1
0
mirror of https://github.com/pavel-odintsov/fastnetmon synced 2024-11-23 09:12:14 +01:00
fastnetmon-rewritten/fastnetmon.cpp

2672 lines
96 KiB
C++

/* Author: pavel.odintsov@gmail.com */
/* License: GPLv2 */
#include <stdio.h>
#include <stdlib.h>
#include <errno.h>
#include <string.h>
#include <unistd.h>
#include <signal.h>
#include <time.h>
#include <math.h>
#include <sys/socket.h>
#include <sys/resource.h>
#include <sys/stat.h>
#include <arpa/inet.h>
#include <netinet/ip.h>
#include <netinet/tcp.h>
#include <netinet/udp.h>
#include <netinet/ip_icmp.h>
#include <netinet/if_ether.h>
#include <netinet/in.h>
#include <netdb.h>
#include "libpatricia/patricia.h"
#include "fastnetmon_types.h"
// Plugins
#include "sflow_plugin/sflow_collector.h"
#include "netflow_plugin/netflow_collector.h"
#include "pcap_plugin/pcap_collector.h"
#ifdef PF_RING
#include "pfring_plugin/pfring_collector.h"
#endif
// Yes, maybe it's not an good idea but with this we can guarantee working code in example plugin
#include "example_plugin/example_collector.h"
#include <algorithm>
#include <iostream>
#include <map>
#include <fstream>
#include <vector>
#include <utility>
#include <sstream>
#include <boost/thread.hpp>
#include <boost/thread/mutex.hpp>
#include <boost/regex.hpp>
// log4cpp logging facility
#include "log4cpp/Category.hh"
#include "log4cpp/Appender.hh"
#include "log4cpp/FileAppender.hh"
#include "log4cpp/OstreamAppender.hh"
#include "log4cpp/Layout.hh"
#include "log4cpp/BasicLayout.hh"
#include "log4cpp/PatternLayout.hh"
#include "log4cpp/Priority.hh"
// Boost libs
#include <boost/algorithm/string.hpp>
#ifdef GEOIP
#include "GeoIP.h"
#endif
#ifdef REDIS
#include <hiredis/hiredis.h>
#endif
std::string global_config_path = "/etc/fastnetmon.conf";
boost::regex regular_expression_cidr_pattern("^\\d+\\.\\d+\\.\\d+\\.\\d+\\/\\d+$");
time_t last_call_of_traffic_recalculation;
// Variable with all data from main screen
std::string screen_data_stats = "";
// Global map with parsed config file
std::map<std::string, std::string> configuration_map;
/* Configuration block, we must move it to configuration file */
#ifdef REDIS
unsigned int redis_port = 6379;
std::string redis_host = "127.0.0.1";
// because it's additional and very specific feature we should disable it by default
bool redis_enabled = false;
#endif
bool enable_ban_for_pps = false;
bool enable_ban_for_bandwidth = false;
bool enable_ban_for_flows_per_second = false;
bool enable_conection_tracking = true;
bool enable_data_collection_from_mirror = true;
bool enable_sflow_collection = false;
bool enable_netflow_collection = false;
bool enable_pcap_collection = false;
// Time consumed by reaclculation for all IPs
struct timeval speed_calculation_time;
// Time consumed by drawing stats for all IPs
struct timeval drawing_thread_execution_time;
// Total number of hosts in our networks
// We need this as global variable because it's very important value for configuring data structures
unsigned int total_number_of_hosts_in_our_networks = 0;
#ifdef GEOIP
GeoIP * geo_ip = NULL;
#endif
patricia_tree_t *lookup_tree, *whitelist_tree;
bool DEBUG = 0;
// flag about dumping all packets to log
bool DEBUG_DUMP_ALL_PACKETS = false;
// Period for update screen for console version of tool
unsigned int check_period = 3;
// Standard ban time in seconds for all attacks but you can tune this value
int standard_ban_time = 1800;
// We calc average pps/bps for this time
double average_calculation_amount = 15;
// Show average or absolute value of speed
bool print_average_traffic_counts = true;
// Key used for sorting clients in output. Allowed sort params: packets/bytes
std::string sort_parameter = "packets";
// Path to notify script
std::string notify_script_path = "/usr/local/bin/notify_about_attack.sh";
// Number of lines in programm output
unsigned int max_ips_in_list = 7;
// We must ban IP if it exceeed this limit in PPS
unsigned int ban_threshold_pps = 20000;
// We must ban IP of it exceed this limit for number of flows in any direction
unsigned int ban_threshold_flows = 3500;
// We must ban client if it exceed 1GBps
unsigned int ban_threshold_mbps = 1000;
// Number of lines for sending ben attack details to email
unsigned int ban_details_records_count = 500;
// log file
log4cpp::Category& logger = log4cpp::Category::getRoot();
std::string log_file_path = "/var/log/fastnetmon.log";
std::string attack_details_folder = "/var/log/fastnetmon_attacks";
/* Configuration block ends */
/* Our data structs */
// Enum with availible sort by field
enum sort_type { PACKETS, BYTES, FLOWS };
enum direction {
INCOMING = 0,
OUTGOING,
INTERNAL,
OTHER
};
typedef struct {
uint64_t bytes;
uint64_t packets;
uint64_t flows;
} total_counter_element;
// We count total number of incoming/outgoing/internal and other traffic type packets/bytes
// And initilize by 0 all fields
total_counter_element total_counters[4];
total_counter_element total_speed_counters[4];
// Total amount of non parsed packets
uint64_t total_unparsed_packets = 0;
uint64_t incoming_total_flows_speed = 0;
uint64_t outgoing_total_flows_speed = 0;
typedef std::pair<uint32_t, uint32_t> subnet;
// main data structure for storing traffic and speed data for all our IPs
class map_element {
public:
map_element() : in_bytes(0), out_bytes(0), in_packets(0), out_packets(0), tcp_in_packets(0), tcp_out_packets(0), tcp_in_bytes(0), tcp_out_bytes(0),
udp_in_packets(0), udp_out_packets(0), udp_in_bytes(0), udp_out_bytes(0), in_flows(0), out_flows(0),
icmp_in_packets(0), icmp_out_packets(0), icmp_in_bytes(0), icmp_out_bytes(0)
{}
uint64_t in_bytes;
uint64_t out_bytes;
uint64_t in_packets;
uint64_t out_packets;
// Additional data for correct attack protocol detection
uint64_t tcp_in_packets;
uint64_t tcp_out_packets;
uint64_t tcp_in_bytes;
uint64_t tcp_out_bytes;
uint64_t udp_in_packets;
uint64_t udp_out_packets;
uint64_t udp_in_bytes;
uint64_t udp_out_bytes;
uint64_t icmp_in_packets;
uint64_t icmp_out_packets;
uint64_t icmp_in_bytes;
uint64_t icmp_out_bytes;
uint64_t in_flows;
uint64_t out_flows;
};
// structure with attack details
class attack_details : public map_element {
public:
attack_details() :
attack_protocol(0), attack_power(0), max_attack_power(0), average_in_bytes(0), average_out_bytes(0), average_in_packets(0), average_out_packets(0), average_in_flows(0), average_out_flows(0) {
}
direction attack_direction;
// first attackpower detected
uint64_t attack_power;
// max attack power
uint64_t max_attack_power;
unsigned int attack_protocol;
// Average counters
uint64_t average_in_bytes;
uint64_t average_out_bytes;
uint64_t average_in_packets;
uint64_t average_out_packets;
uint64_t average_in_flows;
uint64_t average_out_flows;
// time when we but this user
time_t ban_timestamp;
int ban_time; // seconds of the ban
};
typedef attack_details banlist_item;
// struct for save per direction and per protocol details for flow
typedef struct {
uint64_t bytes;
uint64_t packets;
// will be used for Garbage Collection
time_t last_update_time;
} conntrack_key_struct;
typedef uint64_t packed_session;
// Main mega structure for storing conntracks
// We should use class instead struct for correct std::map allocation
typedef std::map<packed_session, conntrack_key_struct> contrack_map_type;
class conntrack_main_struct {
public:
contrack_map_type in_tcp;
contrack_map_type in_udp;
contrack_map_type in_icmp;
contrack_map_type in_other;
contrack_map_type out_tcp;
contrack_map_type out_udp;
contrack_map_type out_icmp;
contrack_map_type out_other;
};
typedef std::map <uint32_t, map_element> map_for_counters;
typedef std::vector<map_element> vector_of_counters;
typedef std::map <unsigned long int, vector_of_counters> map_of_vector_counters;
map_of_vector_counters SubnetVectorMap;
// Flow tracking structures
typedef std::vector<conntrack_main_struct> vector_of_flow_counters;
typedef std::map <unsigned long int, vector_of_flow_counters> map_of_vector_counters_for_flow;
map_of_vector_counters_for_flow SubnetVectorMapFlow;
class packed_conntrack_hash {
public:
packed_conntrack_hash() : opposite_ip(0), src_port(0), dst_port(0) { }
// src or dst IP
uint32_t opposite_ip;
uint16_t src_port;
uint16_t dst_port;
};
// data structure for storing data in Vector
typedef std::pair<uint32_t, map_element> pair_of_map_elements;
/* End of our data structs */
boost::mutex data_counters_mutex;
boost::mutex speed_counters_mutex;
boost::mutex total_counters_mutex;
boost::mutex ban_list_details_mutex;
boost::mutex ban_list_mutex;
boost::mutex flow_counter;
#ifdef REDIS
redisContext *redis_context = NULL;
#endif
// map for flows
std::map<uint64_t, int> FlowCounter;
// Struct for string speed per IP
map_for_counters SpeedCounter;
// Struct for storing average speed per IP for specified interval
map_for_counters SpeedCounterAverage;
#ifdef GEOIP
map_for_counters GeoIpCounter;
#endif
// In ddos info we store attack power and direction
std::map<uint32_t, banlist_item> ban_list;
std::map<uint32_t, std::vector<simple_packet> > ban_list_details;
std::vector<subnet> our_networks;
std::vector<subnet> whitelist_networks;
// Ban enable/disable flag
bool we_do_real_ban = true;
bool process_incoming_traffic = true;
bool process_outgoing_traffic = true;
// Prototypes
#ifdef HWFILTER_LOCKING
void block_all_traffic_with_82599_hardware_filtering(std::string client_ip_as_string);
#endif
unsigned int get_max_used_protocol(uint64_t tcp, uint64_t udp, uint64_t icmp);
std::string get_printable_protocol_name(unsigned int protocol);
void print_attack_details_to_file(std::string details, std::string client_ip_as_string, attack_details current_attack);
bool folder_exists(std::string path);
std::string print_time_t_in_fastnetmon_format(time_t current_time);
std::string print_ban_thresholds();
bool load_configuration_file();
std::string print_flow_tracking_for_ip(conntrack_main_struct& conntrack_element, std::string client_ip);
void convert_integer_to_conntrack_hash_struct(packed_session* packed_connection_data, packed_conntrack_hash* unpacked_data);
uint64_t convert_conntrack_hash_struct_to_integer(packed_conntrack_hash* struct_value);
int timeval_subtract (struct timeval * result, struct timeval * x, struct timeval * y);
bool is_cidr_subnet(const char* subnet);
uint64_t MurmurHash64A (const void * key, int len, uint64_t seed);
void cleanup_ban_list();
std::string print_tcp_flags(uint8_t flag_value);
int extract_bit_value(uint8_t num, int bit);
std::string get_attack_description(uint32_t client_ip, attack_details& current_attack);
uint64_t convert_speed_to_mbps(uint64_t speed_in_bps);
void send_attack_details(uint32_t client_ip, attack_details current_attack_details);
std::string convert_timeval_to_date(struct timeval tv);
void free_up_all_resources();
unsigned int get_cidr_mask_from_network_as_string(std::string network_cidr_format);
std::string print_ddos_attack_details();
void execute_ip_ban(uint32_t client_ip, map_element new_speed_element, uint64_t in_pps, uint64_t out_pps, uint64_t in_bps, uint64_t out_bps, uint64_t in_flows, uint64_t out_flows, std::string flow_attack_details);
direction get_packet_direction(uint32_t src_ip, uint32_t dst_ip, unsigned long& subnet);
void recalculate_speed();
std::string print_channel_speed(std::string traffic_type, direction packet_direction);
