    output_buffer << print_channel_speed("Other traffic", OTHER) << std::endl;

    output_buffer << std::endl;

    if (enable_pcap_collection) {
        output_buffer << get_pcap_stats() << "\n";
    }

    // Application statistics
    output_buffer << "Screen updated in:\t\t" << drawing_thread_execution_time.tv_sec << " sec "
                  << drawing_thread_execution_time.tv_usec << " microseconds\n";
    output_buffer << "Traffic calculated in:\t\t" << speed_calculation_time.tv_sec << " sec "
                  << speed_calculation_time.tv_usec << " microseconds\n";
    output_buffer << "Total amount of not processed packets: " << total_unparsed_packets << "\n";

#ifdef PF_RING
    if (enable_data_collection_from_mirror) {
        output_buffer << get_pf_ring_stats();
    }
#endif

    // Print thresholds
    if (print_configuration_params_on_the_screen) {
        output_buffer << "\n" << print_ban_thresholds();
    }

    if (!ban_list.empty()) {
        output_buffer << std::endl << "Ban list:" << std::endl;
        output_buffer << print_ddos_attack_details();
    }

    if (enable_subnet_counters) {
        output_buffer << std::endl << "Subnet load:" << std::endl;
        output_buffer << print_subnet_load() << "\n";
    }

    screen_data_stats = output_buffer.str();

    // Print screen contents into file
    print_screen_contents_into_file(screen_data_stats);

    struct timeval end_calc_time;
    gettimeofday(&end_calc_time, NULL);

    timeval_subtract(&drawing_thread_execution_time, &end_calc_time, &start_calc_time);
}

// pretty print channel speed in pps and MBit
std::string print_channel_speed(std::string traffic_type, direction packet_direction) {
    uint64_t speed_in_pps = total_speed_counters[packet_direction].packets;
    uint64_t speed_in_bps = total_speed_counters[packet_direction].bytes;

    unsigned int number_of_tabs = 1;
    // We need this for correct alignment of blocks
    if (traffic_type == "Other traffic") {
        number_of_tabs = 2;
    }

    std::stringstream stream;
    stream << traffic_type;

    for (unsigned int i = 0; i < number_of_tabs; i++) {
        stream << "\t";
    }

    uint64_t speed_in_mbps = convert_speed_to_mbps(speed_in_bps);

    stream << std::setw(6) << speed_in_pps << " pps " << std::setw(6) << speed_in_mbps << " mbps";

    if (traffic_type == "Incoming traffic" or traffic_type == "Outgoing traffic") {
        if (packet_direction == INCOMING) {
            stream << " " << std::setw(6) << incoming_total_flows_speed << " flows";
        } else if (packet_direction == OUTGOING) {
            stream << " " << std::setw(6) << outgoing_total_flows_speed << " flows";
        }

        if (graphite_enabled) {
            graphite_data_t graphite_data;

            std::string direction_as_string;

            if (packet_direction == INCOMING) {
                direction_as_string = "incoming";

                graphite_data[graphite_prefix + direction_as_string + "flows"] = incoming_total_flows_speed;
            } else if (packet_direction == OUTGOING) {
                direction_as_string = "outgoing";

                graphite_data[graphite_prefix + direction_as_string + "flows"] = outgoing_total_flows_speed;
            }

            graphite_data[graphite_prefix + direction_as_string + ".pps"] = speed_in_pps;
            graphite_data[graphite_prefix + direction_as_string + ".mbps"] = speed_in_mbps;

            bool graphite_put_result = store_data_to_graphite(graphite_port, graphite_host, graphite_data);

            if (!graphite_put_result) {
                logger << log4cpp::Priority::ERROR << "Can't store data to Graphite";
            }
        }
    }

    return stream.str();
}

void init_logging() {
    log4cpp::PatternLayout* layout = new log4cpp::PatternLayout();
    layout->setConversionPattern("%d [%p] %m%n");

    log4cpp::Appender* appender = new log4cpp::FileAppender("default", log_file_path);
    appender->setLayout(layout);

    logger.setPriority(log4cpp::Priority::INFO);
    logger.addAppender(appender);
    logger.info("Logger initialized!");
}


// Call fork function
int do_fork() {
    int status = 0;

    switch (fork()) {
    case 0:
        // It's child
        break;
    case -1:
        /* fork failed */
        status = -1;
        break;
    default:
        // We should close master process with _exit(0)
        // We should not call exit() because it will destroy all global variables for programm
        _exit(0);
    }

    return status;
}


void redirect_fds() {
    // Close stdin, stdout and stderr
    close(0);
    close(1);
    close(2);

    if (open("/dev/null", O_RDWR) != 0) {
        // We can't notify anybody now
        exit(1);
    }

    // Create copy of zero decriptor for 1 and 2 fd's
    dup(0);
    dup(0);
}

int main(int argc, char** argv) {
    bool daemonize = false;

    if (argc > 1) {
        if (strstr(argv[1], "--daemonize") != NULL) {
            daemonize = true;
        }
    }

    // We use ideas from here https://github.com/bmc/daemonize/blob/master/daemon.c

    if (daemonize) {
        int status = 0;

        printf("We will run in daemonized mode\n");

        if ((status = do_fork()) < 0) {
            // fork failed
            status = -1;
        } else if (setsid() < 0) {
            // Create new session
            status = -1;
        } else if ((status = do_fork()) < 0) {
            status = -1;
        } else {
            // Clear inherited umask
            umask(0);

            // Chdir to root
            chdir("/");

            // close all descriptors because we are daemon!
            redirect_fds();
        }
    }

    // enable core dumps
    enable_core_dumps();

    init_logging();

    if (file_exists(pid_path)) {
        pid_t pid_from_file = 0;

        if (read_pid_from_file(pid_from_file, pid_path)) {
            // We could read pid
            if (pid_from_file > 0) {
                // We use signal zero for check process existence
                int kill_result = kill(pid_from_file, 0);

                if (kill_result == 0) {
                    logger << log4cpp::Priority::ERROR
                           << "FastNetMon is already running with pid: " << pid_from_file;
                    exit(1);
                } else {
                    // Yes, we have pid with pid but it's zero
                }
            } else {
                // pid from file is broken, we assume tool is not running
            }
        } else {
            // We can't open file, let's assume it's broken and tool is not running
        }
    } else {
        // no pid file
    }

