fastnetmon-ng/src/fastnetmon.cpp

3033 lines
114 KiB
C++
Raw Normal View History

2013-10-21 11:43:54 +02:00
/* Author: pavel.odintsov@gmail.com */
/* License: GPLv2 */
2013-10-18 12:16:55 +02:00
#include <stdio.h>
#include <stdlib.h>
#include <errno.h>
2013-10-18 12:16:55 +02:00
#include <string.h>
#include <unistd.h>
#include <signal.h>
2013-10-21 11:43:54 +02:00
#include <time.h>
#include <math.h>
2013-10-21 11:43:54 +02:00
2013-10-18 12:16:55 +02:00
#include <sys/socket.h>
#include <sys/resource.h>
#include <sys/stat.h>
2013-10-18 12:16:55 +02:00
#include <arpa/inet.h>
#include <netinet/ip.h>
#include <netinet/tcp.h>
#include <netinet/udp.h>
#include <netinet/ip_icmp.h>
2013-10-21 11:43:54 +02:00
#include <netinet/if_ether.h>
#include <netinet/in.h>
2013-10-18 12:16:55 +02:00
#include "libpatricia/patricia.h"
2014-12-01 22:08:38 +01:00
#include "fastnetmon_types.h"
2015-03-21 12:24:31 +01:00
#include "fast_library.h"
// Here we store variables which differs for different paltforms
#include "fast_platform.h"
// Plugins
2014-12-01 22:08:38 +01:00
#include "sflow_plugin/sflow_collector.h"
#include "netflow_plugin/netflow_collector.h"
#include "pcap_plugin/pcap_collector.h"
2015-03-10 15:17:52 +01:00
#include "netmap_plugin/netmap_collector.h"
#ifdef PF_RING
#include "pfring_plugin/pfring_collector.h"
#endif
// Yes, maybe it's not an good idea but with this we can guarantee working code in example plugin
2015-01-26 10:10:35 +01:00
#include "example_plugin/example_collector.h"
2014-06-26 17:08:19 +02:00
2013-10-18 12:16:55 +02:00
#include <algorithm>
#include <iostream>
#include <map>
2014-06-09 11:08:19 +02:00
#include <fstream>
2013-11-15 15:35:44 +01:00
2013-10-18 12:16:55 +02:00
#include <vector>
#include <utility>
#include <sstream>
#include <boost/thread.hpp>
#include <boost/thread/mutex.hpp>
#include <boost/regex.hpp>
2013-10-21 16:47:31 +02:00
// log4cpp logging facility
2014-06-24 12:16:22 +02:00
#include "log4cpp/Category.hh"
#include "log4cpp/Appender.hh"
#include "log4cpp/FileAppender.hh"
#include "log4cpp/OstreamAppender.hh"
#include "log4cpp/Layout.hh"
#include "log4cpp/BasicLayout.hh"
#include "log4cpp/PatternLayout.hh"
#include "log4cpp/Priority.hh"
// Boost libs
2013-10-18 12:16:55 +02:00
#include <boost/algorithm/string.hpp>
2013-12-28 20:11:20 +01:00
#ifdef GEOIP
#include "GeoIP.h"
#endif
2013-10-20 00:10:19 +02:00
#ifdef REDIS
#include <hiredis/hiredis.h>
#endif
2013-10-18 12:21:41 +02:00
time_t last_call_of_traffic_recalculation;
// Variable with all data from main screen
2015-01-27 20:29:51 +01:00
std::string screen_data_stats = "";
// Global map with parsed config file
2015-01-27 20:29:51 +01:00
std::map<std::string, std::string> configuration_map;
2013-11-15 15:35:44 +01:00
/* Configuration block, we must move it to configuration file */
2013-10-21 12:27:43 +02:00
#ifdef REDIS
unsigned int redis_port = 6379;
2015-01-27 20:29:51 +01:00
std::string redis_host = "127.0.0.1";
2015-06-04 12:15:42 +02:00
// because it's additional and very specific feature we should disable it by default
bool redis_enabled = false;
2013-10-21 12:27:43 +02:00
#endif
2013-10-18 12:16:55 +02:00
bool monitor_local_ip_addresses = true;
// This flag could enable print of ban actions and thresholds on the client's screen
bool print_configuration_params_on_the_screen = false;
// Trigger for enable or disable traffic counting for whole subnets
bool enable_subnet_counters = false;
// We will announce whole subnet instead single IP with BGP if this flag enabled
bool exabgp_announce_whole_subnet = false;
bool enable_ban_for_pps = false;
bool enable_ban_for_bandwidth = false;
bool enable_ban_for_flows_per_second = false;
bool enable_conection_tracking = true;
2014-12-02 13:43:34 +01:00
bool enable_data_collection_from_mirror = true;
2015-03-10 15:17:52 +01:00
bool enable_netmap_collection = false;
2014-12-02 13:43:34 +01:00
bool enable_sflow_collection = false;
bool enable_netflow_collection = false;
bool enable_pcap_collection = false;
// Time consumed by reaclculation for all IPs
struct timeval speed_calculation_time;
// Time consumed by drawing stats for all IPs
struct timeval drawing_thread_execution_time;
// Global thread group for packet capture threads
boost::thread_group packet_capture_plugin_thread_group;
// Total number of hosts in our networks
// We need this as global variable because it's very important value for configuring data structures
unsigned int total_number_of_hosts_in_our_networks = 0;
2013-12-28 20:11:20 +01:00
#ifdef GEOIP
GeoIP* geo_ip = NULL;
2013-12-28 20:11:20 +01:00
#endif
patricia_tree_t* lookup_tree, *whitelist_tree;
bool DEBUG = 0;
2013-10-21 12:27:43 +02:00
2014-12-15 20:08:39 +01:00
// flag about dumping all packets to log
2014-06-20 17:18:27 +02:00
bool DEBUG_DUMP_ALL_PACKETS = false;
// Period for update screen for console version of tool
unsigned int check_period = 3;
2013-10-21 12:27:43 +02:00
// Standard ban time in seconds for all attacks but you can tune this value
int standard_ban_time = 1800;
// We calc average pps/bps for this time
double average_calculation_amount = 15;
// We calc average pps/bps for subnets with this time, we use longer value for calculation average network traffic
double average_calculation_amount_for_subnets = 30;
// Show average or absolute value of speed
bool print_average_traffic_counts = true;
2015-04-27 14:49:03 +02:00
// Key used for sorting clients in output. Allowed sort params: packets/bytes/flows
2015-01-27 20:29:51 +01:00
std::string sort_parameter = "packets";
2013-10-21 15:43:00 +02:00
2013-11-15 15:35:44 +01:00
// Number of lines in programm output
unsigned int max_ips_in_list = 7;
2013-10-21 12:27:43 +02:00
2013-11-15 15:35:44 +01:00
// We must ban IP if it exceeed this limit in PPS
unsigned int ban_threshold_pps = 20000;
2014-11-14 22:34:29 +01:00
// We must ban IP of it exceed this limit for number of flows in any direction
unsigned int ban_threshold_flows = 3500;
// We must ban client if it exceed 1GBps
unsigned int ban_threshold_mbps = 1000;
2013-10-21 12:27:43 +02:00
2013-11-15 15:35:44 +01:00
// Number of lines for sending ben attack details to email
unsigned int ban_details_records_count = 500;
2013-10-21 12:27:43 +02:00
2014-06-09 14:47:11 +02:00
// log file
2014-06-24 12:16:22 +02:00
log4cpp::Category& logger = log4cpp::Category::getRoot();
2014-06-09 14:47:11 +02:00
2013-11-15 15:35:44 +01:00
/* Configuration block ends */
2013-10-21 12:27:43 +02:00
// We count total number of incoming/outgoing/internal and other traffic type packets/bytes
// And initilize by 0 all fields
total_counter_element total_counters[4];
total_counter_element total_speed_counters[4];
2013-11-15 15:35:44 +01:00
2014-12-10 16:08:12 +01:00
// Total amount of non parsed packets
uint64_t total_unparsed_packets = 0;
2014-12-01 22:08:38 +01:00
uint64_t incoming_total_flows_speed = 0;
uint64_t outgoing_total_flows_speed = 0;
map_of_vector_counters SubnetVectorMap;
// Here we store taffic per subnet
map_for_subnet_counters PerSubnetCountersMap;
// Here we store traffic speed per subnet
map_for_subnet_counters PerSubnetSpeedMap;
// Here we store average speed per subnet
map_for_subnet_counters PerSubnetAverageSpeedMap;
// Flow tracking structures
map_of_vector_counters_for_flow SubnetVectorMapFlow;
2013-11-15 15:35:44 +01:00
/* End of our data structs */
2013-10-18 12:16:55 +02:00
boost::mutex data_counters_mutex;
boost::mutex speed_counters_mutex;
boost::mutex total_counters_mutex;
boost::mutex ban_list_details_mutex;
boost::mutex ban_list_mutex;
2014-10-22 04:29:55 +02:00
boost::mutex flow_counter;
2013-10-21 21:45:33 +02:00
2014-10-22 04:29:55 +02:00
// map for flows
2015-01-27 20:29:51 +01:00
std::map<uint64_t, int> FlowCounter;
2014-10-22 04:29:55 +02:00
2014-11-15 01:10:04 +01:00
// Struct for string speed per IP
map_for_counters SpeedCounter;
// Struct for storing average speed per IP for specified interval
map_for_counters SpeedCounterAverage;
2013-12-28 20:11:20 +01:00
#ifdef GEOIP
map_for_counters GeoIpCounter;
#endif
2014-11-15 01:10:04 +01:00
// In ddos info we store attack power and direction
2015-01-27 20:29:51 +01:00
std::map<uint32_t, banlist_item> ban_list;
std::map<uint32_t, std::vector<simple_packet> > ban_list_details;
2013-10-18 12:16:55 +02:00
2015-05-21 18:34:17 +02:00
std::vector<subnet_t> our_networks;
std::vector<subnet_t> whitelist_networks;
2013-10-18 12:16:55 +02:00
2014-11-15 01:10:04 +01:00
// Ban enable/disable flag
bool we_do_real_ban = true;
2015-04-26 11:47:37 +02:00
// ExaBGP support flag
bool exabgp_enabled = false;
std::string exabgp_community = "";
2015-05-11 21:56:18 +02:00
std::string exabgp_command_pipe = "/var/run/exabgp.cmd";
std::string exabgp_next_hop = "";
2015-04-26 11:47:37 +02:00
2015-05-10 20:42:49 +02:00
// Graphite monitoring
bool graphite_enabled = false;
std::string graphite_host = "127.0.0.1";
unsigned short int graphite_port = 2003;
std::string graphite_prefix = "fastnetmon.";
bool process_incoming_traffic = true;
bool process_outgoing_traffic = true;
2014-11-15 01:10:04 +01:00
// Prototypes
#ifdef HWFILTER_LOCKING
2015-01-27 20:29:51 +01:00
void block_all_traffic_with_82599_hardware_filtering(std::string client_ip_as_string);
#endif
std::string print_subnet_load();
std::string get_printable_attack_name(attack_type_t attack);
attack_type_t detect_attack_type(attack_details& current_attack);
bool we_should_ban_this_ip(map_element* current_average_speed_element);
unsigned int get_max_used_protocol(uint64_t tcp, uint64_t udp, uint64_t icmp);
void print_attack_details_to_file(std::string details, std::string client_ip_as_string, attack_details current_attack);
2015-01-27 20:29:51 +01:00
std::string print_ban_thresholds();
bool load_configuration_file();
2015-01-27 20:29:51 +01:00
std::string print_flow_tracking_for_ip(conntrack_main_struct& conntrack_element, std::string client_ip);
void convert_integer_to_conntrack_hash_struct(packed_session* packed_connection_data,
packed_conntrack_hash* unpacked_data);
2014-11-13 16:01:15 +01:00
uint64_t convert_conntrack_hash_struct_to_integer(packed_conntrack_hash* struct_value);
void cleanup_ban_list();
2015-01-27 20:29:51 +01:00
std::string get_attack_description(uint32_t client_ip, attack_details& current_attack);
void send_attack_details(uint32_t client_ip, attack_details current_attack_details);
void free_up_all_resources();
2015-01-27 20:29:51 +01:00
std::string print_ddos_attack_details();
void execute_ip_ban(uint32_t client_ip,
map_element new_speed_element,
map_element current_speed_element,
std::string flow_attack_details,
subnet_t client_subnet);
direction get_packet_direction(uint32_t src_ip, uint32_t dst_ip, unsigned long& subnet, unsigned int& subnet_cidr_mask);
void recalculate_speed();
2015-01-27 20:29:51 +01:00
std::string print_channel_speed(std::string traffic_type, direction packet_direction);
2014-06-21 16:11:53 +02:00
void process_packet(simple_packet& current_packet);
void traffic_draw_programm();
void interruption_signal_handler(int signal_number);
2013-10-18 12:16:55 +02:00
2014-12-04 15:45:42 +01:00
/* Class for custom comparison fields by different fields */
class TrafficComparatorClass {
private:
sort_type sort_field;
direction sort_direction;
public:
TrafficComparatorClass(direction sort_direction, sort_type sort_field) {
this->sort_field = sort_field;
this->sort_direction = sort_direction;
}
bool operator()(pair_of_map_elements a, pair_of_map_elements b) {
if (sort_field == FLOWS) {
if (sort_direction == INCOMING) {
return a.second.in_flows > b.second.in_flows;
} else if (sort_direction == OUTGOING) {
return a.second.out_flows > b.second.out_flows;
2014-12-04 15:45:42 +01:00
} else {
return false;
}
} else if (sort_field == PACKETS) {
if (sort_direction == INCOMING) {
return a.second.in_packets > b.second.in_packets;
} else if (sort_direction == OUTGOING) {
return a.second.out_packets > b.second.out_packets;
} else {
return false;
}
} else if (sort_field == BYTES) {
if (sort_direction == INCOMING) {
return a.second.in_bytes > b.second.in_bytes;
} else if (sort_direction == OUTGOING) {
return a.second.out_bytes > b.second.out_bytes;
} else {
return false;
}
} else {
return false;
2014-12-04 15:45:42 +01:00
}
}
2014-12-04 15:45:42 +01:00
};
2015-01-27 20:29:51 +01:00
std::string get_direction_name(direction direction_value) {
std::string direction_name;
2013-10-21 11:43:54 +02:00
switch (direction_value) {
case INCOMING:
direction_name = "incoming";
break;
case OUTGOING:
direction_name = "outgoing";
break;
case INTERNAL:
direction_name = "internal";
break;
case OTHER:
direction_name = "other";
break;
default:
direction_name = "unknown";
break;
}
2013-10-21 11:43:54 +02:00
return direction_name;
}
void sigpipe_handler_for_popen(int signo) {
logger << log4cpp::Priority::ERROR << "Sorry but we experienced error with popen. "
<< "Please check your scripts. It should receive data on stdin!";
2015-06-03 13:06:13 +02:00
// Well, we do not need exit here because we have another options to notifying about atatck
// exit(1);
}
2014-06-09 13:53:31 +02:00
// exec command and pass data to it stdin
2015-01-27 20:29:51 +01:00
bool exec_with_stdin_params(std::string cmd, std::string params) {
2013-10-19 16:40:54 +02:00
FILE* pipe = popen(cmd.c_str(), "w");
2014-12-26 09:57:30 +01:00
if (!pipe) {
logger << log4cpp::Priority::ERROR << "Can't execute programm " << cmd
<< " error code: " << errno << " error text: " << strerror(errno);
2014-12-26 09:57:30 +01:00
return false;
}
2013-10-19 16:40:54 +02:00
int fputs_ret = fputs(params.c_str(), pipe);
if (fputs_ret) {
pclose(pipe);
2013-10-19 16:40:54 +02:00
return true;
} else {
logger << log4cpp::Priority::ERROR << "Can't pass data to stdin of programm " << cmd;
pclose(pipe);
2013-10-19 16:40:54 +02:00
return false;
}
}
2013-12-28 20:11:20 +01:00
#ifdef GEOIP
bool geoip_init() {
// load GeoIP ASN database to memory
geo_ip = GeoIP_open("/root/fastnetmon/GeoIPASNum.dat", GEOIP_MEMORY_CACHE);
if (geo_ip == NULL) {
return false;
} else {
return true;
}
}
#endif
2013-10-20 00:10:19 +02:00
#ifdef REDIS
redisContext* redis_init_connection() {
2013-10-21 11:43:54 +02:00
struct timeval timeout = { 1, 500000 }; // 1.5 seconds
redisContext* redis_context = redisConnectWithTimeout(redis_host.c_str(), redis_port, timeout);
2013-10-21 11:43:54 +02:00
if (redis_context->err) {
logger << log4cpp::Priority::INFO << "Connection error:" << redis_context->errstr;
return NULL;
2013-10-21 11:43:54 +02:00
}
2014-11-15 01:10:04 +01:00
// We should check connection with ping because redis do not check connection
2013-10-21 11:43:54 +02:00
redisReply* reply = (redisReply*)redisCommand(redis_context, "PING");
if (reply) {
freeReplyObject(reply);
} else {
return NULL;
2013-10-21 11:43:54 +02:00
}
return redis_context;
2013-10-21 11:43:54 +02:00
}
#endif
2013-10-21 11:43:54 +02:00
#ifdef REDIS
void store_data_in_redis(std::string key_name, std::string attack_details) {
redisReply* reply = NULL;
redisContext* redis_context = redis_init_connection();
2013-10-20 00:10:19 +02:00
2013-10-21 11:43:54 +02:00
if (!redis_context) {
logger << log4cpp::Priority::INFO << "Could not initiate connection to Redis";
2013-10-21 11:43:54 +02:00
return;
2013-10-20 00:10:19 +02:00
}
2013-10-21 11:43:54 +02:00
reply = (redisReply*)redisCommand(redis_context, "SET %s %s", key_name.c_str(), attack_details.c_str());
2013-10-21 11:43:54 +02:00
2014-11-15 01:10:04 +01:00
// If we store data correctly ...