void process_packet(simple_packet& current_packet);
void copy_networks_from_string_form_to_binary(std::vector<std::string> networks_list_as_string, std::vector<subnet>& our_networks);
bool file_exists(std::string path);
void traffic_draw_programm();
void ulog_main_loop();
void signal_handler(int signal_number);
uint32_t convert_cidr_to_binary_netmask(unsigned int cidr);
/* Class for custom comparison fields by different fields */
class TrafficComparatorClass {
private:
sort_type sort_field;
direction sort_direction;
public:
TrafficComparatorClass(direction sort_direction, sort_type sort_field) {
this->sort_field = sort_field;
this->sort_direction = sort_direction;
}
bool operator()(pair_of_map_elements a, pair_of_map_elements b) {
if (sort_field == FLOWS) {
if (sort_direction == INCOMING) {
return a.second.in_flows > b.second.in_flows;
} else if (sort_direction == OUTGOING) {
return a.second.out_flows > b.second.out_flows;
} else {
return false;
}
} else if (sort_field == PACKETS) {
if (sort_direction == INCOMING) {
return a.second.in_packets > b.second.in_packets;
} else if (sort_direction == OUTGOING) {
return a.second.out_packets > b.second.out_packets;
} else {
return false;
}
} else if (sort_field == BYTES) {
if (sort_direction == INCOMING) {
return a.second.in_bytes > b.second.in_bytes;
} else if (sort_direction == OUTGOING) {
return a.second.out_bytes > b.second.out_bytes;
} else {
return false;
}
} else {
return false;
}
}
};
std::string get_direction_name(direction direction_value) {
std::string direction_name;
switch (direction_value) {
case INCOMING: direction_name = "incoming"; break;
case OUTGOING: direction_name = "outgoing"; break;
case INTERNAL: direction_name = "internal"; break;
case OTHER: direction_name = "other"; break;
default: direction_name = "unknown"; break;
}
return direction_name;
}
uint32_t convert_ip_as_string_to_uint(std::string ip) {
struct in_addr ip_addr;
inet_aton(ip.c_str(), &ip_addr);
// in network byte order
return ip_addr.s_addr;
}
std::string convert_ip_as_uint_to_string(uint32_t ip_as_integer) {
struct in_addr ip_addr;
ip_addr.s_addr = ip_as_integer;
return (std::string)inet_ntoa(ip_addr);
}
// convert integer to string
std::string convert_int_to_string(int value) {
std::stringstream out;
out << value;
return out.str();
}
// convert string to integer
int convert_string_to_integer(std::string line) {
return atoi(line.c_str());
}
// exec command in shell
std::vector<std::string> exec(std::string cmd) {
std::vector<std::string> output_list;
FILE* pipe = popen(cmd.c_str(), "r");
if (!pipe) return output_list;
char buffer[256];
std::string result = "";
while(!feof(pipe)) {
if(fgets(buffer, 256, pipe) != NULL) {
size_t newbuflen = strlen(buffer);
// remove newline at the end
if (buffer[newbuflen - 1] == '\n') {
buffer[newbuflen - 1] = '\0';
}
output_list.push_back(buffer);
}
}
pclose(pipe);
return output_list;
}
// exec command and pass data to it stdin
bool exec_with_stdin_params(std::string cmd, std::string params) {
FILE* pipe = popen(cmd.c_str(), "w");
if (!pipe) {
logger<<log4cpp::Priority::ERROR<<"Can't execute programm "<<cmd<<" error code: "<<errno<<" error text: "<<strerror(errno);
return false;
}
if (fputs(params.c_str(), pipe)) {
fclose(pipe);
return true;
} else {
logger<<log4cpp::Priority::ERROR<<"Can't pass data to stdin of programm "<<cmd;
fclose(pipe);
return false;
}
}
#ifdef GEOIP
bool geoip_init() {
// load GeoIP ASN database to memory
geo_ip = GeoIP_open("/root/fastnetmon/GeoIPASNum.dat", GEOIP_MEMORY_CACHE);
if (geo_ip == NULL) {
return false;
} else {
return true;
}
}
#endif
#ifdef REDIS
bool redis_init_connection() {
struct timeval timeout = { 1, 500000 }; // 1.5 seconds
redis_context = redisConnectWithTimeout(redis_host.c_str(), redis_port, timeout);
if (redis_context->err) {
logger<<log4cpp::Priority::INFO<<"Connection error:"<<redis_context->errstr;
return false;
}
// We should check connection with ping because redis do not check connection
redisReply* reply = (redisReply*)redisCommand(redis_context, "PING");
if (reply) {
freeReplyObject(reply);
} else {
return false;
}
return true;
}
void update_traffic_in_redis(uint32_t ip, unsigned int traffic_bytes, direction my_direction) {
std::string ip_as_string = convert_ip_as_uint_to_string(ip);
redisReply *reply;
if (!redis_context) {
logger<< log4cpp::Priority::INFO<<"Please initialize Redis handle";
return;
}
std::string key_name = ip_as_string + "_" + get_direction_name(my_direction);
reply = (redisReply *)redisCommand(redis_context, "INCRBY %s %s", key_name.c_str(), convert_int_to_string(traffic_bytes).c_str());
// If we store data correctly ...
if (!reply) {
logger.error("Can't increment traffic in redis error_code: %d error_string: %s", redis_context->err, redis_context->errstr);
// Handle redis server restart corectly
if (redis_context->err == 1 or redis_context->err == 3) {
// Connection refused
redis_init_connection();
}
} else {
freeReplyObject(reply);
}
}
#endif
std::string draw_table(map_for_counters& my_map_packets, direction data_direction, bool do_redis_update, sort_type sort_item) {
std::vector<pair_of_map_elements> vector_for_sort;
std::stringstream output_buffer;
// Preallocate memory for sort vector
vector_for_sort.reserve(my_map_packets.size());
for( map_for_counters::iterator ii = my_map_packets.begin(); ii != my_map_packets.end(); ++ii) {
// store all elements into vector for sorting
vector_for_sort.push_back( std::make_pair((*ii).first, (*ii).second) );
}
if (data_direction == INCOMING or data_direction == OUTGOING) {
std::sort( vector_for_sort.begin(), vector_for_sort.end(), TrafficComparatorClass(data_direction, sort_item));
} else {
logger<< log4cpp::Priority::INFO<<"Unexpected bahaviour on sort function";
}
unsigned int element_number = 0;
for( std::vector<pair_of_map_elements>::iterator ii=vector_for_sort.begin(); ii!=vector_for_sort.end(); ++ii) {
uint32_t client_ip = (*ii).first;
std::string client_ip_as_string = convert_ip_as_uint_to_string((*ii).first);
uint64_t pps = 0;
uint64_t bps = 0;
uint64_t flows = 0;
uint64_t pps_average = 0;
uint64_t bps_average = 0;
uint64_t flows_average = 0;
// TODO: replace map by vector iteration
map_element* current_average_speed_element = &SpeedCounterAverage[client_ip];
map_element* current_speed_element = &SpeedCounter[client_ip];
// Create polymorphic pps, byte and flow counters
if (data_direction == INCOMING) {
pps = current_speed_element->in_packets;
bps = current_speed_element->in_bytes;
flows = current_speed_element->in_flows;
pps_average = current_average_speed_element->in_packets;
bps_average = current_average_speed_element->in_bytes;
flows_average = current_average_speed_element->in_flows;
} else if (data_direction == OUTGOING) {
pps = current_speed_element->out_packets;
bps = current_speed_element->out_bytes;
flows = current_speed_element->out_flows;
pps_average = current_average_speed_element->out_packets;
bps_average = current_average_speed_element->out_bytes;
flows_average = current_average_speed_element->out_flows;
}
uint64_t mbps = convert_speed_to_mbps(bps);
uint64_t mbps_average = convert_speed_to_mbps(bps_average);
// Print first max_ips_in_list elements in list, we will show top 20 "huge" channel loaders
if (element_number < max_ips_in_list) {
std::string is_banned = ban_list.count(client_ip) > 0 ? " *banned* " : "";
// We use setw for alignment
output_buffer<<client_ip_as_string << "\t\t";
if (print_average_traffic_counts) {
output_buffer<<std::setw(6)<<pps_average << " pps ";
output_buffer<<std::setw(6)<<mbps_average << " mbps ";
output_buffer<<std::setw(6)<<flows_average << " flows ";
} else {
output_buffer<<std::setw(6)<< pps <<" pps ";
output_buffer<<std::setw(6)<< mbps <<" mbps ";
output_buffer<<std::setw(6)<< flows <<" flows ";
}
output_buffer<< is_banned << std::endl;
}
#ifdef REDIS
if (redis_enabled && do_redis_update) {
update_traffic_in_redis( (*ii).first, (*ii).second.in_packets, INCOMING);
update_traffic_in_redis( (*ii).first, (*ii).second.out_packets, OUTGOING);
}
#endif
element_number++;
}
return output_buffer.str();
}
// check file existence
bool file_exists(std::string path) {
FILE* check_file = fopen(path.c_str(), "r");
if (check_file) {
fclose(check_file);
return true;
} else {
return false;
}
}
// read whole file to vector
std::vector<std::string> read_file_to_vector(std::string file_name) {
std::vector<std::string> data;
std::string line;
std::ifstream reading_file;
reading_file.open(file_name.c_str(), std::ifstream::in);
if (reading_file.is_open()) {
while ( getline(reading_file, line) ) {
data.push_back(line);
}
} else {
logger<< log4cpp::Priority::ERROR <<"Can't open file: "<<file_name;
}
return data;
}
// Load configuration
bool load_configuration_file() {
std::ifstream config_file (global_config_path.c_str());
std::string line;
if (!config_file.is_open()) {
logger<< log4cpp::Priority::ERROR<<"Can't open config file";
return false;
}
while ( getline(config_file, line) ) {
std::vector<std::string> parsed_config;
boost::split( parsed_config, line, boost::is_any_of(" ="), boost::token_compress_on );
if (parsed_config.size() == 2) {
configuration_map[ parsed_config[0] ] = parsed_config[1];
} else {
logger<< log4cpp::Priority::ERROR<<"Can't parse config line: "<<line;
}
}
if (configuration_map.count("enable_connection_tracking")) {
if (configuration_map["enable_connection_tracking"] == "on") {
enable_conection_tracking = true;
} else {
enable_conection_tracking = false;
}
}
if (configuration_map.count("ban_time") != 0) {
standard_ban_time = convert_string_to_integer(configuration_map["ban_time"]);
}
if (configuration_map.count("average_calculation_time") != 0) {
average_calculation_amount = convert_string_to_integer(configuration_map["average_calculation_time"]);
}
if (configuration_map.count("threshold_pps") != 0) {
ban_threshold_pps = convert_string_to_integer( configuration_map[ "threshold_pps" ] );
}
if (configuration_map.count("threshold_mbps") != 0) {
ban_threshold_mbps = convert_string_to_integer( configuration_map[ "threshold_mbps" ] );
}
if (configuration_map.count("threshold_flows") != 0) {
ban_threshold_flows = convert_string_to_integer( configuration_map[ "threshold_flows" ] );
}
if (configuration_map.count("enable_ban") != 0) {
if (configuration_map["enable_ban"] == "on") {
we_do_real_ban = true;
} else {
we_do_real_ban = false;
}
}
if (configuration_map.count("sflow") != 0) {
if (configuration_map[ "sflow" ] == "on") {
enable_sflow_collection = true;
} else {
enable_sflow_collection = false;
}
}
if (configuration_map.count("netflow") != 0) {
if (configuration_map[ "netflow" ] == "on") {
enable_netflow_collection = true;
} else {
enable_netflow_collection = false;
}
}
if (configuration_map.count("process_incoming_traffic") != 0) {
process_incoming_traffic = configuration_map[ "process_incoming_traffic" ] == "on" ? true : false;
}
if (configuration_map.count("process_outgoing_traffic") != 0) {
process_outgoing_traffic = configuration_map[ "process_outgoing_traffic" ] == "on" ? true : false;
}
if (configuration_map.count("mirror") != 0) {
if (configuration_map["mirror"] == "on") {
enable_data_collection_from_mirror = true;
} else {
enable_data_collection_from_mirror = false;
}
}
if (configuration_map.count("pcap") != 0) {