    // If we not failed in check steps we could run toolkit
    print_pid_to_file(getpid(), pid_path);

    lookup_tree = New_Patricia(32);
    whitelist_tree = New_Patricia(32);

    // nullify total counters
    for (int index = 0; index < 4; index++) {
        total_counters[index].bytes = 0;
        total_counters[index].packets = 0;

        total_speed_counters[index].bytes = 0;
        total_speed_counters[index].packets = 0;
    }

    /* Create folder for attack details */
    if (!folder_exists(attack_details_folder)) {
        int mkdir_result = mkdir(attack_details_folder.c_str(), S_IRWXU);

        if (mkdir_result != 0) {
            logger << log4cpp::Priority::ERROR << "Can't create folder for attack details: " << attack_details_folder;
            exit(1);
        }
    }

    if (getenv("DUMP_ALL_PACKETS") != NULL) {
        DEBUG_DUMP_ALL_PACKETS = true;
    }

    if (sizeof(packed_conntrack_hash) != sizeof(uint64_t) or sizeof(packed_conntrack_hash) != 8) {
        logger << log4cpp::Priority::INFO << "Assertion about size of packed_conntrack_hash, it's "
               << sizeof(packed_conntrack_hash) << " instead 8";
        exit(1);
    }

    logger << log4cpp::Priority::INFO << "Read configuration file";

    bool load_config_result = load_configuration_file();

    if (!load_config_result) {
        fprintf(stderr, "Can't open config file %s, please create it!\n", global_config_path.c_str());
        exit(1);
    }

    load_our_networks_list();

    // Setup CTRL+C handler
    if (signal(SIGINT, interruption_signal_handler) == SIG_ERR) {
        logger << log4cpp::Priority::ERROR << "Can't setup SIGINT handler";
        exit(1);
    }

    /* Without this SIGPIPE error could shutdown toolkit on call of exec_with_stdin_params */
    if (signal(SIGPIPE, sigpipe_handler_for_popen) == SIG_ERR) {
        logger << log4cpp::Priority::ERROR << "Can't setup SIGPIPE handler";
        exit(1);
    }

#ifdef GEOIP
    // Init GeoIP
    if (!geoip_init()) {
        logger << log4cpp::Priority::ERROR << "Can't load geoip tables";
        exit(1);
    }
#endif
    // Init previous run date
    time(&last_call_of_traffic_recalculation);

    // Run screen draw thread
    boost::thread calc_thread(calculation_thread);

    // start thread for recalculating speed in realtime
    boost::thread recalculate_speed_thread(recalculate_speed_thread_handler);

    // Run banlist cleaner thread
    boost::thread cleanup_ban_list_thread(cleanup_ban_list);

#ifdef PF_RING
    if (enable_data_collection_from_mirror) {
        packet_capture_plugin_thread_group.add_thread(new boost::thread(start_pfring_collection, process_packet));
    }
#endif

    // netmap processing
    if (enable_netmap_collection) {
        packet_capture_plugin_thread_group.add_thread(new boost::thread(start_netmap_collection, process_packet));
    }

    if (enable_sflow_collection) {
        packet_capture_plugin_thread_group.add_thread(new boost::thread(start_sflow_collection, process_packet));
    }

    if (enable_netflow_collection) {
        packet_capture_plugin_thread_group.add_thread(new boost::thread(start_netflow_collection, process_packet));
    }

    if (enable_pcap_collection) {
        packet_capture_plugin_thread_group.add_thread(new boost::thread(start_pcap_collection, process_packet));
    }

    // Wait for all threads in capture thread group
    packet_capture_plugin_thread_group.join_all();

    recalculate_speed_thread.join();
    calc_thread.join();

    free_up_all_resources();

    return 0;
}

void free_up_all_resources() {
#ifdef GEOIP
    // Free up geoip handle
    GeoIP_delete(geo_ip);
#endif

    Destroy_Patricia(lookup_tree, (void_fn_t)0);
    Destroy_Patricia(whitelist_tree, (void_fn_t)0);
}

// For correct programm shutdown by CTRL+C
void interruption_signal_handler(int signal_number) {

    if (enable_pcap_collection) {
        stop_pcap_collection();
    }

#ifdef PF_RING
    stop_pfring_collection();
#endif

    // packet_capture_plugin_thread_group.interrupt_all();
    // Wait some time for threads finishing
    // sleep 3;

    exit(1);
}

/* Get traffic type: check it belongs to our IPs */
direction get_packet_direction(uint32_t src_ip, uint32_t dst_ip, unsigned long& subnet, unsigned int& subnet_cidr_mask) {
    direction packet_direction;

    bool our_ip_is_destination = false;
    bool our_ip_is_source = false;

    prefix_t prefix_for_check_adreess;
    prefix_for_check_adreess.family = AF_INET;
    prefix_for_check_adreess.bitlen = 32;

    patricia_node_t* found_patrica_node = NULL;
    prefix_for_check_adreess.add.sin.s_addr = dst_ip;

    unsigned long destination_subnet = 0;
    unsigned int  destination_subnet_cidr_mask = 0;
    found_patrica_node = patricia_search_best2(lookup_tree, &prefix_for_check_adreess, 1);

    if (found_patrica_node) {
        our_ip_is_destination = true;
        destination_subnet = found_patrica_node->prefix->add.sin.s_addr;
        destination_subnet_cidr_mask = found_patrica_node->prefix->bitlen;
    }

    found_patrica_node = NULL;
    prefix_for_check_adreess.add.sin.s_addr = src_ip;

    unsigned long source_subnet = 0;
    unsigned int source_subnet_cidr_mask = 0;
    found_patrica_node = patricia_search_best2(lookup_tree, &prefix_for_check_adreess, 1);

    if (found_patrica_node) {
        our_ip_is_source = true;
        source_subnet = found_patrica_node->prefix->add.sin.s_addr;
        source_subnet_cidr_mask = found_patrica_node->prefix->bitlen;
    }