2013-10-21 11:43:54 +02:00
if (!reply) {
logger.error("Can't increment traffic in redis error_code: %d error_string: %s",
redis_context->err, redis_context->errstr);
2014-11-15 01:10:04 +01:00
// Handle redis server restart corectly
2013-10-21 11:43:54 +02:00
if (redis_context->err == 1 or redis_context->err == 3) {
// Connection refused
logger.error(
"Unfortunately we can't store data in Redis because server reject connection");
2013-10-21 11:43:54 +02:00
}
} else {
freeReplyObject(reply);
2013-10-21 11:43:54 +02:00
}
redisFree(redis_context);
2013-10-20 00:10:19 +02:00
}
#endif
2015-01-27 20:29:51 +01:00
std::string draw_table(map_for_counters& my_map_packets, direction data_direction, bool do_redis_update, sort_type sort_item) {
std::vector<pair_of_map_elements> vector_for_sort;
2013-10-18 12:16:55 +02:00
2015-01-27 20:29:51 +01:00
std::stringstream output_buffer;
// Preallocate memory for sort vector
vector_for_sort.reserve(my_map_packets.size());
for (map_for_counters::iterator ii = my_map_packets.begin(); ii != my_map_packets.end(); ++ii) {
2014-11-15 01:10:04 +01:00
// store all elements into vector for sorting
vector_for_sort.push_back(std::make_pair((*ii).first, (*ii).second));
}
2014-12-04 15:45:42 +01:00
if (data_direction == INCOMING or data_direction == OUTGOING) {
std::sort(vector_for_sort.begin(), vector_for_sort.end(),
TrafficComparatorClass(data_direction, sort_item));
} else {
logger << log4cpp::Priority::ERROR << "Unexpected bahaviour on sort function";
return "Internal error";
}
2015-05-10 20:42:49 +02:00
graphite_data_t graphite_data;
unsigned int element_number = 0;
// TODO: fix this code because iteraton over over millions of IPs is very CPU intensive
for (std::vector<pair_of_map_elements>::iterator ii = vector_for_sort.begin();
ii != vector_for_sort.end(); ++ii) {
uint32_t client_ip = (*ii).first;
2015-01-27 20:29:51 +01:00
std::string client_ip_as_string = convert_ip_as_uint_to_string((*ii).first);
uint64_t pps = 0;
uint64_t bps = 0;
uint64_t flows = 0;
uint64_t pps_average = 0;
uint64_t bps_average = 0;
uint64_t flows_average = 0;
// TODO: replace map by vector iteration
2014-12-02 15:11:27 +01:00
map_element* current_average_speed_element = &SpeedCounterAverage[client_ip];
map_element* current_speed_element = &SpeedCounter[client_ip];
2014-11-15 01:10:04 +01:00
// Create polymorphic pps, byte and flow counters
if (data_direction == INCOMING) {
pps = current_speed_element->in_packets;
bps = current_speed_element->in_bytes;
2014-12-04 22:01:08 +01:00
flows = current_speed_element->in_flows;
pps_average = current_average_speed_element->in_packets;
bps_average = current_average_speed_element->in_bytes;
2014-12-02 16:30:25 +01:00
flows_average = current_average_speed_element->in_flows;
} else if (data_direction == OUTGOING) {
pps = current_speed_element->out_packets;
bps = current_speed_element->out_bytes;
2014-12-04 22:01:08 +01:00
flows = current_speed_element->out_flows;
2014-12-02 15:11:27 +01:00
pps_average = current_average_speed_element->out_packets;
bps_average = current_average_speed_element->out_bytes;
2014-12-02 16:30:25 +01:00
flows_average = current_average_speed_element->out_flows;
}
uint64_t mbps = convert_speed_to_mbps(bps);
uint64_t mbps_average = convert_speed_to_mbps(bps_average);
2014-11-15 01:10:04 +01:00
// Print first max_ips_in_list elements in list, we will show top 20 "huge" channel loaders
if (element_number < max_ips_in_list) {
2015-01-27 20:29:51 +01:00
std::string is_banned = ban_list.count(client_ip) > 0 ? " *banned* " : "";
// We use setw for alignment
output_buffer << client_ip_as_string << "\t\t";
2015-05-10 20:42:49 +02:00
if (graphite_enabled) {
std::string direction_as_string;
if (data_direction == INCOMING) {
direction_as_string = "incoming";
} else if (data_direction == OUTGOING) {
2015-05-10 20:42:49 +02:00
direction_as_string = "outgoing";
}
std::string ip_as_string_with_dash_delimiters = client_ip_as_string;
// Replace dots by dashes
std::replace(ip_as_string_with_dash_delimiters.begin(),
ip_as_string_with_dash_delimiters.end(), '.', '_');
graphite_data[graphite_prefix + ip_as_string_with_dash_delimiters + "." + direction_as_string + ".pps"] =
pps;
graphite_data[graphite_prefix + ip_as_string_with_dash_delimiters + "." + direction_as_string + ".mbps"] =
mbps;
graphite_data[graphite_prefix + ip_as_string_with_dash_delimiters + "." + direction_as_string + ".flows"] =
flows;
2015-05-10 20:42:49 +02:00
}
if (print_average_traffic_counts) {
output_buffer << std::setw(6) << pps_average << " pps ";
output_buffer << std::setw(6) << mbps_average << " mbps ";
output_buffer << std::setw(6) << flows_average << " flows ";
} else {
output_buffer << std::setw(6) << pps << " pps ";
output_buffer << std::setw(6) << mbps << " mbps ";
output_buffer << std::setw(6) << flows << " flows ";
}
output_buffer << is_banned << std::endl;
}
element_number++;
}
2015-05-11 14:28:14 +02:00
if (graphite_enabled) {
bool graphite_put_result = store_data_to_graphite(graphite_port, graphite_host, graphite_data);
2015-05-10 20:42:49 +02:00
2015-05-11 14:28:14 +02:00
if (!graphite_put_result) {
logger << log4cpp::Priority::ERROR << "Can't store data to Graphite";
2015-05-11 14:28:14 +02:00
}
2015-05-10 20:42:49 +02:00
}
return output_buffer.str();
2013-10-18 12:16:55 +02:00
}
2015-03-21 12:24:31 +01:00
// TODO: move to lirbary
2014-06-09 11:57:28 +02:00
// read whole file to vector
2015-01-27 20:29:51 +01:00
std::vector<std::string> read_file_to_vector(std::string file_name) {
std::vector<std::string> data;
std::string line;
2014-06-09 11:57:28 +02:00
2015-01-27 20:29:51 +01:00
std::ifstream reading_file;
reading_file.open(file_name.c_str(), std::ifstream::in);
2014-06-09 11:57:28 +02:00
if (reading_file.is_open()) {
while (getline(reading_file, line)) {
data.push_back(line);
2014-06-09 11:57:28 +02:00
}
} else {
logger << log4cpp::Priority::ERROR << "Can't open file: " << file_name;
2014-06-09 11:57:28 +02:00
}
return data;
}
2014-06-09 11:08:19 +02:00
// Load configuration
bool load_configuration_file() {
std::ifstream config_file(global_config_path.c_str());
2015-01-27 20:29:51 +01:00
std::string line;
2014-06-09 11:08:19 +02:00
if (!config_file.is_open()) {
logger << log4cpp::Priority::ERROR << "Can't open config file";
return false;
}
2014-06-09 11:08:19 +02:00
while (getline(config_file, line)) {
2015-04-27 14:48:11 +02:00
std::vector<std::string> parsed_config;
2015-04-27 14:48:11 +02:00
if (line.find("#") == 0 or line.empty()) {
// Ignore comments line
continue;
}
boost::split(parsed_config, line, boost::is_any_of(" ="), boost::token_compress_on);
if (parsed_config.size() == 2) {
configuration_map[parsed_config[0]] = parsed_config[1];
} else {
logger << log4cpp::Priority::ERROR << "Can't parse config line: '" << line << "'";
}
}
if (configuration_map.count("enable_connection_tracking")) {
if (configuration_map["enable_connection_tracking"] == "on") {
enable_conection_tracking = true;
} else {
enable_conection_tracking = false;
}
}
2014-12-03 16:03:47 +01:00
if (configuration_map.count("ban_time") != 0) {
standard_ban_time = convert_string_to_integer(configuration_map["ban_time"]);
}
2014-12-02 15:11:27 +01:00
if (configuration_map.count("average_calculation_time") != 0) {
average_calculation_amount =
convert_string_to_integer(configuration_map["average_calculation_time"]);
2014-12-02 15:11:27 +01:00
}
if (configuration_map.count("average_calculation_time_for_subnets") != 0) {
average_calculation_amount_for_subnets =
convert_string_to_integer(configuration_map["average_calculation_time_for_subnets"]);
}
2014-12-02 13:43:34 +01:00
if (configuration_map.count("threshold_pps") != 0) {
ban_threshold_pps = convert_string_to_integer(configuration_map["threshold_pps"]);
}
2014-06-09 11:08:19 +02:00
if (configuration_map.count("threshold_mbps") != 0) {
ban_threshold_mbps = convert_string_to_integer(configuration_map["threshold_mbps"]);
}
if (configuration_map.count("threshold_flows") != 0) {
ban_threshold_flows = convert_string_to_integer(configuration_map["threshold_flows"]);
}
if (configuration_map.count("enable_ban") != 0) {
if (configuration_map["enable_ban"] == "on") {
we_do_real_ban = true;
} else {
we_do_real_ban = false;
}
}
if (configuration_map.count("monitor_local_ip_addresses") != 0) {
monitor_local_ip_addresses = configuration_map["monitor_local_ip_addresses"] == "on" ? true : false;
}
2015-04-26 11:47:37 +02:00
if (configuration_map.count("exabgp") != 0) {
if (configuration_map["exabgp"] == "on") {
exabgp_enabled = true;
} else {
exabgp_enabled = false;
}
}
if (exabgp_enabled) {
// TODO: add community format validation
2015-04-26 11:47:37 +02:00
exabgp_community = configuration_map["exabgp_community"];
if (exabgp_community.empty()) {
logger << log4cpp::Priority::ERROR
<< "You enabled exabgp but not specified community, we disable exabgp support";
exabgp_enabled = false;
}
2015-04-26 11:47:37 +02:00
}
if (exabgp_enabled) {
exabgp_command_pipe = configuration_map["exabgp_command_pipe"];
if (exabgp_command_pipe.empty()) {
logger << log4cpp::Priority::ERROR << "You enabled exabgp but not specified "
"exabgp_command_pipe, so we disable exabgp "
"support";
2015-04-26 11:47:37 +02:00
exabgp_enabled = false;
}
2015-04-26 11:47:37 +02:00
}
if (exabgp_enabled) {
exabgp_next_hop = configuration_map["exabgp_next_hop"];
if (exabgp_next_hop.empty()) {
logger
<< log4cpp::Priority::ERROR
<< "You enabled exabgp but not specified exabgp_next_hop, so we disable exabgp support";
exabgp_enabled = false;
}
2015-05-02 18:00:33 +02:00
if (exabgp_enabled) {
logger << log4cpp::Priority::INFO << "ExaBGP support initialized correctly";
}
2015-05-02 18:00:33 +02:00
}
2015-04-26 11:47:37 +02:00
2014-12-02 13:43:34 +01:00
if (configuration_map.count("sflow") != 0) {
if (configuration_map["sflow"] == "on") {
2014-12-02 13:43:34 +01:00
enable_sflow_collection = true;
} else {
enable_sflow_collection = false;
}
}
if (configuration_map.count("netflow") != 0) {
if (configuration_map["netflow"] == "on") {
enable_netflow_collection = true;
} else {
enable_netflow_collection = false;
}
}
if (configuration_map.count("exabgp_announce_whole_subnet") != 0) {
exabgp_announce_whole_subnet = configuration_map["exabgp_announce_whole_subnet"] == "on" ? true : false;
}
if (configuration_map.count("enable_subnet_counters") != 0) {
enable_subnet_counters = configuration_map["enable_subnet_counters"] == "on" ? true : false;
}
2015-05-10 20:42:49 +02:00
// Graphite
if (configuration_map.count("graphite") != 0) {
graphite_enabled = configuration_map["graphite"] == "on" ? true : false;
}
if (configuration_map.count("graphite_host") != 0) {
graphite_host = configuration_map["graphite_host"];
}
if (configuration_map.count("graphite_port") != 0) {
graphite_port = convert_string_to_integer(configuration_map["graphite_port"]);
}
if (configuration_map.count("process_incoming_traffic") != 0) {
process_incoming_traffic = configuration_map["process_incoming_traffic"] == "on" ? true : false;
}
if (configuration_map.count("process_outgoing_traffic") != 0) {
process_outgoing_traffic = configuration_map["process_outgoing_traffic"] == "on" ? true : false;
}
if (configuration_map.count("mirror") != 0) {
2014-12-02 13:43:34 +01:00
if (configuration_map["mirror"] == "on") {
enable_data_collection_from_mirror = true;
} else {
enable_data_collection_from_mirror = false;
}
}
if (configuration_map.count("mirror_netmap") != 0) {
2015-03-10 15:17:52 +01:00
if (configuration_map["mirror_netmap"] == "on") {
enable_netmap_collection = true;
} else {
enable_netmap_collection = false;
}
}
2015-03-10 15:17:52 +01:00
if (enable_netmap_collection && enable_data_collection_from_mirror) {
logger << log4cpp::Priority::ERROR << "You have enabled pfring and netmap data collection "
"from mirror which strictly prohibited, please "
"select one";
2015-03-10 15:17:52 +01:00
exit(1);
}
if (configuration_map.count("pcap") != 0) {
if (configuration_map["pcap"] == "on") {
enable_pcap_collection = true;
} else {
enable_pcap_collection = false;
}
}
if (configuration_map.count("ban_for_pps") != 0) {
if (configuration_map["ban_for_pps"] == "on") {
enable_ban_for_pps = true;
} else {
enable_ban_for_pps = false;
}
}
if (configuration_map.count("ban_for_bandwidth") != 0) {
if (configuration_map["ban_for_bandwidth"] == "on") {
enable_ban_for_bandwidth = true;
} else {
enable_ban_for_bandwidth = false;
}
}
if (configuration_map.count("ban_for_flows") != 0) {
if (configuration_map["ban_for_flows"] == "on") {
enable_ban_for_flows_per_second = true;
} else {
enable_ban_for_flows_per_second = false;
}
}
if (configuration_map.count("white_list_path") != 0) {
white_list_path = configuration_map["white_list_path"];
}
if (configuration_map.count("networks_list_path") != 0) {
networks_list_path = configuration_map["networks_list_path"];
}
2014-06-09 11:57:28 +02:00
#ifdef REDIS
if (configuration_map.count("redis_port") != 0) {
redis_port = convert_string_to_integer(configuration_map["redis_port"]);
}
2014-06-09 11:08:19 +02:00
if (configuration_map.count("redis_host") != 0) {
redis_host = configuration_map["redis_host"];
}
if (configuration_map.count("redis_enabled") != 0) {
if (configuration_map["redis_enabled"] == "yes") {
redis_enabled = true;
} else {
redis_enabled = false;
}
}
2014-06-09 11:57:28 +02:00
#endif
2014-06-09 11:08:19 +02:00
if (configuration_map.count("ban_details_records_count") != 0) {
ban_details_records_count =
convert_string_to_integer(configuration_map["ban_details_records_count"]);
}
2014-06-09 11:08:19 +02:00
if (configuration_map.count("check_period") != 0) {
check_period = convert_string_to_integer(configuration_map["check_period"]);
}
2014-06-09 11:08:19 +02:00
if (configuration_map.count("sort_parameter") != 0) {
sort_parameter = configuration_map["sort_parameter"];
}
2014-06-09 11:08:19 +02:00
if (configuration_map.count("max_ips_in_list") != 0) {
max_ips_in_list = convert_string_to_integer(configuration_map["max_ips_in_list"]);
}
2014-06-09 11:08:19 +02:00
if (configuration_map.count("notify_script_path") != 0) {