if (configuration_map["pcap"] == "on") {
enable_pcap_collection = true;
} else {
enable_pcap_collection = false;
}
}
if (configuration_map.count("ban_for_pps") != 0) {
if (configuration_map["ban_for_pps"] == "on") {
enable_ban_for_pps = true;
} else {
enable_ban_for_pps = false;
}
}
if (configuration_map.count("ban_for_bandwidth") != 0) {
if (configuration_map["ban_for_bandwidth"] == "on") {
enable_ban_for_bandwidth = true;
} else {
enable_ban_for_bandwidth = false;
}
}
if (configuration_map.count("ban_for_flows") != 0) {
if (configuration_map["ban_for_flows"] == "on") {
enable_ban_for_flows_per_second = true;
} else {
enable_ban_for_flows_per_second = false;
}
}
#ifdef REDIS
if (configuration_map.count("redis_port") != 0) {
redis_port = convert_string_to_integer(configuration_map[ "redis_port" ] );
}
if (configuration_map.count("redis_host") != 0) {
redis_host = configuration_map[ "redis_host" ];
}
if (configuration_map.count("redis_enabled") != 0) {
if (configuration_map[ "redis_enabled" ] == "yes") {
redis_enabled = true;
} else {
redis_enabled = false;
}
}
#endif
if (configuration_map.count("ban_details_records_count") != 0 ) {
ban_details_records_count = convert_string_to_integer( configuration_map[ "ban_details_records_count" ]);
}
if (configuration_map.count("check_period") != 0) {
check_period = convert_string_to_integer( configuration_map[ "check_period" ]);
}
if (configuration_map.count("sort_parameter") != 0) {
sort_parameter = configuration_map[ "sort_parameter" ];
}
if (configuration_map.count("max_ips_in_list") != 0) {
max_ips_in_list = convert_string_to_integer( configuration_map[ "max_ips_in_list" ]);
}
if (configuration_map.count("notify_script_path") != 0 ) {
notify_script_path = configuration_map[ "notify_script_path" ];
}
return true;
}
/* Enable core dumps for simplify debug tasks */
void enable_core_dumps() {
struct rlimit rlim;
int result = getrlimit(RLIMIT_CORE, &rlim);
if (result) {
logger<< log4cpp::Priority::ERROR<<"Can't get current rlimit for RLIMIT_CORE";
return;
} else {
rlim.rlim_cur = rlim.rlim_max;
setrlimit(RLIMIT_CORE, &rlim);
}
}
void subnet_vectors_allocator(prefix_t* prefix, void* data) {
// Network byte order
uint32_t subnet_as_integer = prefix->add.sin.s_addr;
u_short bitlen = prefix->bitlen;
double base = 2;
int network_size_in_ips = pow(base, 32-bitlen);
//logger<< log4cpp::Priority::INFO<<"Subnet: "<<prefix->add.sin.s_addr<<" network size: "<<network_size_in_ips;
logger<< log4cpp::Priority::INFO<<"I will allocate "<<network_size_in_ips<<" records for subnet "<<subnet_as_integer<<" cidr mask: "<<bitlen;
// Initialize map element
SubnetVectorMap[subnet_as_integer] = vector_of_counters(network_size_in_ips);
// Zeroify all vector elements
map_element zero_map_element;
memset(&zero_map_element, 0, sizeof(zero_map_element));
std::fill(SubnetVectorMap[subnet_as_integer].begin(), SubnetVectorMap[subnet_as_integer].end(), zero_map_element);
// Initilize map element
SubnetVectorMapFlow[subnet_as_integer] = vector_of_flow_counters(network_size_in_ips);
// On creating it initilizes by zeros
conntrack_main_struct zero_conntrack_main_struct;
std::fill(SubnetVectorMapFlow[subnet_as_integer].begin(), SubnetVectorMapFlow[subnet_as_integer].end(), zero_conntrack_main_struct);
}
void zeroify_all_counters() {
map_element zero_map_element;
memset(&zero_map_element, 0, sizeof(zero_map_element));
for (map_of_vector_counters::iterator itr = SubnetVectorMap.begin(); itr != SubnetVectorMap.end(); itr++) {
//logger<< log4cpp::Priority::INFO<<"Zeroify "<<itr->first;
std::fill(itr->second.begin(), itr->second.end(), zero_map_element);
}
}
void zeroify_all_flow_counters() {
// On creating it initilizes by zeros
conntrack_main_struct zero_conntrack_main_struct;
// Iterate over map
for (map_of_vector_counters_for_flow::iterator itr = SubnetVectorMapFlow.begin(); itr != SubnetVectorMapFlow.end(); itr++) {
// Iterate over vector
for (vector_of_flow_counters::iterator vector_iterator = itr->second.begin(); vector_iterator != itr->second.end(); vector_iterator++) {
// TODO: rewrite this monkey code
vector_iterator->in_tcp.clear();
vector_iterator->in_udp.clear();
vector_iterator->in_icmp.clear();
vector_iterator->in_other.clear();
vector_iterator->out_tcp.clear();
vector_iterator->out_udp.clear();
vector_iterator->out_icmp.clear();
vector_iterator->out_other.clear();
}
}
}
bool load_our_networks_list() {
if (file_exists("/etc/networks_whitelist")) {
std::vector<std::string> network_list_from_config = read_file_to_vector("/etc/networks_whitelist");
for( std::vector<std::string>::iterator ii=network_list_from_config.begin(); ii!=network_list_from_config.end(); ++ii) {
if (ii->length() > 0 && is_cidr_subnet(ii->c_str())) {
make_and_lookup(whitelist_tree, const_cast<char*>(ii->c_str()));
} else {
logger<<log4cpp::Priority::ERROR<<"Can't parse line from whitelist: "<<*ii;
}
}
logger<<log4cpp::Priority::INFO<<"We loaded "<<network_list_from_config.size()<< " networks from whitelist file";
}
std::vector<std::string> networks_list_as_string;
// We can bould "our subnets" automatically here
if (file_exists("/proc/vz/version")) {
logger<< log4cpp::Priority::INFO<<"We found OpenVZ";
// Add /32 CIDR mask for every IP here
std::vector<std::string> openvz_ips = read_file_to_vector("/proc/vz/veip");
for( std::vector<std::string>::iterator ii=openvz_ips.begin(); ii!=openvz_ips.end(); ++ii) {
// skip IPv6 addresses
if (strstr(ii->c_str(), ":") != NULL) {
continue;
}
// skip header
if (strstr(ii->c_str(), "Version") != NULL) {
continue;
}
std::vector<std::string> subnet_as_string;
split( subnet_as_string, *ii, boost::is_any_of(" "), boost::token_compress_on );
std::string openvz_subnet = subnet_as_string[1] + "/32";
networks_list_as_string.push_back(openvz_subnet);
}
logger<<log4cpp::Priority::INFO<<"We loaded "<<networks_list_as_string.size()<< " networks from /proc/vz/version";
}
if (file_exists("/etc/networks_list")) {
std::vector<std::string> network_list_from_config = read_file_to_vector("/etc/networks_list");
networks_list_as_string.insert(networks_list_as_string.end(), network_list_from_config.begin(), network_list_from_config.end());
logger<<log4cpp::Priority::INFO<<"We loaded "<<network_list_from_config.size()<< " networks from networks file";
}
// Some consistency checks
assert( convert_ip_as_string_to_uint("255.255.255.0") == convert_cidr_to_binary_netmask(24) );
assert( convert_ip_as_string_to_uint("255.255.255.255") == convert_cidr_to_binary_netmask(32) );
for( std::vector<std::string>::iterator ii=networks_list_as_string.begin(); ii!=networks_list_as_string.end(); ++ii) {
if (ii->length() > 0 && is_cidr_subnet(ii->c_str())) {
unsigned int cidr_mask = get_cidr_mask_from_network_as_string(*ii);
double base = 2;
total_number_of_hosts_in_our_networks += pow(base, 32-cidr_mask);
make_and_lookup(lookup_tree, const_cast<char*>(ii->c_str()));
} else {
logger<<log4cpp::Priority::ERROR<<"Can't parse line from subnet list: "<<*ii;
}
}
/* Preallocate data structures */
patricia_process (lookup_tree, (void_fn_t)subnet_vectors_allocator);
logger<<log4cpp::Priority::INFO<<"We start total zerofication of counters";
zeroify_all_counters();
logger<<log4cpp::Priority::INFO<<"We finished it";
logger<<log4cpp::Priority::INFO<<"We loaded "<<networks_list_as_string.size()<<" subnets to our in-memory list of networks";
logger<<log4cpp::Priority::INFO<<"Total number of monitored hosts (total size of all networks): "
<<total_number_of_hosts_in_our_networks;
return true;
}
// extract 24 from 192.168.1.1/24
unsigned int get_cidr_mask_from_network_as_string(std::string network_cidr_format) {
std::vector<std::string> subnet_as_string;
split( subnet_as_string, network_cidr_format, boost::is_any_of("/"), boost::token_compress_on );
if (subnet_as_string.size() != 2) {
return 0;
}
return convert_string_to_integer(subnet_as_string[1]);
}
void copy_networks_from_string_form_to_binary(std::vector<std::string> networks_list_as_string, std::vector<subnet>& our_networks ) {
for( std::vector<std::string>::iterator ii=networks_list_as_string.begin(); ii!=networks_list_as_string.end(); ++ii) {
std::vector<std::string> subnet_as_string;
split( subnet_as_string, *ii, boost::is_any_of("/"), boost::token_compress_on );
unsigned int cidr = convert_string_to_integer(subnet_as_string[1]);
uint32_t subnet_as_int = convert_ip_as_string_to_uint(subnet_as_string[0]);
uint32_t netmask_as_int = convert_cidr_to_binary_netmask(cidr);
subnet current_subnet = std::make_pair(subnet_as_int, netmask_as_int);
our_networks.push_back(current_subnet);
}
}
uint32_t convert_cidr_to_binary_netmask(unsigned int cidr) {
uint32_t binary_netmask = 0xFFFFFFFF;
binary_netmask = binary_netmask << ( 32 - cidr );
// htonl from host byte order to network
// ntohl from network byte order to host
// We need network byte order at output
return htonl(binary_netmask);
}
std::string get_printable_protocol_name(unsigned int protocol) {
std::string proto_name;
switch (protocol) {
case IPPROTO_TCP:
proto_name = "tcp";
break;
case IPPROTO_UDP:
proto_name = "udp";
break;
case IPPROTO_ICMP:
proto_name = "icmp";
break;
default:
proto_name = "unknown";
break;
}
return proto_name;
}
std::string print_simple_packet(simple_packet packet) {
std::stringstream buffer;
buffer<<convert_timeval_to_date(packet.ts)<<" ";
buffer
<<convert_ip_as_uint_to_string(packet.src_ip)<<":"<<packet.source_port
<<" > "
<<convert_ip_as_uint_to_string(packet.dst_ip)<<":"<<packet.destination_port
<<" protocol: "<<get_printable_protocol_name(packet.protocol);
// Print flags only for TCP
if (packet.protocol == IPPROTO_TCP) {
buffer<<" flags: "<<print_tcp_flags(packet.flags);
}
buffer<<" ";
buffer<<"packets: " <<packet.number_of_packets <<" ";
buffer<<"size: " <<packet.length <<" bytes ";
buffer<<"sample ratio: "<<packet.sample_ratio <<" ";
buffer<<" \n";
return buffer.str();
}
/* Process simple unified packet */
void process_packet(simple_packet& current_packet) {
// Packets dump is very useful for bug hunting
if (DEBUG_DUMP_ALL_PACKETS) {
logger<< log4cpp::Priority::INFO<<"Dump: "<<print_simple_packet(current_packet);
}
// Subnet for found IPs
unsigned long subnet = 0;
direction packet_direction = get_packet_direction(current_packet.src_ip, current_packet.dst_ip, subnet);
// Skip processing of specific traffic direction
if ( (packet_direction == INCOMING && !process_incoming_traffic) or (packet_direction == OUTGOING && !process_outgoing_traffic) ) {
return;
}
uint32_t subnet_in_host_byte_order = 0;
// We operate in host bytes order and need to convert subnet
if (subnet != 0) {
subnet_in_host_byte_order = ntohl(subnet);
}
// Try to find map key for this subnet
map_of_vector_counters::iterator itr;
if (packet_direction == OUTGOING or packet_direction == INCOMING) {
itr = SubnetVectorMap.find(subnet);
if (itr == SubnetVectorMap.end()) {
logger<< log4cpp::Priority::ERROR<<"Can't find vector address in subnet map";
return;
}
}
map_of_vector_counters_for_flow::iterator itr_flow;
if (enable_conection_tracking) {
if (packet_direction == OUTGOING or packet_direction == INCOMING) {
itr_flow = SubnetVectorMapFlow.find(subnet);
if (itr_flow == SubnetVectorMapFlow.end()) {
logger<< log4cpp::Priority::ERROR<<"Can't find vector address in subnet flow map";
return;
}
}
}