    subnet = 0;
    if (our_ip_is_source && our_ip_is_destination) {
        packet_direction = INTERNAL;
    } else if (our_ip_is_source) {
        subnet = source_subnet;
        subnet_cidr_mask = source_subnet_cidr_mask;

        packet_direction = OUTGOING;
    } else if (our_ip_is_destination) {
        subnet = destination_subnet;
        subnet_cidr_mask = destination_subnet_cidr_mask;

        packet_direction = INCOMING;
    } else {
        packet_direction = OTHER;
    }

    return packet_direction;
}

unsigned int detect_attack_protocol(map_element& speed_element, direction attack_direction) {
    if (attack_direction == INCOMING) {
        return get_max_used_protocol(speed_element.tcp_in_packets, speed_element.udp_in_packets,
                                     speed_element.icmp_in_packets);
    } else {
        // OUTGOING
        return get_max_used_protocol(speed_element.tcp_out_packets, speed_element.udp_out_packets,
                                     speed_element.icmp_out_packets);
    }
}

#define my_max_on_defines(a, b) (a > b ? a : b)
unsigned int get_max_used_protocol(uint64_t tcp, uint64_t udp, uint64_t icmp) {
    unsigned int max = my_max_on_defines(my_max_on_defines(udp, tcp), icmp);

    if (max == tcp) {
        return IPPROTO_TCP;
    } else if (max == udp) {
        return IPPROTO_UDP;
    } else if (max == icmp) {
        return IPPROTO_ICMP;
    }

    return 0;
}

void exabgp_ban_manage(std::string action, std::string ip_as_string) {
    /* Buffer for BGP message */
    char bgp_message[256];
    std::string ip_as_string_with_mask = ip_as_string + "/32";
    
    // We could use subnet instead 
    if (exabgp_announce_whole_subnet) {
        ip_as_string_with_mask = find_subnet_by_ip_in_string_format(lookup_tree, ip_as_string);

        if (ip_as_string_with_mask.empty()) {
            logger.warn("Can't find subnet for IP: " + ip_as_string);
            return;
        } else {
            logger.info("We detected subnet for this IP: " + ip_as_string_with_mask);
        }
    }

   if (action == "ban") {
        sprintf(bgp_message, "announce route %s next-hop %s community %s\n",
                ip_as_string_with_mask.c_str(), exabgp_next_hop.c_str(), exabgp_community.c_str());
    } else {
        sprintf(bgp_message, "withdraw route %s\n", ip_as_string_with_mask.c_str());
    }    

    logger.info("ExaBGP announce message: %s", bgp_message);
 
    int exabgp_pipe = open(exabgp_command_pipe.c_str(), O_WRONLY);

    if (exabgp_pipe <= 0) {
        logger << log4cpp::Priority::ERROR << "Can't open ExaBGP pipe " << exabgp_command_pipe
               << " Ban is not executed";
        return;
    }

    int wrote_bytes = write(exabgp_pipe, bgp_message, strlen(bgp_message));

    if (wrote_bytes != strlen(bgp_message)) {
        logger << log4cpp::Priority::ERROR << "Can't write message to ExaBGP pipe";
    }

    close(exabgp_pipe);
}

void execute_ip_ban(uint32_t client_ip, map_element speed_element, map_element average_speed_element, std::string flow_attack_details) {
    struct attack_details current_attack;
    uint64_t pps = 0;

    uint64_t in_pps = average_speed_element.in_packets;
    uint64_t out_pps = average_speed_element.out_packets;
    uint64_t in_bps = average_speed_element.in_bytes;
    uint64_t out_bps = average_speed_element.out_bytes;
    uint64_t in_flows = average_speed_element.in_flows;
    uint64_t out_flows = average_speed_element.out_flows;

    direction data_direction;

    if (!we_do_real_ban) {
        logger << log4cpp::Priority::INFO << "We do not ban: " << convert_ip_as_uint_to_string(client_ip)
               << " because ban disabled completely";
        return;
    }

    // Detect attack direction with simple heuristic
    if (abs(int((int)in_pps - (int)out_pps)) < 1000) {
        // If difference between pps speed is so small we should do additional investigation using
        // bandwidth speed
        if (in_bps > out_bps) {
            data_direction = INCOMING;
            pps = in_pps;
        } else {
            data_direction = OUTGOING;
            pps = out_pps;
        }
    } else {
        if (in_pps > out_pps) {
            data_direction = INCOMING;
            pps = in_pps;
        } else {
            data_direction = OUTGOING;
            pps = out_pps;
        }
    }

    current_attack.attack_protocol = detect_attack_protocol(speed_element, data_direction);

    if (ban_list.count(client_ip) > 0) {
        if (ban_list[client_ip].attack_direction != data_direction) {
            logger << log4cpp::Priority::INFO
                   << "We expected very strange situation: attack direction for "
                   << convert_ip_as_uint_to_string(client_ip) << " was changed";

            return;
        }

        // update attack power
        if (pps > ban_list[client_ip].max_attack_power) {
            ban_list[client_ip].max_attack_power = pps;
        }

        return;
    }

    prefix_t prefix_for_check_adreess;
    prefix_for_check_adreess.add.sin.s_addr = client_ip;
    prefix_for_check_adreess.family = AF_INET;
    prefix_for_check_adreess.bitlen = 32;

    bool in_white_list = (patricia_search_best2(whitelist_tree, &prefix_for_check_adreess, 1) != NULL);

    if (in_white_list) {
        return;
    }

    std::string data_direction_as_string = get_direction_name(data_direction);

    logger.info("We run execute_ip_ban code with following params in_pps: %d out_pps: %d in_bps: "
                "%d out_bps: %d and we decide it's %s attack",
                in_pps, out_pps, in_bps, out_bps, data_direction_as_string.c_str());

    std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);
    std::string pps_as_string = convert_int_to_string(pps);

    // Store ban time
    time(&current_attack.ban_timestamp);
    // set ban time in seconds
    current_attack.ban_time = standard_ban_time;