notify_script_path = configuration_map["notify_script_path"];
2014-06-09 11:08:19 +02:00
}
return true;
2014-06-09 11:08:19 +02:00
}
2014-06-22 21:04:43 +02:00
/* Enable core dumps for simplify debug tasks */
void enable_core_dumps() {
struct rlimit rlim;
2014-06-22 21:04:43 +02:00
int result = getrlimit(RLIMIT_CORE, &rlim);
if (result) {
logger << log4cpp::Priority::ERROR << "Can't get current rlimit for RLIMIT_CORE";
2014-06-22 21:04:43 +02:00
return;
} else {
rlim.rlim_cur = rlim.rlim_max;
setrlimit(RLIMIT_CORE, &rlim);
}
}
2013-11-15 15:35:44 +01:00
void subnet_vectors_allocator(prefix_t* prefix, void* data) {
// Network byte order
uint32_t subnet_as_integer = prefix->add.sin.s_addr;
u_short bitlen = prefix->bitlen;
double base = 2;
int network_size_in_ips = pow(base, 32 - bitlen);
// logger<< log4cpp::Priority::INFO<<"Subnet: "<<prefix->add.sin.s_addr<<" network size:
// "<<network_size_in_ips;
logger << log4cpp::Priority::INFO << "I will allocate " << network_size_in_ips
<< " records for subnet " << subnet_as_integer << " cidr mask: " << bitlen;
subnet_t current_subnet = std::make_pair(subnet_as_integer, bitlen);
// Initialize map element
SubnetVectorMap[current_subnet] = vector_of_counters(network_size_in_ips);
// Zeroify all vector elements
map_element zero_map_element;
memset(&zero_map_element, 0, sizeof(zero_map_element));
std::fill(SubnetVectorMap[current_subnet].begin(), SubnetVectorMap[current_subnet].end(), zero_map_element);
2014-11-13 16:01:15 +01:00
// Initilize map element
SubnetVectorMapFlow[current_subnet] = vector_of_flow_counters(network_size_in_ips);
2014-11-13 16:01:15 +01:00
2014-11-16 18:09:16 +01:00
// On creating it initilizes by zeros
conntrack_main_struct zero_conntrack_main_struct;
std::fill(SubnetVectorMapFlow[current_subnet].begin(),
SubnetVectorMapFlow[current_subnet].end(), zero_conntrack_main_struct);
PerSubnetCountersMap[current_subnet] = zero_map_element;
PerSubnetSpeedMap[current_subnet] = zero_map_element;
}
void zeroify_all_counters() {
map_element zero_map_element;
memset(&zero_map_element, 0, sizeof(zero_map_element));
for (map_of_vector_counters::iterator itr = SubnetVectorMap.begin(); itr != SubnetVectorMap.end(); ++itr) {
// logger<< log4cpp::Priority::INFO<<"Zeroify "<<itr->first;
std::fill(itr->second.begin(), itr->second.end(), zero_map_element);
}
}
void zeroify_all_flow_counters() {
2014-11-16 18:09:16 +01:00
// On creating it initilizes by zeros
conntrack_main_struct zero_conntrack_main_struct;
2014-11-13 16:01:15 +01:00
// Iterate over map
for (map_of_vector_counters_for_flow::iterator itr = SubnetVectorMapFlow.begin();
itr != SubnetVectorMapFlow.end(); ++itr) {
2014-11-13 16:01:15 +01:00
// Iterate over vector
for (vector_of_flow_counters::iterator vector_iterator = itr->second.begin();
vector_iterator != itr->second.end(); ++vector_iterator) {
2014-11-13 16:01:15 +01:00
// TODO: rewrite this monkey code
vector_iterator->in_tcp.clear();
vector_iterator->in_udp.clear();
vector_iterator->in_icmp.clear();
vector_iterator->in_other.clear();
vector_iterator->out_tcp.clear();
vector_iterator->out_udp.clear();
vector_iterator->out_icmp.clear();
vector_iterator->out_other.clear();
}
}
}
bool load_our_networks_list() {
if (file_exists(white_list_path)) {
std::vector<std::string> network_list_from_config = read_file_to_vector(white_list_path);
2014-06-09 14:47:11 +02:00
for (std::vector<std::string>::iterator ii = network_list_from_config.begin();
ii != network_list_from_config.end(); ++ii) {
if (ii->length() > 0 && is_cidr_subnet(ii->c_str())) {
2014-10-21 12:21:48 +02:00
make_and_lookup(whitelist_tree, const_cast<char*>(ii->c_str()));
} else {
logger << log4cpp::Priority::ERROR << "Can't parse line from whitelist: " << *ii;
2014-10-21 12:21:48 +02:00
}
}
logger << log4cpp::Priority::INFO << "We loaded " << network_list_from_config.size()
<< " networks from whitelist file";
2014-06-09 14:47:11 +02:00
}
2015-01-27 20:29:51 +01:00
std::vector<std::string> networks_list_as_string;
// We can bould "our subnets" automatically here
2013-10-18 12:59:58 +02:00
if (file_exists("/proc/vz/version")) {
logger << log4cpp::Priority::INFO << "We found OpenVZ";
2014-11-15 01:10:04 +01:00
// Add /32 CIDR mask for every IP here
2015-01-27 20:29:51 +01:00
std::vector<std::string> openvz_ips = read_file_to_vector("/proc/vz/veip");
for (std::vector<std::string>::iterator ii = openvz_ips.begin(); ii != openvz_ips.end(); ++ii) {
2014-06-09 13:53:31 +02:00
// skip IPv6 addresses
if (strstr(ii->c_str(), ":") != NULL) {
continue;
}
// skip header
if (strstr(ii->c_str(), "Version") != NULL) {
continue;
}
std::vector<std::string> subnet_as_string;
split(subnet_as_string, *ii, boost::is_any_of(" "), boost::token_compress_on);
2015-01-27 20:29:51 +01:00
std::string openvz_subnet = subnet_as_string[1] + "/32";
2014-06-09 13:53:31 +02:00
networks_list_as_string.push_back(openvz_subnet);
}
2014-06-30 10:49:55 +02:00
logger << log4cpp::Priority::INFO << "We loaded " << networks_list_as_string.size()
<< " networks from /proc/vz/veip";
}
if (monitor_local_ip_addresses && file_exists("/sbin/ip")) {
logger << log4cpp::Priority::INFO
<< "We are working on Linux and could use ip tool for detecting local IP's";
ip_addresses_list_t ip_list = get_local_ip_addresses_list();
logger << log4cpp::Priority::INFO << "We found " << ip_list.size()
<< " local IP addresses and will monitor they";
for (ip_addresses_list_t::iterator iter = ip_list.begin(); iter != ip_list.end(); ++iter) {
networks_list_as_string.push_back(*iter + "/32");
}
}
2013-10-18 12:59:58 +02:00
if (file_exists(networks_list_path)) {
std::vector<std::string> network_list_from_config =
read_file_to_vector(networks_list_path);
networks_list_as_string.insert(networks_list_as_string.end(), network_list_from_config.begin(),
network_list_from_config.end());
2014-06-09 16:28:56 +02:00
logger << log4cpp::Priority::INFO << "We loaded " << network_list_from_config.size()
<< " networks from networks file";
2013-10-18 12:59:58 +02:00
}
2013-10-18 12:16:55 +02:00
2014-11-15 01:10:04 +01:00
// Some consistency checks
assert(convert_ip_as_string_to_uint("255.255.255.0") == convert_cidr_to_binary_netmask(24));
assert(convert_ip_as_string_to_uint("255.255.255.255") == convert_cidr_to_binary_netmask(32));
2013-10-18 12:16:55 +02:00
for (std::vector<std::string>::iterator ii = networks_list_as_string.begin();
ii != networks_list_as_string.end(); ++ii) {
2015-02-18 20:31:55 +01:00
if (ii->length() == 0) {
// Skip blank lines in subnet list file silently
continue;
}
if (!is_cidr_subnet(ii->c_str())) {
logger << log4cpp::Priority::ERROR << "Can't parse line from subnet list: '" << *ii << "'";
2015-02-18 20:31:55 +01:00
continue;
}
2015-02-18 20:31:55 +01:00
std::string network_address_in_cidr_form = *ii;
2015-02-18 20:31:55 +01:00
unsigned int cidr_mask = get_cidr_mask_from_network_as_string(network_address_in_cidr_form);
std::string network_address = get_net_address_from_network_as_string(network_address_in_cidr_form);
2014-12-16 11:56:08 +01:00
2015-02-18 20:31:55 +01:00
double base = 2;
total_number_of_hosts_in_our_networks += pow(base, 32 - cidr_mask);
2015-02-18 20:31:55 +01:00
// Make sure it's "subnet address" and not an host address
uint32_t subnet_address_as_uint = convert_ip_as_string_to_uint(network_address);
uint32_t subnet_address_netmask_binary = convert_cidr_to_binary_netmask(cidr_mask);
2015-02-18 20:31:55 +01:00
uint32_t generated_subnet_address = subnet_address_as_uint & subnet_address_netmask_binary;
if (subnet_address_as_uint != generated_subnet_address) {
std::string new_network_address_as_string =
convert_ip_as_uint_to_string(generated_subnet_address) + "/" + convert_int_to_string(cidr_mask);
logger << log4cpp::Priority::WARN << "We will use " << new_network_address_as_string << " instead of "
<< network_address_in_cidr_form << " because it's host address";
2015-02-18 20:31:55 +01:00
network_address_in_cidr_form = new_network_address_as_string;
2014-10-21 12:21:48 +02:00
}
2015-02-18 20:31:55 +01:00
make_and_lookup(lookup_tree, const_cast<char*>(network_address_in_cidr_form.c_str()));
}
/* Preallocate data structures */
patricia_process(lookup_tree, (void_fn_t)subnet_vectors_allocator);
logger << log4cpp::Priority::INFO << "We start total zerofication of counters";
zeroify_all_counters();
logger << log4cpp::Priority::INFO << "We finished zerofication";
logger << log4cpp::Priority::INFO << "We loaded " << networks_list_as_string.size()
<< " subnets to our in-memory list of networks";
logger << log4cpp::Priority::INFO
<< "Total number of monitored hosts (total size of all networks): " << total_number_of_hosts_in_our_networks;
2014-06-30 10:49:55 +02:00
2014-06-09 16:28:56 +02:00
return true;
}
2014-11-15 01:10:04 +01:00
/* Process simple unified packet */
void process_packet(simple_packet& current_packet) {
2014-06-20 17:18:27 +02:00
// Packets dump is very useful for bug hunting
if (DEBUG_DUMP_ALL_PACKETS) {
logger << log4cpp::Priority::INFO << "Dump: " << print_simple_packet(current_packet);
2014-06-20 17:18:27 +02:00
}
2013-10-18 15:28:00 +02:00
// Subnet for found IPs
unsigned long subnet = 0;
unsigned int subnet_cidr_mask = 0;
direction packet_direction = get_packet_direction(current_packet.src_ip, current_packet.dst_ip, subnet, subnet_cidr_mask);
// Skip processing of specific traffic direction
if ((packet_direction == INCOMING && !process_incoming_traffic) or
(packet_direction == OUTGOING && !process_outgoing_traffic)) {
return;
}
subnet_t current_subnet = std::make_pair(subnet, subnet_cidr_mask);
uint32_t subnet_in_host_byte_order = 0;
// We operate in host bytes order and need to convert subnet
if (subnet != 0) {
subnet_in_host_byte_order = ntohl(current_subnet.first);
}
// Try to find map key for this subnet
map_of_vector_counters::iterator itr;
// Iterator for subnet counter
subnet_counter_t* subnet_counter = NULL;
if (packet_direction == OUTGOING or packet_direction == INCOMING) {
// Find element in map of vectors
itr = SubnetVectorMap.find(current_subnet);
if (itr == SubnetVectorMap.end()) {
logger << log4cpp::Priority::ERROR << "Can't find vector address in subnet map";
return;
}
if (enable_subnet_counters) {
map_for_subnet_counters::iterator subnet_iterator;
// Find element in map of subnet counters
subnet_iterator = PerSubnetCountersMap.find(current_subnet);
if (subnet_iterator == PerSubnetCountersMap.end()) {
logger << log4cpp::Priority::ERROR << "Can't find counter structure for subnet";
return;
}
subnet_counter = &subnet_iterator->second;
}
}
2013-10-21 21:45:33 +02:00
map_of_vector_counters_for_flow::iterator itr_flow;
if (enable_conection_tracking) {
if (packet_direction == OUTGOING or packet_direction == INCOMING) {
itr_flow = SubnetVectorMapFlow.find(current_subnet);
if (itr_flow == SubnetVectorMapFlow.end()) {
logger << log4cpp::Priority::ERROR
<< "Can't find vector address in subnet flow map";
return;
}
}
}
/* Because we support mirroring, sflow and netflow we should support different cases:
- One packet passed for processing (mirror)
- Multiple packets ("flows") passed for processing (netflow)
- One sampled packed passed for processing (netflow)
- Another combinations of this three options
*/
uint64_t sampled_number_of_packets = current_packet.number_of_packets * current_packet.sample_ratio;
uint64_t sampled_number_of_bytes = current_packet.length * current_packet.sample_ratio;
2014-12-02 10:30:20 +01:00
__sync_fetch_and_add(&total_counters[packet_direction].packets, sampled_number_of_packets);
__sync_fetch_and_add(&total_counters[packet_direction].bytes, sampled_number_of_bytes);
// Incerementi main and per protocol packet counters
if (packet_direction == OUTGOING) {
int64_t shift_in_vector = (int64_t)ntohl(current_packet.src_ip) - (int64_t)subnet_in_host_byte_order;
if (shift_in_vector < 0 or shift_in_vector >= itr->second.size()) {
logger << log4cpp::Priority::ERROR << "We tried to access to element with index " << shift_in_vector
<< " which located outside allocated vector with size " << itr->second.size();
logger << log4cpp::Priority::ERROR
<< "We expect issues with this packet in OUTGOING direction: "
<< print_simple_packet(current_packet);
return;
}
map_element* current_element = &itr->second[shift_in_vector];
2014-12-19 16:55:43 +01:00
// Main packet/bytes counter
__sync_fetch_and_add(&current_element->out_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->out_bytes, sampled_number_of_bytes);
// Fragmented IP packets
2015-05-08 09:54:39 +02:00
if (current_packet.ip_fragmented) {
__sync_fetch_and_add(&current_element->fragmented_out_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->fragmented_out_bytes, sampled_number_of_bytes);
2015-05-08 09:54:39 +02:00
}
// TODO: add another counters
if (enable_subnet_counters) {
__sync_fetch_and_add(&subnet_counter->out_packets, sampled_number_of_packets);
__sync_fetch_and_add(&subnet_counter->out_bytes, sampled_number_of_bytes);
}
conntrack_main_struct* current_element_flow = NULL;
if (enable_conection_tracking) {
current_element_flow = &itr_flow->second[shift_in_vector];
}
2014-06-28 12:12:56 +02:00
// Collect data when ban client
if (!ban_list_details.empty() && ban_list_details.count(current_packet.src_ip) > 0 &&
ban_list_details[current_packet.src_ip].size() < ban_details_records_count) {
ban_list_details_mutex.lock();
ban_list_details[current_packet.src_ip].push_back(current_packet);
ban_list_details_mutex.unlock();
}
uint64_t connection_tracking_hash = 0;
2013-10-18 15:28:00 +02:00
if (enable_conection_tracking) {
packed_conntrack_hash flow_tracking_structure;
flow_tracking_structure.opposite_ip = current_packet.dst_ip;
flow_tracking_structure.src_port = current_packet.source_port;
flow_tracking_structure.dst_port = current_packet.destination_port;
2014-11-13 16:01:15 +01:00
// convert this struct to 64 bit integer
connection_tracking_hash = convert_conntrack_hash_struct_to_integer(&flow_tracking_structure);
}
2014-11-13 16:01:15 +01:00
if (current_packet.protocol == IPPROTO_TCP) {