/* Because we support mirroring, sflow and netflow we should support different cases:
- One packet passed for processing (mirror)
- Multiple packets ("flows") passed for processing (netflow)
- One sampled packed passed for processing (netflow)
- Another combinations of this three options
*/
uint32_t sampled_number_of_packets = current_packet.number_of_packets * current_packet.sample_ratio;
uint32_t sampled_number_of_bytes = current_packet.length * current_packet.sample_ratio;
__sync_fetch_and_add(&total_counters[packet_direction].packets, sampled_number_of_packets);
__sync_fetch_and_add(&total_counters[packet_direction].bytes, sampled_number_of_bytes);
// Incerementi main and per protocol packet counters
if (packet_direction == OUTGOING) {
uint32_t shift_in_vector = ntohl(current_packet.src_ip) - subnet_in_host_byte_order;
if (shift_in_vector >= itr->second.size()) {
logger<< log4cpp::Priority::ERROR<<"We tried to access to element with index "<<shift_in_vector
<<" which located outside allocated vector with size "<<itr->second.size();
logger<< log4cpp::Priority::INFO<<"We expect issues with this packet in OUTGOING direction: "<<print_simple_packet(current_packet);
return;
}
map_element* current_element = &itr->second[shift_in_vector];
// Main packet/bytes counter
__sync_fetch_and_add(&current_element->out_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->out_bytes, sampled_number_of_bytes);
conntrack_main_struct* current_element_flow = NULL;
if (enable_conection_tracking) {
current_element_flow = &itr_flow->second[shift_in_vector];
}
// Collect data when ban client
if (ban_list_details.size() > 0 && ban_list_details.count(current_packet.src_ip) > 0 &&
ban_list_details[current_packet.src_ip].size() < ban_details_records_count) {
ban_list_details_mutex.lock();
ban_list_details[current_packet.src_ip].push_back(current_packet);
ban_list_details_mutex.unlock();
}
uint64_t connection_tracking_hash = 0;
if (enable_conection_tracking) {
packed_conntrack_hash flow_tracking_structure;
flow_tracking_structure.opposite_ip = current_packet.dst_ip;
flow_tracking_structure.src_port = current_packet.source_port;
flow_tracking_structure.dst_port = current_packet.destination_port;
// convert this struct to 64 bit integer
connection_tracking_hash = convert_conntrack_hash_struct_to_integer(&flow_tracking_structure);
}
if (current_packet.protocol == IPPROTO_TCP) {
__sync_fetch_and_add(&current_element->tcp_out_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->tcp_out_bytes, sampled_number_of_bytes);
if (enable_conection_tracking) {
flow_counter.lock();
conntrack_key_struct* conntrack_key_struct_ptr = &current_element_flow->out_tcp[connection_tracking_hash];
conntrack_key_struct_ptr->packets += sampled_number_of_packets;
conntrack_key_struct_ptr->bytes += sampled_number_of_bytes;
flow_counter.unlock();
}
} else if (current_packet.protocol == IPPROTO_UDP) {
__sync_fetch_and_add(&current_element->udp_out_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->udp_out_bytes, sampled_number_of_bytes);
if (enable_conection_tracking) {
flow_counter.lock();
conntrack_key_struct* conntrack_key_struct_ptr = &current_element_flow->out_udp[connection_tracking_hash];
conntrack_key_struct_ptr->packets += sampled_number_of_packets;
conntrack_key_struct_ptr->bytes += sampled_number_of_bytes;
flow_counter.unlock();
}
} else if (current_packet.protocol == IPPROTO_ICMP) {
__sync_fetch_and_add(&current_element->icmp_out_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->icmp_out_bytes, sampled_number_of_bytes);
// no flow tracking for icmp
} else {
}
} else if (packet_direction == INCOMING) {
uint32_t shift_in_vector = ntohl(current_packet.dst_ip) - subnet_in_host_byte_order;
if (shift_in_vector >= itr->second.size()) {
logger<< log4cpp::Priority::ERROR<<"We tried to access to element with index "<<shift_in_vector
<<" which located outside allocated vector with size "<<itr->second.size();
logger<< log4cpp::Priority::INFO<<"We expect issues with this packet in INCOMING direction: "<<print_simple_packet(current_packet);
return;
}
map_element* current_element = &itr->second[shift_in_vector];
// Main packet/bytes counter
__sync_fetch_and_add(&current_element->in_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->in_bytes, sampled_number_of_bytes);
conntrack_main_struct* current_element_flow = NULL;
if (enable_conection_tracking) {
current_element_flow = &itr_flow->second[shift_in_vector];
}
uint64_t connection_tracking_hash = 0;
if (enable_conection_tracking) {
packed_conntrack_hash flow_tracking_structure;
flow_tracking_structure.opposite_ip = current_packet.src_ip;
flow_tracking_structure.src_port = current_packet.source_port;
flow_tracking_structure.dst_port = current_packet.destination_port;
// convert this struct to 64 bit integer
connection_tracking_hash = convert_conntrack_hash_struct_to_integer(&flow_tracking_structure);
}
// Collect attack details
if (ban_list_details.size() > 0 && ban_list_details.count(current_packet.dst_ip) > 0 &&
ban_list_details[current_packet.dst_ip].size() < ban_details_records_count) {
ban_list_details_mutex.lock();
ban_list_details[current_packet.dst_ip].push_back(current_packet);
ban_list_details_mutex.unlock();
}
if (current_packet.protocol == IPPROTO_TCP) {
__sync_fetch_and_add(&current_element->tcp_in_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->tcp_in_bytes, sampled_number_of_bytes);
if (enable_conection_tracking) {
flow_counter.lock();
conntrack_key_struct* conntrack_key_struct_ptr = &current_element_flow->in_tcp[connection_tracking_hash];
conntrack_key_struct_ptr->packets += sampled_number_of_packets;
conntrack_key_struct_ptr->bytes += sampled_number_of_bytes;
flow_counter.unlock();
}
} else if (current_packet.protocol == IPPROTO_UDP) {
__sync_fetch_and_add(&current_element->udp_in_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->udp_in_bytes, sampled_number_of_bytes);
if (enable_conection_tracking) {
flow_counter.lock();
conntrack_key_struct* conntrack_key_struct_ptr = &current_element_flow->in_udp[connection_tracking_hash];
conntrack_key_struct_ptr->packets += sampled_number_of_packets;
conntrack_key_struct_ptr->bytes += sampled_number_of_bytes;
flow_counter.unlock();
}
} else if (current_packet.protocol == IPPROTO_ICMP) {
__sync_fetch_and_add(&current_element->icmp_in_packets, sampled_number_of_packets);
__sync_fetch_and_add(&current_element->icmp_in_bytes, sampled_number_of_bytes);
// no flow tarcking for icmp
} else {
// TBD
}
} else if (packet_direction == INTERNAL) {
}
}
#ifdef GEOIP
unsigned int get_asn_for_ip(uint32_t ip) {
char* asn_raw = GeoIP_org_by_name(geo_ip, convert_ip_as_uint_to_string(remote_ip).c_str());
uint32_t asn_number = 0;
if (asn_raw == NULL) {
asn_number = 0;
} else {
// split string: AS1299 TeliaSonera International Carrier
std::vector<std::string> asn_as_string;
split( asn_as_string, asn_raw, boost::is_any_of(" "), boost::token_compress_on );
// free up original string
free(asn_raw);
// extract raw number
asn_number = convert_string_to_integer(asn_as_string[0].substr(2));
}
return asn_number;
}
#endif
// void* void* data
// It's not an calculation thread, it's vizualization thread :)
void calculation_thread() {
// we need wait one second for calculating speed by recalculate_speed
//#include <sys/prctl.h>
//prctl(PR_SET_NAME , "fastnetmon calc thread", 0, 0, 0);
// Sleep for a half second for shift against calculatiuon thread
boost::this_thread::sleep(boost::posix_time::milliseconds(500));
while (1) {
// Availible only from boost 1.54: boost::this_thread::sleep_for( boost::chrono::seconds(check_period) );
boost::this_thread::sleep(boost::posix_time::seconds(check_period));
traffic_draw_programm();
}
}
void recalculate_speed_thread_handler() {
while (1) {
// recalculate data every one second
// Availible only from boost 1.54: boost::this_thread::sleep_for( boost::chrono::seconds(1) );
boost::this_thread::sleep(boost::posix_time::seconds(1));
recalculate_speed();
}
}
/* Calculate speed for all connnections */
void recalculate_speed() {
//logger<< log4cpp::Priority::INFO<<"We run recalculate_speed";
struct timeval start_calc_time;
gettimeofday(&start_calc_time, NULL);
double speed_calc_period = 1;
time_t start_time;
time(&start_time);
// If we got 1+ seconds lag we should use new "delta" or skip this step
double time_difference = difftime(start_time, last_call_of_traffic_recalculation);
if (time_difference < 1) {
// It could occur on programm start
logger<< log4cpp::Priority::INFO<<"We skip one iteration of speed_calc because it runs so early!";
return;
} else if (int(time_difference) == 1) {
// All fine, we run on time
} else {
logger<< log4cpp::Priority::INFO<<"Time from last run of speed_recalc is soooo big, we got ugly lags: "<<time_difference;
speed_calc_period = time_difference;
}
map_element zero_map_element;
memset(&zero_map_element, 0, sizeof(zero_map_element));
uint64_t incoming_total_flows = 0;
uint64_t outgoing_total_flows = 0;
for (map_of_vector_counters::iterator itr = SubnetVectorMap.begin(); itr != SubnetVectorMap.end(); ++itr) {
for (vector_of_counters::iterator vector_itr = itr->second.begin(); vector_itr != itr->second.end(); ++vector_itr) {
int current_index = vector_itr - itr->second.begin();
// New element
map_element new_speed_element;
// convert to host order for math operations
uint32_t subnet_ip = ntohl(itr->first);
uint32_t client_ip_in_host_bytes_order = subnet_ip + current_index;
// covnert to our standard network byte order
uint32_t client_ip = htonl(client_ip_in_host_bytes_order);
new_speed_element.in_packets = uint64_t((double)vector_itr->in_packets / speed_calc_period);
new_speed_element.out_packets = uint64_t((double)vector_itr->out_packets / speed_calc_period);
new_speed_element.in_bytes = uint64_t((double)vector_itr->in_bytes / speed_calc_period);
new_speed_element.out_bytes = uint64_t((double)vector_itr->out_bytes / speed_calc_period);
// By protocol counters
// TCP
new_speed_element.tcp_in_packets = uint64_t((double)vector_itr->tcp_in_packets / speed_calc_period);
new_speed_element.tcp_out_packets = uint64_t((double)vector_itr->tcp_out_packets / speed_calc_period);
new_speed_element.tcp_in_bytes = uint64_t((double)vector_itr->tcp_in_bytes / speed_calc_period);
new_speed_element.tcp_out_bytes = uint64_t((double)vector_itr->tcp_out_bytes / speed_calc_period);
// UDP
new_speed_element.udp_in_packets = uint64_t((double)vector_itr->udp_in_packets / speed_calc_period);
new_speed_element.udp_out_packets = uint64_t((double)vector_itr->udp_out_packets / speed_calc_period);
new_speed_element.udp_in_bytes = uint64_t((double)vector_itr->udp_in_bytes / speed_calc_period);
new_speed_element.udp_out_bytes = uint64_t((double)vector_itr->udp_out_bytes / speed_calc_period);
// ICMP
new_speed_element.icmp_in_packets = uint64_t((double)vector_itr->icmp_in_packets / speed_calc_period);
new_speed_element.icmp_out_packets = uint64_t((double)vector_itr->icmp_out_packets / speed_calc_period);
new_speed_element.icmp_in_bytes = uint64_t((double)vector_itr->icmp_in_bytes / speed_calc_period);
new_speed_element.icmp_out_bytes = uint64_t((double)vector_itr->icmp_out_bytes / speed_calc_period);
conntrack_main_struct* flow_counter_ptr = &SubnetVectorMapFlow[itr->first][current_index];
// todo: optimize this operations!