    // Pass main information about attack
    current_attack.attack_direction = data_direction;
    current_attack.attack_power = pps;
    current_attack.max_attack_power = pps;

    current_attack.in_packets = in_pps;
    current_attack.out_packets = out_pps;

    current_attack.in_bytes = in_bps;
    current_attack.out_bytes = out_bps;

    // pass flow information
    current_attack.in_flows = in_flows;
    current_attack.out_flows = out_flows;

    current_attack.fragmented_in_packets = speed_element.fragmented_in_packets;
    current_attack.tcp_in_packets = speed_element.tcp_in_packets;
    current_attack.tcp_syn_in_packets = speed_element.tcp_syn_in_packets;
    current_attack.udp_in_packets = speed_element.udp_in_packets;
    current_attack.icmp_in_packets = speed_element.icmp_in_packets;

    current_attack.fragmented_out_packets = speed_element.fragmented_out_packets;
    current_attack.tcp_out_packets = speed_element.tcp_out_packets;
    current_attack.tcp_syn_out_packets = speed_element.tcp_syn_out_packets;
    current_attack.udp_out_packets = speed_element.udp_out_packets;
    current_attack.icmp_out_packets = speed_element.icmp_out_packets;

    current_attack.fragmented_out_bytes = speed_element.fragmented_out_bytes;
    current_attack.tcp_out_bytes = speed_element.tcp_out_bytes;
    current_attack.tcp_syn_out_bytes = speed_element.tcp_syn_out_bytes;
    current_attack.udp_out_bytes = speed_element.udp_out_bytes;
    current_attack.icmp_out_bytes = speed_element.icmp_out_bytes;

    current_attack.fragmented_in_bytes = speed_element.fragmented_in_bytes;
    current_attack.tcp_in_bytes = speed_element.tcp_in_bytes;
    current_attack.tcp_syn_in_bytes = speed_element.tcp_syn_in_bytes;
    current_attack.udp_in_bytes = speed_element.udp_in_bytes;
    current_attack.icmp_in_bytes = speed_element.icmp_in_bytes;

    // Add average counters
    map_element* current_average_speed_element = &SpeedCounterAverage[client_ip];

    current_attack.average_in_packets = current_average_speed_element->in_packets;
    current_attack.average_in_bytes = current_average_speed_element->in_bytes;
    current_attack.average_in_flows = current_average_speed_element->in_flows;

    current_attack.average_out_packets = current_average_speed_element->out_packets;
    current_attack.average_out_bytes = current_average_speed_element->out_bytes;
    current_attack.average_out_flows = current_average_speed_element->out_flows;

    ban_list_mutex.lock();
    ban_list[client_ip] = current_attack;
    ban_list_mutex.unlock();

    ban_list_details_mutex.lock();
    ban_list_details[client_ip] = std::vector<simple_packet>();
    ban_list_details_mutex.unlock();

    logger << log4cpp::Priority::INFO << "Attack with direction: " << data_direction_as_string
           << " IP: " << client_ip_as_string << " Power: " << pps_as_string;

#ifdef HWFILTER_LOCKING
    logger << log4cpp::Priority::INFO
           << "We will block traffic to/from this IP with hardware filters";
    block_all_traffic_with_82599_hardware_filtering(client_ip_as_string);
#endif

    std::string basic_attack_information = get_attack_description(client_ip, current_attack);
    std::string full_attack_description = basic_attack_information + flow_attack_details;
    print_attack_details_to_file(full_attack_description, client_ip_as_string, current_attack);

    if (file_exists(notify_script_path)) {
        std::string script_call_params = notify_script_path + " " + client_ip_as_string + " " +
                                         data_direction_as_string + " " + pps_as_string +
                                         " attack_details";
        logger << log4cpp::Priority::INFO << "Call script for ban client: " << client_ip_as_string;

        // We should execute external script in separate thread because any lag in this code will be
        // very distructive
        boost::thread exec_thread(exec_with_stdin_params, script_call_params, full_attack_description);
        exec_thread.detach();

        logger << log4cpp::Priority::INFO << "Script for ban client is finished: " << client_ip_as_string;
    }

    if (exabgp_enabled) {
        logger << log4cpp::Priority::INFO << "Call ExaBGP for ban client started: " << client_ip_as_string;

        boost::thread exabgp_thread(exabgp_ban_manage, "ban", client_ip_as_string);
        exabgp_thread.detach();

        logger << log4cpp::Priority::INFO << "Call to ExaBGP for ban client is finished: " << client_ip_as_string;
    }

#ifdef REDIS
    if (redis_enabled) {
        std::string redis_key_name = client_ip_as_string + "_information";

        logger << log4cpp::Priority::INFO << "Start data save in redis in key: " << redis_key_name;
        boost::thread redis_store_thread(store_data_in_redis, redis_key_name, basic_attack_information);
        redis_store_thread.detach();
        logger << log4cpp::Priority::INFO << "Finish data save in redis in key: " << redis_key_name;
    }

    // If we have flow dump put in redis too
    if (redis_enabled && !flow_attack_details.empty()) {
        std::string redis_key_name = client_ip_as_string + "_flow_dump";

        logger << log4cpp::Priority::INFO << "Start data save in redis in key: " << redis_key_name;
        boost::thread redis_store_thread(store_data_in_redis, redis_key_name, flow_attack_details);
        redis_store_thread.detach();
        logger << log4cpp::Priority::INFO << "Finish data save in redis in key: " << redis_key_name;
    }
#endif
}

#ifdef HWFILTER_LOCKING
void block_all_traffic_with_82599_hardware_filtering(std::string client_ip_as_string) {
    /* 6 - tcp, 17 - udp, 0 - other (non tcp and non udp) */
    std::vector<int> banned_protocols;
    banned_protocols.push_back(17);
    banned_protocols.push_back(6);
    banned_protocols.push_back(0);

    int rule_number = 10;

    // Iterate over incoming and outgoing direction
    for (int rule_direction = 0; rule_direction < 2; rule_direction++) {
        for (std::vector<int>::iterator banned_protocol = banned_protocols.begin();
             banned_protocol != banned_protocols.end(); ++banned_protocol) {