__sync_fetch_and_add(&current_element->tcp_out_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->tcp_out_bytes, sampled_number_of_bytes);
if (extract_bit_value(current_packet.flags, TCP_SYN_FLAG_SHIFT)) {
__sync_fetch_and_add(&current_element->tcp_syn_out_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->tcp_syn_out_bytes, sampled_number_of_bytes);
}
if (enable_conection_tracking) {
flow_counter.lock();
conntrack_key_struct* conntrack_key_struct_ptr =
&current_element_flow->out_tcp[connection_tracking_hash];
conntrack_key_struct_ptr->packets += sampled_number_of_packets;
conntrack_key_struct_ptr->bytes += sampled_number_of_bytes;
flow_counter.unlock();
}
} else if (current_packet.protocol == IPPROTO_UDP) {
__sync_fetch_and_add(&current_element->udp_out_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->udp_out_bytes, sampled_number_of_bytes);
2014-11-13 16:01:15 +01:00
if (enable_conection_tracking) {
flow_counter.lock();
conntrack_key_struct* conntrack_key_struct_ptr =
&current_element_flow->out_udp[connection_tracking_hash];
conntrack_key_struct_ptr->packets += sampled_number_of_packets;
conntrack_key_struct_ptr->bytes += sampled_number_of_bytes;
flow_counter.unlock();
}
} else if (current_packet.protocol == IPPROTO_ICMP) {
__sync_fetch_and_add(&current_element->icmp_out_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->icmp_out_bytes, sampled_number_of_bytes);
2014-12-19 16:55:43 +01:00
// no flow tracking for icmp
} else {
}
} else if (packet_direction == INCOMING) {
int64_t shift_in_vector = (int64_t)ntohl(current_packet.dst_ip) - (int64_t)subnet_in_host_byte_order;
if (shift_in_vector < 0 or shift_in_vector >= itr->second.size()) {
logger << log4cpp::Priority::ERROR << "We tried to access to element with index " << shift_in_vector
<< " which located outside allocated vector with size " << itr->second.size();
logger << log4cpp::Priority::INFO
<< "We expect issues with this packet in INCOMING direction: "
<< print_simple_packet(current_packet);
return;
}
map_element* current_element = &itr->second[shift_in_vector];
// Main packet/bytes counter
__sync_fetch_and_add(&current_element->in_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->in_bytes, sampled_number_of_bytes);
if (enable_subnet_counters) {
__sync_fetch_and_add(&subnet_counter->in_packets, sampled_number_of_packets);
__sync_fetch_and_add(&subnet_counter->in_bytes, sampled_number_of_bytes);
}
// Count fragmented IP packets
2015-05-08 09:54:39 +02:00
if (current_packet.ip_fragmented) {
__sync_fetch_and_add(&current_element->fragmented_in_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->fragmented_in_bytes, sampled_number_of_bytes);
2015-05-08 09:54:39 +02:00
}
conntrack_main_struct* current_element_flow = NULL;
if (enable_conection_tracking) {
current_element_flow = &itr_flow->second[shift_in_vector];
}
uint64_t connection_tracking_hash = 0;
if (enable_conection_tracking) {
packed_conntrack_hash flow_tracking_structure;
flow_tracking_structure.opposite_ip = current_packet.src_ip;
flow_tracking_structure.src_port = current_packet.source_port;
flow_tracking_structure.dst_port = current_packet.destination_port;
// convert this struct to 64 bit integer
connection_tracking_hash = convert_conntrack_hash_struct_to_integer(&flow_tracking_structure);
}
2013-10-18 15:28:00 +02:00
// Collect attack details
if (!ban_list_details.empty() && ban_list_details.count(current_packet.dst_ip) > 0 &&
ban_list_details[current_packet.dst_ip].size() < ban_details_records_count) {
ban_list_details_mutex.lock();
ban_list_details[current_packet.dst_ip].push_back(current_packet);
ban_list_details_mutex.unlock();
}
if (current_packet.protocol == IPPROTO_TCP) {
__sync_fetch_and_add(&current_element->tcp_in_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->tcp_in_bytes, sampled_number_of_bytes);
if (extract_bit_value(current_packet.flags, TCP_SYN_FLAG_SHIFT)) {
__sync_fetch_and_add(&current_element->tcp_syn_in_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->tcp_syn_in_bytes, sampled_number_of_bytes);
}
if (enable_conection_tracking) {
flow_counter.lock();
conntrack_key_struct* conntrack_key_struct_ptr =
&current_element_flow->in_tcp[connection_tracking_hash];
conntrack_key_struct_ptr->packets += sampled_number_of_packets;
conntrack_key_struct_ptr->bytes += sampled_number_of_bytes;
flow_counter.unlock();
}
} else if (current_packet.protocol == IPPROTO_UDP) {
__sync_fetch_and_add(&current_element->udp_in_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->udp_in_bytes, sampled_number_of_bytes);
if (enable_conection_tracking) {
flow_counter.lock();
conntrack_key_struct* conntrack_key_struct_ptr =
&current_element_flow->in_udp[connection_tracking_hash];
2014-12-05 14:09:25 +01:00
conntrack_key_struct_ptr->packets += sampled_number_of_packets;
conntrack_key_struct_ptr->bytes += sampled_number_of_bytes;
flow_counter.unlock();
}
} else if (current_packet.protocol == IPPROTO_ICMP) {
__sync_fetch_and_add(&current_element->icmp_in_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->icmp_in_bytes, sampled_number_of_bytes);
// no flow tracking for icmp
} else {
// TBD
}
} else if (packet_direction == INTERNAL) {
2013-10-18 12:16:55 +02:00
}
}
2013-10-18 12:16:55 +02:00
2013-12-28 20:11:20 +01:00
#ifdef GEOIP
unsigned int get_asn_for_ip(uint32_t ip) {
char* asn_raw = GeoIP_org_by_name(geo_ip, convert_ip_as_uint_to_string(remote_ip).c_str());
uint32_t asn_number = 0;
if (asn_raw == NULL) {
asn_number = 0;
} else {
// split string: AS1299 TeliaSonera International Carrier
2015-01-27 20:29:51 +01:00
std::vector<std::string> asn_as_string;
split(asn_as_string, asn_raw, boost::is_any_of(" "), boost::token_compress_on);
2013-12-28 20:11:20 +01:00
// free up original string
free(asn_raw);
2013-12-28 20:11:20 +01:00
// extract raw number
asn_number = convert_string_to_integer(asn_as_string[0].substr(2));
2013-12-28 20:11:20 +01:00
}
return asn_number;
2013-10-21 16:47:31 +02:00
}
#endif
2013-10-21 16:47:31 +02:00
2013-10-21 21:45:33 +02:00
// void* void* data
// It's not an calculation thread, it's vizualization thread :)
2013-10-21 21:45:33 +02:00
void calculation_thread() {
// we need wait one second for calculating speed by recalculate_speed
//#include <sys/prctl.h>
// prctl(PR_SET_NAME , "fastnetmon calc thread", 0, 0, 0);
// Sleep for a half second for shift against calculatiuon thread
boost::this_thread::sleep(boost::posix_time::milliseconds(500));
2013-10-21 21:45:33 +02:00
while (1) {
// Available only from boost 1.54: boost::this_thread::sleep_for(
// boost::chrono::seconds(check_period) );
boost::this_thread::sleep(boost::posix_time::seconds(check_period));
traffic_draw_programm();
2013-10-21 21:45:33 +02:00
}
}
void recalculate_speed_thread_handler() {
while (1) {
// recalculate data every one second
// Available only from boost 1.54: boost::this_thread::sleep_for( boost::chrono::seconds(1)
// );
boost::this_thread::sleep(boost::posix_time::seconds(1));
recalculate_speed();
}
}
2014-11-15 01:10:04 +01:00
/* Calculate speed for all connnections */
void recalculate_speed() {
// logger<< log4cpp::Priority::INFO<<"We run recalculate_speed";
struct timeval start_calc_time;
gettimeofday(&start_calc_time, NULL);
double speed_calc_period = 1;
time_t start_time;
time(&start_time);
2014-12-05 14:31:55 +01:00
// If we got 1+ seconds lag we should use new "delta" or skip this step
double time_difference = difftime(start_time, last_call_of_traffic_recalculation);
if (time_difference < 1) {
// It could occur on programm start
logger << log4cpp::Priority::INFO
<< "We skip one iteration of speed_calc because it runs so early!";
return;
} else if (int(time_difference) == 1) {
2014-11-15 01:10:04 +01:00
// All fine, we run on time
} else {
logger << log4cpp::Priority::INFO
<< "Time from last run of speed_recalc is soooo big, we got ugly lags: " << time_difference;
speed_calc_period = time_difference;
}
map_element zero_map_element;
memset(&zero_map_element, 0, sizeof(zero_map_element));
uint64_t incoming_total_flows = 0;
uint64_t outgoing_total_flows = 0;
if (enable_subnet_counters) {
for (map_for_subnet_counters::iterator itr = PerSubnetSpeedMap.begin(); itr != PerSubnetSpeedMap.end(); ++itr) {
2015-05-21 18:34:17 +02:00
subnet_t current_subnet = itr->first;
map_for_subnet_counters::iterator iter_subnet = PerSubnetCountersMap.find(current_subnet);
if (iter_subnet == PerSubnetCountersMap.end()) {
logger << log4cpp::Priority::INFO<<"Can't find traffic counters for subnet";
break;
}
subnet_counter_t* subnet_traffic = &iter_subnet->second;
subnet_counter_t new_speed_element;
new_speed_element.in_packets = uint64_t((double)subnet_traffic->in_packets / speed_calc_period);
new_speed_element.in_bytes = uint64_t((double)subnet_traffic->in_bytes / speed_calc_period);
new_speed_element.out_packets = uint64_t((double)subnet_traffic->out_packets / speed_calc_period);
new_speed_element.out_bytes = uint64_t((double)subnet_traffic->out_bytes / speed_calc_period);
/* Moving average recalculation for subnets */
/* http://en.wikipedia.org/wiki/Moving_average#Application_to_measuring_computer_performance */
double exp_power = -speed_calc_period / average_calculation_amount_for_subnets;
double exp_value = exp(exp_power);
map_element* current_average_speed_element = &PerSubnetAverageSpeedMap[current_subnet];
current_average_speed_element->in_bytes = uint64_t(new_speed_element.in_bytes +
exp_value * ((double)current_average_speed_element->in_bytes - (double)new_speed_element.in_bytes));
current_average_speed_element->out_bytes = uint64_t(new_speed_element.out_bytes +
exp_value * ((double)current_average_speed_element->out_bytes - (double)new_speed_element.out_bytes));
current_average_speed_element->in_packets = uint64_t(new_speed_element.in_packets +
exp_value * ((double)current_average_speed_element->in_packets - (double)new_speed_element.in_packets));
current_average_speed_element->out_packets = uint64_t(new_speed_element.out_packets +
exp_value * ((double)current_average_speed_element->out_packets - (double)new_speed_element.out_packets));
// Update speed calculation structure
PerSubnetSpeedMap[current_subnet] = new_speed_element;
*subnet_traffic = zero_map_element;
//logger << log4cpp::Priority::INFO<<convert_subnet_to_string(current_subnet)
// << "in pps: " << new_speed_element.in_packets << " out pps: " << new_speed_element.out_packets;
}
}
for (map_of_vector_counters::iterator itr = SubnetVectorMap.begin(); itr != SubnetVectorMap.end(); ++itr) {
for (vector_of_counters::iterator vector_itr = itr->second.begin();
vector_itr != itr->second.end(); ++vector_itr) {
int current_index = vector_itr - itr->second.begin();
2014-12-05 14:47:57 +01:00
// New element
map_element new_speed_element;
// convert to host order for math operations
uint32_t subnet_ip = ntohl(itr->first.first);
uint32_t client_ip_in_host_bytes_order = subnet_ip + current_index;
// covnert to our standard network byte order
uint32_t client_ip = htonl(client_ip_in_host_bytes_order);
// Calculate speed for IP or whole subnet
// calculate_speed_for_certain_entity(map_element* new_speed_element, map_element* traffic_counter_element);
// calculate_speed(new_speed_element speed_element, vector_itr* );
new_speed_element.in_packets = uint64_t((double)vector_itr->in_packets / speed_calc_period);
new_speed_element.out_packets = uint64_t((double)vector_itr->out_packets / speed_calc_period);
new_speed_element.in_bytes = uint64_t((double)vector_itr->in_bytes / speed_calc_period);
new_speed_element.out_bytes = uint64_t((double)vector_itr->out_bytes / speed_calc_period);
// Fragmented
new_speed_element.fragmented_in_packets =
uint64_t((double)vector_itr->fragmented_in_packets / speed_calc_period);
new_speed_element.fragmented_out_packets =
uint64_t((double)vector_itr->fragmented_out_packets / speed_calc_period);
new_speed_element.fragmented_in_bytes =
uint64_t((double)vector_itr->fragmented_in_bytes / speed_calc_period);
new_speed_element.fragmented_out_bytes =
uint64_t((double)vector_itr->fragmented_out_bytes / speed_calc_period);
2014-12-05 15:34:59 +01:00
// By protocol counters
// TCP
new_speed_element.tcp_in_packets = uint64_t((double)vector_itr->tcp_in_packets / speed_calc_period);
new_speed_element.tcp_out_packets =
uint64_t((double)vector_itr->tcp_out_packets / speed_calc_period);
2014-12-05 15:34:59 +01:00
new_speed_element.tcp_in_bytes = uint64_t((double)vector_itr->tcp_in_bytes / speed_calc_period);
new_speed_element.tcp_out_bytes = uint64_t((double)vector_itr->tcp_out_bytes / speed_calc_period);
2014-12-05 15:34:59 +01:00
// TCP syn
new_speed_element.tcp_syn_in_packets =
uint64_t((double)vector_itr->tcp_syn_in_packets / speed_calc_period);
new_speed_element.tcp_syn_out_packets =
uint64_t((double)vector_itr->tcp_syn_out_packets / speed_calc_period);
new_speed_element.tcp_syn_in_bytes =
uint64_t((double)vector_itr->tcp_syn_in_bytes / speed_calc_period);
new_speed_element.tcp_syn_out_bytes =
uint64_t((double)vector_itr->tcp_syn_out_bytes / speed_calc_period);
2014-12-05 15:34:59 +01:00
// UDP
new_speed_element.udp_in_packets = uint64_t((double)vector_itr->udp_in_packets / speed_calc_period);
new_speed_element.udp_out_packets =
uint64_t((double)vector_itr->udp_out_packets / speed_calc_period);
2014-12-05 15:34:59 +01:00
new_speed_element.udp_in_bytes = uint64_t((double)vector_itr->udp_in_bytes / speed_calc_period);
new_speed_element.udp_out_bytes = uint64_t((double)vector_itr->udp_out_bytes / speed_calc_period);
2014-12-05 15:34:59 +01:00
// ICMP
new_speed_element.icmp_in_packets =
uint64_t((double)vector_itr->icmp_in_packets / speed_calc_period);
new_speed_element.icmp_out_packets =
uint64_t((double)vector_itr->icmp_out_packets / speed_calc_period);
2014-12-05 15:34:59 +01:00
new_speed_element.icmp_in_bytes = uint64_t((double)vector_itr->icmp_in_bytes / speed_calc_period);
new_speed_element.icmp_out_bytes = uint64_t((double)vector_itr->icmp_out_bytes / speed_calc_period);
2014-12-05 15:34:59 +01:00
conntrack_main_struct* flow_counter_ptr = &SubnetVectorMapFlow[itr->first][current_index];
// todo: optimize this operations!