uint64_t total_out_flows =
(uint64_t)flow_counter_ptr->out_tcp.size() +
(uint64_t)flow_counter_ptr->out_udp.size() +
(uint64_t)flow_counter_ptr->out_icmp.size() +
(uint64_t)flow_counter_ptr->out_other.size();
uint64_t total_in_flows =
(uint64_t)flow_counter_ptr->in_tcp.size() +
(uint64_t)flow_counter_ptr->in_udp.size() +
(uint64_t)flow_counter_ptr->in_icmp.size() +
(uint64_t)flow_counter_ptr->in_other.size();
new_speed_element.out_flows = uint64_t((double)total_out_flows / speed_calc_period);
new_speed_element.in_flows = uint64_t((double)total_in_flows / speed_calc_period);
// Increment global counter
incoming_total_flows += new_speed_element.in_flows;
outgoing_total_flows += new_speed_element.out_flows;
/* Moving average recalculation */
// http://en.wikipedia.org/wiki/Moving_average#Application_to_measuring_computer_performance
//double speed_calc_period = 1;
double exp_power = -speed_calc_period/average_calculation_amount;
double exp_value = exp(exp_power);
map_element* current_average_speed_element = &SpeedCounterAverage[client_ip];
current_average_speed_element->in_bytes = uint64_t(new_speed_element.in_bytes + exp_value *
((double)current_average_speed_element->in_bytes - (double)new_speed_element.in_bytes));
current_average_speed_element->out_bytes = uint64_t(new_speed_element.out_bytes + exp_value *
((double)current_average_speed_element->out_bytes - (double)new_speed_element.out_bytes));
current_average_speed_element->in_packets = uint64_t(new_speed_element.in_packets + exp_value *
((double)current_average_speed_element->in_packets - (double)new_speed_element.in_packets));
current_average_speed_element->out_packets = uint64_t(new_speed_element.out_packets + exp_value *
((double)current_average_speed_element->out_packets - (double)new_speed_element.out_packets));
current_average_speed_element->out_flows = uint64_t(new_speed_element.out_flows + exp_value *
((double)current_average_speed_element->out_flows - (double)new_speed_element.out_flows));
current_average_speed_element->in_flows = uint64_t(new_speed_element.in_flows + exp_value *
((double)current_average_speed_element->in_flows - (double)new_speed_element.in_flows));
uint64_t in_pps_average = current_average_speed_element->in_packets;
uint64_t out_pps_average = current_average_speed_element->out_packets;
uint64_t in_bps_average = current_average_speed_element->in_bytes;
uint64_t out_bps_average = current_average_speed_element->out_bytes;
uint64_t in_flows_average = current_average_speed_element->in_flows;
uint64_t out_flows_average = current_average_speed_element->out_flows;
/* Moving average recalculation end */
// we detect overspeed by packets
bool attack_detected_by_pps = false;
bool attack_detected_by_bandwidth = false;
bool attack_detected_by_flow = false;
if (enable_ban_for_pps && (in_pps_average > ban_threshold_pps or out_pps_average > ban_threshold_pps)) {
attack_detected_by_pps = true;
}
// we detect overspeed by bandwidth
if (enable_ban_for_bandwidth && (convert_speed_to_mbps(in_bps_average) > ban_threshold_mbps or convert_speed_to_mbps(out_bps_average) > ban_threshold_mbps)) {
attack_detected_by_bandwidth = true;
}
if (enable_ban_for_flows_per_second && (in_flows_average > ban_threshold_flows or out_flows_average > ban_threshold_flows)) {
attack_detected_by_flow = true;
}
if (attack_detected_by_pps or attack_detected_by_bandwidth or attack_detected_by_flow) {
std::string flow_attack_details = "";
if (enable_conection_tracking) {
flow_attack_details = print_flow_tracking_for_ip(*flow_counter_ptr, convert_ip_as_uint_to_string(client_ip));
}
// TODO: we should pass type of ddos ban source (pps, flowd, bandwidth)!
execute_ip_ban(client_ip, new_speed_element, in_pps_average, out_pps_average, in_bps_average, out_bps_average, in_flows_average, out_flows_average, flow_attack_details);
}
speed_counters_mutex.lock();
//map_element* current_speed_element = &SpeedCounter[client_ip];
//*current_speed_element = new_speed_element;
SpeedCounter[client_ip] = new_speed_element;
speed_counters_mutex.unlock();
data_counters_mutex.lock();
*vector_itr = zero_map_element;
data_counters_mutex.unlock();
}
}
// Calculate global flow speed
incoming_total_flows_speed = uint64_t((double)incoming_total_flows / (double)speed_calc_period);
outgoing_total_flows_speed = uint64_t((double)outgoing_total_flows / (double)speed_calc_period);
if (enable_conection_tracking) {
// Clean Flow Counter
flow_counter.lock();
zeroify_all_flow_counters();
flow_counter.unlock();
}
for (unsigned int index = 0; index < 4; index++) {
total_speed_counters[index].bytes = uint64_t((double)total_counters[index].bytes / (double)speed_calc_period);
total_speed_counters[index].packets = uint64_t((double)total_counters[index].packets / (double)speed_calc_period);
// nullify data counters after speed calculation
//total_counters_mutex.lock();
total_counters[index].bytes = 0;
total_counters[index].packets = 0;
//total_counters_mutex.unlock();
}
// Set time of previous startup
time(&last_call_of_traffic_recalculation);
struct timeval finish_calc_time;
gettimeofday(&finish_calc_time, NULL);
timeval_subtract(&speed_calculation_time, &finish_calc_time, &start_calc_time);
}
void print_screen_contents_into_file(std::string screen_data_stats_param) {
std::ofstream screen_data_file;
screen_data_file.open("/tmp/fastnetmon.dat", std::ios::trunc);
if (screen_data_file.is_open()) {
screen_data_file<<screen_data_stats_param;
screen_data_file.close();
} else {
logger<<log4cpp::Priority::ERROR<<"Can't print programm screen into file";
}
}
void traffic_draw_programm() {
std::stringstream output_buffer;
//logger<<log4cpp::Priority::INFO<<"Draw table call";
struct timeval start_calc_time;
gettimeofday(&start_calc_time, NULL);
sort_type sorter;
if (sort_parameter == "packets") {
sorter = PACKETS;
} else if (sort_parameter == "bytes") {
sorter = BYTES;
} else if (sort_parameter == "flows") {
sorter = FLOWS;
} else {
logger<< log4cpp::Priority::INFO<<"Unexpected sorter type: "<<sort_parameter;
sorter = PACKETS;
}
output_buffer<<"FastNetMon v1.0 FastVPS Eesti OU (c) VPS and dedicated: http://FastVPS.host"<<"\n"
<<"IPs ordered by: "<<sort_parameter<<"\n";
output_buffer<<print_channel_speed("Incoming traffic", INCOMING)<<std::endl;
output_buffer<<draw_table(SpeedCounter, INCOMING, true, sorter);
output_buffer<<std::endl;
output_buffer<<print_channel_speed("Outgoing traffic", OUTGOING)<<std::endl;
output_buffer<<draw_table(SpeedCounter, OUTGOING, false, sorter);
output_buffer<<std::endl;
output_buffer<<print_channel_speed("Internal traffic", INTERNAL)<<std::endl;
output_buffer<<std::endl;
output_buffer<<print_channel_speed("Other traffic", OTHER)<<std::endl;
output_buffer<<std::endl;
if (enable_pcap_collection) {
output_buffer<<get_pcap_stats()<<"\n";
}
// Application statistics
output_buffer<<"Screen updated in:\t\t"<< drawing_thread_execution_time.tv_sec<<" sec "<<drawing_thread_execution_time.tv_usec<<" microseconds\n";
output_buffer<<"Traffic calculated in:\t\t"<< speed_calculation_time.tv_sec<<" sec "<<speed_calculation_time.tv_usec<<" microseconds\n";
output_buffer<<"Total amount of not processed packets: "<<total_unparsed_packets<<"\n";
#ifdef PF_RING
if (enable_data_collection_from_mirror) {
output_buffer<<get_pf_ring_stats();
}
#endif
// Print thresholds
output_buffer<<"\n\n"<<print_ban_thresholds();
if (!ban_list.empty()) {
output_buffer<<std::endl<<"Ban list:"<<std::endl;
output_buffer<<print_ddos_attack_details();
}
screen_data_stats = output_buffer.str();
// Print screen contents into file
print_screen_contents_into_file(screen_data_stats);
struct timeval end_calc_time;
gettimeofday(&end_calc_time, NULL);
timeval_subtract(&drawing_thread_execution_time, &end_calc_time, &start_calc_time);
}
// pretty print channel speed in pps and MBit
std::string print_channel_speed(std::string traffic_type, direction packet_direction) {
uint64_t speed_in_pps = total_speed_counters[packet_direction].packets;
uint64_t speed_in_bps = total_speed_counters[packet_direction].bytes;
unsigned int number_of_tabs = 1;
// We need this for correct alignment of blocks
if (traffic_type == "Other traffic") {
number_of_tabs = 2;
}
std::stringstream stream;
stream<<traffic_type;
for (unsigned int i = 0; i < number_of_tabs; i ++ ) {
stream<<"\t";
}
uint64_t speed_in_mbps = convert_speed_to_mbps(speed_in_bps);
stream<<std::setw(6)<<speed_in_pps<<" pps "<<std::setw(6)<<speed_in_mbps<<" mbps";
if (traffic_type == "Incoming traffic" or traffic_type == "Outgoing traffic") {
if (packet_direction == INCOMING) {
stream<<" "<<std::setw(6)<<incoming_total_flows_speed<<" flows";
} else if (packet_direction == OUTGOING) {
stream<<" "<<std::setw(6)<<outgoing_total_flows_speed<<" flows";
}
}
return stream.str();
}
uint64_t convert_speed_to_mbps(uint64_t speed_in_bps) {
return uint64_t((double)speed_in_bps / 1024 / 1024 * 8);
}
void init_logging() {
log4cpp::PatternLayout* layout = new log4cpp::PatternLayout();
layout->setConversionPattern ("%d [%p] %m%n");
log4cpp::Appender *appender = new log4cpp::FileAppender("default", log_file_path);
appender->setLayout(layout);
logger.setPriority(log4cpp::Priority::INFO);
logger.addAppender(appender);
logger.info("Logger initialized!");
}
bool folder_exists(std::string path) {
if (access(path.c_str(), 0) == 0) {
struct stat status;
stat(path.c_str(), &status);
if (status.st_mode & S_IFDIR) {
return true;
}
}
return false;
}
int main(int argc,char **argv) {
lookup_tree = New_Patricia(32);
whitelist_tree = New_Patricia(32);
// nullify total counters
for (int index = 0; index < 4; index++) {
total_counters[index].bytes = 0;
total_counters[index].packets = 0;
total_speed_counters[index].bytes = 0;
total_speed_counters[index].packets = 0;
}
// enable core dumps
enable_core_dumps();
init_logging();
/* Create folder for attack details */