            /* On 82599 NIC we can ban traffic using hardware filtering rules */

            // Difference between fie tuple and perfect filters:
            // http://www.ntop.org/products/pf_ring/hardware-packet-filtering/

            hw_filtering_rule rule;
            intel_82599_five_tuple_filter_hw_rule* ft_rule;

            ft_rule = &rule.rule_family.five_tuple_rule;

            memset(&rule, 0, sizeof(rule));
            rule.rule_family_type = intel_82599_five_tuple_rule;
            rule.rule_id = rule_number++;
            ft_rule->queue_id = -1; // drop traffic
            ft_rule->proto = *banned_protocol;

            std::string hw_filter_rule_direction = "";
            if (rule_direction == 0) {
                hw_filter_rule_direction = "outgoing";
                ft_rule->s_addr = ntohl(inet_addr(client_ip_as_string.c_str()));
            } else {
                hw_filter_rule_direction = "incoming";
                ft_rule->d_addr = ntohl(inet_addr(client_ip_as_string.c_str()));
            }

            if (pfring_add_hw_rule(pf_ring_descr, &rule) != 0) {
                logger << log4cpp::Priority::ERROR
                       << "Can't add hardware filtering rule for protocol: " << *banned_protocol
                       << " in direction: " << hw_filter_rule_direction;
            }

            rule_number++;
        }
    }
}
#endif

/* Thread for cleaning up ban list */
void cleanup_ban_list() {
    // Every X seconds we will run ban list cleaner thread
    int iteration_sleep_time = 600;

    // If we use very small ban time we should call ban_cleanup thread more often
    if (iteration_sleep_time > standard_ban_time) {
        iteration_sleep_time = int(standard_ban_time / 2);
    }

    logger << log4cpp::Priority::INFO << "Run banlist cleanup thread";

    while (true) {
        // Sleep for ten minutes
        boost::this_thread::sleep(boost::posix_time::seconds(iteration_sleep_time));

        time_t current_time;
        time(&current_time);

        std::map<uint32_t, banlist_item>::iterator itr = ban_list.begin();
        while (itr != ban_list.end()) {
            uint32_t client_ip = (*itr).first;

            double time_difference = difftime(current_time, ((*itr).second).ban_timestamp);
            int ban_time = ((*itr).second).ban_time;

            // Zero value for ban_time means "no unban feature"
            if (ban_time != 0 && time_difference > ban_time) {
                // Cleanup all data related with this attack
                std::string data_direction_as_string = get_direction_name((*itr).second.attack_direction);
                std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);
                std::string pps_as_string = convert_int_to_string((*itr).second.attack_power);

                logger << log4cpp::Priority::INFO << "We will unban banned IP: " << client_ip_as_string
                       << " because it ban time " << ban_time << " seconds is ended";

                ban_list_mutex.lock();
                std::map<uint32_t, banlist_item>::iterator itr_to_erase = itr;
                ++itr;

                ban_list.erase(itr_to_erase);
                ban_list_mutex.unlock();

                if (file_exists(notify_script_path)) {
                    std::string script_call_params = notify_script_path + " " + client_ip_as_string +
                                                     " " + data_direction_as_string + " " +
                                                     pps_as_string + " unban";

                    logger << log4cpp::Priority::INFO << "Call script for unban client: " << client_ip_as_string;

                    // We should execute external script in separate thread because any lag in this
                    // code will be very distructive
                    boost::thread exec_thread(exec, script_call_params);
                    exec_thread.detach();

                    logger << log4cpp::Priority::INFO
                           << "Script for unban client is finished: " << client_ip_as_string;
                }

                if (exabgp_enabled) {
                    logger << log4cpp::Priority::INFO
                           << "Call ExaBGP for unban client started: " << client_ip_as_string;

                    boost::thread exabgp_thread(exabgp_ban_manage, "unban", client_ip_as_string);
                    exabgp_thread.detach();

                    logger << log4cpp::Priority::INFO
                           << "Call to ExaBGP for unban client is finished: " << client_ip_as_string;
                }
            } else {
                ++itr;
            }
        }
    }
}

std::string print_ddos_attack_details() {
    std::stringstream output_buffer;

    for (std::map<uint32_t, banlist_item>::iterator ii = ban_list.begin(); ii != ban_list.end(); ++ii) {
        uint32_t client_ip = (*ii).first;

        std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);
        std::string max_pps_as_string = convert_int_to_string(((*ii).second).max_attack_power);
        std::string attack_direction = get_direction_name(((*ii).second).attack_direction);

        output_buffer << client_ip_as_string << "/" << max_pps_as_string << " pps "
                      << attack_direction << " at "
                      << print_time_t_in_fastnetmon_format(ii->second.ban_timestamp) << std::endl;

        send_attack_details(client_ip, (*ii).second);
    }


    return output_buffer.str();
}

std::string get_attack_description(uint32_t client_ip, attack_details& current_attack) {
    std::stringstream attack_description;

    attack_type_t attack_type = detect_attack_type(current_attack);
    std::string printable_attack_type = get_printable_attack_name(attack_type);

    attack_description
    << "IP: " << convert_ip_as_uint_to_string(client_ip) << "\n"
    << "Attack type: " << printable_attack_type << "\n"
    << "Initial attack power: " << current_attack.attack_power << " packets per second\n"
    << "Peak attack power: " << current_attack.max_attack_power << " packets per second\n"
    << "Attack direction: " << get_direction_name(current_attack.attack_direction) << "\n"
    << "Attack protocol: " << get_printable_protocol_name(current_attack.attack_protocol) << "\n"

    << "Total incoming traffic: " << convert_speed_to_mbps(current_attack.in_bytes) << " mbps\n"
    << "Total outgoing traffic: " << convert_speed_to_mbps(current_attack.out_bytes) << " mbps\n"
    << "Total incoming pps: " << current_attack.in_packets << " packets per second\n"
    << "Total outgoing pps: " << current_attack.out_packets << " packets per second\n"
    << "Total incoming flows: " << current_attack.in_flows << " flows per second\n"
    << "Total outgoing flows: " << current_attack.out_flows << " flows per second\n";