uint64_t total_out_flows =
(uint64_t)flow_counter_ptr->out_tcp.size() + (uint64_t)flow_counter_ptr->out_udp.size() +
(uint64_t)flow_counter_ptr->out_icmp.size() + (uint64_t)flow_counter_ptr->out_other.size();
uint64_t total_in_flows =
(uint64_t)flow_counter_ptr->in_tcp.size() + (uint64_t)flow_counter_ptr->in_udp.size() +
(uint64_t)flow_counter_ptr->in_icmp.size() + (uint64_t)flow_counter_ptr->in_other.size();
new_speed_element.out_flows = uint64_t((double)total_out_flows / speed_calc_period);
new_speed_element.in_flows = uint64_t((double)total_in_flows / speed_calc_period);
// Increment global counter
2014-12-05 14:47:57 +01:00
incoming_total_flows += new_speed_element.in_flows;
outgoing_total_flows += new_speed_element.out_flows;
/* Moving average recalculation */
// http://en.wikipedia.org/wiki/Moving_average#Application_to_measuring_computer_performance
// double speed_calc_period = 1;
double exp_power = -speed_calc_period / average_calculation_amount;
double exp_value = exp(exp_power);
map_element* current_average_speed_element = &SpeedCounterAverage[client_ip];
current_average_speed_element->in_bytes = uint64_t(
new_speed_element.in_bytes +
exp_value * ((double)current_average_speed_element->in_bytes - (double)new_speed_element.in_bytes));
current_average_speed_element->out_bytes =
uint64_t(new_speed_element.out_bytes +
exp_value * ((double)current_average_speed_element->out_bytes -
(double)new_speed_element.out_bytes));
current_average_speed_element->in_packets =
uint64_t(new_speed_element.in_packets +
exp_value * ((double)current_average_speed_element->in_packets -
(double)new_speed_element.in_packets));
current_average_speed_element->out_packets =
uint64_t(new_speed_element.out_packets +
exp_value * ((double)current_average_speed_element->out_packets -
(double)new_speed_element.out_packets));
current_average_speed_element->out_flows =
uint64_t(new_speed_element.out_flows +
exp_value * ((double)current_average_speed_element->out_flows -
(double)new_speed_element.out_flows));
current_average_speed_element->in_flows = uint64_t(
new_speed_element.in_flows +
exp_value * ((double)current_average_speed_element->in_flows - (double)new_speed_element.in_flows));
2014-12-02 16:15:26 +01:00
2014-12-02 16:34:49 +01:00
/* Moving average recalculation end */
if (we_should_ban_this_ip(current_average_speed_element)) {
2015-01-27 20:29:51 +01:00
std::string flow_attack_details = "";
if (enable_conection_tracking) {
flow_attack_details =
print_flow_tracking_for_ip(*flow_counter_ptr, convert_ip_as_uint_to_string(client_ip));
}
// TODO: we should pass type of ddos ban source (pps, flowd, bandwidth)!
execute_ip_ban(client_ip, new_speed_element, *current_average_speed_element, flow_attack_details, itr->first);
2014-11-13 09:01:52 +01:00
}
speed_counters_mutex.lock();
// map_element* current_speed_element = &SpeedCounter[client_ip];
2014-12-05 14:47:57 +01:00
//*current_speed_element = new_speed_element;
SpeedCounter[client_ip] = new_speed_element;
speed_counters_mutex.unlock();
data_counters_mutex.lock();
*vector_itr = zero_map_element;
data_counters_mutex.unlock();
}
}
// Calculate global flow speed
incoming_total_flows_speed = uint64_t((double)incoming_total_flows / (double)speed_calc_period);
outgoing_total_flows_speed = uint64_t((double)outgoing_total_flows / (double)speed_calc_period);
if (enable_conection_tracking) {
// Clean Flow Counter
flow_counter.lock();
zeroify_all_flow_counters();
flow_counter.unlock();
}
2014-10-22 04:29:55 +02:00
for (unsigned int index = 0; index < 4; index++) {
total_speed_counters[index].bytes =
uint64_t((double)total_counters[index].bytes / (double)speed_calc_period);
total_speed_counters[index].packets =
uint64_t((double)total_counters[index].packets / (double)speed_calc_period);
// nullify data counters after speed calculation
// total_counters_mutex.lock();
total_counters[index].bytes = 0;
total_counters[index].packets = 0;
// total_counters_mutex.unlock();
}
// Set time of previous startup
time(&last_call_of_traffic_recalculation);
struct timeval finish_calc_time;
gettimeofday(&finish_calc_time, NULL);
timeval_subtract(&speed_calculation_time, &finish_calc_time, &start_calc_time);
}
2014-06-09 14:47:11 +02:00
2015-01-27 20:29:51 +01:00
void print_screen_contents_into_file(std::string screen_data_stats_param) {
std::ofstream screen_data_file;
screen_data_file.open("/tmp/fastnetmon.dat", std::ios::trunc);
if (screen_data_file.is_open()) {
screen_data_file << screen_data_stats_param;
screen_data_file.close();
} else {
logger << log4cpp::Priority::ERROR << "Can't print programm screen into file";
}
}
void traffic_draw_programm() {
2015-01-27 20:29:51 +01:00
std::stringstream output_buffer;
// logger<<log4cpp::Priority::INFO<<"Draw table call";
struct timeval start_calc_time;
gettimeofday(&start_calc_time, NULL);
2013-10-21 21:45:33 +02:00
sort_type sorter;
if (sort_parameter == "packets") {
sorter = PACKETS;
} else if (sort_parameter == "bytes") {
sorter = BYTES;
} else if (sort_parameter == "flows") {
sorter = FLOWS;
} else {
logger << log4cpp::Priority::INFO << "Unexpected sorter type: " << sort_parameter;
sorter = PACKETS;
}
2013-10-21 15:43:00 +02:00
2015-06-04 12:15:42 +02:00
output_buffer << "FastNetMon " << fastnetmon_version
<< " FastVPS Eesti OU (c) VPS and dedicated: http://FastVPS.host"
<< "\n"
<< "IPs ordered by: " << sort_parameter << "\n";
output_buffer << print_channel_speed("Incoming traffic", INCOMING) << std::endl;
output_buffer << draw_table(SpeedCounter, INCOMING, true, sorter);
output_buffer << std::endl;
2013-10-18 12:16:55 +02:00
output_buffer << print_channel_speed("Outgoing traffic", OUTGOING) << std::endl;
output_buffer << draw_table(SpeedCounter, OUTGOING, false, sorter);
2013-10-18 12:16:55 +02:00
output_buffer << std::endl;
2013-10-18 12:16:55 +02:00
output_buffer << print_channel_speed("Internal traffic", INTERNAL) << std::endl;
2013-10-18 12:16:55 +02:00
output_buffer << std::endl;
2013-10-18 12:16:55 +02:00
output_buffer << print_channel_speed("Other traffic", OTHER) << std::endl;
2013-10-18 12:16:55 +02:00
output_buffer << std::endl;
2013-12-28 20:36:22 +01:00
if (enable_pcap_collection) {
output_buffer << get_pcap_stats() << "\n";
}
// Application statistics
output_buffer << "Screen updated in:\t\t" << drawing_thread_execution_time.tv_sec << " sec "
<< drawing_thread_execution_time.tv_usec << " microseconds\n";
output_buffer << "Traffic calculated in:\t\t" << speed_calculation_time.tv_sec << " sec "
<< speed_calculation_time.tv_usec << " microseconds\n";
output_buffer << "Total amount of not processed packets: " << total_unparsed_packets << "\n";
#ifdef PF_RING
if (enable_data_collection_from_mirror) {
output_buffer << get_pf_ring_stats();
}
#endif
2014-12-05 09:46:26 +01:00
2014-12-04 17:07:44 +01:00
// Print thresholds
if (print_configuration_params_on_the_screen) {
output_buffer << "\n" << print_ban_thresholds();
}
2014-12-04 17:07:44 +01:00
2014-11-15 01:10:04 +01:00
if (!ban_list.empty()) {
output_buffer << std::endl << "Ban list:" << std::endl;
output_buffer << print_ddos_attack_details();
2014-11-15 01:10:04 +01:00
}
if (enable_subnet_counters) {
output_buffer << std::endl << "Subnet load:" << std::endl;
output_buffer << print_subnet_load() << "\n";
}
screen_data_stats = output_buffer.str();
// Print screen contents into file
print_screen_contents_into_file(screen_data_stats);
struct timeval end_calc_time;
gettimeofday(&end_calc_time, NULL);
timeval_subtract(&drawing_thread_execution_time, &end_calc_time, &start_calc_time);
2013-10-18 12:16:55 +02:00
}
// pretty print channel speed in pps and MBit
2015-01-27 20:29:51 +01:00
std::string print_channel_speed(std::string traffic_type, direction packet_direction) {
uint64_t speed_in_pps = total_speed_counters[packet_direction].packets;
uint64_t speed_in_bps = total_speed_counters[packet_direction].bytes;
unsigned int number_of_tabs = 1;
// We need this for correct alignment of blocks
if (traffic_type == "Other traffic") {
number_of_tabs = 2;
}
std::stringstream stream;
stream << traffic_type;
for (unsigned int i = 0; i < number_of_tabs; i++) {
stream << "\t";
}
uint64_t speed_in_mbps = convert_speed_to_mbps(speed_in_bps);
stream << std::setw(6) << speed_in_pps << " pps " << std::setw(6) << speed_in_mbps << " mbps";
if (traffic_type == "Incoming traffic" or traffic_type == "Outgoing traffic") {
if (packet_direction == INCOMING) {
stream << " " << std::setw(6) << incoming_total_flows_speed << " flows";
} else if (packet_direction == OUTGOING) {
stream << " " << std::setw(6) << outgoing_total_flows_speed << " flows";
}
2015-05-10 20:42:49 +02:00
if (graphite_enabled) {
graphite_data_t graphite_data;
std::string direction_as_string;
if (packet_direction == INCOMING) {
direction_as_string = "incoming";
graphite_data[graphite_prefix + direction_as_string + "flows"] = incoming_total_flows_speed;
2015-05-10 20:42:49 +02:00
} else if (packet_direction == OUTGOING) {
direction_as_string = "outgoing";
graphite_data[graphite_prefix + direction_as_string + "flows"] = outgoing_total_flows_speed;
}
graphite_data[graphite_prefix + direction_as_string + ".pps"] = speed_in_pps;
graphite_data[graphite_prefix + direction_as_string + ".mbps"] = speed_in_mbps;
2015-05-10 20:42:49 +02:00
bool graphite_put_result = store_data_to_graphite(graphite_port, graphite_host, graphite_data);
if (!graphite_put_result) {
logger << log4cpp::Priority::ERROR << "Can't store data to Graphite";
2015-05-10 20:42:49 +02:00
}
}
}
2015-05-10 20:42:49 +02:00
return stream.str();
}
2013-10-18 12:16:55 +02:00
2014-06-24 12:16:22 +02:00
void init_logging() {
log4cpp::PatternLayout* layout = new log4cpp::PatternLayout();
layout->setConversionPattern("%d [%p] %m%n");
2014-06-24 12:16:22 +02:00
log4cpp::Appender* appender = new log4cpp::FileAppender("default", log_file_path);
2014-06-24 12:16:22 +02:00
appender->setLayout(layout);
logger.setPriority(log4cpp::Priority::INFO);
logger.addAppender(appender);
logger.info("Logger initialized!");
}
2015-05-02 21:18:56 +02:00
// Call fork function
int do_fork() {
int status = 0;
switch (fork()) {
case 0:
// It's child
break;
case -1:
/* fork failed */
status = -1;
break;
default:
// We should close master process with _exit(0)
// We should not call exit() because it will destroy all global variables for programm
_exit(0);
}
2015-05-02 21:18:56 +02:00
return status;
}
void redirect_fds() {
// Close stdin, stdout and stderr
2015-05-02 21:18:56 +02:00
close(0);
close(1);
close(2);
if (open("/dev/null", O_RDWR) != 0) {
// We can't notify anybody now
exit(1);
}
// Create copy of zero decriptor for 1 and 2 fd's
2015-06-06 17:19:10 +02:00
// We do not need return codes here but we need do it for suppressing complaints from compiler
int first_dup_result = dup(0);
int second_dup_result = dup(0);
2015-05-02 21:18:56 +02:00
}
int main(int argc, char** argv) {
2015-05-02 21:18:56 +02:00
bool daemonize = false;
if (argc > 1) {
2015-05-02 21:18:56 +02:00
if (strstr(argv[1], "--daemonize") != NULL) {
daemonize = true;
}
}
// We use ideas from here https://github.com/bmc/daemonize/blob/master/daemon.c
if (daemonize) {
int status = 0;
printf("We will run in daemonized mode\n");
if ((status = do_fork()) < 0) {
2015-05-02 21:18:56 +02:00
// fork failed
status = -1;
} else if (setsid() < 0) {
// Create new session
status = -1;
} else if ((status = do_fork()) < 0) {
status = -1;
} else {
2015-05-02 21:18:56 +02:00
// Clear inherited umask
umask(0);
// Chdir to root
int chdir_result = chdir("/");
2015-05-02 21:18:56 +02:00
// close all descriptors because we are daemon!