if (!folder_exists(attack_details_folder)) {
int mkdir_result = mkdir(attack_details_folder.c_str(), S_IRWXU);
if (mkdir_result != 0) {
logger<<log4cpp::Priority::ERROR<<"Can't create folder for attack details: "<<attack_details_folder;
exit(1);
}
}
if (getenv("DUMP_ALL_PACKETS") != NULL) {
DEBUG_DUMP_ALL_PACKETS = true;
}
if (sizeof(packed_conntrack_hash) != sizeof(uint64_t) or sizeof(packed_conntrack_hash) != 8) {
logger<< log4cpp::Priority::INFO<<"Assertion about size of packed_conntrack_hash, it's "<<sizeof(packed_conntrack_hash)<<" instead 8";
exit(1);
}
logger<<log4cpp::Priority::INFO<<"Read configuration file";
bool load_config_result = load_configuration_file();
if (!load_config_result) {
fprintf(stderr, "Can't open config file %s, please create it!\n", global_config_path.c_str());
exit(1);
}
logger<< log4cpp::Priority::INFO<<"I need few seconds for collecting data, please wait. Thank you!";
load_our_networks_list();
// Setup CTRL+C handler
signal(SIGINT, signal_handler);
#ifdef REDIS
// Init redis connection
if (redis_enabled) {
if (!redis_init_connection()) {
logger<< log4cpp::Priority::ERROR<<"Can't establish connection to the redis";
exit(1);
}
}
#endif
#ifdef GEOIP
// Init GeoIP
if(!geoip_init()) {
logger<< log4cpp::Priority::ERROR<<"Can't load geoip tables";
exit(1);
}
#endif
// Init previous run date
time(&last_call_of_traffic_recalculation);
// Run screen draw thread
boost::thread calc_thread(calculation_thread);
// start thread for recalculating speed in realtime
boost::thread recalculate_speed_thread(recalculate_speed_thread_handler);
// Run banlist cleaner thread
boost::thread cleanup_ban_list_thread(cleanup_ban_list);
#ifdef PF_RING
// pf_ring processing
boost::thread pfring_process_collector_thread;
if (enable_data_collection_from_mirror) {
pfring_process_collector_thread = boost::thread(start_pfring_collection, process_packet);
}
#endif
boost::thread sflow_process_collector_thread;
if (enable_sflow_collection) {
sflow_process_collector_thread = boost::thread(start_sflow_collection, process_packet);
}
boost::thread netflow_process_collector_thread;
if (enable_netflow_collection) {
netflow_process_collector_thread = boost::thread(start_netflow_collection, process_packet);
}
boost::thread pcap_process_collector_thread;
if (enable_pcap_collection) {
pcap_process_collector_thread = boost::thread(start_pcap_collection, process_packet);
}
if (enable_sflow_collection) {
sflow_process_collector_thread.join();
}
if (enable_data_collection_from_mirror) {
#ifdef PF_RING
pfring_process_collector_thread.join();
#endif
}
recalculate_speed_thread.join();
calc_thread.join();
free_up_all_resources();
return 0;
}
void free_up_all_resources() {
#ifdef GEOIP
// Free up geoip handle
GeoIP_delete(geo_ip);
#endif
Destroy_Patricia(lookup_tree, (void_fn_t)0);
Destroy_Patricia(whitelist_tree, (void_fn_t)0);
}
// For correct programm shutdown by CTRL+C
void signal_handler(int signal_number) {
if (enable_pcap_collection) {
stop_pcap_collection();
}
#ifdef PF_RING
stop_pfring_collection();
#endif
#ifdef REDIS
if (redis_enabled) {
redisFree(redis_context);
}
#endif
exit(1);
}
/* Get traffic type: check it belongs to our IPs */
direction get_packet_direction(uint32_t src_ip, uint32_t dst_ip, unsigned long& subnet) {
direction packet_direction;
bool our_ip_is_destination = false;
bool our_ip_is_source = false;
prefix_t prefix_for_check_adreess;
prefix_for_check_adreess.family = AF_INET;
prefix_for_check_adreess.bitlen = 32;
patricia_node_t* found_patrica_node = NULL;
prefix_for_check_adreess.add.sin.s_addr = dst_ip;
unsigned long destination_subnet = 0;
found_patrica_node = patricia_search_best2(lookup_tree, &prefix_for_check_adreess, 1);
if (found_patrica_node) {
our_ip_is_destination = true;
destination_subnet = found_patrica_node->prefix->add.sin.s_addr;
}
found_patrica_node = NULL;
prefix_for_check_adreess.add.sin.s_addr = src_ip;
unsigned long source_subnet = 0;
found_patrica_node = patricia_search_best2(lookup_tree, &prefix_for_check_adreess, 1);
if (found_patrica_node) {
our_ip_is_source = true;
source_subnet = found_patrica_node->prefix->add.sin.s_addr;
}
subnet = 0;
if (our_ip_is_source && our_ip_is_destination) {
packet_direction = INTERNAL;
} else if (our_ip_is_source) {
subnet = source_subnet;
packet_direction = OUTGOING;
} else if (our_ip_is_destination) {
subnet = destination_subnet;
packet_direction = INCOMING;
} else {
packet_direction = OTHER;
}
return packet_direction;
}
unsigned int detect_attack_protocol(map_element& speed_element, direction attack_direction) {
if (attack_direction == INCOMING) {
return get_max_used_protocol(speed_element.tcp_in_packets, speed_element.udp_in_packets, speed_element.icmp_in_packets);
} else {
// OUTGOING
return get_max_used_protocol(speed_element.tcp_out_packets, speed_element.udp_out_packets, speed_element.icmp_out_packets);
}
}
#define my_max_on_defines(a, b) (a > b ? a : b)
unsigned int get_max_used_protocol(uint64_t tcp, uint64_t udp, uint64_t icmp) {
unsigned int max = my_max_on_defines(my_max_on_defines(udp, tcp), icmp);
if (max == tcp) {
return IPPROTO_TCP;
} else if (max == udp) {
return IPPROTO_UDP;
} else if (max == icmp) {
return IPPROTO_ICMP;
}
return 0;
}
void execute_ip_ban(uint32_t client_ip, map_element speed_element, uint64_t in_pps, uint64_t out_pps, uint64_t in_bps, uint64_t out_bps, uint64_t in_flows, uint64_t out_flows, std::string flow_attack_details) {
struct attack_details current_attack;
uint64_t pps = 0;
direction data_direction;
if (!we_do_real_ban) {
logger<<log4cpp::Priority::INFO<<"We do not ban: "<<convert_ip_as_uint_to_string(client_ip)<<" because ban disabled completely";
return;
}
// Detect attack direction with simple heuristic
if (abs(int((int)in_pps - (int)out_pps)) < 1000) {
// If difference between pps speed is so small we should do additional investigation using bandwidth speed
if (in_bps > out_bps) {
data_direction = INCOMING;
pps = in_pps;
} else {
data_direction = OUTGOING;
pps = out_pps;
}
} else {
if (in_pps > out_pps) {
data_direction = INCOMING;
pps = in_pps;
} else {
data_direction = OUTGOING;
pps = out_pps;
}
}
current_attack.attack_protocol = detect_attack_protocol(speed_element, data_direction);
if (ban_list.count(client_ip) > 0) {
if ( ban_list[client_ip].attack_direction != data_direction ) {
logger<<log4cpp::Priority::INFO<<"We expected very strange situation: attack direction for "
<<convert_ip_as_uint_to_string(client_ip)<<" was changed";
return;
}
// update attack power
if (pps > ban_list[client_ip].max_attack_power) {
ban_list[client_ip].max_attack_power = pps;
}
return;
}
prefix_t prefix_for_check_adreess;
prefix_for_check_adreess.add.sin.s_addr = client_ip;
prefix_for_check_adreess.family = AF_INET;
prefix_for_check_adreess.bitlen = 32;
bool in_white_list = (patricia_search_best2(whitelist_tree, &prefix_for_check_adreess, 1) != NULL);
if (in_white_list) {
return;
}
std::string data_direction_as_string = get_direction_name(data_direction);
logger.info("We run execute_ip_ban code with following params in_pps: %d out_pps: %d in_bps: %d out_bps: %d and we decide it's %s attack",
in_pps, out_pps, in_bps, out_bps, data_direction_as_string.c_str());
std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);
std::string pps_as_string = convert_int_to_string(pps);
// Store ban time
time(&current_attack.ban_timestamp);
// set ban time in seconds
current_attack.ban_time = standard_ban_time;
// Pass main information about attack
current_attack.attack_direction = data_direction;
current_attack.attack_power = pps;
current_attack.max_attack_power = pps;
current_attack.in_packets = in_pps;
current_attack.out_packets = out_pps;
current_attack.in_bytes = in_bps;
current_attack.out_bytes = out_bps;
// pass flow information
current_attack.in_flows = in_flows;
current_attack.out_flows = out_flows;
current_attack.tcp_in_packets = speed_element.tcp_in_packets;
current_attack.udp_in_packets = speed_element.udp_in_packets;
current_attack.icmp_in_packets = speed_element.icmp_in_packets;
current_attack.tcp_out_packets = speed_element.tcp_out_packets;
current_attack.udp_out_packets = speed_element.udp_out_packets;
current_attack.icmp_out_packets = speed_element.icmp_out_packets;
current_attack.tcp_out_bytes = speed_element.tcp_out_bytes;
current_attack.udp_out_bytes = speed_element.udp_out_bytes;
current_attack.icmp_out_bytes = speed_element.icmp_out_bytes;
current_attack.tcp_in_bytes = speed_element.tcp_in_bytes;
current_attack.udp_in_bytes = speed_element.udp_in_bytes;
current_attack.icmp_in_bytes = speed_element.icmp_in_bytes;
// Add average counters
map_element* current_average_speed_element = &SpeedCounterAverage[client_ip];
current_attack.average_in_packets = current_average_speed_element->in_packets;
current_attack.average_in_bytes = current_average_speed_element->in_bytes;
current_attack.average_in_flows = current_average_speed_element->in_flows;
current_attack.average_out_packets = current_average_speed_element->out_packets;
current_attack.average_out_bytes = current_average_speed_element->out_bytes;
current_attack.average_out_flows = current_average_speed_element->out_flows;
ban_list_mutex.lock();
ban_list[client_ip] = current_attack;
ban_list_mutex.unlock();
ban_list_details_mutex.lock();
ban_list_details[client_ip] = std::vector<simple_packet>();
ban_list_details_mutex.unlock();
logger<<log4cpp::Priority::INFO<<"Attack with direction: " << data_direction_as_string
<< " IP: " << client_ip_as_string << " Power: "<<pps_as_string;
#ifdef HWFILTER_LOCKING
logger<<log4cpp::Priority::INFO<<"We will block traffic to/from this IP with hardware filters";
block_all_traffic_with_82599_hardware_filtering(client_ip_as_string);
#endif
std::string full_attack_description = get_attack_description(client_ip, current_attack) + flow_attack_details;