    // Add average counters
    attack_description
    << "Average incoming traffic: " << convert_speed_to_mbps(current_attack.average_in_bytes)
    << " mbps\n"
    << "Average outgoing traffic: " << convert_speed_to_mbps(current_attack.average_out_bytes) << " mbps\n"
    << "Average incoming pps: " << current_attack.average_in_packets << " packets per second\n"
    << "Average outgoing pps: " << current_attack.average_out_packets << " packets per second\n"
    << "Average incoming flows: " << current_attack.average_in_flows << " flows per second\n"
    << "Average outgoing flows: " << current_attack.average_out_flows << " flows per second\n";

    double average_packet_size_for_incoming_traffic = 0;
    double average_packet_size_for_outgoing_traffic = 0;

    if (current_attack.average_in_packets > 0) {
        average_packet_size_for_incoming_traffic =
        (double)current_attack.average_in_bytes / (double)current_attack.average_in_packets;
    }

    if (current_attack.average_out_packets > 0) {
        average_packet_size_for_outgoing_traffic =
        (double)current_attack.average_out_bytes / (double)current_attack.average_out_packets;
    }

    attack_description
    << "Incoming ip fragmented traffic: " << convert_speed_to_mbps(current_attack.fragmented_in_bytes) << " mbps\n"
    << "Outgoing ip fragmented traffic: " << convert_speed_to_mbps(current_attack.fragmented_out_bytes)
    << " mbps\n"
    << "Incoming ip fragmented pps: " << current_attack.fragmented_in_packets
    << " packets per second\n"
    << "Outgoing ip fragmented pps: " << current_attack.fragmented_out_packets
    << " packets per second\n"

    << "Incoming tcp traffic: " << convert_speed_to_mbps(current_attack.tcp_in_bytes) << " mbps\n"
    << "Outgoing tcp traffic: " << convert_speed_to_mbps(current_attack.tcp_out_bytes) << " mbps\n"
    << "Incoming tcp pps: " << current_attack.tcp_in_packets << " packets per second\n"
    << "Outgoing tcp pps: " << current_attack.tcp_out_packets << " packets per second\n"

    << "Incoming syn tcp traffic: " << convert_speed_to_mbps(current_attack.tcp_syn_in_bytes)
    << " mbps\n"
    << "Outgoing syn tcp traffic: " << convert_speed_to_mbps(current_attack.tcp_syn_out_bytes) << " mbps\n"
    << "Incoming syn tcp pps: " << current_attack.tcp_syn_in_packets << " packets per second\n"
    << "Outgoing syn tcp pps: " << current_attack.tcp_syn_out_packets << " packets per second\n"

    << "Incoming udp traffic: " << convert_speed_to_mbps(current_attack.udp_in_bytes) << " mbps\n"
    << "Outgoing udp traffic: " << convert_speed_to_mbps(current_attack.udp_out_bytes) << " mbps\n"
    << "Incoming udp pps: " << current_attack.udp_in_packets << " packets per second\n"
    << "Outgoing udp pps: " << current_attack.udp_out_packets << " packets per second\n"

    << "Incoming icmp traffic: " << convert_speed_to_mbps(current_attack.icmp_in_bytes) << " mbps\n"
    << "Outgoing icmp traffic: " << convert_speed_to_mbps(current_attack.icmp_out_bytes)
    << " mbps\n"
    << "Incoming icmp pps: " << current_attack.icmp_in_packets << " packets per second\n"
    << "Outgoing icmp pps: " << current_attack.icmp_out_packets << " packets per second\n";

    // We do not need very accurate size
    attack_description.precision(1);
    attack_description << "Average packet size for incoming traffic: " << std::fixed
                       << average_packet_size_for_incoming_traffic << " bytes \n"
                       << "Average packet size for outgoing traffic: " << std::fixed
                       << average_packet_size_for_outgoing_traffic << " bytes \n";

    return attack_description.str();
}

void send_attack_details(uint32_t client_ip, attack_details current_attack_details) {
    std::string pps_as_string = convert_int_to_string(current_attack_details.attack_power);
    std::string attack_direction = get_direction_name(current_attack_details.attack_direction);
    std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);

    // Very strange code but it work in 95% cases
    if (ban_list_details.count(client_ip) > 0 && ban_list_details[client_ip].size() == ban_details_records_count) {
        std::stringstream attack_details;

        attack_details << get_attack_description(client_ip, current_attack_details) << "\n\n";

        std::map<unsigned int, unsigned int> protocol_counter;
        for (std::vector<simple_packet>::iterator iii = ban_list_details[client_ip].begin();
             iii != ban_list_details[client_ip].end(); ++iii) {
            attack_details << print_simple_packet(*iii);

            protocol_counter[iii->protocol]++;
        }

        std::map<unsigned int, unsigned int>::iterator max_proto =
        std::max_element(protocol_counter.begin(), protocol_counter.end(), protocol_counter.value_comp());
        attack_details << "\n"
                       << "We got more packets (" << max_proto->second << " from " << ban_details_records_count
                       << ") for protocol: " << get_protocol_name_by_number(max_proto->first) << "\n";

        logger << log4cpp::Priority::INFO << "Attack with direction: " << attack_direction
               << " IP: " << client_ip_as_string << " Power: " << pps_as_string
               << " traffic sample collected";

        print_attack_details_to_file(attack_details.str(), client_ip_as_string, current_attack_details);

        // Pass attack details to script
        if (file_exists(notify_script_path)) {
            logger << log4cpp::Priority::INFO
                   << "Call script for notify about attack details for: " << client_ip_as_string;

            std::string script_params = notify_script_path + " " + client_ip_as_string + " " +
                                        attack_direction + " " + pps_as_string + " ban";

            // We should execute external script in separate thread because any lag in this code
            // will be very distructive
            boost::thread exec_with_params_thread(exec_with_stdin_params, script_params, attack_details.str());
            exec_with_params_thread.detach();

            logger << log4cpp::Priority::INFO
                   << "Script for notify about attack details is finished: " << client_ip_as_string;
        }