redirect_fds();
}
}
2015-05-02 22:53:45 +02:00
// enable core dumps
enable_core_dumps();
init_logging();
if (file_exists(pid_path)) {
pid_t pid_from_file = 0;
if (read_pid_from_file(pid_from_file, pid_path)) {
// We could read pid
if (pid_from_file > 0) {
// We use signal zero for check process existence
int kill_result = kill(pid_from_file, 0);
if (kill_result == 0) {
logger << log4cpp::Priority::ERROR
<< "FastNetMon is already running with pid: " << pid_from_file;
2015-05-02 22:53:45 +02:00
exit(1);
} else {
// Yes, we have pid with pid but it's zero
}
2015-05-02 22:53:45 +02:00
} else {
// pid from file is broken, we assume tool is not running
}
} else {
// We can't open file, let's assume it's broken and tool is not running
2015-05-02 22:53:45 +02:00
}
} else {
// no pid file
}
// If we not failed in check steps we could run toolkit
print_pid_to_file(getpid(), pid_path);
lookup_tree = New_Patricia(32);
whitelist_tree = New_Patricia(32);
// nullify total counters
for (int index = 0; index < 4; index++) {
total_counters[index].bytes = 0;
total_counters[index].packets = 0;
total_speed_counters[index].bytes = 0;
total_speed_counters[index].packets = 0;
}
/* Create folder for attack details */
if (!folder_exists(attack_details_folder)) {
int mkdir_result = mkdir(attack_details_folder.c_str(), S_IRWXU);
if (mkdir_result != 0) {
logger << log4cpp::Priority::ERROR << "Can't create folder for attack details: " << attack_details_folder;
exit(1);
}
}
2014-06-20 17:18:27 +02:00
if (getenv("DUMP_ALL_PACKETS") != NULL) {
DEBUG_DUMP_ALL_PACKETS = true;
}
2014-11-13 16:01:15 +01:00
if (sizeof(packed_conntrack_hash) != sizeof(uint64_t) or sizeof(packed_conntrack_hash) != 8) {
logger << log4cpp::Priority::INFO << "Assertion about size of packed_conntrack_hash, it's "
<< sizeof(packed_conntrack_hash) << " instead 8";
2014-11-13 16:01:15 +01:00
exit(1);
}
logger << log4cpp::Priority::INFO << "Read configuration file";
2014-06-09 14:47:11 +02:00
bool load_config_result = load_configuration_file();
if (!load_config_result) {
2015-02-01 14:02:30 +01:00
fprintf(stderr, "Can't open config file %s, please create it!\n", global_config_path.c_str());
2014-11-23 20:19:52 +01:00
exit(1);
}
2014-06-09 13:15:22 +02:00
2014-06-28 12:12:56 +02:00
load_our_networks_list();
2014-11-15 01:10:04 +01:00
// Setup CTRL+C handler
if (signal(SIGINT, interruption_signal_handler) == SIG_ERR) {
logger << log4cpp::Priority::ERROR << "Can't setup SIGINT handler";
exit(1);
}
/* Without this SIGPIPE error could shutdown toolkit on call of exec_with_stdin_params */
if (signal(SIGPIPE, sigpipe_handler_for_popen) == SIG_ERR) {
logger << log4cpp::Priority::ERROR << "Can't setup SIGPIPE handler";
exit(1);
}
2014-06-28 12:12:56 +02:00
2013-12-28 20:11:20 +01:00
#ifdef GEOIP
2014-11-15 01:10:04 +01:00
// Init GeoIP
if (!geoip_init()) {
logger << log4cpp::Priority::ERROR << "Can't load geoip tables";
2013-12-28 20:11:20 +01:00
exit(1);
}
2013-12-28 20:11:20 +01:00
#endif
2014-11-15 01:10:04 +01:00
// Init previous run date
time(&last_call_of_traffic_recalculation);
// Run screen draw thread
boost::thread calc_thread(calculation_thread);
2014-06-26 11:30:38 +02:00
// start thread for recalculating speed in realtime
boost::thread recalculate_speed_thread(recalculate_speed_thread_handler);
// Run banlist cleaner thread
boost::thread cleanup_ban_list_thread(cleanup_ban_list);
2013-10-21 16:47:31 +02:00
#ifdef PF_RING
2014-12-02 13:43:34 +01:00
if (enable_data_collection_from_mirror) {
packet_capture_plugin_thread_group.add_thread(new boost::thread(start_pfring_collection, process_packet));
2014-12-02 13:43:34 +01:00
}
#endif
2015-01-22 16:51:04 +01:00
2015-03-10 15:17:52 +01:00
// netmap processing
if (enable_netmap_collection) {
packet_capture_plugin_thread_group.add_thread(new boost::thread(start_netmap_collection, process_packet));
2015-03-10 15:17:52 +01:00
}
2014-12-02 13:43:34 +01:00
if (enable_sflow_collection) {
packet_capture_plugin_thread_group.add_thread(new boost::thread(start_sflow_collection, process_packet));
2014-12-02 13:43:34 +01:00
}
if (enable_netflow_collection) {
packet_capture_plugin_thread_group.add_thread(new boost::thread(start_netflow_collection, process_packet));
}
if (enable_pcap_collection) {
packet_capture_plugin_thread_group.add_thread(new boost::thread(start_pcap_collection, process_packet));
2014-12-02 13:43:34 +01:00
}
2014-12-01 22:08:38 +01:00
// Wait for all threads in capture thread group
packet_capture_plugin_thread_group.join_all();
2015-03-10 15:17:52 +01:00
recalculate_speed_thread.join();
calc_thread.join();
free_up_all_resources();
return 0;
}
void free_up_all_resources() {
2013-12-28 20:11:20 +01:00
#ifdef GEOIP
// Free up geoip handle
2013-12-28 20:11:20 +01:00
GeoIP_delete(geo_ip);
#endif
Destroy_Patricia(lookup_tree, (void_fn_t)0);
Destroy_Patricia(whitelist_tree, (void_fn_t)0);
}
2013-11-15 15:35:44 +01:00
// For correct programm shutdown by CTRL+C
void interruption_signal_handler(int signal_number) {
2013-10-18 12:16:55 +02:00
if (enable_pcap_collection) {
stop_pcap_collection();
}
2013-10-18 12:16:55 +02:00
2014-03-11 20:48:15 +01:00
#ifdef PF_RING
stop_pfring_collection();
2014-03-11 20:48:15 +01:00
#endif
// packet_capture_plugin_thread_group.interrupt_all();
// Wait some time for threads finishing
// sleep 3;
exit(1);
2013-10-18 12:16:55 +02:00
}
/* Get traffic type: check it belongs to our IPs */
direction get_packet_direction(uint32_t src_ip, uint32_t dst_ip, unsigned long& subnet, unsigned int& subnet_cidr_mask) {
direction packet_direction;
bool our_ip_is_destination = false;
bool our_ip_is_source = false;
prefix_t prefix_for_check_adreess;
prefix_for_check_adreess.family = AF_INET;
prefix_for_check_adreess.bitlen = 32;
patricia_node_t* found_patrica_node = NULL;
prefix_for_check_adreess.add.sin.s_addr = dst_ip;
unsigned long destination_subnet = 0;
unsigned int destination_subnet_cidr_mask = 0;
found_patrica_node = patricia_search_best2(lookup_tree, &prefix_for_check_adreess, 1);
if (found_patrica_node) {
our_ip_is_destination = true;
destination_subnet = found_patrica_node->prefix->add.sin.s_addr;
destination_subnet_cidr_mask = found_patrica_node->prefix->bitlen;
}
found_patrica_node = NULL;
prefix_for_check_adreess.add.sin.s_addr = src_ip;
unsigned long source_subnet = 0;
unsigned int source_subnet_cidr_mask = 0;
found_patrica_node = patricia_search_best2(lookup_tree, &prefix_for_check_adreess, 1);
if (found_patrica_node) {
our_ip_is_source = true;
source_subnet = found_patrica_node->prefix->add.sin.s_addr;
source_subnet_cidr_mask = found_patrica_node->prefix->bitlen;
}
subnet = 0;
if (our_ip_is_source && our_ip_is_destination) {
packet_direction = INTERNAL;
} else if (our_ip_is_source) {
subnet = source_subnet;
subnet_cidr_mask = source_subnet_cidr_mask;
packet_direction = OUTGOING;
} else if (our_ip_is_destination) {
subnet = destination_subnet;
subnet_cidr_mask = destination_subnet_cidr_mask;
packet_direction = INCOMING;
} else {
packet_direction = OTHER;
}
return packet_direction;
}
2014-06-26 11:30:38 +02:00
unsigned int detect_attack_protocol(map_element& speed_element, direction attack_direction) {
if (attack_direction == INCOMING) {
return get_max_used_protocol(speed_element.tcp_in_packets, speed_element.udp_in_packets,
speed_element.icmp_in_packets);
} else {
// OUTGOING
return get_max_used_protocol(speed_element.tcp_out_packets, speed_element.udp_out_packets,
speed_element.icmp_out_packets);
}
}
#define my_max_on_defines(a, b) (a > b ? a : b)
unsigned int get_max_used_protocol(uint64_t tcp, uint64_t udp, uint64_t icmp) {
unsigned int max = my_max_on_defines(my_max_on_defines(udp, tcp), icmp);
if (max == tcp) {
return IPPROTO_TCP;
} else if (max == udp) {
return IPPROTO_UDP;
} else if (max == icmp) {
return IPPROTO_ICMP;
}
return 0;
}
void exabgp_ban_manage(std::string action, std::string ip_as_string) {
/* Buffer for BGP message */
char bgp_message[256];
std::string ip_as_string_with_mask = ip_as_string + "/32";
// We could use subnet instead
if (exabgp_announce_whole_subnet) {
ip_as_string_with_mask = find_subnet_by_ip_in_string_format(lookup_tree, ip_as_string);
if (ip_as_string_with_mask.empty()) {
logger.warn("Can't find subnet for IP: " + ip_as_string);
return;
} else {
logger.info("We detected subnet for this IP: " + ip_as_string_with_mask);
}
}
if (action == "ban") {
sprintf(bgp_message, "announce route %s next-hop %s community %s\n",
ip_as_string_with_mask.c_str(), exabgp_next_hop.c_str(), exabgp_community.c_str());
} else {
sprintf(bgp_message, "withdraw route %s\n", ip_as_string_with_mask.c_str());
}
logger.info("ExaBGP announce message: %s", bgp_message);
int exabgp_pipe = open(exabgp_command_pipe.c_str(), O_WRONLY);
if (exabgp_pipe <= 0) {
logger << log4cpp::Priority::ERROR << "Can't open ExaBGP pipe " << exabgp_command_pipe
<< " Ban is not executed";
return;
}
int wrote_bytes = write(exabgp_pipe, bgp_message, strlen(bgp_message));
if (wrote_bytes != strlen(bgp_message)) {
logger << log4cpp::Priority::ERROR << "Can't write message to ExaBGP pipe";
}
close(exabgp_pipe);
}
void execute_ip_ban(uint32_t client_ip, map_element speed_element, map_element average_speed_element, std::string flow_attack_details, subnet_t customer_subnet) {
2014-12-05 16:01:17 +01:00
struct attack_details current_attack;
uint64_t pps = 0;
uint64_t in_pps = average_speed_element.in_packets;
uint64_t out_pps = average_speed_element.out_packets;
uint64_t in_bps = average_speed_element.in_bytes;
uint64_t out_bps = average_speed_element.out_bytes;
uint64_t in_flows = average_speed_element.in_flows;
uint64_t out_flows = average_speed_element.out_flows;
2014-12-05 16:01:17 +01:00
direction data_direction;
if (!we_do_real_ban) {
logger << log4cpp::Priority::INFO << "We do not ban: " << convert_ip_as_uint_to_string(client_ip)
<< " because ban disabled completely";
return;
}
// Detect attack direction with simple heuristic
2014-12-05 20:44:24 +01:00
if (abs(int((int)in_pps - (int)out_pps)) < 1000) {
// If difference between pps speed is so small we should do additional investigation using
// bandwidth speed
if (in_bps > out_bps) {
data_direction = INCOMING;
pps = in_pps;
} else {
data_direction = OUTGOING;
pps = out_pps;
}
} else {
if (in_pps > out_pps) {
data_direction = INCOMING;
pps = in_pps;
} else {
data_direction = OUTGOING;
pps = out_pps;
}
}
current_attack.attack_protocol = detect_attack_protocol(speed_element, data_direction);
if (ban_list.count(client_ip) > 0) {
if (ban_list[client_ip].attack_direction != data_direction) {
logger << log4cpp::Priority::INFO
<< "We expected very strange situation: attack direction for "
<< convert_ip_as_uint_to_string(client_ip) << " was changed";
return;
}
// update attack power
if (pps > ban_list[client_ip].max_attack_power) {
ban_list[client_ip].max_attack_power = pps;
}
2014-06-30 16:37:27 +02:00
return;
}
prefix_t prefix_for_check_adreess;
prefix_for_check_adreess.add.sin.s_addr = client_ip;
prefix_for_check_adreess.family = AF_INET;
prefix_for_check_adreess.bitlen = 32;
bool in_white_list = (patricia_search_best2(whitelist_tree, &prefix_for_check_adreess, 1) != NULL);
2014-06-30 16:37:27 +02:00
if (in_white_list) {
return;
}
2014-06-30 16:37:27 +02:00
2015-01-27 20:29:51 +01:00
std::string data_direction_as_string = get_direction_name(data_direction);
logger.info("We run execute_ip_ban code with following params in_pps: %d out_pps: %d in_bps: "
"%d out_bps: %d and we decide it's %s attack",
in_pps, out_pps, in_bps, out_bps, data_direction_as_string.c_str());
2014-06-26 11:30:38 +02:00
2015-01-27 20:29:51 +01:00
std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);
std::string pps_as_string = convert_int_to_string(pps);
2014-06-26 11:30:38 +02:00
// Store information about subnet
current_attack.customer_network = customer_subnet;
2014-11-15 01:10:04 +01:00
// Store ban time
time(&current_attack.ban_timestamp);
// set ban time in seconds
current_attack.ban_time = standard_ban_time;
2014-10-20 17:42:14 +02:00
2014-11-15 01:10:04 +01:00
// Pass main information about attack
current_attack.attack_direction = data_direction;
current_attack.attack_power = pps;
current_attack.max_attack_power = pps;
current_attack.in_packets = in_pps;
current_attack.out_packets = out_pps;
current_attack.in_bytes = in_bps;
current_attack.out_bytes = out_bps;
2014-12-05 15:34:59 +01:00
// pass flow information
current_attack.in_flows = in_flows;
current_attack.out_flows = out_flows;
current_attack.fragmented_in_packets = speed_element.fragmented_in_packets;
current_attack.tcp_in_packets = speed_element.tcp_in_packets;
current_attack.tcp_syn_in_packets = speed_element.tcp_syn_in_packets;
current_attack.udp_in_packets = speed_element.udp_in_packets;
2014-12-05 15:34:59 +01:00
current_attack.icmp_in_packets = speed_element.icmp_in_packets;
current_attack.fragmented_out_packets = speed_element.fragmented_out_packets;
2014-12-05 15:34:59 +01:00
current_attack.tcp_out_packets = speed_element.tcp_out_packets;
current_attack.tcp_syn_out_packets = speed_element.tcp_syn_out_packets;
2014-12-05 15:34:59 +01:00
current_attack.udp_out_packets = speed_element.udp_out_packets;
current_attack.icmp_out_packets = speed_element.icmp_out_packets;
current_attack.fragmented_out_bytes = speed_element.fragmented_out_bytes;
current_attack.tcp_out_bytes = speed_element.tcp_out_bytes;
current_attack.tcp_syn_out_bytes = speed_element.tcp_syn_out_bytes;
current_attack.udp_out_bytes = speed_element.udp_out_bytes;
2014-12-05 15:34:59 +01:00
current_attack.icmp_out_bytes = speed_element.icmp_out_bytes;
current_attack.fragmented_in_bytes = speed_element.fragmented_in_bytes;
2014-12-05 15:34:59 +01:00
current_attack.tcp_in_bytes = speed_element.tcp_in_bytes;
current_attack.tcp_syn_in_bytes = speed_element.tcp_syn_in_bytes;
2014-12-05 15:34:59 +01:00
current_attack.udp_in_bytes = speed_element.udp_in_bytes;
current_attack.icmp_in_bytes = speed_element.icmp_in_bytes;
2014-12-04 16:48:11 +01:00
// Add average counters
map_element* current_average_speed_element = &SpeedCounterAverage[client_ip];
2014-12-04 16:48:11 +01:00
current_attack.average_in_packets = current_average_speed_element->in_packets;
current_attack.average_in_bytes = current_average_speed_element->in_bytes;
current_attack.average_in_flows = current_average_speed_element->in_flows;
2014-12-04 16:48:11 +01:00