print_attack_details_to_file(full_attack_description, client_ip_as_string, current_attack);
if (file_exists(notify_script_path)) {
std::string script_call_params = notify_script_path + " " + client_ip_as_string + " " + data_direction_as_string + " " + pps_as_string + " attack_details";
logger<<log4cpp::Priority::INFO<<"Call script for ban client: "<<client_ip_as_string;
// We should execute external script in separate thread because any lag in this code will be very distructive
boost::thread exec_thread(exec_with_stdin_params, script_call_params, full_attack_description);
exec_thread.detach();
logger<<log4cpp::Priority::INFO<<"Script for ban client is finished: "<<client_ip_as_string;
}
}
#ifdef HWFILTER_LOCKING
void block_all_traffic_with_82599_hardware_filtering(std::string client_ip_as_string) {
/* 6 - tcp, 17 - udp, 0 - other (non tcp and non udp) */
std::vector<int> banned_protocols;
banned_protocols.push_back(17);
banned_protocols.push_back(6);
banned_protocols.push_back(0);
int rule_number = 10;
// Iterate over incoming and outgoing direction
for (int rule_direction = 0; rule_direction < 2; rule_direction++) {
for (std::vector<int>::iterator banned_protocol = banned_protocols.begin() ;
banned_protocol != banned_protocols.end(); ++banned_protocol) {
/* On 82599 NIC we can ban traffic using hardware filtering rules */
// Difference between fie tuple and perfect filters:
// http://www.ntop.org/products/pf_ring/hardware-packet-filtering/
hw_filtering_rule rule;
intel_82599_five_tuple_filter_hw_rule *ft_rule;
ft_rule = &rule.rule_family.five_tuple_rule;
memset(&rule, 0, sizeof(rule));
rule.rule_family_type = intel_82599_five_tuple_rule;
rule.rule_id = rule_number++;
ft_rule->queue_id = -1; // drop traffic
ft_rule->proto = *banned_protocol;
std::string hw_filter_rule_direction = "";
if (rule_direction == 0) {
hw_filter_rule_direction = "outgoing";
ft_rule->s_addr = ntohl(inet_addr(client_ip_as_string.c_str()));
} else {
hw_filter_rule_direction = "incoming";
ft_rule->d_addr = ntohl(inet_addr(client_ip_as_string.c_str()));
}
if (pfring_add_hw_rule(pf_ring_descr, &rule) != 0) {
logger<<log4cpp::Priority::ERROR<<"Can't add hardware filtering rule for protocol: "<<*banned_protocol<<" in direction: "<<hw_filter_rule_direction;
}
rule_number ++;
}
}
}
#endif
/* Thread for cleaning up ban list */
void cleanup_ban_list() {
// Every X seconds we will run ban list cleaner thread
int iteration_sleep_time = 600;
logger<<log4cpp::Priority::INFO<<"Run banlist cleanup thread";
while (true) {
// Sleep for ten minutes
boost::this_thread::sleep(boost::posix_time::seconds(iteration_sleep_time));
time_t current_time;
time(&current_time);
std::map<uint32_t,banlist_item>::iterator itr = ban_list.begin();
while (itr != ban_list.end()) {
uint32_t client_ip = (*itr).first;
double time_difference = difftime(current_time, ((*itr).second).ban_timestamp);
int ban_time = ((*itr).second).ban_time;
if (time_difference > ban_time) {
// Cleanup all data related with this attack
std::string data_direction_as_string = get_direction_name((*itr).second.attack_direction);
std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);
std::string pps_as_string = convert_int_to_string((*itr).second.attack_power);
logger<<log4cpp::Priority::INFO<<"We will unban banned IP: "<<client_ip_as_string<<
" because it ban time "<<ban_time<<" seconds is ended";
ban_list_mutex.lock();
std::map<uint32_t,banlist_item>::iterator itr_to_erase = itr;
itr++;
ban_list.erase(itr_to_erase);
ban_list_mutex.unlock();
if (file_exists(notify_script_path)) {
std::string script_call_params = notify_script_path + " " + client_ip_as_string + " " +
data_direction_as_string + " " + pps_as_string + " unban";
logger<<log4cpp::Priority::INFO<<"Call script for unban client: "<<client_ip_as_string;
// We should execute external script in separate thread because any lag in this code will be very distructive
boost::thread exec_thread(exec, script_call_params);
exec_thread.detach();
logger<<log4cpp::Priority::INFO<<"Script for unban client is finished: "<<client_ip_as_string;
}
} else {
itr++;
}
}
}
}
std::string print_time_t_in_fastnetmon_format(time_t current_time) {
struct tm* timeinfo;
char buffer[80];
timeinfo = localtime (&current_time);
strftime (buffer, sizeof(buffer), "%d_%m_%y_%H:%M:%S", timeinfo);
return std::string(buffer);
}
std::string print_ddos_attack_details() {
std::stringstream output_buffer;
for( std::map<uint32_t,banlist_item>::iterator ii=ban_list.begin(); ii!=ban_list.end(); ++ii) {
uint32_t client_ip = (*ii).first;
std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);
std::string pps_as_string = convert_int_to_string(((*ii).second).attack_power);
std::string max_pps_as_string = convert_int_to_string(((*ii).second).max_attack_power);
std::string attack_direction = get_direction_name(((*ii).second).attack_direction);
output_buffer<<client_ip_as_string<<"/"<<max_pps_as_string<<" pps "<<attack_direction<<" at "<<print_time_t_in_fastnetmon_format(ii->second.ban_timestamp)<<std::endl;
send_attack_details(client_ip, (*ii).second);
}
return output_buffer.str();
}
std::string get_attack_description(uint32_t client_ip, attack_details& current_attack) {
std::stringstream attack_description;
attack_description
<<"IP: "<<convert_ip_as_uint_to_string(client_ip)<<"\n"
<<"Initial attack power: " <<current_attack.attack_power<<" packets per second\n"
<<"Peak attack power: " <<current_attack.max_attack_power<< " packets per second\n"
<<"Attack direction: " <<get_direction_name(current_attack.attack_direction)<<"\n"
<<"Attack protocol: " <<get_printable_protocol_name(current_attack.attack_protocol)<<"\n"
<<"Total incoming traffic: " <<convert_speed_to_mbps(current_attack.in_bytes)<<" mbps\n"
<<"Total outgoing traffic: " <<convert_speed_to_mbps(current_attack.out_bytes)<<" mbps\n"
<<"Total incoming pps: " <<current_attack.in_packets<<" packets per second\n"
<<"Total outgoing pps: " <<current_attack.out_packets<<" packets per second\n"
<<"Total incoming flows: " <<current_attack.in_flows<<" flows per second\n"
<<"Total outgoing flows: " <<current_attack.out_flows<<" flows per second\n";
// Add average counters
attack_description
<<"Average incoming traffic: " << convert_speed_to_mbps(current_attack.average_in_bytes) <<" mbps\n"
<<"Average outgoing traffic: " << convert_speed_to_mbps(current_attack.average_out_bytes) <<" mbps\n"
<<"Average incoming pps: " << current_attack.average_in_packets <<" packets per second\n"
<<"Average outgoing pps: " << current_attack.average_out_packets <<" packets per second\n"
<<"Average incoming flows: " << current_attack.average_in_flows <<" flows per second\n"
<<"Average outgoing flows: " << current_attack.average_out_flows <<" flows per second\n";
attack_description
<<"Incoming tcp traffic: " <<convert_speed_to_mbps(current_attack.tcp_in_bytes)<<" mbps\n"
<<"Outgoing tcp traffic: " <<convert_speed_to_mbps(current_attack.tcp_out_bytes)<<" mbps\n"
<<"Incoming tcp pps: " <<current_attack.tcp_in_packets<<" packets per second\n"
<<"Outgoing tcp pps: " <<current_attack.tcp_out_packets<<" packets per second\n"
<<"Incoming udp traffic: " <<convert_speed_to_mbps(current_attack.udp_in_bytes)<<" mbps\n"
<<"Outgoing udp traffic: " <<convert_speed_to_mbps(current_attack.udp_out_bytes)<<" mbps\n"
<<"Incoming udp pps: " <<current_attack.udp_in_packets<<" packets per second\n"
<<"Outgoing udp pps: " <<current_attack.udp_out_packets<<" packets per second\n"
<<"Incoming icmp traffic: " <<convert_speed_to_mbps(current_attack.icmp_in_bytes)<<" mbps\n"
<<"Outgoing icmp traffic: " <<convert_speed_to_mbps(current_attack.icmp_out_bytes)<<" mbps\n"
<<"Incoming icmp pps: " <<current_attack.icmp_in_packets<<" packets per second\n"
<<"Outgoing icmp pps: " <<current_attack.icmp_out_packets<<" packets per second\n";
return attack_description.str();
}
std::string get_protocol_name_by_number(unsigned int proto_number) {
struct protoent* proto_ent = getprotobynumber( proto_number );
std::string proto_name = proto_ent->p_name;
return proto_name;
}
void send_attack_details(uint32_t client_ip, attack_details current_attack_details) {
std::string pps_as_string = convert_int_to_string(current_attack_details.attack_power);
std::string attack_direction = get_direction_name(current_attack_details.attack_direction);
std::string client_ip_as_string = convert_ip_as_uint_to_string(client_ip);
// Very strange code but it work in 95% cases
if (ban_list_details.count( client_ip ) > 0 && ban_list_details[ client_ip ].size() == ban_details_records_count) {
std::stringstream attack_details;
attack_details<<get_attack_description(client_ip, current_attack_details)<<"\n\n";
std::map<unsigned int, unsigned int> protocol_counter;
for( std::vector<simple_packet>::iterator iii=ban_list_details[ client_ip ].begin(); iii!=ban_list_details[ client_ip ].end(); ++iii) {
attack_details<<print_simple_packet( *iii );
protocol_counter[ iii->protocol ]++;
}
std::map<unsigned int, unsigned int>::iterator max_proto = std::max_element(protocol_counter.begin(), protocol_counter.end(), protocol_counter.value_comp());
attack_details<<"\n"<<"We got more packets ("
<<max_proto->second
<<" from "
<< ban_details_records_count
<<") for protocol: "<< get_protocol_name_by_number(max_proto->first)<<"\n";
logger<<log4cpp::Priority::INFO<<"Attack with direction: "<<attack_direction<<
" IP: "<<client_ip_as_string<<" Power: "<<pps_as_string<<" traffic sample collected";
print_attack_details_to_file(attack_details.str(), client_ip_as_string, current_attack_details);
// Pass attack details to script
if (file_exists(notify_script_path)) {
logger<<log4cpp::Priority::INFO<<"Call script for notify about attack details for: "<<client_ip_as_string;
std::string script_params = notify_script_path + " " + client_ip_as_string + " " + attack_direction + " " + pps_as_string + " ban";