#ifdef REDIS
        if (redis_enabled) {
            std::string redis_key_name = client_ip_as_string + "_packets_dump";

            logger << log4cpp::Priority::INFO << "Start data save in redis for key: " << redis_key_name;
            boost::thread redis_store_thread(store_data_in_redis, redis_key_name, attack_details.str());
            redis_store_thread.detach();
            logger << log4cpp::Priority::INFO << "Finish data save in redis for key: " << redis_key_name;
        }
#endif

        // TODO: here we have definitely RACE CONDITION!!! FIX IT

        // Remove key and prevent collection new data about this attack
        ban_list_details_mutex.lock();
        ban_list_details.erase(client_ip);
        ban_list_details_mutex.unlock();
    }
}

uint64_t convert_conntrack_hash_struct_to_integer(packed_conntrack_hash* struct_value) {
    uint64_t unpacked_data = 0;
    memcpy(&unpacked_data, struct_value, sizeof(uint64_t));
    return unpacked_data;
}

void convert_integer_to_conntrack_hash_struct(packed_session* packed_connection_data,
                                              packed_conntrack_hash* unpacked_data) {
    memcpy(unpacked_data, packed_connection_data, sizeof(uint64_t));
}

std::string print_flow_tracking_for_specified_protocol(contrack_map_type& protocol_map,
                                                       std::string client_ip,
                                                       direction flow_direction) {
    std::stringstream buffer;
    // We shoud iterate over all fields

    int printed_records = 0;
    for (contrack_map_type::iterator itr = protocol_map.begin(); itr != protocol_map.end(); ++itr) {
        // We should limit number of records in flow dump because syn flood attacks produce
        // thounsands of lines
        if (printed_records > ban_details_records_count) {
            buffer << "Flows have cropped due to very long list.\n";
            break;
        }

        uint64_t packed_connection_data = itr->first;
        packed_conntrack_hash unpacked_key_struct;
        convert_integer_to_conntrack_hash_struct(&packed_connection_data, &unpacked_key_struct);

        std::string opposite_ip_as_string = convert_ip_as_uint_to_string(unpacked_key_struct.opposite_ip);
        if (flow_direction == INCOMING) {
            buffer << client_ip << ":" << unpacked_key_struct.dst_port << " < "
                   << opposite_ip_as_string << ":" << unpacked_key_struct.src_port << " ";
        } else if (flow_direction == OUTGOING) {
            buffer << client_ip << ":" << unpacked_key_struct.src_port << " > "
                   << opposite_ip_as_string << ":" << unpacked_key_struct.dst_port << " ";
        }

        buffer << itr->second.bytes << " bytes " << itr->second.packets << " packets";
        buffer << "\n";

        printed_records++;
    }

    return buffer.str();
}

/*
    Attack types:
        - syn flood: one local port, multiple remote hosts (and maybe multiple remote ports) and
   small packet size
*/

/* Iterate over all flow tracking table */
bool process_flow_tracking_table(conntrack_main_struct& conntrack_element, std::string client_ip) {
    std::map<uint32_t, unsigned int> uniq_remote_hosts_which_generate_requests_to_us;
    std::map<unsigned int, unsigned int> uniq_local_ports_which_target_of_connectiuons_from_inside;

    /* Process incoming TCP connections */
    for (contrack_map_type::iterator itr = conntrack_element.in_tcp.begin();
         itr != conntrack_element.in_tcp.end(); ++itr) {
        uint64_t packed_connection_data = itr->first;
        packed_conntrack_hash unpacked_key_struct;
        convert_integer_to_conntrack_hash_struct(&packed_connection_data, &unpacked_key_struct);

        uniq_remote_hosts_which_generate_requests_to_us[unpacked_key_struct.opposite_ip]++;
        uniq_local_ports_which_target_of_connectiuons_from_inside[unpacked_key_struct.dst_port]++;

        // we can calc average packet size
        // string opposite_ip_as_string =
        // convert_ip_as_uint_to_string(unpacked_key_struct.opposite_ip);
        // unpacked_key_struct.src_port
        // unpacked_key_struct.dst_port
        // itr->second.packets
        // itr->second.bytes
    }

    return true;
}

std::string print_flow_tracking_for_ip(conntrack_main_struct& conntrack_element, std::string client_ip) {
    std::stringstream buffer;

    std::string in_tcp =
    print_flow_tracking_for_specified_protocol(conntrack_element.in_tcp, client_ip, INCOMING);
    std::string in_udp =
    print_flow_tracking_for_specified_protocol(conntrack_element.in_udp, client_ip, INCOMING);

    unsigned long long total_number_of_incoming_tcp_flows = conntrack_element.in_tcp.size();
    unsigned long long total_number_of_incoming_udp_flows = conntrack_element.in_udp.size();

    unsigned long long total_number_of_outgoing_tcp_flows = conntrack_element.out_tcp.size();
    unsigned long long total_number_of_outgoing_udp_flows = conntrack_element.out_udp.size();

    bool we_have_incoming_flows = in_tcp.length() > 0 or in_udp.length() > 0;
    if (we_have_incoming_flows) {
        buffer << "Incoming\n\n";

        if (in_tcp.length() > 0) {
            buffer << "TCP flows: " << total_number_of_incoming_tcp_flows << "\n";
            buffer << in_tcp << "\n";
        }

        if (in_udp.length() > 0) {
            buffer << "UDP flows: " << total_number_of_incoming_udp_flows << "\n";
            buffer << in_udp << "\n";
        }
    }

    std::string out_tcp =
    print_flow_tracking_for_specified_protocol(conntrack_element.out_tcp, client_ip, OUTGOING);
    std::string out_udp =
    print_flow_tracking_for_specified_protocol(conntrack_element.out_udp, client_ip, OUTGOING);

    bool we_have_outgoing_flows = out_tcp.length() > 0 or out_udp.length() > 0;