current_attack.average_out_packets = current_average_speed_element->out_packets;
current_attack.average_out_bytes = current_average_speed_element->out_bytes;
current_attack.average_out_flows = current_average_speed_element->out_flows;
ban_list_mutex.lock();
ban_list[client_ip] = current_attack;
ban_list_mutex.unlock();
ban_list_details_mutex.lock();
2015-01-27 20:29:51 +01:00
ban_list_details[client_ip] = std::vector<simple_packet>();
ban_list_details_mutex.unlock();
logger << log4cpp::Priority::INFO << "Attack with direction: " << data_direction_as_string
<< " IP: " << client_ip_as_string << " Power: " << pps_as_string;
#ifdef HWFILTER_LOCKING
logger << log4cpp::Priority::INFO
<< "We will block traffic to/from this IP with hardware filters";
block_all_traffic_with_82599_hardware_filtering(client_ip_as_string);
#endif
std::string basic_attack_information = get_attack_description(client_ip, current_attack);
std::string full_attack_description = basic_attack_information + flow_attack_details;
print_attack_details_to_file(full_attack_description, client_ip_as_string, current_attack);
if (file_exists(notify_script_path)) {
std::string script_call_params = notify_script_path + " " + client_ip_as_string + " " +
data_direction_as_string + " " + pps_as_string +
" attack_details";
logger << log4cpp::Priority::INFO << "Call script for ban client: " << client_ip_as_string;
// We should execute external script in separate thread because any lag in this code will be
// very distructive
boost::thread exec_thread(exec_with_stdin_params, script_call_params, full_attack_description);
exec_thread.detach();
logger << log4cpp::Priority::INFO << "Script for ban client is finished: " << client_ip_as_string;
}
2015-05-11 21:56:18 +02:00
if (exabgp_enabled) {
logger << log4cpp::Priority::INFO << "Call ExaBGP for ban client started: " << client_ip_as_string;
2015-05-11 21:56:18 +02:00
boost::thread exabgp_thread(exabgp_ban_manage, "ban", client_ip_as_string);
2015-05-11 21:56:18 +02:00
exabgp_thread.detach();
logger << log4cpp::Priority::INFO << "Call to ExaBGP for ban client is finished: " << client_ip_as_string;
}
#ifdef REDIS
if (redis_enabled) {
std::string redis_key_name = client_ip_as_string + "_information";
logger << log4cpp::Priority::INFO << "Start data save in redis in key: " << redis_key_name;
boost::thread redis_store_thread(store_data_in_redis, redis_key_name, basic_attack_information);
redis_store_thread.detach();
logger << log4cpp::Priority::INFO << "Finish data save in redis in key: " << redis_key_name;
}
// If we have flow dump put in redis too
if (redis_enabled && !flow_attack_details.empty()) {
std::string redis_key_name = client_ip_as_string + "_flow_dump";
logger << log4cpp::Priority::INFO << "Start data save in redis in key: " << redis_key_name;
boost::thread redis_store_thread(store_data_in_redis, redis_key_name, flow_attack_details);
redis_store_thread.detach();
logger << log4cpp::Priority::INFO << "Finish data save in redis in key: " << redis_key_name;
}
#endif
}
#ifdef HWFILTER_LOCKING
2015-01-27 20:29:51 +01:00
void block_all_traffic_with_82599_hardware_filtering(std::string client_ip_as_string) {
/* 6 - tcp, 17 - udp, 0 - other (non tcp and non udp) */
2015-01-27 20:29:51 +01:00
std::vector<int> banned_protocols;
banned_protocols.push_back(17);
banned_protocols.push_back(6);
banned_protocols.push_back(0);
int rule_number = 10;
// Iterate over incoming and outgoing direction
2014-10-16 15:25:46 +02:00
for (int rule_direction = 0; rule_direction < 2; rule_direction++) {
for (std::vector<int>::iterator banned_protocol = banned_protocols.begin();
banned_protocol != banned_protocols.end(); ++banned_protocol) {
/* On 82599 NIC we can ban traffic using hardware filtering rules */
// Difference between fie tuple and perfect filters:
// http://www.ntop.org/products/pf_ring/hardware-packet-filtering/
hw_filtering_rule rule;
intel_82599_five_tuple_filter_hw_rule* ft_rule;
ft_rule = &rule.rule_family.five_tuple_rule;
memset(&rule, 0, sizeof(rule));
rule.rule_family_type = intel_82599_five_tuple_rule;
rule.rule_id = rule_number++;
ft_rule->queue_id = -1; // drop traffic
ft_rule->proto = *banned_protocol;
2015-01-27 20:29:51 +01:00
std::string hw_filter_rule_direction = "";
if (rule_direction == 0) {
hw_filter_rule_direction = "outgoing";
ft_rule->s_addr = ntohl(inet_addr(client_ip_as_string.c_str()));
} else {
hw_filter_rule_direction = "incoming";
ft_rule->d_addr = ntohl(inet_addr(client_ip_as_string.c_str()));
}
if (pfring_add_hw_rule(pf_ring_descr, &rule) != 0) {
logger << log4cpp::Priority::ERROR
<< "Can't add hardware filtering rule for protocol: " << *banned_protocol
<< " in direction: " << hw_filter_rule_direction;
}
rule_number++;
}
}
}
#endif
2014-10-20 17:42:14 +02:00
/* Thread for cleaning up ban list */
void cleanup_ban_list() {
2014-11-15 01:10:04 +01:00
// Every X seconds we will run ban list cleaner thread
2014-10-20 17:42:14 +02:00
int iteration_sleep_time = 600;
// If we use very small ban time we should call ban_cleanup thread more often
if (iteration_sleep_time > standard_ban_time) {
iteration_sleep_time = int(standard_ban_time / 2);
}
logger << log4cpp::Priority::INFO << "Run banlist cleanup thread";
2014-10-21 15:25:13 +02:00
2014-10-20 17:42:14 +02:00
while (true) {
// Sleep for ten minutes
2014-10-21 16:44:20 +02:00
boost::this_thread::sleep(boost::posix_time::seconds(iteration_sleep_time));
2014-10-20 17:42:14 +02:00
time_t current_time;
time(&current_time);
std::map<uint32_t, banlist_item>::iterator itr = ban_list.begin();
2014-10-22 01:49:10 +02:00
while (itr != ban_list.end()) {
uint32_t client_ip = (*itr).first;
2014-10-20 17:42:14 +02:00
2014-10-22 01:49:10 +02:00
double time_difference = difftime(current_time, ((*itr).second).ban_timestamp);
int ban_time = ((*itr).second).ban_time;
2014-10-20 17:42:14 +02:00
2015-04-27 18:01:13 +02:00
// Zero value for ban_time means "no unban feature"
if (ban_time != 0 && time_difference > ban_time) {
2014-11-15 01:10:04 +01:00
// Cleanup all data related with this attack
2015-01-27 20:29:51 +01:00
std::string data_direction_as_string = get_direction_name((*itr).second.attack_direction);
std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);
std::string pps_as_string = convert_int_to_string((*itr).second.attack_power);
logger << log4cpp::Priority::INFO << "We will unban banned IP: " << client_ip_as_string
<< " because it ban time " << ban_time << " seconds is ended";
ban_list_mutex.lock();
std::map<uint32_t, banlist_item>::iterator itr_to_erase = itr;
++itr;
2014-10-22 01:49:10 +02:00
ban_list.erase(itr_to_erase);
ban_list_mutex.unlock();
if (file_exists(notify_script_path)) {
std::string script_call_params = notify_script_path + " " + client_ip_as_string +
" " + data_direction_as_string + " " +
pps_as_string + " unban";
logger << log4cpp::Priority::INFO << "Call script for unban client: " << client_ip_as_string;
// We should execute external script in separate thread because any lag in this
// code will be very distructive
boost::thread exec_thread(exec, script_call_params);
exec_thread.detach();
logger << log4cpp::Priority::INFO
<< "Script for unban client is finished: " << client_ip_as_string;
}
if (exabgp_enabled) {
logger << log4cpp::Priority::INFO
<< "Call ExaBGP for unban client started: " << client_ip_as_string;
boost::thread exabgp_thread(exabgp_ban_manage, "unban", client_ip_as_string);
exabgp_thread.detach();
logger << log4cpp::Priority::INFO
<< "Call to ExaBGP for unban client is finished: " << client_ip_as_string;
}
2014-10-22 01:49:10 +02:00
} else {
++itr;
}
2014-10-20 17:42:14 +02:00
}
}
}
2015-01-27 20:29:51 +01:00
std::string print_ddos_attack_details() {
std::stringstream output_buffer;
for (std::map<uint32_t, banlist_item>::iterator ii = ban_list.begin(); ii != ban_list.end(); ++ii) {
uint32_t client_ip = (*ii).first;
2015-01-27 20:29:51 +01:00
std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);
std::string max_pps_as_string = convert_int_to_string(((*ii).second).max_attack_power);
std::string attack_direction = get_direction_name(((*ii).second).attack_direction);
output_buffer << client_ip_as_string << "/" << max_pps_as_string << " pps "
<< attack_direction << " at "
<< print_time_t_in_fastnetmon_format(ii->second.ban_timestamp) << std::endl;
send_attack_details(client_ip, (*ii).second);
}
return output_buffer.str();
}
2015-01-27 20:29:51 +01:00
std::string get_attack_description(uint32_t client_ip, attack_details& current_attack) {
std::stringstream attack_description;
attack_type_t attack_type = detect_attack_type(current_attack);
std::string printable_attack_type = get_printable_attack_name(attack_type);
attack_description
<< "IP: " << convert_ip_as_uint_to_string(client_ip) << "\n"
<< "Attack type: " << printable_attack_type << "\n"
<< "Initial attack power: " << current_attack.attack_power << " packets per second\n"
<< "Peak attack power: " << current_attack.max_attack_power << " packets per second\n"
<< "Attack direction: " << get_direction_name(current_attack.attack_direction) << "\n"
<< "Attack protocol: " << get_printable_protocol_name(current_attack.attack_protocol) << "\n";
if (enable_subnet_counters) {
// Got subnet tracking structure
// TODO: we suppose case "no key exists" is not possible
map_element network_speed_meter = PerSubnetSpeedMap[ current_attack.customer_network ];
map_element average_network_speed_meter = PerSubnetAverageSpeedMap[ current_attack.customer_network ];
attack_description
<<"Network: " << convert_subnet_to_string(current_attack.customer_network) << "\n"
<<"Network incoming traffic: "<< convert_speed_to_mbps(network_speed_meter.in_bytes) << " mbps\n"
<<"Network outgoing traffic: "<< convert_speed_to_mbps(network_speed_meter.out_bytes) << " mbps\n"
<<"Network incoming pps: "<< network_speed_meter.in_packets << " packets per second\n"
<<"Network outgoing pps: "<< network_speed_meter.out_packets << " packets per second\n";
attack_description
<<"Average network incoming traffic: "<< convert_speed_to_mbps(average_network_speed_meter.in_bytes) << " mbps\n"
<<"Average network outgoing traffic: "<< convert_speed_to_mbps(average_network_speed_meter.out_bytes) << " mbps\n"
<<"Average network incoming pps: "<< average_network_speed_meter.in_packets << " packets per second\n"
<<"Average network outgoing pps: "<< average_network_speed_meter.out_packets << " packets per second\n";
}
attack_description
<< "Total incoming traffic: " << convert_speed_to_mbps(current_attack.in_bytes) << " mbps\n"
<< "Total outgoing traffic: " << convert_speed_to_mbps(current_attack.out_bytes) << " mbps\n"
<< "Total incoming pps: " << current_attack.in_packets << " packets per second\n"
<< "Total outgoing pps: " << current_attack.out_packets << " packets per second\n"
<< "Total incoming flows: " << current_attack.in_flows << " flows per second\n"
<< "Total outgoing flows: " << current_attack.out_flows << " flows per second\n";
// Add average counters
2014-12-04 16:48:11 +01:00
attack_description
<< "Average incoming traffic: " << convert_speed_to_mbps(current_attack.average_in_bytes)
<< " mbps\n"
<< "Average outgoing traffic: " << convert_speed_to_mbps(current_attack.average_out_bytes) << " mbps\n"
<< "Average incoming pps: " << current_attack.average_in_packets << " packets per second\n"
<< "Average outgoing pps: " << current_attack.average_out_packets << " packets per second\n"
<< "Average incoming flows: " << current_attack.average_in_flows << " flows per second\n"
<< "Average outgoing flows: " << current_attack.average_out_flows << " flows per second\n";
2014-12-04 16:48:11 +01:00
double average_packet_size_for_incoming_traffic = 0;
double average_packet_size_for_outgoing_traffic = 0;
if (current_attack.average_in_packets > 0) {
average_packet_size_for_incoming_traffic =
(double)current_attack.average_in_bytes / (double)current_attack.average_in_packets;
}
if (current_attack.average_out_packets > 0) {
average_packet_size_for_outgoing_traffic =
(double)current_attack.average_out_bytes / (double)current_attack.average_out_packets;
}
2014-12-05 15:34:59 +01:00
attack_description
<< "Incoming ip fragmented traffic: " << convert_speed_to_mbps(current_attack.fragmented_in_bytes) << " mbps\n"
<< "Outgoing ip fragmented traffic: " << convert_speed_to_mbps(current_attack.fragmented_out_bytes)
<< " mbps\n"
<< "Incoming ip fragmented pps: " << current_attack.fragmented_in_packets
<< " packets per second\n"
<< "Outgoing ip fragmented pps: " << current_attack.fragmented_out_packets
<< " packets per second\n"
<< "Incoming tcp traffic: " << convert_speed_to_mbps(current_attack.tcp_in_bytes) << " mbps\n"
<< "Outgoing tcp traffic: " << convert_speed_to_mbps(current_attack.tcp_out_bytes) << " mbps\n"
<< "Incoming tcp pps: " << current_attack.tcp_in_packets << " packets per second\n"
<< "Outgoing tcp pps: " << current_attack.tcp_out_packets << " packets per second\n"
<< "Incoming syn tcp traffic: " << convert_speed_to_mbps(current_attack.tcp_syn_in_bytes)
<< " mbps\n"
<< "Outgoing syn tcp traffic: " << convert_speed_to_mbps(current_attack.tcp_syn_out_bytes) << " mbps\n"
<< "Incoming syn tcp pps: " << current_attack.tcp_syn_in_packets << " packets per second\n"
<< "Outgoing syn tcp pps: " << current_attack.tcp_syn_out_packets << " packets per second\n"
<< "Incoming udp traffic: " << convert_speed_to_mbps(current_attack.udp_in_bytes) << " mbps\n"
<< "Outgoing udp traffic: " << convert_speed_to_mbps(current_attack.udp_out_bytes) << " mbps\n"
<< "Incoming udp pps: " << current_attack.udp_in_packets << " packets per second\n"
<< "Outgoing udp pps: " << current_attack.udp_out_packets << " packets per second\n"
<< "Incoming icmp traffic: " << convert_speed_to_mbps(current_attack.icmp_in_bytes) << " mbps\n"
<< "Outgoing icmp traffic: " << convert_speed_to_mbps(current_attack.icmp_out_bytes)
<< " mbps\n"
<< "Incoming icmp pps: " << current_attack.icmp_in_packets << " packets per second\n"
<< "Outgoing icmp pps: " << current_attack.icmp_out_packets << " packets per second\n";
// We do not need very accurate size
attack_description.precision(1);
attack_description << "Average packet size for incoming traffic: " << std::fixed
<< average_packet_size_for_incoming_traffic << " bytes \n"
<< "Average packet size for outgoing traffic: " << std::fixed
<< average_packet_size_for_outgoing_traffic << " bytes \n";