// We should execute external script in separate thread because any lag in this code will be very distructive
boost::thread exec_with_params_thread(exec_with_stdin_params, script_params, attack_details.str());
exec_with_params_thread.detach();
logger<<log4cpp::Priority::INFO<<"Script for notify about attack details is finished: "<<client_ip_as_string;
}
// Remove key and prevent collection new data about this attack
ban_list_details.erase(client_ip);
}
}
std::string convert_timeval_to_date(struct timeval tv) {
time_t nowtime = tv.tv_sec;
struct tm *nowtm = localtime(&nowtime);
char tmbuf[64];
char buf[64];
strftime(tmbuf, sizeof(tmbuf), "%Y-%m-%d %H:%M:%S", nowtm);
snprintf(buf, sizeof(buf), "%s.%06ld", tmbuf, tv.tv_usec);
return std::string(buf);
}
// http://stackoverflow.com/questions/14528233/bit-masking-in-c-how-to-get-first-bit-of-a-byte
int extract_bit_value(uint8_t num, int bit) {
if (bit > 0 && bit <= 8) {
return ( (num >> (bit-1)) & 1 );
} else {
return 0;
}
}
std::string print_tcp_flags(uint8_t flag_value) {
if (flag_value == 0) {
return "-";
}
// cod from pfring.h
// (tcp->fin * TH_FIN_MULTIPLIER) + (tcp->syn * TH_SYN_MULTIPLIER) +
// (tcp->rst * TH_RST_MULTIPLIER) + (tcp->psh * TH_PUSH_MULTIPLIER) +
// (tcp->ack * TH_ACK_MULTIPLIER) + (tcp->urg * TH_URG_MULTIPLIER);
/*
// Required for decoding tcp flags
#define TH_FIN_MULTIPLIER 0x01
#define TH_SYN_MULTIPLIER 0x02
#define TH_RST_MULTIPLIER 0x04
#define TH_PUSH_MULTIPLIER 0x08
#define TH_ACK_MULTIPLIER 0x10
#define TH_URG_MULTIPLIER 0x20
*/
std::vector<std::string> all_flags;
if (extract_bit_value(flag_value, 1)) {
all_flags.push_back("fin");
}
if (extract_bit_value(flag_value, 2)) {
all_flags.push_back("syn");
}
if (extract_bit_value(flag_value, 3)) {
all_flags.push_back("rst");
}
if (extract_bit_value(flag_value, 4)) {
all_flags.push_back("psh");
}
if (extract_bit_value(flag_value, 5)) {
all_flags.push_back("ack");
}
if (extract_bit_value(flag_value, 6)) {
all_flags.push_back("urg");
}
std::ostringstream flags_as_string;
if (all_flags.empty()) {
return "-";
}
// concatenate all vector elements with comma
std::copy(all_flags.begin(), all_flags.end() - 1, std::ostream_iterator<std::string>(flags_as_string, ","));
// add last element
flags_as_string << all_flags.back();
return flags_as_string.str();
}
#define BIG_CONSTANT(x) (x##LLU)
/*
// calculate hash
unsigned int seed = 11;
uint64_t hash = MurmurHash64A(&current_packet, sizeof(current_packet), seed);
*/
// https://code.google.com/p/smhasher/source/browse/trunk/MurmurHash2.cpp
// 64-bit hash for 64-bit platforms
uint64_t MurmurHash64A ( const void * key, int len, uint64_t seed ) {
const uint64_t m = BIG_CONSTANT(0xc6a4a7935bd1e995);
const int r = 47;
uint64_t h = seed ^ (len * m);
const uint64_t * data = (const uint64_t *)key;
const uint64_t * end = data + (len/8);
while(data != end) {
uint64_t k = *data++;
k *= m;
k ^= k >> r;
k *= m;
h ^= k;
h *= m;
}
const unsigned char * data2 = (const unsigned char*)data;
switch(len & 7) {
case 7: h ^= uint64_t(data2[6]) << 48;
case 6: h ^= uint64_t(data2[5]) << 40;
case 5: h ^= uint64_t(data2[4]) << 32;
case 4: h ^= uint64_t(data2[3]) << 24;
case 3: h ^= uint64_t(data2[2]) << 16;
case 2: h ^= uint64_t(data2[1]) << 8;
case 1: h ^= uint64_t(data2[0]);
h *= m;
};
h ^= h >> r;
h *= m;
h ^= h >> r;
return h;
}
bool is_cidr_subnet(const char* subnet) {
boost::cmatch what;
if (regex_match(subnet, what, regular_expression_cidr_pattern)) {
return true;
} else {
return false;
}
}
// http://www.gnu.org/software/libc/manual/html_node/Elapsed-Time.html
int timeval_subtract (struct timeval * result, struct timeval * x, struct timeval * y) {
/* Perform the carry for the later subtraction by updating y. */
if (x->tv_usec < y->tv_usec) {
int nsec = (y->tv_usec - x->tv_usec) / 1000000 + 1;
y->tv_usec -= 1000000 * nsec;
y->tv_sec += nsec;
}
if (x->tv_usec - y->tv_usec > 1000000) {
int nsec = (x->tv_usec - y->tv_usec) / 1000000;
y->tv_usec += 1000000 * nsec;
y->tv_sec -= nsec;
}
/* Compute the time remaining to wait. tv_usec is certainly positive. */
result->tv_sec = x->tv_sec - y->tv_sec;
result->tv_usec = x->tv_usec - y->tv_usec;
/* Return 1 if result is negative. */
return x->tv_sec < y->tv_sec;
}
uint64_t convert_conntrack_hash_struct_to_integer(packed_conntrack_hash* struct_value) {
uint64_t unpacked_data = 0;
memcpy(&unpacked_data, struct_value, sizeof(uint64_t));
return unpacked_data;
}
void convert_integer_to_conntrack_hash_struct(packed_session* packed_connection_data, packed_conntrack_hash* unpacked_data) {
memcpy(unpacked_data, packed_connection_data, sizeof(uint64_t));
}
std::string print_flow_tracking_for_specified_protocol(contrack_map_type& protocol_map, std::string client_ip, direction flow_direction) {
std::stringstream buffer;
// We shoud iterate over all fields
int printed_records = 0;
for (contrack_map_type::iterator itr = protocol_map.begin(); itr != protocol_map.end(); ++itr) {
// We should limit number of records in flow dump because syn flood attacks produce thounsands of lines
if (printed_records > ban_details_records_count) {
buffer<<"Flows are cropped due very long list\n";
break;
}
uint64_t packed_connection_data = itr->first;
packed_conntrack_hash unpacked_key_struct;
convert_integer_to_conntrack_hash_struct(&packed_connection_data, &unpacked_key_struct);
std::string opposite_ip_as_string = convert_ip_as_uint_to_string(unpacked_key_struct.opposite_ip);
if (flow_direction == INCOMING) {
buffer<<client_ip<<":"<<unpacked_key_struct.dst_port<<" < "<<opposite_ip_as_string<<":"<<unpacked_key_struct.src_port<<" ";
} else if (flow_direction == OUTGOING) {
buffer<<client_ip<<":"<<unpacked_key_struct.src_port<<" > "<<opposite_ip_as_string<<":"<<unpacked_key_struct.dst_port<<" ";
}
buffer<<itr->second.bytes<<" bytes "<<itr->second.packets<<" packets";
buffer<<"\n";
printed_records++;
}
return buffer.str();
}
/*
Attack types:
- syn flood: one local port, multiple remote hosts (and maybe multiple remote ports) and small packet size
*/
/* Iterate over all flow tracking table */
bool process_flow_tracking_table(conntrack_main_struct& conntrack_element, std::string client_ip) {
std::map <uint32_t, unsigned int> uniq_remote_hosts_which_generate_requests_to_us;
std::map <unsigned int, unsigned int> uniq_local_ports_which_target_of_connectiuons_from_inside;
/* Process incoming TCP connections */
for (contrack_map_type::iterator itr = conntrack_element.in_tcp.begin(); itr != conntrack_element.in_tcp.end(); ++itr) {
uint64_t packed_connection_data = itr->first;
packed_conntrack_hash unpacked_key_struct;
convert_integer_to_conntrack_hash_struct(&packed_connection_data, &unpacked_key_struct);
uniq_remote_hosts_which_generate_requests_to_us[unpacked_key_struct.opposite_ip]++;
uniq_local_ports_which_target_of_connectiuons_from_inside[unpacked_key_struct.dst_port]++;
// we can calc average packet size
// string opposite_ip_as_string = convert_ip_as_uint_to_string(unpacked_key_struct.opposite_ip);
// unpacked_key_struct.src_port
// unpacked_key_struct.dst_port
// itr->second.packets
// itr->second.bytes
}
return true;
}
std::string print_flow_tracking_for_ip(conntrack_main_struct& conntrack_element, std::string client_ip) {
std::stringstream buffer;
std::string in_tcp = print_flow_tracking_for_specified_protocol(conntrack_element.in_tcp, client_ip, INCOMING);
std::string in_udp = print_flow_tracking_for_specified_protocol(conntrack_element.in_udp, client_ip, INCOMING);
bool we_have_incoming_flows = in_tcp.length() > 0 or in_udp.length() > 0;
if (we_have_incoming_flows) {
buffer<<"Incoming\n\n";
if (in_tcp.length() > 0) {
buffer<<"TCP\n"<<in_tcp<<"\n";
}
if (in_udp.length() > 0) {
buffer<<"UDP\n"<<in_udp<<"\n";
}
}
std::string out_tcp = print_flow_tracking_for_specified_protocol(conntrack_element.out_tcp, client_ip, OUTGOING);
std::string out_udp = print_flow_tracking_for_specified_protocol(conntrack_element.out_udp, client_ip, OUTGOING);
bool we_have_outgoing_flows = out_tcp.length() > 0 or out_udp.length() > 0;
// print delimiter if we have flows in both directions
if (we_have_incoming_flows && we_have_outgoing_flows) {
buffer<<"\n";
}
if (we_have_outgoing_flows) {
buffer<<"Outgoing\n\n";
if (out_tcp.length() > 0 ) {
buffer<<"TCP\n"<<out_tcp<<"\n";
}
if (out_udp.length() > 0) {
buffer<<"UDP\n"<<out_udp<<"\n";
}
}
return buffer.str();
}
std::string print_ban_thresholds() {
std::stringstream output_buffer;
output_buffer<<"Configuration params:\n";
if (we_do_real_ban) {
output_buffer<<"We call ban script: yes\n";
} else {
output_buffer<<"We call ban script: no\n";
}
output_buffer<<"Packets per second: ";
if (enable_ban_for_pps) {
output_buffer<<ban_threshold_pps;
} else {
output_buffer<<"disabled";
}
output_buffer<<"\n";
output_buffer<<"Mbps per second: ";
if (enable_ban_for_bandwidth) {
output_buffer<<ban_threshold_mbps;
} else {
output_buffer<<"disabled";
}
output_buffer<<"\n";
output_buffer<<"Flows per second: ";
if (enable_ban_for_flows_per_second) {
output_buffer<<ban_threshold_flows;
} else {
output_buffer<<"disabled";
}
output_buffer<<"\n";
return output_buffer.str();
}
void print_attack_details_to_file(std::string details, std::string client_ip_as_string, attack_details current_attack) {
std::ofstream my_attack_details_file;
std::string ban_timestamp_as_string = print_time_t_in_fastnetmon_format(current_attack.ban_timestamp);
std::string attack_dump_path = attack_details_folder + "/" + client_ip_as_string + "_" + ban_timestamp_as_string;
my_attack_details_file.open(attack_dump_path.c_str(), std::ios::app);
if (my_attack_details_file.is_open()) {
my_attack_details_file << details << "\n\n";
my_attack_details_file.close();
} else {
logger<<log4cpp::Priority::ERROR<<"Can't print attack details to file";
}
}