    // print delimiter if we have flows in both directions
    if (we_have_incoming_flows && we_have_outgoing_flows) {
        buffer << "\n";
    }

    if (we_have_outgoing_flows) {
        buffer << "Outgoing\n\n";

        if (out_tcp.length() > 0) {
            buffer << "TCP flows: " << total_number_of_outgoing_tcp_flows << "\n";
            buffer << out_tcp << "\n";
        }

        if (out_udp.length() > 0) {
            buffer << "UDP flows: " << total_number_of_outgoing_udp_flows << "\n";
            buffer << out_udp << "\n";
        }
    }

    return buffer.str();
}

std::string print_subnet_load() {
    std::stringstream buffer;

    for (map_for_subnet_counters::iterator itr = PerSubnetSpeedMap.begin(); itr != PerSubnetSpeedMap.end(); ++itr) {
        map_element* speed = &itr->second; 

        buffer
            << std::setw(18)
            << std::left
            << convert_subnet_to_string(itr->first);
            
        buffer
            << "\t"
            << "pps in: " << speed->in_packets
            << " out: "    << speed->out_packets
            << " mbps in: " << convert_speed_to_mbps(speed->in_bytes)
            << " out: "    << convert_speed_to_mbps(speed->out_bytes)
            << "\n";
    }

    return buffer.str();
}

std::string print_ban_thresholds() {
    std::stringstream output_buffer;

    output_buffer << "Configuration params:\n";
    if (we_do_real_ban) {
        output_buffer << "We call ban script: yes\n";
    } else {
        output_buffer << "We call ban script: no\n";
    }

    output_buffer << "Packets per second: ";
    if (enable_ban_for_pps) {
        output_buffer << ban_threshold_pps;
    } else {
        output_buffer << "disabled";
    }

    output_buffer << "\n";

    output_buffer << "Mbps per second: ";
    if (enable_ban_for_bandwidth) {
        output_buffer << ban_threshold_mbps;
    } else {
        output_buffer << "disabled";
    }

    output_buffer << "\n";

    output_buffer << "Flows per second: ";
    if (enable_ban_for_flows_per_second) {
        output_buffer << ban_threshold_flows;
    } else {
        output_buffer << "disabled";
    }

    output_buffer << "\n";
    return output_buffer.str();
}

void print_attack_details_to_file(std::string details, std::string client_ip_as_string, attack_details current_attack) {
    std::ofstream my_attack_details_file;

    std::string ban_timestamp_as_string = print_time_t_in_fastnetmon_format(current_attack.ban_timestamp);
    std::string attack_dump_path = attack_details_folder + "/" + client_ip_as_string + "_" + ban_timestamp_as_string;

    my_attack_details_file.open(attack_dump_path.c_str(), std::ios::app);

    if (my_attack_details_file.is_open()) {
        my_attack_details_file << details << "\n\n";
        my_attack_details_file.close();
    } else {
        logger << log4cpp::Priority::ERROR << "Can't print attack details to file";
    }
}

// Return true when we should ban this IP
bool we_should_ban_this_ip(map_element* average_speed_element) {
    uint64_t in_pps_average = average_speed_element->in_packets;
    uint64_t out_pps_average = average_speed_element->out_packets;

    uint64_t in_bps_average = average_speed_element->in_bytes;
    uint64_t out_bps_average = average_speed_element->out_bytes;

    uint64_t in_flows_average = average_speed_element->in_flows;
    uint64_t out_flows_average = average_speed_element->out_flows;

    // we detect overspeed by packets
    bool attack_detected_by_pps = false;
    bool attack_detected_by_bandwidth = false;
    bool attack_detected_by_flow = false;
    if (enable_ban_for_pps && (in_pps_average > ban_threshold_pps or out_pps_average > ban_threshold_pps)) {
        attack_detected_by_pps = true;
    }

    // we detect overspeed by bandwidth
    if (enable_ban_for_bandwidth && (convert_speed_to_mbps(in_bps_average) > ban_threshold_mbps or
                                     convert_speed_to_mbps(out_bps_average) > ban_threshold_mbps)) {
        attack_detected_by_bandwidth = true;
    }

    if (enable_ban_for_flows_per_second &&
        (in_flows_average > ban_threshold_flows or out_flows_average > ban_threshold_flows)) {
        attack_detected_by_flow = true;
    }

    return attack_detected_by_pps or attack_detected_by_bandwidth or attack_detected_by_flow;
}

attack_type_t detect_attack_type(attack_details& current_attack) {
    double threshold_value = 0.9;

    if (current_attack.attack_direction == INCOMING) {
        if (current_attack.tcp_syn_in_packets > threshold_value * current_attack.in_packets) {
            return ATTACK_SYN_FLOOD;
        } else if (current_attack.icmp_in_packets > threshold_value * current_attack.in_packets) {
            return ATTACK_ICMP_FLOOD;
        } else if (current_attack.fragmented_in_packets > threshold_value * current_attack.in_packets) {
            return ATTACK_IP_FRAGMENTATION_FLOOD;
        } else if (current_attack.udp_in_packets > threshold_value * current_attack.in_packets) {
            return ATTACK_UDP_FLOOD;
        }
    } else if (current_attack.attack_direction == OUTGOING) {
        if (current_attack.tcp_syn_out_packets > threshold_value * current_attack.out_packets) {
            return ATTACK_SYN_FLOOD;
        } else if (current_attack.icmp_out_packets > threshold_value * current_attack.out_packets) {
            return ATTACK_ICMP_FLOOD;
        } else if (current_attack.fragmented_out_packets > threshold_value * current_attack.out_packets) {
            return ATTACK_IP_FRAGMENTATION_FLOOD;
        } else if (current_attack.udp_out_packets > threshold_value * current_attack.out_packets) {
            return ATTACK_UDP_FLOOD;
        }
    }

    return ATTACK_UNKNOWN;
}

std::string get_printable_attack_name(attack_type_t attack) {
    if (attack == ATTACK_SYN_FLOOD) {
        return "syn_flood";
    } else if (attack == ATTACK_ICMP_FLOOD) {
        return "icmp_flood";
    } else if (attack == ATTACK_UDP_FLOOD) {
        return "udp_flood";
    } else if (attack == ATTACK_IP_FRAGMENTATION_FLOOD) {
        return "ip_fragmentation";
    } else if (attack == ATTACK_UNKNOWN) {
        return "unknown";
    } else {
        return "unknown";
    }
}