2014-12-04 16:48:11 +01:00
return attack_description.str();
}
void send_attack_details(uint32_t client_ip, attack_details current_attack_details) {
2015-01-27 20:29:51 +01:00
std::string pps_as_string = convert_int_to_string(current_attack_details.attack_power);
std::string attack_direction = get_direction_name(current_attack_details.attack_direction);
std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);
// Very strange code but it work in 95% cases
if (ban_list_details.count(client_ip) > 0 && ban_list_details[client_ip].size() == ban_details_records_count) {
2015-01-27 20:29:51 +01:00
std::stringstream attack_details;
attack_details << get_attack_description(client_ip, current_attack_details) << "\n\n";
2014-07-04 13:10:23 +02:00
std::map<unsigned int, unsigned int> protocol_counter;
for (std::vector<simple_packet>::iterator iii = ban_list_details[client_ip].begin();
iii != ban_list_details[client_ip].end(); ++iii) {
attack_details << print_simple_packet(*iii);
protocol_counter[iii->protocol]++;
2014-07-04 13:10:23 +02:00
}
std::map<unsigned int, unsigned int>::iterator max_proto =
std::max_element(protocol_counter.begin(), protocol_counter.end(), protocol_counter.value_comp());
attack_details << "\n"
<< "We got more packets (" << max_proto->second << " from " << ban_details_records_count
<< ") for protocol: " << get_protocol_name_by_number(max_proto->first) << "\n";
logger << log4cpp::Priority::INFO << "Attack with direction: " << attack_direction
<< " IP: " << client_ip_as_string << " Power: " << pps_as_string
<< " traffic sample collected";
print_attack_details_to_file(attack_details.str(), client_ip_as_string, current_attack_details);
2014-11-15 01:10:04 +01:00
// Pass attack details to script
if (file_exists(notify_script_path)) {
logger << log4cpp::Priority::INFO
<< "Call script for notify about attack details for: " << client_ip_as_string;
std::string script_params = notify_script_path + " " + client_ip_as_string + " " +
attack_direction + " " + pps_as_string + " ban";
// We should execute external script in separate thread because any lag in this code
// will be very distructive
boost::thread exec_with_params_thread(exec_with_stdin_params, script_params, attack_details.str());
exec_with_params_thread.detach();
logger << log4cpp::Priority::INFO
<< "Script for notify about attack details is finished: " << client_ip_as_string;
}
#ifdef REDIS
if (redis_enabled) {
std::string redis_key_name = client_ip_as_string + "_packets_dump";
logger << log4cpp::Priority::INFO << "Start data save in redis for key: " << redis_key_name;
boost::thread redis_store_thread(store_data_in_redis, redis_key_name, attack_details.str());
redis_store_thread.detach();
logger << log4cpp::Priority::INFO << "Finish data save in redis for key: " << redis_key_name;
}
#endif
// TODO: here we have definitely RACE CONDITION!!! FIX IT
2014-11-15 01:10:04 +01:00
// Remove key and prevent collection new data about this attack
2015-04-27 09:49:46 +02:00
ban_list_details_mutex.lock();
ban_list_details.erase(client_ip);
2015-04-27 09:49:46 +02:00
ban_list_details_mutex.unlock();
}
2014-06-26 12:10:57 +02:00
}
2014-11-13 16:01:15 +01:00
uint64_t convert_conntrack_hash_struct_to_integer(packed_conntrack_hash* struct_value) {
uint64_t unpacked_data = 0;
memcpy(&unpacked_data, struct_value, sizeof(uint64_t));
return unpacked_data;
}
2014-11-14 22:36:54 +01:00
void convert_integer_to_conntrack_hash_struct(packed_session* packed_connection_data,
packed_conntrack_hash* unpacked_data) {
memcpy(unpacked_data, packed_connection_data, sizeof(uint64_t));
2014-11-15 00:41:54 +01:00
}
std::string print_flow_tracking_for_specified_protocol(contrack_map_type& protocol_map,
std::string client_ip,
direction flow_direction) {
2015-01-27 20:29:51 +01:00
std::stringstream buffer;
2014-11-15 00:41:54 +01:00
// We shoud iterate over all fields
2014-11-29 22:50:31 +01:00
int printed_records = 0;
2014-11-15 00:41:54 +01:00
for (contrack_map_type::iterator itr = protocol_map.begin(); itr != protocol_map.end(); ++itr) {
// We should limit number of records in flow dump because syn flood attacks produce
// thounsands of lines
2014-11-29 22:50:31 +01:00
if (printed_records > ban_details_records_count) {
buffer << "Flows have cropped due to very long list.\n";
2014-11-29 22:50:31 +01:00
break;
}
2014-11-15 00:41:54 +01:00
uint64_t packed_connection_data = itr->first;
packed_conntrack_hash unpacked_key_struct;
convert_integer_to_conntrack_hash_struct(&packed_connection_data, &unpacked_key_struct);
std::string opposite_ip_as_string = convert_ip_as_uint_to_string(unpacked_key_struct.opposite_ip);
2014-11-15 00:41:54 +01:00
if (flow_direction == INCOMING) {
buffer << client_ip << ":" << unpacked_key_struct.dst_port << " < "
<< opposite_ip_as_string << ":" << unpacked_key_struct.src_port << " ";
2014-11-15 00:41:54 +01:00
} else if (flow_direction == OUTGOING) {
buffer << client_ip << ":" << unpacked_key_struct.src_port << " > "
<< opposite_ip_as_string << ":" << unpacked_key_struct.dst_port << " ";
}
buffer << itr->second.bytes << " bytes " << itr->second.packets << " packets";
buffer << "\n";
2014-11-29 22:50:31 +01:00
printed_records++;
}
2014-11-15 00:41:54 +01:00
return buffer.str();
}
2014-12-05 14:09:25 +01:00
/*
Attack types:
- syn flood: one local port, multiple remote hosts (and maybe multiple remote ports) and
small packet size
2014-12-05 14:09:25 +01:00
*/
/* Iterate over all flow tracking table */
2015-01-27 20:29:51 +01:00
bool process_flow_tracking_table(conntrack_main_struct& conntrack_element, std::string client_ip) {
std::map<uint32_t, unsigned int> uniq_remote_hosts_which_generate_requests_to_us;
std::map<unsigned int, unsigned int> uniq_local_ports_which_target_of_connectiuons_from_inside;
2014-12-05 14:09:25 +01:00
/* Process incoming TCP connections */
for (contrack_map_type::iterator itr = conntrack_element.in_tcp.begin();
itr != conntrack_element.in_tcp.end(); ++itr) {
2014-12-05 14:09:25 +01:00
uint64_t packed_connection_data = itr->first;
packed_conntrack_hash unpacked_key_struct;
convert_integer_to_conntrack_hash_struct(&packed_connection_data, &unpacked_key_struct);
2014-12-05 14:09:25 +01:00
uniq_remote_hosts_which_generate_requests_to_us[unpacked_key_struct.opposite_ip]++;
uniq_local_ports_which_target_of_connectiuons_from_inside[unpacked_key_struct.dst_port]++;
// we can calc average packet size
// string opposite_ip_as_string =
// convert_ip_as_uint_to_string(unpacked_key_struct.opposite_ip);
2014-12-05 14:09:25 +01:00
// unpacked_key_struct.src_port
// unpacked_key_struct.dst_port
// itr->second.packets
// itr->second.bytes
}
2014-12-16 11:56:08 +01:00
return true;
2014-12-05 14:09:25 +01:00
}
2015-01-27 20:29:51 +01:00
std::string print_flow_tracking_for_ip(conntrack_main_struct& conntrack_element, std::string client_ip) {
std::stringstream buffer;
2014-11-15 00:41:54 +01:00
std::string in_tcp =
print_flow_tracking_for_specified_protocol(conntrack_element.in_tcp, client_ip, INCOMING);
std::string in_udp =
print_flow_tracking_for_specified_protocol(conntrack_element.in_udp, client_ip, INCOMING);
2014-11-15 00:41:54 +01:00
2015-05-08 10:42:20 +02:00
unsigned long long total_number_of_incoming_tcp_flows = conntrack_element.in_tcp.size();
unsigned long long total_number_of_incoming_udp_flows = conntrack_element.in_udp.size();
unsigned long long total_number_of_outgoing_tcp_flows = conntrack_element.out_tcp.size();
unsigned long long total_number_of_outgoing_udp_flows = conntrack_element.out_udp.size();
2015-05-08 10:42:20 +02:00
2014-11-15 00:41:54 +01:00
bool we_have_incoming_flows = in_tcp.length() > 0 or in_udp.length() > 0;
if (we_have_incoming_flows) {
buffer << "Incoming\n\n";
2014-11-15 00:41:54 +01:00
if (in_tcp.length() > 0) {
buffer << "TCP flows: " << total_number_of_incoming_tcp_flows << "\n";
buffer << in_tcp << "\n";
2014-11-15 00:41:54 +01:00
}
if (in_udp.length() > 0) {
buffer << "UDP flows: " << total_number_of_incoming_udp_flows << "\n";
buffer << in_udp << "\n";
2014-11-15 00:41:54 +01:00
}
}
std::string out_tcp =
print_flow_tracking_for_specified_protocol(conntrack_element.out_tcp, client_ip, OUTGOING);
std::string out_udp =
print_flow_tracking_for_specified_protocol(conntrack_element.out_udp, client_ip, OUTGOING);
2014-11-15 00:41:54 +01:00
bool we_have_outgoing_flows = out_tcp.length() > 0 or out_udp.length() > 0;
// print delimiter if we have flows in both directions
if (we_have_incoming_flows && we_have_outgoing_flows) {
buffer << "\n";
2014-11-15 00:41:54 +01:00
}
if (we_have_outgoing_flows) {
buffer << "Outgoing\n\n";
2014-11-15 00:41:54 +01:00
if (out_tcp.length() > 0) {
buffer << "TCP flows: " << total_number_of_outgoing_tcp_flows << "\n";
buffer << out_tcp << "\n";
2014-11-15 00:41:54 +01:00
}
if (out_udp.length() > 0) {
buffer << "UDP flows: " << total_number_of_outgoing_udp_flows << "\n";
buffer << out_udp << "\n";
2014-11-15 00:41:54 +01:00
}
}
return buffer.str();
}
2014-11-14 22:36:54 +01:00
std::string print_subnet_load() {
std::stringstream buffer;
for (map_for_subnet_counters::iterator itr = PerSubnetSpeedMap.begin(); itr != PerSubnetSpeedMap.end(); ++itr) {
map_element* speed = &itr->second;
buffer
<< std::setw(18)
<< std::left
<< convert_subnet_to_string(itr->first);
buffer
<< "\t"
<< "pps in: " << speed->in_packets
<< " out: " << speed->out_packets
<< " mbps in: " << convert_speed_to_mbps(speed->in_bytes)
<< " out: " << convert_speed_to_mbps(speed->out_bytes)
<< "\n";
}
return buffer.str();
}
2015-01-27 20:29:51 +01:00
std::string print_ban_thresholds() {
std::stringstream output_buffer;
2014-12-04 17:07:44 +01:00
output_buffer << "Configuration params:\n";
if (we_do_real_ban) {
output_buffer << "We call ban script: yes\n";
} else {
output_buffer << "We call ban script: no\n";
}
output_buffer << "Packets per second: ";
2014-12-04 17:07:44 +01:00
if (enable_ban_for_pps) {
output_buffer << ban_threshold_pps;
2014-12-04 17:07:44 +01:00
} else {
output_buffer << "disabled";
2014-12-04 17:07:44 +01:00
}
output_buffer << "\n";
2014-12-04 17:07:44 +01:00
output_buffer << "Mbps per second: ";
2014-12-04 17:07:44 +01:00
if (enable_ban_for_bandwidth) {
output_buffer << ban_threshold_mbps;
2014-12-04 17:07:44 +01:00
} else {
output_buffer << "disabled";
2014-12-04 17:07:44 +01:00
}
output_buffer << "\n";
2014-12-04 17:07:44 +01:00
output_buffer << "Flows per second: ";
2014-12-04 17:07:44 +01:00
if (enable_ban_for_flows_per_second) {
output_buffer << ban_threshold_flows;
2014-12-04 17:07:44 +01:00
} else {
output_buffer << "disabled";
2014-12-04 17:07:44 +01:00
}
output_buffer << "\n";
2014-12-04 17:07:44 +01:00
return output_buffer.str();
}
void print_attack_details_to_file(std::string details, std::string client_ip_as_string, attack_details current_attack) {
2015-01-27 20:29:51 +01:00
std::ofstream my_attack_details_file;
std::string ban_timestamp_as_string = print_time_t_in_fastnetmon_format(current_attack.ban_timestamp);
2015-01-27 20:29:51 +01:00
std::string attack_dump_path = attack_details_folder + "/" + client_ip_as_string + "_" + ban_timestamp_as_string;
2015-01-27 20:29:51 +01:00
my_attack_details_file.open(attack_dump_path.c_str(), std::ios::app);
if (my_attack_details_file.is_open()) {
my_attack_details_file << details << "\n\n";
my_attack_details_file.close();
} else {
logger << log4cpp::Priority::ERROR << "Can't print attack details to file";
}
}
// Return true when we should ban this IP
2015-03-13 17:29:00 +01:00
bool we_should_ban_this_ip(map_element* average_speed_element) {
uint64_t in_pps_average = average_speed_element->in_packets;
2015-03-13 17:29:00 +01:00
uint64_t out_pps_average = average_speed_element->out_packets;
uint64_t in_bps_average = average_speed_element->in_bytes;
uint64_t out_bps_average = average_speed_element->out_bytes;
uint64_t in_flows_average = average_speed_element->in_flows;
2015-03-13 17:29:00 +01:00
uint64_t out_flows_average = average_speed_element->out_flows;
// we detect overspeed by packets
bool attack_detected_by_pps = false;
bool attack_detected_by_bandwidth = false;
bool attack_detected_by_flow = false;
if (enable_ban_for_pps && (in_pps_average > ban_threshold_pps or out_pps_average > ban_threshold_pps)) {
attack_detected_by_pps = true;
}
// we detect overspeed by bandwidth
if (enable_ban_for_bandwidth && (convert_speed_to_mbps(in_bps_average) > ban_threshold_mbps or
convert_speed_to_mbps(out_bps_average) > ban_threshold_mbps)) {
attack_detected_by_bandwidth = true;
}
if (enable_ban_for_flows_per_second &&
(in_flows_average > ban_threshold_flows or out_flows_average > ban_threshold_flows)) {
attack_detected_by_flow = true;
}
return attack_detected_by_pps or attack_detected_by_bandwidth or attack_detected_by_flow;
}
attack_type_t detect_attack_type(attack_details& current_attack) {
double threshold_value = 0.9;
if (current_attack.attack_direction == INCOMING) {
if (current_attack.tcp_syn_in_packets > threshold_value * current_attack.in_packets) {
return ATTACK_SYN_FLOOD;
} else if (current_attack.icmp_in_packets > threshold_value * current_attack.in_packets) {
return ATTACK_ICMP_FLOOD;
} else if (current_attack.fragmented_in_packets > threshold_value * current_attack.in_packets) {
return ATTACK_IP_FRAGMENTATION_FLOOD;
} else if (current_attack.udp_in_packets > threshold_value * current_attack.in_packets) {
return ATTACK_UDP_FLOOD;
}
} else if (current_attack.attack_direction == OUTGOING) {
if (current_attack.tcp_syn_out_packets > threshold_value * current_attack.out_packets) {
return ATTACK_SYN_FLOOD;
} else if (current_attack.icmp_out_packets > threshold_value * current_attack.out_packets) {
return ATTACK_ICMP_FLOOD;
} else if (current_attack.fragmented_out_packets > threshold_value * current_attack.out_packets) {
return ATTACK_IP_FRAGMENTATION_FLOOD;
} else if (current_attack.udp_out_packets > threshold_value * current_attack.out_packets) {
return ATTACK_UDP_FLOOD;
}
}
return ATTACK_UNKNOWN;
}
std::string get_printable_attack_name(attack_type_t attack) {
if (attack == ATTACK_SYN_FLOOD) {
return "syn_flood";
} else if (attack == ATTACK_ICMP_FLOOD) {
return "icmp_flood";
} else if (attack == ATTACK_UDP_FLOOD) {
return "udp_flood";
} else if (attack == ATTACK_IP_FRAGMENTATION_FLOOD) {
return "ip_fragmentation";
} else if (attack == ATTACK_UNKNOWN) {
return "unknown";
} else {
return "unknown";
}
}